обновление: 2020. 12. 14

А - Аг -Ад - Аи - Ал - Ам - Ан - Ар - Ат

Авторы, местонахождения и минералы - в одном списке

А _ Заметки geo.web.ru/druza \ минералы + местонахождения + авторы

А - Аг- Аи - Ам - Ар - -Б - Бе - Бо - Бр - В - Г - Д - Де - Е - Ж - З - И - Й - К - Кв - Км - Кр -- Л - Ли -

М --М - Мал - Мг - Мм - Му - Н - Ни -О - П - Р - С - Ск - Ст - Т - Ти - Тр -У - Ф - Фо - Х - Ц - Ч - Ш Щ - Э - Ю - Я - - za - zaa

1234567 891011121314151617181920212223242526272829303132 - 33

26 минералов \ Страны, регионы - короткий список минералов от A до Z (26 названий)

26 минералов \ 26 минералов_Казахстан и Средняя Азия_короткий список от A до Z

30 минералов \ Регионы и месторождения России - 30 минералов от А до Я (короткий список) 

1. Адамин. Охуэла р-к, Мапими, Дуранго, Мексика. 2. Анапаит. Друза сферокристаллов. 2-ой Черноморский р-к, Керчь (р-н), Крым, Россия. Образец: ФМ (№90786. Сбор музея: Абрамов Д.В., 1986).3. Аксинит. Чегитунь, Россия. Минер. музей МГРИ - РГГРУ, №704. 12х7 см. 4. Аметрин (секториальное распределение окраски). Анаи, Санта-Крус \ Anahi, Santa Cruz, Боливия. Более 9 см. Образец: Образец: Мин. музей им. А.Е. Ферсмана РАН(ОП-2712. Белаковский Д.И., 2013). 5. 6

на карте мира: 123Россия - 4567 891011121314151617181920212223242526272829303132 - 33 -

Фото минералов и др. - смотрите страницы:

33_NW - СЕВ. АМЕРИКА (С) - Гренландия 33_N - АРКТИКА - АТЛАНТИКАИсландия - СКАНДИНАВИЯ. Кольский п-ов и Карелия - ВОСТ. ЕВРОПА - УРАЛ 33_NE - АЗИЯ (С): Ср.Сибирь - Якутия.- СВ РОССИИ - КАМЧАТКА.
33W - СЕВ. АМЕРИКА (США \ КАНАДА). Тихоокеанское побережье - Запад - Восток 33_C - Британские о-ва. Пиренейский п-ов - ЕВРОПА (центр и юг)

33_E - ЮГ СИБИРИ. ДАЛЬНИЙ ВОСТОК. Корейский п-ов - Япония

- АЗИЯ (ЮЗ) - АЗИЯ (ЦЕНТР. - Индия и Шри-Ланка.- Китай, Монголия и ЮВ АЗИЯ.

33SW -Мексика. ЦЕНТР. и Ю.АМЕРИКА(Анды) - БРАЗИЛИЯ. Уругвай. Парагвай

33_S -АФРИКА (С) - АФРИКА (ЭКВ. и ЮЖН.) - АФРИКА ВОСТ. - Индийский океан



А-авторы \\ А-автор_фото

А- Местонахождения минералов \\ http://geo.web.ru/druza/page-39.html

А - минералы

Минералогические находки по всему миру. Примеры (А) по Fleischer M., 2004, pp.12-13. Составил: А. Евсеев, 2019. \ m-min_33_sv_Flei_12_190412.jpg

Вокруг света. Минералы на "А" . Стрелками показаны (приблизительно!) районы находок образцов . Фотомонтаж: © А. Евсеев.\ m-min_33_A-fo2.jpg

A - Z - список минералов - http://rruff.info/ima/

Замечательные минералогические находки (А - минералы - примеры по листам карты мира №№1-32): 5 -авгит; 6- анапаит; 9-алабандин; 10 - аксинит; 13 - азурит; 14 - аквамарин; 16 - апофиллит; 17 - андалузит; 18 - англезит; 19 - азурит и аквамарин; 20 - алабандин; 25 - азурит; 29 - аметрин; 30 - аквамарин. Составил: А. Евсеев, 2017. \ k-33_A-min_171121.jpg

Замечательные минералогические находки (А - минералы - примеры по листам карты мира №№1-32)

Первоначальные местонахождения новых минералов, открытых на территории быв. СССР (10 примеров - аверьевит, авиценнит, азопроит, айкинит, акдалаит, аксаит, акташит, алакранит, алланит-(La), аллуайвит). Составил: А. Евсеев, 2018. Подробнее о минералах : Pekov I.V. Minerals First Discovered on the Territory of the Former Soviet Union. Moscow, OP, 1998.- 369 pp. \\ k-USSR_loc_nmin_A_Pk-98_180226.jpg

Краткий указатель минералов к томам справочника “Минералы”(т.IV-V)
Сокращения: М-5-2, 114 - "Минералы", том V, вып.2, стр. 114

Минералы: Справочник. Т. IV, вып.1. – М.: Наука, 1992.– 600 с. (= М-4-1)
Минералы: Справочник. Т. IV, вып.2. – М.: Наука, 1992.– 663 с. (= М-4-2)
Минералы: Справочник. Т. IV, вып.3. – М.: Наука, 1996.– 426 с. (= М-4-3)
Минералы: Справочник. Т. V, вып.1. – М.: Наука, 2003. – 583 с. (= М-5-1)
Минералы: Справочник. Т. V, вып.2. – М.: Наука, 2003. – 382 с. (= М-5-2)

Адуляр \\ М-5-1, 265
Акатореит \\ М-4-3, 194
Алиэттит \\ М-4-2, 248
Аллуайвит \\ М-4-3, 261
Алтисит \\ М-4-3, 416
Альбит \\ М-5-1, 136
Алюминиевый сапонит \\ М-4-2, 82
Алюминиевый сепиолит \\ М-4-2, 370
Алюмоферрихризоколла \\ М-4-2, 388
Алюмохризоколла \\ М-4-2, 388
Амазонит \\ М-5-1, 241
Аммониолейцит \\ М-5-2, 114
Амсталлит \\ М-4-3, 402
Анальбит \\ М-5-1, 129
Андезины \\ М-5-1, 472
Андремейерит \\ М-4-3, 113
Анортит \\ М-5-1, 412
Анортоклазы \\ М-5-1, 367
Апофиллит \\ М-4-2, 459
Арденнит \\ М-4-3, 187
Армстронгит \\ М-4-2, 536
Афганит \\ М-5-2, 264
Ахоит \\ М-4-2, 608

А_минералы в иллюстрациях

А-минералы - Фото

А-Г_минералы_в музее РГГРУ

Аар \ Aar (быв.) = Аре (также Ааре) - 1) река, лев. прит. Рейна 2) Аарский массив, Альпы; Швейцария \\ [кварц!!] кр-лы в полостях (до 2 м в поперечнике); микроклин!(1980л); пирротин 5C (!); флюорит!--розовые xls \\ https://de.wikipedia.org/wiki/Aarmassiv \\ на карте - см. https://www.researchgate.net/figure/Geographical-and-geological-setting-of-the-Aar-Massif-after-Abrecht-1994-showing_fig1_37439516

Аахен = Ахен (см.), Германия \\ ЕК

Абагазское = Абагасское м-ние (Fe), Аскизский район Хакасии (Россия), в 196 км к западу от Абакана, Россия \\ Минералогические находки: ильваит!!--почти моноинеральная ильваит. порода (Минералы, т.3, в.1, с.704) магнетит!; малахит!--сферолит. корки из игол. кр-лов--ФМ (№94679, Лисицин Д.В., 2014) \\ Вахрушев В.А. Минералогия, геохимия и генетические группы контактово-метасоматических железорудных месторождений Алтае-Саянской области. - М.: Наука, 1965. - 291 с. \\ 53°16'32'' с.ш., 89°36'28'' в.д - https://webmineral.ru/deposits/item.php?id=1026

Абагасское м-ние (Fe), Хакасия \\ . Минералогические находки: ильваит--почти мономинеральная ильваит. порода (Минералы, т.3, в.1, с.704) магнетит!; \\ Вахрушев В.А. Минералогия, геохимия и генетические группы контактово-метасоматических железорудных месторождений Алтае-Саянской области. - М.: Наука, 1965. - 291 с.

- Васильева А.И. О некоторых особенностях рудной минерализации в месторождении Абагасс // Геология и генезис магнетитовых месторождений Сибири. Сб-к статей. Изд. Наука. 1967. - 216 с

- Вахрушев В.А. Минералогия, геохимия и генетические группы контактово-метасоматических железорудных месторождений Алтае-Саянской области. - М.: Наука, 1965. - 291 с.

Абагайтуй = Абагайтуйское м-ние флюорита \ Abagaitui , Вост. Забайкалье, РФ; 49°42'23'' с.ш., 117°53'52'' в.д \\ барит!!--друзы; флюорит!! \\ без сульфидов! ; Смо, 348; флюорит!! \\ Расческин Е.В., 2004, 209; Болдырев А.К., 1926 \\ Пилипенко П.П., 1937 \\ М-2-1, 25, 23а) \\ ЕК

Барит. Абагайтуй, Вост. Забайкалье, Россия.. Проявляет очень яркую желтую люминесценцию. Фото: © К. Власов. \\ НМК-115

Абагасское = Абагас (=Абагазское) м-ние (Fe), Аскизский р-н, Хакассия, юг Сибири, Россия; пос. Вершина Теи \\ ильваит!!--"почти мономинеральная ильваит. порода"--М-3-1, 704; магнетит!; малахит!--сферолит. корки из игольчат. кр-лов, обр. 10 см ФМ (№94679, Лисицин Д.В., 2014) ; \\ http://webmineral.ru/deposits/item.php?id=1026

--Васильева А.И. О некоторых особенностях рудной минерализации в месторождении Абагасс // Геология и генезис магнетитовых месторождений Сибири. Сб-к статей. Изд. Наука. 1967. - 216 с.

Абаил, м-ние (Fe), 7-8 км от пос. Тюлькубас, 75 км к СВВ от Чимкента, ЮВ Каратау, Казахстан (Ю) \\ арагонит!!!

Абаилское[1] (Абайылинское) месторождение — месторождение железных руд на территории Тюлькубасского района Туркестанской области, в 15 км к северу от железнодорожной станции Абаил. Расположено на юго-восточном склоне хребта Каратау ; 42°37` с. ш. 70°27` в. д. \\ Источник: https://ru.wikipedia.org/wiki/Абаилское_месторождение

--Баталов А.Б. К минералогии окисленных руд Абаила. Ташк., 1946 \\см. также ДАН СССР, 1946, т.54, №4

Арагонит. Абаил м-ние, Ю. Казахстан. Большой штуф 36х32х22 см . Образец: ФМ(№46672.). Фото: 1) А.А. Евсеев. 2) https://www.fmm.ru/FMM_1_46672

Абак речка, Вилюйский округ, Якутия, Россия \\ галит --ГМ (СПб)

Абакан г., Хакассия, юг Сибири, Россия \\ окамен. дерево --ЦСГМ(о)

Абакан м-ние [176 км к ЮЗ от г. Абакан]., Хакассия, юг Сибири, Россия \\ М-2-3, 67--магнетитовые руды; фторпапатит--ФМ \\ РдМ-, с. 68сх-69

Абаканское м-ние, Зап. Саян, Сибирь, Россия \\ пирротин; саффлорит; фторапатит--ЦСГМ-1978

Абаканский солеваренный зав.(окр-ти), быв. Енисейская губ., юг Ср. Сибири, Россия \\ ангидрит!--"выходы с прекрасными синеват. кристаллами" (Драверт П., 1922)

Абакумова Н. Б. Зональные метакристаллы циркона и пирохлора из щелочных пегматитов Елетьозерского массива // Физика минералов и проблемы типоморфизма / Ред. И. И. Шафрановский, С. А. Руденко. Л.: Недра, 1976. С. 98-103.

Абакумова Н. Б. Щелочные пегматиты Елетьозерского массива габброидных и щелочных пород (Северная Карелия). Сов. геология, 1966, № 5.

Абанагур (Abanagur), близ Пуны, Индия \\ кавансит!!!--в туфобрекчих толеит. базальтов; D, 1997

Абанойское м-ние , р. Лопанис-цхали, бл.с. Абано, Грузия \\ доломиты! (1959)\\ ЕК

Абас-Туман = Аббас-Туман = Абастумани п., р-н Ахалцихе, Грузия \\ кварц!; стильбит!; цеолиты --Лебедев Н.И., 1901 и др; \\ ЕК

Аббот майн \ Abbott mine, округ Лейк, Калифорния, США; 39° 1' 22'' North , 122° 26' 44'' West \\ метациннабарит--ГМ-1911 \\ ЕК

Абдашт р-к (Cr) \ Abdasht , к Ю от г. Керман, Иран \\ гидромагнезит!!--xls<19 см; (1983л) \\ ЕК

Абду рудопроявление (Ni-Co), Богаинский разлом, Южн. Гиссар хр., Таджикистан \\ ЕК

Абдукагор р. , Зап. Памир, Таджикистан \\ кварц!!--в т.ч. япон. двойник 7 см. --ЦСГМ(о) \\ на карте - l-Abduka_Vanch

Кварц. Абдукагор (река и м-ние), Ванч р., Памир, Таджикистан. Образец: ФМ (№46707. Передано государством.). 36х32х18 см.. Фото: © А.А. Евсеев.\\ см. https://www.fmm.ru/FMM_1_46707 и фото

Абдуллаев, Хабиб Мухамедович. Геология шеелитоносных скарнов Средней Азии [Текст] / Х. М. Абдуллаев ; Акад. наук Узб. ССР. Геол. ин-т. - Ташкент : изд-во и тип. Изд-ва Акад. наук УзССР, 1947. - 400 с., 12 л. ил. : ил.; 27 см. Указатели главнейших геогр. названий и важнейших минералов, с. 377-81

Абдул-Абад, Иран - гемиморфит с кварцем - М-3-1, 624

Абдул-Касимовское м-ние, Башкирия, Ю. Урал, Россия \\ тальк!--ФМ(о5)

Абдуррезаги \ Abdurrezzagi, Нишапур, Маден, Иран \\ бирюза!!!--Bancroft P., 1984, 285

Абеллаит [= абельяит] \ Abellaite - новый минерал из Каталонии (Испания) \\ Ibanez-Insa J., Elvira J.J., Llovet X., Perez-Cano J., Oriols N., Busquets-Maso M., Hernandez S. (2017): Abellaite, NaPb2(CO3)2(OH), a new supergene mineral from the Eureka mine, Lleida province, Catalonia, Spain. European Journal of Mineralogy: 29: 915-922. \\ https://www.mindat.org/min-47008.html

--Юбилейная ж., Карнасурт, Ловозеро, Кольский п-ов, Россия \ Yubileinaya pegmatite, Karnasurt Mountain, Lovozersky District, Murmansk Oblast, Russia - фото - www.mindat.org \\ Касаткин А.В. Новые находки редких минералов на территории постсоветских государств. Минералогический альманах, Том 2, вып.2. 2019, стр.4- 47.

Абелсонит = абельсонит - Abelsonite Ni(C31H32N4) - новый минерал из формации Грин-Ривер, Юта, США \ WOSCO Well, Грин-Ривер формация, округ Юинта, Юта, США \  Green River formationUintah Co.UtahUSA \\ Milton, C., Dwornik, E. J., Estep-Barnes, P. A., Finkelman, R. B., Pabst, A., & Palmer, S. (1978). Abelsonite, nickel porphyrin, a new mineral from the Green River Formation, Utah. American Mineralogist, 63(9-10), 930-937 \\ Daniel R. Hummer, Bruce C. Noll, Robert M. Hazen, Robert T. Downs (2017): Crystal structure of abelsonite, the only known crystalline geoporphyrin. American Mineralogist 102, 1129-1132.

- США:  WOSCO Well, Uintah Co., Utah, USA - первоначальное местонахождение \ Type Locality

Абенаб р-к, Намибия \ Abenab Mine, Grootfontein, Grootfontein District, Otjozondjupa Region, Namibia; 19° 17' 40'' South , 18° 5' 22'' East--фд: ванадинит -9; деклуазит!!!-9фд+Gui-72; моттрамит (xls<2см)--ФМ; смитсонит-2 \\ www.mindat.org

Моттрамит. Абенаб р-к [40 км к З от Цумеба], близ Цумеба, Намибия. Образец: Мин. музей им. А.Е. Ферсмана РАН (№52577. Передано государством, 1957). Фото: А.А. Евсеев. \\ Abenab Mine, Grootfontein, Grootfontein District - http://www.mindat.org/loc-8280.htm

Экваториальная, Южная и Восточная Африка. Абенаб р-к и другие местонахождения минералов (примеры - первые на А в картотеке А. Евсеева).

Абенакиит-(Ce) \ Abenakiite-(Ce) Na26Ce6(Si6O18)(PO4)6(CO3)6(SO2)O

--Кольский регион--Борисова В.В., Волошин А.В., 2015 \\ Источник: http://discoverkola.com/mineraly

- Канада: Пудрет к-р*, Сент-Илер, Квебек \ McDonald, A.M., Chao, G.Y. and Grice, J.D. (1994), Abenakiite-(Ce), a new silicophosphate carbonate mineral from Mont Saint-Hilaire, Quebec: Description and structure determination. Canadian Mineralogist, 32, 843-854.

Абендрот, Германия \ Grube Abendrothe, St Andreasberg, Harz; 51° 42' 47'' North , 10° 30' 57'' East (est) \\ https://www.mindat.org/loc-13511.html \\ пираргирит!!--ГМ(о) --пираргирит!!--ГМ (о) \\ ЕК

Абердин (Абердиншир) графство \ Aberdeenshire, Шотландия, Великобритания \\ агат!(о)--ГГМ (МГРИ, №24162); дюмортьерит--М-3-1, 333; гиперстен!--М-3-2, 451а); феррогиперстен--М-3-2, 462а) \\ ЕК

Аберллин майн, Уэльс, Великобритания \  Aberllyn Mine, Betws-y-coed, Gwydyr Forest area, Conwy, Wales, UK \\ намууит\ Namuwite *

Абернатиит \ Abernathyite K(UO2)(AsO4) · 3H2O - https://www.mindat.org/min-3.html

--Fuemrol No. 2 mine (Fuemrole mine), Temple MountainSan Rafael District (San Rafael Swell)Emery Co.UtahUSA - первоначальное местонахождение \ Type Locality \\ абернатиит* -Thompson, M.E., Ingram, B., Gross, E.B. (1956): Abernathyite, a new uranium mineral of the metatorbernite group. American Mineralogist, 41, 82-90. http://rruff.info/rruff_1.0/uploads/AM41_82.pdf   \\  "Fuemrole" in the original literature is an obvious misnomer for fumarole.--миндат

--Deer Strike and Elk Mine,  Stanley Basin DistrictCuster Co.IdahoUSA

Абернатиит. Фьюэмроул Майн \ Fuemrole mine, Темпл Маунтин, Юта, США. Образец: Мин. музей им.А.Е. Ферсмана РАН (№88664, Обмен, 1997). Фото: © А. Евсеев

Абертами, близ Яхимова, Чехия \ AbertamyKarlovy Vary DistrictKarlovy Vary RegionCzech Republic \ Paulis, P.: Curienit z Abertam u Jachymova. Casopis pro mineralogii a geologii, 1992, roc. 35, c. 1, s. 55-65. \ реферат

Кюрьенит. Абертами, близ Яхимова - 1-я находка в Чехии (1992). \\ НМК-162

Абеширо р-к, преф. Аомори, Япония \\ лепидокрокит в пиритсод. желваках среди глин - М-2-3, 544

Абзаковское м-ние хризотил-асбест, Ю. Урал, Россия \\ ЕК

Абзалов М.З., Полежаева Л. И. Сульфоарсениды в породах продуктивной толщи Печенги (Кольский полуостров) // ЗВМО, 1989. № 4. С. 64-73.

Абзелиловский р-н, Башкирия, Ю. Урал \\ золото!!--xls--Смолин А.П.,1970. с.80

Абидос м-ния, Австралия \\ гадолинит - в гальках...--М-3-1, 415 \\ ЕК

Абикью оз. \ Abiquiu,, Нью-Мексико, США \\ агат--в 30 км к ЮЗ от оз. Абикью (1980л) \\ ЕК

Абиндадрема (Abindadrema), Мадагаскар \\ ибонит! \\ ЕК

Абиркатиб р-к \ Abirkatib mine, Al Bahr al Ahmar, Wilayah, Судан \\ актинолит; альбит; золото; кварц; хлорит; эпидот--mindat

Абитиби. зеленокамен. пояс, Канада \\ ЭПГ в сульфидной минерализации (1990л) \\ родингиты \\ ЕК
Абитиби, пегм. пров. , Онтарио\ Квебек, Канада \\ Ш, 45

Абихит = клиноклаз (КМС) \\ Меднорудянск, Ниж. Тагил, Ср. Урал, Россия

Або (быв.) - Турку (ныне), Финляндия \\ альмандин!--ГМ-1911(о); "бонсфордит" (изменен. кордиерит) - ГМ -1911 (о4) ; ломонтит(1857л и др.) ; неотокит\\ ЕК

Абовянское (Капутанское) м-ние (Fe), у ЮЗ окраины с. Капутан, Армения \\ магнетит-апатитовые жилы; апатит!--крупные удлинен. кристаллы [ могут быть сравнимы с образцами Лебяжинского рудника или Кируновары] ; магнетит--Киракосян Т.А., 1979 (л) \\ Геол. Арм. ССР, 1967, т.6, с.63-67 \\ ЕК

Абрамов Г.Ю.

Абрамов Д.В.

1. Г.Абрамов и др. Володарск-Волынский, Украина. 1968 г. 2. Д.В. Абрамов (справа) на уч-ке "Е" Керченского м-ния (бл. п. Приозерный, Крым, Украина). 1987.06.25. Фото 1-2: А. Евсеев.

Абрамов Ф.И., Данилов С.Д., Крутов Г.А. Минералого-петрографический очерк Никитовского ртутно-сурьмяного месторождения. М.: ГНТГГИ, 1932. 132 с.

Абрамовит* \\ Abramovite Pb2SnInBiS7 \\ Кудрявый вулк., о. Итуруп, Курильские о-ва, россия \ Kudriavy volcano, Iturup Island, Kuril Islands, Sakhalin Oblast, Russia \\ https://ru.wikipedia.org/wiki/Абрамовит

--Юдовская М. А., Трубкин Н. В., Копорулина Е. В., Белаковский Д. И., Мохов А. В., Кузнецова М. В., Голованова Т. И. Абрамовит Pb2SnInBiS7-новый минерал из фумарол вулкана Кудрявый (Курильские острова). - Зап. РМО, 2007, ч.136, вып. 5, с. 45-51 \\

--M. A. Yudovskaya, N. V. Trybkin, E. V. Koporulina, D. I. Belakovsky, A. V. Mokhov, M. V. Kuznetsova & T. I. Golovanova, Abramovite, Pb2SnInBiS7, the new mineral from fumaroles of Kudryavy volcano (Kurily Islands). // Abstract in American Mineralogist (2009), 94, 1075.

Абрамович Ю.М. и др. Аутигенный флюорит в кунгурских отложениях Пермского Приуралья. - ДАН СССР, 1960, 135, 2, 415-415

Абрамовка р., Приморье, Россия --тантал сам. - Bern-04 \ Bernard, 2004, 687

Абруд (Абрудбанья) город и админ. центр, расположенного поблизости золоторудного района, Румыния \ Abrud (Abrudbanya; Gross-Schlatten; Abruttus), AlbaRomania - https://www.mindat.org/loc-146858.html \\ Abrud is a town and an administrative center of nearby gold mining. 
The Rosia Montana (Verespatak) locality is nearby.

Абсарока Рейндж \ Absaroka Range [к В от Йеллоустонского нац. парка], Вайоминг, США \\ лейцит!

Абсвурмбахит \ Abswurmbachite \

- Греция:  Myli (Mili) *(TL) \\  Apikia (Apoikia)* (TL) \\ Reinecke, T., Tillmanns, E. & Bernhardt, H.-J. (1991): Abswurmbachite, Cu2+Mn3+[O8/SiO4], a new mineral of the braunite group: natural occurrence, synthesis and crystal structure. Neues Jahrbuch fur Mineralogie Abhandlungen, 163, 117-143.

- Япония: Sanbagawa metamorphic belt --Enami, M., & Banno, Y. (2001). Partitioning of Sr between coexisting minerals of the hollandite-and piemontite-groups in a quartz-rich schist from the Sanbagawa metamorphic belt, Japan. American Mineralogist, 86(3), 205-214.

---Iyomishima, Shikokuchuo CityEhimeJapan \\ The Mineral Species of Japan (5th ed) Matsubara \\

Абу Али ибн Сина (Абу Али Хусейн ибн Абдаллах ибн Сина) (980- 1037), крупнейший ученый средневековья, известный на Западе как Авице?нна \\ https://ru.wikipedia.org/wiki/Ибн_Сина

Абу-Галага р-к \ Abu Ghalaga Ilmenite Mine, Восточная пустыня, Египет \\ ильменитовые руды- - https://mrdata.usgs.gov/mrds/show-mrds.php?dep_id=10079520 \\ мин-гия и ген. ильмен.руд--Basts E.Z., 1968; \\ ЕК

Абу-Даббаб\ Abu Dabbab , Египет \\ вольфрамит--Bernard, 2004, 687

Абужа \ Abuja, Abuja Capitol Territory, Нигерия--штольцит! --GEM

Абуит* - новый минерал р-ка Хиномару, преф. Ямагути \\ Enju, S. & Uehara, S. (2017): Abuite, CaAl2(PO4)2F2, a new mineral from the Hinomaru–Nago mine, Yamaguchi Prefecture, Japan. Journal of Mineralogical and Petrological Sciences, 112, 109–115

Абукума плато (Abukuma), преф. Фукусима, Япония \\ пьемонтитсод. сланцы --минералогия--(1993л) РЖ "Геология" - 4В401-1994

Абукума хр. (Abukuma Range), преф. Фукусима, Япония \\ абукумалит-Y = бритолит-(Y)*; манганортит--в пегматитах --Hata S., 139 \\ М-3-1, 763

Абукумалит = бритолит-(Y) \ Britholite-(Y) (КМС) (Y,Ca)5(SiO4)3OH

--Вюнцпахк, Кейвы, Кольский п-ов, Россия \ West Keivy Block, Western Keivy Massif, Keivy Mountains, Lovozersky District, Murmansk Oblast, Russia --фото

--Сахарийок м-в, Кольский п-ов, Россия \\ ЕК

Абу-Хайн, Ливия \\ целестин

Абхурит \ Abhurite - новый минерал из Саудовской Аравии \ Sharm Abhur CoveJiddah (Jeddah)Mintaqah MakkahSaudi Arabia

--Matzko, J.J., Evans, H.T., Jr., Mrose, M.E., Aruscavage, P. (1985) Abhurite, a new tin hydroxychloride mineral, and a comparative study with a synthetic basic tin chloride. The Canadian Mineralogist: 23: 233-240.

--Dunkle S E, Craig J R, Rimstidt J D, Lusardi W R (2003) Romarchite, hydroromarchite and abhurite formed during the corrosion of pewter artifacts from the Queen Anne's Revenge (1718). The Canadian Mineralogist 41, 659-669 http://rruff.info/rruff_1.0/uploads/CM41_659.pdf

Абчада р., Сев. Прибайкалье, Россия \\ ФМ: берилл; приорит; эвксенит \\ пегматиты с амазонитом, гадолинитом, циннвальдитом; фергюсонитом и др. \\ Е.И. Семёнов \\ ЕК

Берилл (кристалл более 10 см) на кварце. Абчада, Сев. Прибайкалье, Россия. Образец: Минер. музей МГРИ-РГГРУ (Дар: Е.Б. Соловьёв, 2018.03. Его находка 1985 г.). Фото: © А.А. Евсеев

Абшир (Абширское) м-ние (Sb, флюорит), верх. р. Абшир, на сев. склоне хр. Кичик-Алайского хр., к В от Чаувая, Ю. Фергана; Киргизия; 40° 9' 35'' c.ш. , 72° 21' 49'' в.д. (Wikimapia)\\ антимонит!--до 15 см; барит--"розы"; флюорит!--кристаллы и друзы \\ Моргенштерн Л.Е. и др... Узб. геол. ж., 1971 , №6, 48-54

Ава \ Ava (район), Мьянма (быв. Бирма) \\ аквамарин!!; иридий, Pt-стый!--М-1-1, 49; шпинель!!

Авала гора , 15 км к ЮВ от Белграда, Сербия \\ каломель--1) 1) фото 2) прекрасные xls<10 мм--Dana, 1997; киноварь!; ртуть!

Авам р., р-н Норильска, Ср. Сибирь \\ датолит! \\ЕК

Аванг Пангкал, Калимантан о.(Борнео о.) \\ золото (микро) в породе --ФМ(№80126)

Авансолерудник, Ереван, Армения. 

Галит. Авансолерудник, Ереван, Армения. Образец: Геолого-минерал. музей МГОУ (№3290. Сборы ГК). Фото: © А.А. Евсеев.

Авант, округ Гарленд, Арканзас \ Avant, Garland Co., США; 34° 38' 45'' North , 93° 20' 23'' West - https://www.mindat.org/loc-3404.html \\ вавеллит!!; варисцит!!--171 ф


Авантюрин. [Таганай], Ю. Урал. Россия. Образец: Минер. музей РГГРУ (Р-934 ). Фото: © А.А. Евсеев

Авантюрин-лабрадор \\ Паромовка, Волынь, Украина \\ ЕК (л)

Аваруа зал., Нов. Зеландия \ близ Awarua Bay, New Zealand находится первоначальное местонахождение аваруита - Gorge River, Westland District, West Coast Region, New Zealand ; 44° 11' 20'' South , 168° 18' 18'' East \\ "Originally arawuite was found in stream sediments in this river, derived from a belt of serpentinised ultramafic rocks in the Red Hills, in which it occurs in situ (Rodgers and Hey, 1980)".

Type locality for awaruite. The mineral was named after the Awarua River, or the Awarua Bay it flows into, however the species is not found in either site.

Аваруит \ Awaruite \ Ni3Fe \ https://www.mindat.org/min-439.html

- Россия: Бобровка р., гора Соловьёва, Ср. Урал, Россия (1913л)

----Лапта-Пай р., [б-н р. Мокр. Сыня], Пол. Урал, Россия--(Савельева Г.Н. и др.,1970л)

- Нов. Зеландия: Горж Ривер, Вестланд Дистр., Южный о., Нов. Зеландия \ Gorge River, Westland District, West Coast Region, New Zealand ; 44° 11' 20'' South , 168° 18' 18'' East---3 фото (mindat.org) \\ Originally arawuite was found in stream sediments in this river, derived from a belt of serpentinised ultramafic rocks in the Red Hills, in which it occurs in situ (Rodgers and Hey, 1980)". \\ аваруит*

---- Skey, W. (1885) Article LXL - On a New Mineral (Awaruite) from Barn Bay. Transactions and Proceedings of the New Zealand Institute, Vol 18, pp 401-402.

---- Rodgers, K.A., Hey, M.H. (1980) On the type locality and other occurrences of awaruite (FeNi?) in Westland, New Zealand. Mineralogical Magazine, 43:329, pp 647-650.

- США: Орегон-- Josephine Creek placers, Josephine Creek Mining District, Josephine Co., Oregon, US - лучшие и самые крупные образцы в мире (до 2,5 см кг) \\ There are a lot of awaruite localities on the Earth, but Josephine Creek placers produce the best and largest known (up to 2.5 kg nuggets) its specimens. Источник: www.mindat.org

---- South Fork Smith River, Klamath Mts, Del Norte Co., California, USA --фото

Аваруит. Калифорния, США. Образец: Геолог. музей им. А.А. Штукенберга (№6832), Казанский ун-т. Фото: © А.А. Евсеев

--Базылев Б. А., Аваруит (Ni3Fe)-содержащая метаморфическая ассоциация в мантийных перидотитах из зоны разлома 15°20' (Атлантический океан): первая находка в океанической литосфере, Юбилейная сессия Ученого Совета ГЕОХИ, Тезисы докладов молодых ученых, c. 15-16, ГЕОХИ, Москва, 1997а.

--Базылев Б.А. Развитие аваруитсодержащей минеральной ассоциации в перидотитах из зоны разлома 15°20' (Атлантический океан) как одно из проявлений океанического метаморфизма. - Рос. журнал наук о Земле, 2000, Т. 2, № 3. \\ http://geo.web.ru/db/msg.html?mid=1162742&uri=part17.htm

Первоначальное местонахождение \ Type Locality аваруита (Горж Ривер, Вестланд Дистр., Южный о., Нов. Зеландия) и место находки (Josephine Creek placers, Орегон, США) его самых лучших и самых крупных образцов (до 2,5 кг) - по https://www.mindat.org/gallery.php?loc=4064&min=439

Авача вулк., Камчатка, Россия \\ алуноген; вольтаит@; гейландит; сассолин; сера \\ Заварицкий А.Н., 1977 \\ ЕК

Авгит \ Augite (CaxMgyFez)(Mgy1Fez1)Si2O6 \ фото mindat -558 фото из 34 стран мира (2020.09)

- Мексика: La Panchita Mine, La Panchita, La Pe Municipality, Oaxaca, Mexico --фото


--Пай-Хой \\

--Сухая гора, Верх-Нейвинский зав., Ср. Урал \\ ЕК

--Пышминско-Ключевское м-ние, Ср. Урал \\ ЕК


- Испания: Montana Ayosa, Tenerife, Santa Cruz de Tenerife Province, Canary Islands, Spain - фото

Чехия: Боржислав

- Vlci hora, Cernosin, Tachov District, Plzen Region, Czech Republic ; 49° 48' 45'' North , 12° 51' 34'' East --авгит!! -- 17 фото

Авгит (кристаллы до 1,5-2 см). Пашкаполе\Paskapole, Боржислав, Чехия. Образец: Мин. музей им.А.Е. Ферсмана РАН (№49516). 2. Авгит. Парайнен (быв. Паргас), Финляндия. Образец: Мин. музей им. А.Е. Ферсмана РАН (№26067, Иосса В.А., 1917). Фото 1-2: © А.А. Евсеев.

1. Авгит. Сидар-Бьютт \ Cedar Butte, Орегон, США. Образец: Минер. музей РГГРУ (Р-1744). Более 2 см. 2. Авгит (кристаллы до 2-3 см) из туфов Восточно-Африканского рифта. Образец: ФМ (№91248. От Петрографического музея ИГЕМ РАН. Дар, 2002). Фото 1-2: © А.А. Евсеев

--Старый карьер у пос. Донское, Волновахский р-н, Приазовье--xls \\ Гнездо земляной осы, построенное из кристаллов авгита и микроклина. В пегматоидном сиените. Пеков И.В., Пекова Н.А. \\ #1695 (ФМ-MY)

Авдеевит \ Avdeevite  (Na,Cs)(Be2Li)Al2(Si6O18)  - новый минерал из группы берилла \\ первоначальное местонахождение \ Type Locality -
 Palelni mine ("Kat Chay mine"), Khetchel village (Cache village; Khat Che village), Molo quarter, Momeik Township, Kyaukme District, Shan State, Myanmar \\ Agakhanov, A.A., Stepanenko, D.A., Zubkova, N.V., Pekov, I.V., Pautov, L.A., Kasatkin, A.V., Karpenko, V.Y., Agakhanova, V.A., Skoda, R. and Britvin, S.N. (2019) Avdeevite, IMA 2018-109. CNMNC Newsletter No. 47, February 2019, page 199; European Journal of Mineralogy, 31: 199–204

Авдонин Владимир Николаевич|

В.Н. Авдонин и Г.Ф. Анастасенко (справа). Санкт-Петербургский ун-т, 2005. Фото: А.Евсеев

Авдонин, Андрей Валерьевич, кандидат геолого-минералогических наук, 2005, Москва. Глобальные широтные линеаменты и их значение для палеотектонических реконструкций: На примере каледонид Северного Тянь-Шаня - https://www.dissercat.com/content/globalnye-shirotnye-lineamenty-i-ikh-znachenie-dlya-paleotektonicheskikh-rekonstruktsii-na-p

--Авдонин А.В., Долгинов Е.А. Глобальные широтные линеаменты и их значение для оценки общей структуры, развития и геодинамики Земли. – М.: 2004, 100с.


--Пеков И.В.Кривовичев С.В.Чуканов Н.В.Япаскурт В.О.Сидоров Е.Г -- Авдонинит: новые данные, кристаллическая структура и уточненная формула K2Cu5Cl8(OH)4•2H2O . - Записки Российского минералогического общества, 2015, 144, № 3, с. 55-69

--Ядовитая, фумарола, Толбачик вулк., Камчатка 2) Блява, м-ние, Ю. Урал, Россия \\ Чуканов Н. В., Мурашко М. Н., Задов А. Е., Бушмакин А. Ф. Авдонинит K2Cu5Cl8(OH)4·Н2О - новый минерал из вулканических эксгаляций и зоны техногенеза колчеданных месторождений. - Зап. РМО, 2006, т.135, №3, с. 38-41.

--Германия \\ Grona Mine, BernburgStassfurt Potash DepositSaxony-AnhaltGermany \\ Witzke, T. (2012): Gillardit, Cu3Ni(OH)6Cl2, und Avdoninit, K2Cu5Cl8(OH)4 • H2O, zwei Neufunde von Bernburg, Sachsen-Anhalt. Aufschluss 63, 209-211.

Авейрон, Франция \\ вивианит!!--xls--Музей Высш. горн. школы(Париж) (1864л) \\ нет фото в mindat \\ ЕК

Аверьевит  Cu5O2(VO4)2·n(Cs,Rb,K)Cl
Установлен в продуктах фумарольной деятельности на Северном прорыве Большого трещинного извержения (1975-76 гг) вулкана Толбачик, Камчатка. Встречен в виде черных шестиугольных пластинчатых кристаллов до 0.3х0.1 см в ассоциации с пийпитом, теноритом и др. [757].Название: в честь Валерия Викторовича Аверьева (1929-1968), вулканолога, специалиста в области геотермии вулканических областей; Институт вулканологии, Петропавловск-Камчатский.TS: PMM 2102/2. \\ Источник: Pekov, I. (1998) Minerals First discovered on the territory of the former Soviet Union 369p. Ocean Pictures, Moscow

Авес о., Карибское море; Венесуэла \ Aves IslandNueva EspartaVenezuela \\ брушит*; на острове добывалось гуано

Авзянская свита \\ А.В. Маслов Л.В. Анфимов АВЗЯНСКАЯ РУДОНОСНАЯ СВИТА СРЕДНЕГО РИФЕЯ ЮЖНОГО УРАЛА (литостратиграфия, условия образования, минерагения) г \\ флюорит--Русская платф (вост. часть) (л) \\ ЕК \\ https://docplayer.ru/56805206-Avzyanskaya-rudonosnaya-svita

Авикая \ Avicaya, Боливия \\ Avicaya Mines (Totoral Mines), Monserrat-Antequera districtPaznaPoopo Province,Oruro DepartmentBolivia \ https://www.mindat.org/loc-146874.html \ 18° 30' S, 66° 53' W \\ дерев. олово!!--ФМ

"Авиларгус \ Avilargus"(очевидно, ошибочное назв.) = Colquechaca (Aullagas), Боливия --канфильдит*

Авимор \ Aviemore, Waimate Distr., Южный о., Нов. Зеландия \\ ЕК

Авиретх-Криндж \ Awireth-Krinj, Читраль, Пакистан \\ GAMERITH H. Antimony, Gold and Polymetallic Deposits of the Awireth-Krinj Area, Chitral/Pakistan --читать - http://www.zobodat.at/pdf/MittNatVerSt_120_0155-0165.pdf \\ ЕК

Ависжарфик \ [= Auvaitsersarfik, Nuuk (Godthab), Гренландия \ www.mindat.org \\ сапфирин!--в гнейсах--М-3-2, 581 \\ ЕК

Ависсавелла \ Avissawella, Western Province, Sri Lanka ; 6° 57' 31'' North , 80° 11' 55'' East \\ корунд --д.к.!!- добыча--mindat

Авиценнит \ Avicennite . Tl2O3
Найден в 1956 г Х.Н.Карповой в образцах из древних выработок близ кишлака Джузумли в Зирабулакских горах, в 25 км к юго-западу от ж/д станции Зирабулак, Самаркандская обл., З.Узбекистан. Образует мелкие (до десятых долей мм) черные с буровато-серым оттенком кубические кристаллы, похожие на кристаллы перовскита, в массе полосчатого лимонита в карбонатных жилах среди известняков [238,277].
Название: в честь Авиценны (Абу Али ибн Сина, 980-1037), таджикского естествоиспытателя, философа и врача, автора книги о минералах, работавшего в Бухаре и в Иране.
TS: FM vis5689
. \\ Источник: Pekov, I. (1998) Minerals First discovered on the territory of the former Soviet Union 369p. Ocean Pictures, Moscow

- Карпова Х.Н., Конькова Е.А., Савельев В.Ф., Ларкин Э.Ф. Авиценнит - новый таллиевый минерал. Докл. АН УзССР, 1958, 2, стр. 23-25

- Россия: Хохойское рудное поле. Рудопроявление Хохой расположено в бассейне верхнего течения одноименного ручья, правого притока р. Амга. 

- Гренландия, Дания: Илимауссак

1. Авиценнит. Лукаут-Пасс \ Lookout Pass, Юта, США. Образец: Минер. музей им. А.Е. Ферсмана РАН (№90166). \\ ср. Thallium Prospect, Little Valley, Tooele Co., Utah, USA --www.mindat.org. . (Егоров К.Ф., 1955.). Фото: © А.А. Евсеев

- США : Карлин м-ние, Невада, США \\ Radtke, A. S., Dickson, F. W. and Slack, J. F. (1978): Occurrence and formation of avicennite, Tl2O3, as a secondary mineral at the Carlin gold deposit, Nevada. J. Res. U.S. Geol. Surv. 6, 241-246.

Авняшевка рч, ("к С от Миасса"), Южн. Урал, Россия \\ гематит!; колумбит ("менгит"); корунд!!; топаз!--xls; циркон! --ГМ(СПб)

Авник \ Avnik, Вост. Турция, м-ние магнетит-апатитовое \\ ЕК \\ Huseyin Celebi, Cahit Helvac and Ali Ucurum; 38° 39' 0'' North , 40° 19' 59'' East ; по карте - 350 км к З от Дашкесана (Азербайджан) \\

--Helvaci, C. (1984) Apatite-rich iron deposits of the Avnik (Bingoel) region, southeastern Turkey. Economic Geology, 79(2), 354-371.

АвогадритМ-2-1, 15 – рис. кр-ла—Везувий*--фумаролы

Авогадрит, малладрит. Везувий, Италия. Образец: Минер. музей им. А.Е. Ферсмана РАН (Егоров К.Ф., 1955.). Фото: © А.А. Евсеев.

Авока клейм, Брит. Колумбия, Канада \ Avoca claim, Bonaparte River, Lillooet Distr. \\ бонаттит--ф; пуатвенит \ poitevinite*(1964л) \\ ЕК

Авренско-Маджаровский рудный пояс, Болгария (1989л) \\ ЕК

Аврора майн = Орора майн, Невада, США \\ аурорит \ aurorite--North Aurora mineSummit areaTreasure HillSilver BeltWhite Pine DistrictWhite Pine Co.,NevadaUSA

Авроринский прииск, [г. Соловьёва], к ЮВ от Нижний Тагила, Ср. Урал, Россия \\ золото!; жедвабит*; платина!!

Авроринское м-ние, Нижнетагильский дунитовый массив, [г. Соловьёва], к ЮВ от Нижний Тагила, Ср. Урал, Россия \\ платина!!; поликсен!-М-1-1, 51(а) ; цинк - М-1-1, 57 \\ см. Минералы Урала, 1990, с.31 -- изоферроплатина--в дунит. пегматитах--куб. кристаллы, сростки, зерна и самородки


Австралия в www.mindat.org

минералы - 1451

новые минералы - 174

фото минералов - 13394

на 2019.07.18

Новая Зеландия в www.mindat.org

минералы - 455

новые минералы - 13

фото минералов - 1687

на 2019.07.12


Австралия. Местонахождения минералов (примеры). Составил: А. Евсеев. 2018.02.13 \\ Аделаида Майн, Дундас - крокоит!!!; англезит!! -Guillemin,1964,53;:гиббсит+дундасит*!! \\ Аргайл р--к-алмаз!!!--роз! \\ Брокен-Хилл--родонит!!!--ф-Тус-17; родохрозит!; церуссит!!-80фд; галенит!; леграндит!--ф \\ Воджина \ Wodgina--бобьерит; воджинит*; колумбит -(Mn)!!-фд;танталит-(Mn)-2фд; ферроколумбит; "крупн.в мире ист-к танталита в 20 в." \\ Калгурли-алтаит; золото!!; колорадоит;креннерит-ФМ; кулсонит, Ti-стый (л), томичит*; теллуриды! \\ Кубер-Педи--опал по беле мнитам!!\\ Малбунка --азурит!!! \\ Burra Burra--атакамит; медь!! \\ Dimbulah--висмут!!--РГ--ф; молибденит!!--ф \\ Greenbushes Sn placers-- сподумен!!--2фд; стибиотанталит*; тапиолит-(Fe);холтит*; холмквистит--mindatl \\ Marlborough \ Мальборо--хризопраз!!\\ Rum Jungle, 8 км к С от Batchelor--малахит!

--Новые минеральные виды, впервые описанные из Австралии \\ Sutherland F. L. Mineral species first described from Australia and their type specimens. // Australian Journal of Mineralogy. 2000, V. 6. No. 2. P. 104-128.

-- Australia! - Mineralogical Record, 1988, Vol. 19, No. 6 \\ специальный. выпуск журнала

Австралия \ карта и минералогические находки

Австралия_МН-4_местонахождения минералов

Австралия_минералогические особенности

Австралия (С) - с.202 в книге Евсеев А.А. Атлас мира для минералога. М., 2004. - 284 с.

Австралия (ЮВ) - с.203 в книге Евсеев А.А. Атлас мира для минералога. М., 2004. - 284 с.

Виктория - с.204 в книге Евсеев А.А. Атлас мира для минералога. М., 2004. - 284 с.

Западная Австралия (С) - с.205 в книге Евсеев А.А. Атлас мира для минералога. М., 2004. - 284 с.

Западная Австралия (Ю) - с.206 в книге Евсеев А.А. Атлас мира для минералога. М., 2004. - 284 с.

Квинсленд - с.207 в книге Евсеев А.А. Атлас мира для минералога. М., 2004. - 284 с.

Тасмания - с.208 в книге Евсеев А.А. Атлас мира для минералога. М., 2004. - 284 с.


Австралия (Центр)_15°Ю-125°В

Замечательные минералогические находки Австралии (примеры). Малахит. Хризопраз. Дравит. Азурит. Благородный опал. Золото. Родонит. Крокоит. Фото: М. Аносов, Д. Тонкачеев, А. Евсеев и др. \\ НМК-149

АВСТРИЯ \\ фото минералов - 21119 (на 2018.12.24) \ https://www.mindat.org/loc-14279.html

Арагонит ("железные цветы"). Эрцберг \ Erzberg, Штирия, Австрия. Образец: Музей ест.истории (Вена). Фото: © В.И. Дворядкин.

Автомобиль, дороги, минералы

В.И. Степанов (слева), В. Москалев и А. Ефимов у сломавшегося ГАЗ-51. Краснодарский край. 1977.08.16. Фото: А. Евсеев.

Авторы и публикации по минералогии (зарубежные)_A-Z - авторы от A до Z (примеры)+


Галенит. Автоэпитаксия мелких октаэдров на грани {100} крупного кристалла. Джоплин, Миссури, США. Образец: Мин. музей им.А.Е. Ферсмана РАН (№87612. Обмен 1992). Фото: © А.А. Евсеев.

Из публикаций

2 - авгит







аваруит; авгит


абернатиит; авиценнит




авгит; авогадрит; арагонит





арагонит; горн.хрусталь


барит; берилл




19 -моттрамит

20 - авгит

Фотографии минералов на этой странице по регионам 1-32 (2020.10)

А - Аг -Ад - Аи - Ал - Ам - Ан - Ар - Ат

А _ Заметки geo.web.ru/druza \ минералы + местонахождения + авторы

А - Аг - Аи - Ам - Ар - Б - Бе - Бо - В - Г - Д - Де - Е - Ж - З - И - Й - К - Кв - Км - Кр -- Л - Ли -

М - Мал - Мг - Мм - Му -- Н - Ни - О - П - Р - С -- Ск - Ст - Т - Ти - Тр - У -Ф -- Фо - Х - Ц - Ч - Ш Щ - Э - Ю - Я

СТРАНЫ от А до Я

находки минералов по листам карты мира: 1234567 891011121314151617181920212223242526272829303132 - 33



А - Б - В - Г - Д - Е - Ж - З - И - К - Л - М - Н - О - П - Р - С - Т - У - Ф - Х - Ц - Ч - ШЩ - Э - Ю - Я

местонахождения минералов - | - mineral localities : А Б В ГДЕ Ж З И Й К Л М Н О ПР С Т У Ф Х Ц ЧШ Щ Э Ю Я || A B C D E F G H I J K L M N O P R S T U V W X Y Z
№104 №112
2014 №114
№126 №131
№163 №166
2020 №193

Кристаллы пяти континентов

Заметки - А - Б - В - Г - Д - Е - Ж - З - И - Й - К - Л - М- Н -О - П - Р - С - Т - У -Ф - Х - Ц - Ч - Ш Щ - Э - Ю - Я - za - zaa

обновление: 2020. 12. 14

© Александр Евсеев, 2003 - 2020. © Фото: принадлежит авторам, 2020