обновление: 2020. 03. 18

А - Аг -Ад - Аи - Ал - Ам - Ар - Ат

А _ Заметки geo.web.ru/druza \ минералы + местонахождения + авторы \ Т - Ти -Тр -

Авторы, местонахождения и минералы - в одном списке \\ 1234567 891011121314151617181920212223242526272829303132 - 33

А - Аг- Аи - Ам - Ар - -Б - Бе - Бо - Бр - В - Г - Д - Де - Е - Ж - З - И - Й - К - Кв - Км - Кр -- Л - Ли -

М --М - Мал - Мг - Мм - Му - Н - Ни -О - П - Р - С - Ск - Ст - Т - Ти - Тр -У - Ф - Фо - Х - Ц - Ч - Ш Щ - Э - Ю - Я - - za - zaa

1. Адамин. Охуэла р-к, Мапими, Дуранго, Мексика. 2. Анапаит. Друза сферокристаллов. 2-ой Черноморский р-к, Керчь (р-н), Крым, Россия. Образец: ФМ (№90786. Сбор музея: Абрамов Д.В., 1986).3. Аксинит. Чегитунь, Россия. Минер. музей МГРИ - РГГРУ, №704. 12х7 см. 4. Аметрин (секториальное распределение окраски). Анаи, Санта-Крус \ Anahi, Santa Cruz, Боливия. Более 9 см. Образец: Образец: Мин. музей им. А.Е. Ферсмана РАН(ОП-2712. Белаковский Д.И., 2013). 5. 6

на карте мира: 123Россия - 4567 891011121314151617181920212223242526272829303132 - 33 -

Фото минералов и др. - смотрите страницы:

33_NW - СЕВ. АМЕРИКА (С) - Гренландия 33_N - АРКТИКА - АТЛАНТИКАИсландия - СКАНДИНАВИЯ. Кольский п-ов и Карелия - ВОСТ. ЕВРОПА - УРАЛ 33_NE - АЗИЯ (С): Ср.Сибирь - Якутия.- СВ РОССИИ - КАМЧАТКА.
33W - СЕВ. АМЕРИКА (США \ КАНАДА). Тихоокеанское побережье - Запад - Восток 33_C - Британские о-ва. Пиренейский п-ов - ЕВРОПА (центр и юг)

33_E - ЮГ СИБИРИ. ДАЛЬНИЙ ВОСТОК. Корейский п-ов - Япония

- АЗИЯ (ЮЗ) - АЗИЯ (ЦЕНТР. - Индия и Шри-Ланка.- Китай, Монголия и ЮВ АЗИЯ.

33SW -Мексика. ЦЕНТР. и Ю.АМЕРИКА(Анды) - БРАЗИЛИЯ. Уругвай. Парагвай

33_S -АФРИКА (С) - АФРИКА (ЭКВ. и ЮЖН.) - АФРИКА ВОСТ. - Индийский океан



А-авторы \\ А-автор_фото

А- Местонахождения минералов \\ http://geo.web.ru/druza/page-39.html

А - минералы

Минералогические находки по всему миру. Примеры (А) по Fleischer M., 2004, pp.12-13. Составил: А. Евсеев, 2019. \ m-min_33_sv_Flei_12_190412.jpg

Вокруг света. Минералы на "А" . Стрелками показаны (приблизительно!) районы находок образцов . Фотомонтаж: © А. Евсеев.\ m-min_33_A-fo2.jpg

A - Z - список минералов - http://rruff.info/ima/

Замечательные минералогические находки (А - минералы - примеры по листам карты мира №№1-32): 5 -авгит; 6- анапаит; 9-алабандин; 10 - аксинит; 13 - азурит; 14 - аквамарин; 16 - апофиллит; 17 - андалузит; 18 - англезит; 19 - азурит и аквамарин; 20 - алабандин; 25 - азурит; 29 - аметрин; 30 - аквамарин. Составил: А. Евсеев, 2017. \ k-33_A-min_171121.jpg

Первоначальные местонахождения новых минералов, открытых на территории быв. СССР (10 примеров - аверьевит, авиценнит, азопроит, айкинит, акдалаит, аксаит, акташит, алакранит, алланит-(La), аллуайвит). Составил: А. Евсеев, 2018. Подробнее о минералах : Pekov I.V. Minerals First Discovered on the Territory of the Former Soviet Union. Moscow, OP, 1998.- 369 pp. \\ k-USSR_loc_nmin_A_Pk-98_180226.jpg

Краткий указатель минералов к томам справочника “Минералы”(т.IV-V)
Сокращения: М-5-2, 114 - "Минералы", том V, вып.2, стр. 114

Минералы: Справочник. Т. IV, вып.1. – М.: Наука, 1992.– 600 с. (= М-4-1)
Минералы: Справочник. Т. IV, вып.2. – М.: Наука, 1992.– 663 с. (= М-4-2)
Минералы: Справочник. Т. IV, вып.3. – М.: Наука, 1996.– 426 с. (= М-4-3)
Минералы: Справочник. Т. V, вып.1. – М.: Наука, 2003. – 583 с. (= М-5-1)
Минералы: Справочник. Т. V, вып.2. – М.: Наука, 2003. – 382 с. (= М-5-2)

Адуляр \\ М-5-1, 265
Акатореит \\ М-4-3, 194
Алиэттит \\ М-4-2, 248
Аллуайвит \\ М-4-3, 261
Алтисит \\ М-4-3, 416
Альбит \\ М-5-1, 136
Алюминиевый сапонит \\ М-4-2, 82
Алюминиевый сепиолит \\ М-4-2, 370
Алюмоферрихризоколла \\ М-4-2, 388
Алюмохризоколла \\ М-4-2, 388
Амазонит \\ М-5-1, 241
Аммониолейцит \\ М-5-2, 114
Амсталлит \\ М-4-3, 402
Анальбит \\ М-5-1, 129
Андезины \\ М-5-1, 472
Андремейерит \\ М-4-3, 113
Анортит \\ М-5-1, 412
Анортоклазы \\ М-5-1, 367
Апофиллит \\ М-4-2, 459
Арденнит \\ М-4-3, 187
Армстронгит \\ М-4-2, 536
Афганит \\ М-5-2, 264
Ахоит \\ М-4-2, 608

А_минералы в иллюстрациях

А-минералы - Фото

А-Г_минералы_в музее РГГРУ

Аар \ Aar (быв.) = Аре (также Ааре) - 1) река, лев. прит. Рейна 2) Аарский массив, Альпы; Швейцария \\ [кварц!!] кр-лы в полостях (до 2 м в поперечнике); микроклин!(1980л); пирротин 5C (!); флюорит!--розовые xls \\ https://de.wikipedia.org/wiki/Aarmassiv \\ на карте - см. https://www.researchgate.net/figure/Geographical-and-geological-setting-of-the-Aar-Massif-after-Abrecht-1994-showing_fig1_37439516

Аахен = Ахен (см.), Германия \\ ЕК

Абагазское = Абагасское м-ние (Fe), Аскизский район Хакасии (Россия), в 196 км к западу от Абакана, Россия \\ Минералогические находки: ильваит!!--почти моноинеральная ильваит. порода (Минералы, т.3, в.1, с.704) магнетит!; малахит!--сферолит. корки из игол. кр-лов--ФМ (№94679, Лисицин Д.В., 2014) \\ Вахрушев В.А. Минералогия, геохимия и генетические группы контактово-метасоматических железорудных месторождений Алтае-Саянской области. - М.: Наука, 1965. - 291 с. \\ 53°16'32'' с.ш., 89°36'28'' в.д - https://webmineral.ru/deposits/item.php?id=1026

- Васильева А.И. О некоторых особенностях рудной минерализации в месторождении Абагасс // Геология и генезис магнетитовых месторождений Сибири. Сб-к статей. Изд. Наука. 1967. - 216 с

- Вахрушев В.А. Минералогия, геохимия и генетические группы контактово-метасоматических железорудных месторождений Алтае-Саянской области. - М.: Наука, 1965. - 291 с.

Абагайтуй = Абагайтуйское м-ние флюорита \ Abagaitui , Вост. Забайкалье, РФ; 49°42'23'' с.ш., 117°53'52'' в.д \\ барит!!--друзы; флюорит!! \\ без сульфидов! ; Смо, 348; флюорит!! \\ Расческин Е.В., 2004, 209; Болдырев А.К., 1926 \\ Пилипенко П.П., 1937 \\ М-2-1, 25, 23а) \\ ЕК

Барит. Абагайтуй, Вост. Забайкалье, Россия.. Проявляет очень яркую желтую люминесценцию. Фото: © К. Власов. \\ НМК-115

Абагасское = Абагас (=Абагазское) м-ние (Fe), Аскизский р-н, Хакассия, юг Сибири, Россия; пос. Вершина Теи \\ ильваит!!--"почти мономинеральная ильваит. порода"--М-3-1, 704; магнетит!; малахит!--сферолит. корки из игольчат. кр-лов, обр. 10 см ФМ (№94679, Лисицин Д.В., 2014) ; \\ http://webmineral.ru/deposits/item.php?id=1026

--Васильева А.И. О некоторых особенностях рудной минерализации в месторождении Абагасс // Геология и генезис магнетитовых месторождений Сибири. Сб-к статей. Изд. Наука. 1967. - 216 с.

Абаил, м-ние (Fe), 7-8 км от пос. Тюлькубас, 75 км к СВВ от Чимкента, ЮВ Каратау, Казахстан (Ю) \\ арагонит!!!

Абаилское[1] (Абайылинское) месторождение — месторождение железных руд на территории Тюлькубасского района Туркестанской области, в 15 км к северу от железнодорожной станции Абаил. Расположено на юго-восточном склоне хребта Каратау ; 42°37` с. ш. 70°27` в. д. \\ Источник: https://ru.wikipedia.org/wiki/Абаилское_месторождение

--Баталов А.Б. К минералогии окисленных руд Абаила. Ташк., 1946 \\см. также ДАН СССР, 1946, т.54, №4

Арагонит. Абаил м-ние, Ю. Казахстан. Большой штуф 36х32х22 см . Образец: ФМ(№46672.). Фото: 1) А.А. Евсеев. 2) https://www.fmm.ru/FMM_1_46672

Абак речка, Вилюйский округ, Якутия, Россия \\ галит --ГМ (СПб)

Абакан г., Хакассия, юг Сибири, Россия \\ окамен. дерево --ЦСГМ(о)

Абакан м-ние [176 км к ЮЗ от г. Абакан]., Хакассия, юг Сибири, Россия \\ М-2-3, 67--магнетитовые руды; фторпапатит--ФМ \\ РдМ-, с. 68сх-69

Абаканское м-ние, Зап. Саян, Сибирь, Россия \\ пирротин; саффлорит; фторапатит--ЦСГМ-1978

Абаканский солеваренный зав.(окр-ти), быв. Енисейская губ., юг Ср. Сибири, Россия \\ ангидрит!--"выходы с прекрасными синеват. кристаллами" (Драверт П., 1922)

Абакумова Н. Б. Зональные метакристаллы циркона и пирохлора из щелочных пегматитов Елетьозерского массива // Физика минералов и проблемы типоморфизма / Ред. И. И. Шафрановский, С. А. Руденко. Л.: Недра, 1976. С. 98-103.

Абакумова Н. Б. Щелочные пегматиты Елетьозерского массива габброидных и щелочных пород (Северная Карелия). Сов. геология, 1966, № 5.

Абанагур (Abanagur), близ Пуны, Индия \\ кавансит!!!--в туфобрекчих толеит. базальтов; D, 1997

Абанойское м-ние , р. Лопанис-цхали, бл.с. Абано, Грузия \\ доломиты! (1959)\\ ЕК

Абас-Туман = Аббас-Туман = Абастумани п., р-н Ахалцихе, Грузия \\ кварц!; стильбит!; цеолиты --Лебедев Н.И., 1901 и др; \\ ЕК

Аббот майн \ Abbott mine, округ Лейк, Калифорния, США; 39° 1' 22'' North , 122° 26' 44'' West \\ метациннабарит--ГМ-1911 \\ ЕК

Абдашт р-к (Cr) \ Abdasht , к Ю от г. Керман, Иран \\ гидромагнезит!!--xls<19 см; (1983л) \\ ЕК

Абду рудопроявление (Ni-Co), Богаинский разлом, Южн. Гиссар хр., Таджикистан \\ ЕК

Абдукагор р. , Зап. Памир, Таджикистан \\ кварц!!--в т.ч. япон. двойник 7 см. --ЦСГМ(о) \\ на карте - l-Abduka_Vanch

Горный хрусталь. Абдукагор м-ние, Памир, Таджикистан. Справа - кристалл в арагонитовой "рубашке" (высота более 15 см). Образцы: музей "Самоцветы". Фото: © А.А. Евсеев.

Абдул-Абад, Иран - гемиморфит с кварцем - М-3-1, 624

Абдул-Касимовское м-ние, Башкирия, Ю. Урал, Россия \\ тальк!--ФМ(о5)

Абдуррезаги \ Abdurrezzagi, Нишапур, Маден, Иран \\ бирюза!!!--Bancroft P., 1984, 285

Абеллаит [= абельяит] \ Abellaite - новый минерал из Каталонии (Испания) \\ Ibanez-Insa J., Elvira J.J., Llovet X., Perez-Cano J., Oriols N., Busquets-Maso M., Hernandez S. (2017): Abellaite, NaPb2(CO3)2(OH), a new supergene mineral from the Eureka mine, Lleida province, Catalonia, Spain. European Journal of Mineralogy: 29: 915-922. \\ https://www.mindat.org/min-47008.html

--Юбилейная ж., Карнасурт, Ловозеро, Кольский п-ов, Россия - фото - www.mindat.org \\ Касаткин А.В. Новые находки редких минералов на территории постсоветских государств. Минералогический альманах, Том 2, вып.2. 2019, стр.4- 47.

Абелсонит = абельсонит - новый минерал из формации Грин-Ривер, Юта, США \ WOSCO Well, Грин-Ривер формация, округ Юинта, Юта, США \  Green River formationUintah Co.UtahUSA \\ Milton, C., Dwornik, E. J., Estep-Barnes, P. A., Finkelman, R. B., Pabst, A., & Palmer, S. (1978). Abelsonite, nickel porphyrin, a new mineral from the Green River Formation, Utah. American Mineralogist, 63(9-10), 930-937

Абенаб р-к, Намибия \ Abenab Mine, Grootfontein, Grootfontein District, Otjozondjupa Region, Namibia; 19° 17' 40'' South , 18° 5' 22'' East--фд: ванадинит -9; деклуазит!!!-9фд+Gui-72; моттрамит (xls<2см)--ФМ; смитсонит-2 \\ www.mindat.org

Моттрамит. Абенаб р-к [40 км к З от Цумеба], близ Цумеба, Намибия. Образец: Мин. музей им. А.Е. Ферсмана РАН (№52577. Передано государством, 1957). Фото: А.А. Евсеев. \\ Abenab Mine, Grootfontein, Grootfontein District - http://www.mindat.org/loc-8280.htm

Экваториальная, Южная и Восточная Африка. Абенаб р-к и другие местонахождения минералов (примеры - первые на А в картотеке А. Евсеева).

Абенакиит-(Ce) \ Abenakiite-(Ce) Na26Ce6(Si6O18)(PO4)6(CO3)6(SO2)O

--Кольский регион--Борисова В.В., Волошин А.В., 2015 \\ Источник: http://discoverkola.com/mineraly

- Канада: Пудрет к-р*, Сент-Илер, Квебек \ McDonald, A.M., Chao, G.Y. and Grice, J.D. (1994), Abenakiite-(Ce), a new silicophosphate carbonate mineral from Mont Saint-Hilaire, Quebec: Description and structure determination. Canadian Mineralogist, 32, 843-854.

Абендрот, Германия \ Grube Abendrothe, St Andreasberg, Harz; 51° 42' 47'' North , 10° 30' 57'' East (est) \\ https://www.mindat.org/loc-13511.html \\ пираргирит!!--ГМ(о) --пираргирит!!--ГМ (о) \\ ЕК

Абердин (Абердиншир) графство \ Aberdeenshire, Шотландия, Великобритания \\ агат!(о)--ГГМ (МГРИ, №24162); дюмортьерит--М-3-1, 333; гиперстен!--М-3-2, 451а); феррогиперстен--М-3-2, 462а) \\ ЕК

Аберллин майн, Уэльс, Великобритания \  Aberllyn Mine, Betws-y-coed, Gwydyr Forest area, Conwy, Wales, UK \\ намууит\ Namuwite *

Абернатиит \ Abernathyite - https://www.mindat.org/min-3.html

--Fuemrol No. 2 mine (Fuemrole mine), Temple MountainSan Rafael District (San Rafael Swell)Emery Co.UtahUSA  \\ абернатиит* -Thompson, M.E., Ingram, B., Gross, E.B. (1956): Abernathyite, a new uranium mineral of the metatorbernite group. American Mineralogist, 41, 82-90. http://rruff.info/rruff_1.0/uploads/AM41_82.pdf   \\  "Fuemrole" in the original literature is an obvious misnomer for fumarole.--миндат

--Deer Strike and Elk Mine,  Stanley Basin DistrictCuster Co.IdahoUSA

Абернатиит. Фьюэмроул Майн \ Fuemrole mine, Темпл Маунтин, Юта, США. Образец: Мин. музей им.А.Е. Ферсмана РАН (№88664, Обмен, 1997 ). Фото: © А. Евсеев

Абертами, близ Яхимова, Чехия \ AbertamyKarlovy Vary DistrictKarlovy Vary RegionCzech Republic \ Paulis, P.: Curienit z Abertam u Jachymova. Casopis pro mineralogii a geologii, 1992, roc. 35, c. 1, s. 55-65. \ реферат

Кюрьенит. Абертами, близ Яхимова - 1-я находка в Чехии (1992). \\ НМК-162

Абеширо р-к, преф. Аомори, Япония \\ лепидокрокит в пиритсод. желваках среди глин - М-2-3, 544

Абзаковское м-ние хризотил-асбест, Ю. Урал, Россия \\ ЕК

Абзалов М.З., Полежаева Л. И. Сульфоарсениды в породах продуктивной толщи Печенги (Кольский полуостров) // ЗВМО, 1989. № 4. С. 64-73.

Абзелиловский р-н, Башкирия, Ю. Урал \\ золото!!--xls--Смолин А.П.,1970. с.80

Абидос м-ния, Австралия \\ гадолинит - в гальках...--М-3-1, 415 \\ ЕК

Абикью оз. \ Abiquiu,, Нью-Мексико, США \\ агат--в 30 км к ЮЗ от оз. Абикью (1980л) \\ ЕК

Абиндадрема (Abindadrema), Мадагаскар \\ ибонит! \\ ЕК

Абиркатиб р-к \ Abirkatib mine, Al Bahr al Ahmar, Wilayah, Судан \\ актинолит; альбит; золото; кварц; хлорит; эпидот--mindat

Абитиби. зеленокамен. пояс, Канада \\ ЭПГ в сульфидной минерализации (1990л) \\ родингиты \\ ЕК
Абитиби, пегм. пров. , Онтарио\ Квебек, Канада \\ Ш, 45

Абихит = клиноклаз (КМС) \\ Меднорудянск, Ниж. Тагил, Ср. Урал, Россия

Або (быв.) - Турку (ныне), Финляндия \\ альмандин!--ГМ-1911(о); "бонсфордит" (изменен. кордиерит) - ГМ -1911 (о4) ; ломонтит(1857л и др.) ; неотокит\\ ЕК

Абовянское (Капутанское) м-ние (Fe), у ЮЗ окраины с. Капутан, Армения \\ магнетит-апатитовые жилы; апатит!--крупные удлинен. кристаллы [ могут быть сравнимы с образцами Лебяжинского рудника или Кируновары] ; магнетит--Киракосян Т.А., 1979 (л) \\ Геол. Арм. ССР, 1967, т.6, с.63-67 \\ ЕК

Абрамов Г.Ю.

Абрамов Д.В.

1. Г.Абрамов и др. Володарск-Волынский, Украина. 1968 г. 2. Д.В. Абрамов (справа) на уч-ке "Е" Керченского м-ния (бл. п. Приозерный, Крым, Украина). 1987.06.25. Фото 1-2: А. Евсеев.

Абрамов Ф.И., Данилов С.Д., Крутов Г.А. Минералого-петрографический очерк Никитовского ртутно-сурьмяного месторождения. М.: ГНТГГИ, 1932. 132 с.

Абрамовит* \\ Abramovite

--Юдовская М. А., Трубкин Н. В., Копорулина Е. В., Белаковский Д. И., Мохов А. В., Кузнецова М. В., Голованова Т. И. Абрамовит Pb2SnInBiS7-новый минерал из фумарол вулкана Кудрявый (Курильские острова). - Зап. РМО, 2007, ч.136, вып. 5, с. 45-51 \\

--M. A. Yudovskaya, N. V. Trybkin, E. V. Koporulina, D. I. Belakovsky, A. V. Mokhov, M. V. Kuznetsova & T. I. Golovanova, Abramovite, Pb2SnInBiS7, the new mineral from fumaroles of Kudryavy volcano (Kurily Islands). // Abstract in American Mineralogist (2009), 94, 1075.

Абрамович Ю.М. и др. Аутигенный флюорит в кунгурских отложениях Пермского Приуралья. - ДАН СССР, 1960, 135, 2, 415-415

Абрамовка р., Приморье, Россия --тантал сам. - Bern-04 \ Bernard, 2004, 687

Абруд (Абрудбанья) город и админ. центр, расположенного поблизости золоторудного района, Румыния \ Abrud (Abrudbanya; Gross-Schlatten; Abruttus), AlbaRomania - https://www.mindat.org/loc-146858.html \\ Abrud is a town and an administrative center of nearby gold mining. 
The Rosia Montana (Verespatak) locality is nearby.

Абсарока Рейндж \ Absaroka Range [к В от Йеллоустонского нац. парка], Вайоминг, США \\ лейцит!

Абсвурмбахит \ Abswurmbachite \

- Греция:  Myli (Mili) *(TL) \\  Apikia (Apoikia)* (TL) \\ Reinecke, T., Tillmanns, E. & Bernhardt, H.-J. (1991): Abswurmbachite, Cu2+Mn3+[O8/SiO4], a new mineral of the braunite group: natural occurrence, synthesis and crystal structure. Neues Jahrbuch fur Mineralogie Abhandlungen, 163, 117-143.

- Япония: Sanbagawa metamorphic belt --Enami, M., & Banno, Y. (2001). Partitioning of Sr between coexisting minerals of the hollandite-and piemontite-groups in a quartz-rich schist from the Sanbagawa metamorphic belt, Japan. American Mineralogist, 86(3), 205-214.

---Iyomishima, Shikokuchuo CityEhimeJapan \\ The Mineral Species of Japan (5th ed) Matsubara \\

Абу Али ибн Сина (Абу Али Хусейн ибн Абдаллах ибн Сина) (980- 1037), крупнейший ученый средневековья, известный на Западе как Авице?нна \\ https://ru.wikipedia.org/wiki/Ибн_Сина

Абу-Галага р-к \ Abu Ghalaga Ilmenite Mine, Восточная пустыня, Египет \\ ильменитовые руды- - https://mrdata.usgs.gov/mrds/show-mrds.php?dep_id=10079520 \\ мин-гия и ген. ильмен.руд--Basts E.Z., 1968; \\ ЕК

Абу-Даббаб\ Abu Dabbab , Египет \\ вольфрамит--Bernard, 2004, 687

Абужа \ Abuja, Abuja Capitol Territory, Нигерия--штольцит! --GEM

Абуит* - новый минерал р-ка Хиномару, преф. Ямагути \\ Enju, S. & Uehara, S. (2017): Abuite, CaAl2(PO4)2F2, a new mineral from the Hinomaru–Nago mine, Yamaguchi Prefecture, Japan. Journal of Mineralogical and Petrological Sciences, 112, 109–115

Абукума плато (Abukuma), преф. Фукусима, Япония \\ пьемонтитсод. сланцы --минералогия--(1993л) РЖ "Геология" - 4В401-1994

Абукума хр. (Abukuma Range), преф. Фукусима, Япония \\ абукумалит-Y = бритолит-(Y)*; манганортит--в пегматитах --Hata S., 139 \\ М-3-1, 763

Абукумалит = бритолит-(Y) (КМС)

--Вюнцпахк, Кейвы, Кольский п-ов, Россия

--Сахарийок м-в, Кольский п-ов, Россия \\ ЕК

Абу-Хайн, Ливия \\ целестин

Абхурит \ Abhurite - новый минерал из Саудовской Аравии \ Sharm Abhur CoveJiddah (Jeddah)Mintaqah MakkahSaudi Arabia

--Matzko, J.J., Evans, H.T., Jr., Mrose, M.E., Aruscavage, P. (1985) Abhurite, a new tin hydroxychloride mineral, and a comparative study with a synthetic basic tin chloride. The Canadian Mineralogist: 23: 233-240.

--Dunkle S E, Craig J R, Rimstidt J D, Lusardi W R (2003) Romarchite, hydroromarchite and abhurite formed during the corrosion of pewter artifacts from the Queen Anne's Revenge (1718). The Canadian Mineralogist 41, 659-669 http://rruff.info/rruff_1.0/uploads/CM41_659.pdf

Абчада р., Сев. Прибайкалье, Россия \\ ФМ: берилл; приорит; эвксенит \\ пегматиты с амазонитом, гадолинитом, циннвальдитом; фергюсонитом и др. \\ Е.И. Семёнов \\ ЕК

Берилл (кристалл более 10 см) на кварце. Абчада, Сев. Прибайкалье, Россия. Образец: Минер. музей МГРИ-РГГРУ (Дар: Е.Б. Соловьёв, 2018.03. Его находка 1985 г.). Фото: © А.А. Евсеев

Абшир (Абширское) м-ние (Sb, флюорит), верх. р. Абшир, на сев. склоне хр. Кичик-Алайского хр., к В от Чаувая, Ю. Фергана; Киргизия; 40° 9' 35'' c.ш. , 72° 21' 49'' в.д. (Wikimapia)\\ антимонит!--до 15 см; барит--"розы"; флюорит!--кристаллы и друзы \\ Моргенштерн Л.Е. и др... Узб. геол. ж., 1971 , №6, 48-54

Ава \ Ava (район), Мьянма (быв. Бирма) \\ аквамарин!!; иридий, Pt-стый!--М-1-1, 49; шпинель!!

Авала гора , 15 км к ЮВ от Белграда, Сербия \\ каломель--1) 1) фото 2) прекрасные xls<10 мм--Dana, 1997; киноварь!; ртуть!

Авам р., р-н Норильска, Ср. Сибирь \\ датолит! \\ЕК

Аванг Пангкал, Калимантан о.(Борнео о.) \\ золото (микро) в породе --ФМ(№80126)

Авансолерудник, Ереван, Армения. 

Галит. Авансолерудник, Ереван, Армения. Образец: Геолого-минерал. музей МГОУ (№3290. Сборы ГК). Фото: © А.А. Евсеев.

Авант, округ Гарленд, Арканзас \ Avant, Garland Co., США; 34° 38' 45'' North , 93° 20' 23'' West - https://www.mindat.org/loc-3404.html \\ вавеллит!!; варисцит!!--171 ф


Авантюрин. [Таганай], Ю. Урал. Россия. Образец: Минер. музей РГГРУ (Р-934 ). Фото: © А.А. Евсеев

Авантюрин-лабрадор \\ Паромовка, Волынь, Украина \\ ЕК (л)

Аваруа зал., Нов. Зеландия \ близ Awarua Bay, New Zealand находится первоначальное местонахождение аваруита - Gorge River, Westland District, West Coast Region, New Zealand

Аваруит \ Awaruite \ Ni3Fe \ https://www.mindat.org/min-439.html

- Россия: Бобровка р., гора Соловьёва, Ср. Урал, Россия (1913л)

----Лапта-Пай р., [б-н р. Мокр. Сыня], Пол. Урал, Россия--(Савельева Г.Н. и др.,1970л)

- Нов. Зеландия: Gorge River, Westland District, West Coast Region, South Island, New Zealand ---3 фото (mindat.org)

---- Skey, W. (1885) Article LXL - On a New Mineral (Awaruite) from Barn Bay. Transactions and Proceedings of the New Zealand Institute, Vol 18, pp 401-402.

- США: Орегон-- Josephine Creek placers, Josephine Creek Mining District, Josephine Co., Oregon, US - лучшие и самые крупные образцы в мире (до 2,5 см кг) \\ There are a lot of awaruite localities on the Earth, but Josephine Creek placers produce the best and largest known (up to 2.5 kg nuggets) its specimens. Источник: www.mindat.org

---- South Fork Smith River, Klamath Mts, Del Norte Co., California, USA

Аваруит. Калифорния, США. Образец: Геолог. музей им. А.А. Штукенберга (№6832), Казанский ун-т. Фото: © А.А. Евсеев

--Базылев Б. А., Аваруит (Ni3Fe)-содержащая метаморфическая ассоциация в мантийных перидотитах из зоны разлома 15°20' (Атлантический океан): первая находка в океанической литосфере, Юбилейная сессия Ученого Совета ГЕОХИ, Тезисы докладов молодых ученых, c. 15-16, ГЕОХИ, Москва, 1997а.

--Базылев Б.А. Развитие аваруитсодержащей минеральной ассоциации в перидотитах из зоны разлома 15°20' (Атлантический океан) как одно из проявлений океанического метаморфизма. - Рос. журнал наук о Земле, 2000, Т. 2, № 3. \\ http://geo.web.ru/db/msg.html?mid=1162742&uri=part17.htm

Авача вулк., Камчатка, Россия \\ алуноген; вольтаит@; гейландит; сассолин; сера \\ Заварицкий А.Н., 1977 \\ ЕК

Авгит \ Augite - 520 фото mindat


--Пай-Хой \\

--Сухая гора, Верх-Нейвинский зав., Ср. Урал \\ ЕК

--Пышминско-Ключевское м-ние, Ср. Урал \\ ЕК



Авгит (кристаллы до 1,5-2 см). Пашкаполе\Paskapole, Боржислав, Чехия. Образец: Мин. музей им.А.Е. Ферсмана РАН (№49516). 2. Авгит. Парайнен (быв. Паргас), Финляндия. Образец: Мин. музей им. А.Е. Ферсмана РАН (№26067, Иосса В.А., 1917). Фото 1-2: © А.А. Евсеев.

1. Авгит. Сидар-Бьютт \ Cedar Butte, Орегон, США. Образец: Минер. музей РГГРУ (Р-1744). Более 2 см. 2. Авгит (кристаллы до 2-3 см) из туфов Восточно-Африканского рифта. Образец: ФМ (№91248. От Петрографического музея ИГЕМ РАН. Дар, 2002). Фото 1-2: © А.А. Евсеев

--Старый карьер у пос. Донское, Волновахский р-н, Приазовье--xls\\ Гнездо земляной осы, построенное из кристаллов авгита и микроклина. В пегматоидном сиените. Пеков И.В., Пекова Н.А. \\ #1695 (ФМ-MY)

Авдонин Владимир Николаевич|

В.Н. Авдонин и Г.Ф. Анастасенко (справа). Санкт-Петербургский ун-т, 2005. Фото: А.Евсеев

Авдонин, Андрей Валерьевич, кандидат геолого-минералогических наук, 2005, Москва. Глобальные широтные линеаменты и их значение для палеотектонических реконструкций: На примере каледонид Северного Тянь-Шаня - https://www.dissercat.com/content/globalnye-shirotnye-lineamenty-i-ikh-znachenie-dlya-paleotektonicheskikh-rekonstruktsii-na-p

--Авдонин А.В., Долгинов Е.А. Глобальные широтные линеаменты и их значение для оценки общей структуры, развития и геодинамики Земли. – М.: 2004, 100с.


--Пеков И.В.Кривовичев С.В.Чуканов Н.В.Япаскурт В.О.Сидоров Е.Г -- Авдонинит: новые данные, кристаллическая структура и уточненная формула K2Cu5Cl8(OH)4•2H2O . - Записки Российского минералогического общества, 2015, 144, № 3, с. 55-69

--Ядовитая, фумарола, Толбачик вулк., Камчатка 2) Блява, м-ние, Ю. Урал, Россия \\ Чуканов Н. В., Мурашко М. Н., Задов А. Е., Бушмакин А. Ф. Авдонинит K2Cu5Cl8(OH)4·Н2О - новый минерал из вулканических эксгаляций и зоны техногенеза колчеданных месторождений. - Зап. РМО, 2006, т.135, №3, с. 38-41.

--Германия \\ Grona Mine, BernburgStassfurt Potash DepositSaxony-AnhaltGermany \\ Witzke, T. (2012): Gillardit, Cu3Ni(OH)6Cl2, und Avdoninit, K2Cu5Cl8(OH)4 • H2O, zwei Neufunde von Bernburg, Sachsen-Anhalt. Aufschluss 63, 209-211.

Авейрон, Франция \\ вивианит!!--xls--Музей Высш. горн. школы(Париж) (1864л) \\ нет фото в mindat \\ ЕК

Аверьевит  Cu5O2(VO4)2·n(Cs,Rb,K)Cl
Установлен в продуктах фумарольной деятельности на Северном прорыве Большого трещинного извержения (1975-76 гг) вулкана Толбачик, Камчатка. Встречен в виде черных шестиугольных пластинчатых кристаллов до 0.3х0.1 см в ассоциации с пийпитом, теноритом и др. [757].Название: в честь Валерия Викторовича Аверьева (1929-1968), вулканолога, специалиста в области геотермии вулканических областей; Институт вулканологии, Петропавловск-Камчатский.TS: PMM 2102/2. \\ Источник: Pekov, I. (1998) Minerals First discovered on the territory of the former Soviet Union 369p. Ocean Pictures, Moscow

Авес о., Карибское море; Венесуэла \ Aves IslandNueva EspartaVenezuela \\ брушит*; на острове добывалось гуано

Авзянская свита \\ А.В. Маслов Л.В. Анфимов АВЗЯНСКАЯ РУДОНОСНАЯ СВИТА СРЕДНЕГО РИФЕЯ ЮЖНОГО УРАЛА (литостратиграфия, условия образования, минерагения) г \\ флюорит--Русская платф (вост. часть) (л) \\ ЕК \\ https://docplayer.ru/56805206-Avzyanskaya-rudonosnaya-svita

Авикая \ Avicaya, Боливия \\ Avicaya Mines (Totoral Mines), Monserrat-Antequera districtPaznaPoopo Province,Oruro DepartmentBolivia \ https://www.mindat.org/loc-146874.html \ 18° 30' S, 66° 53' W \\ дерев. олово!!--ФМ

"Авиларгус \ Avilargus"(очевидно, ошибочное назв.) = Colquechaca (Aullagas), Боливия --канфильдит*

Авимор \ Aviemore, Waimate Distr., Южный о., Нов. Зеландия \\ ЕК

Авиретх-Криндж \ Awireth-Krinj, Читраль, Пакистан \\ GAMERITH H. Antimony, Gold and Polymetallic Deposits of the Awireth-Krinj Area, Chitral/Pakistan --читать - http://www.zobodat.at/pdf/MittNatVerSt_120_0155-0165.pdf \\ ЕК

Ависжарфик \ [= Auvaitsersarfik, Nuuk (Godthab), Гренландия \ www.mindat.org \\ сапфирин!--в гнейсах--М-3-2, 581 \\ ЕК

Ависсавелла \ Avissawella, Western Province, Sri Lanka ; 6° 57' 31'' North , 80° 11' 55'' East \\ корунд --д.к.!!- добыча--mindat

Авиценнит \ Avicennite . Tl2O3
Найден в 1956 г Х.Н.Карповой в образцах из древних выработок близ кишлака Джузумли в Зирабулакских горах, в 25 км к юго-западу от ж/д станции Зирабулак, Самаркандская обл., З.Узбекистан. Образует мелкие (до десятых долей мм) черные с буровато-серым оттенком кубические кристаллы, похожие на кристаллы перовскита, в массе полосчатого лимонита в карбонатных жилах среди известняков [238,277].
Название: в честь Авиценны (Абу Али ибн Сина, 980-1037), таджикского естествоиспытателя, философа и врача, автора книги о минералах, работавшего в Бухаре и в Иране.
TS: FM vis5689
. \\ Источник: Pekov, I. (1998) Minerals First discovered on the territory of the former Soviet Union 369p. Ocean Pictures, Moscow

- Гренландия, Дания: Илимауссак

1. Авиценнит. Лукаут-Пасс \ Lookout Pass, Юта, США. Образец: Минер. музей им. А.Е. Ферсмана РАН (№90166). \\ ср. Thallium Prospect, Little Valley, Tooele Co., Utah, USA --www.mindat.org. . (Егоров К.Ф., 1955.). Фото: © А.А. Евсеев

- США : Карлин м-ние, Невада, США \\ Radtke, A. S., Dickson, F. W. and Slack, J. F. (1978): Occurrence and formation of avicennite, Tl2O3, as a secondary mineral at the Carlin gold deposit, Nevada. J. Res. U.S. Geol. Surv. 6, 241-246.

Авняшевка рч, ("к С от Миасса"), Южн. Урал, Россия \\ гематит!; колумбит ("менгит"); корунд!!; топаз!--xls; циркон! --ГМ(СПб)

Авник \ Avnik, Вост. Турция, м-ние магнетит-апатитовое \\ ЕК \\ Huseyin Celebi, Cahit Helvac and Ali Ucurum; 38° 39' 0'' North , 40° 19' 59'' East ; по карте - 350 км к З от Дашкесана (Азербайджан) \\

--Helvaci, C. (1984) Apatite-rich iron deposits of the Avnik (Bingoel) region, southeastern Turkey. Economic Geology, 79(2), 354-371.

АвогадритМ-2-1, 15 – рис. кр-ла—Везувий*--фумаролы

Авогадрит, малладрит. Везувий, Италия. Образец: Минер. музей им. А.Е. Ферсмана РАН (Егоров К.Ф., 1955.). Фото: © А.А. Евсеев.

Авока клейм, Брит. Колумбия, Канада \ Avoca claim, Bonaparte River, Lillooet Distr. \\ бонаттит--ф; пуатвенит \ poitevinite*(1964л) \\ ЕК

Авренско-Маджаровский рудный пояс, Болгария (1989л) \\ ЕК

Аврора майн = Орора майн, Невада, США \\ аурорит \ aurorite--North Aurora mineSummit areaTreasure HillSilver BeltWhite Pine DistrictWhite Pine Co.,NevadaUSA

Авроринский прииск, [г. Соловьёва], к ЮВ от Нижний Тагила, Ср. Урал, Россия \\ золото!; жедвабит*; платина!!

Авроринское м-ние, Нижнетагильский дунитовый массив, [г. Соловьёва], к ЮВ от Нижний Тагила, Ср. Урал, Россия \\ платина!!; поликсен!-М-1-1, 51(а) ; цинк - М-1-1, 57 \\ см. Минералы Урала, 1990, с.31 -- изоферроплатина--в дунит. пегматитах--куб. кристаллы, сростки, зерна и самородки


Австралия. Местонахождения минералов (примеры). Составил: А. Евсеев. 2018.02.13 \\ Аделаида Майн, Дундас - крокоит!!!; англезит!! -Guillemin,1964,53;:гиббсит+дундасит*!! \\ Аргайл р--к-алмаз!!!--роз! \\ Брокен-Хилл--родонит!!!--ф-Тус-17; родохрозит!; церуссит!!-80фд; галенит!; леграндит!--ф \\ Воджина \ Wodgina--бобьерит; воджинит*; колумбит -(Mn)!!-фд;танталит-(Mn)-2фд; ферроколумбит; "крупн.в мире ист-к танталита в 20 в." \\ Калгурли-алтаит; золото!!; колорадоит;креннерит-ФМ; кулсонит, Ti-стый (л), томичит*; теллуриды! \\ Кубер-Педи--опал по беле мнитам!!\\ Малбунка --азурит!!! \\ Burra Burra--атакамит; медь!! \\ Dimbulah--висмут!!--РГ--ф; молибденит!!--ф \\ Greenbushes Sn placers-- сподумен!!--2фд; стибиотанталит*; тапиолит-(Fe);холтит*; холмквистит--mindatl \\ Marlborough \ Мальборо--хризопраз!!\\ Rum Jungle, 8 км к С от Batchelor--малахит!

--Новые минеральные виды, впервые описанные из Австралии \\ Sutherland F. L. Mineral species first described from Australia and their type specimens. // Australian Journal of Mineralogy. 2000, V. 6. No. 2. P. 104-128.

-- Australia! - Mineralogical Record, 1988, Vol. 19, No. 6 \\ специальный. выпуск журнала

Австралия \ карта и минералогические находки

Австралия_МН-4_местонахождения минералов

Австралия_минералогические особенности

Австралия (Центр)_15°Ю-125°В

Замечательные минералогические находки Австралии (примеры). Малахит. Хризопраз. Дравит. Азурит. Благородный опал. Золото. Родонит. Крокоит. Фото: М. Аносов, Д. Тонкачеев, А. Евсеев и др. \\ НМК-149

АВСТРИЯ \\ фото минералов - 21119 (на 2018.12.24) \ https://www.mindat.org/loc-14279.html

Арагонит ("железные цветы"). Эрцберг \ Erzberg, Штирия, Австрия. Образец: Музей ест.истории (Вена). Фото: © В.И. Дворядкин.

Автомобиль, дороги, минералы

В.И. Степанов (слева), В. Москалев и А. Ефимов у сломавшегося ГАЗ-51. Краснодарский край. 1977.08.16. Фото: А. Евсеев.

Авторы и публикации по минералогии (зарубежные)_A-Z - авторы от A до Z (примеры)+


Галенит. Автоэпитаксия мелких октаэдров на грани {100} крупного кристалла. Джоплин, Миссури, США. Образец: Мин. музей им.А.Е. Ферсмана РАН (№87612. Обмен 1992). Фото: © А.А. Евсеев.

Из публикаций

А - Аг - Аи - Ал - Ам - Ар - Ат

А _ Заметки geo.web.ru/druza \ минералы + местонахождения + авторы

А - Аг - Аи - Ам - Ар - Б - Бе - Бо - В - Г - Д - Де - Е - Ж - З - И - Й - К - Кв - Км - Кр -- Л - Ли -

М - Мал - Мг - Мм - Му -- Н - Ни - О - П - Р - С -- Ск - Ст - Т - Ти - Тр - У -Ф -- Фо - Х - Ц - Ч - Ш Щ - Э - Ю - Я

СТРАНЫ от А до Я

находки минералов по листам карты мира: 1234567 891011121314151617181920212223242526272829303132 - 33



А - Б - В - Г - Д - Е - Ж - З - И - К - Л - М - Н - О - П - Р - С - Т - У - Ф - Х - Ц - Ч - ШЩ - Э - Ю - Я

местонахождения минералов - | - mineral localities : А Б В ГДЕ Ж З И Й К Л М Н О ПР С Т У Ф Х Ц ЧШ Щ Э Ю Я || A B C D E F G H I J K L M N O P R S T U V W X Y Z

Заметки на geo.web.ru/druza

От А до Я

№104 №112
2014 №114
№126 №131
№163 №166

Заметки - А - Б - В - Г - Д - Е - Ж - З - И - Й - К - Л - М- Н -О - П - Р - С - Т - У -Ф - Х - Ц - Ч - Ш Щ - Э - Ю - Я - za - zaa

обновление: 2020. 03. 18

© Александр Евсеев, 2003 - 2020. © Фото: принадлежит авторам, 2020