обновление: 2020. 10. 20

местонахождения А Б В ГДЕ Ж З И Й К Л М Н О ПР С Т У Ф Х Ц ЧШ Щ Э Ю Я || A B C D E F G H I J K L M N O P R S T U V W X Y Z \\ регионы мира: 1234567 891011121314151617181920212223242526272829303132 - 33 || Россия \ Европа \ Азия \ Африка \ Австралия \ Северная Америка \ Южная Америка \

ВСЕ КАМНИ МИРА195 - В ДВЕ СТРОКИ

или НОВЫЙ МИР КАМНЯ \ ОКТЯБРЬ, 2020

Заметки на geo.web.ru/druza

От А до Я

№104 №112
2014 №114
№126 №131
№146
№163 №166
2020        

Замечательные минералогические находки восточного полушария (примеры).

1. Плюмбомикролит. Плоская г., Кейвы, Кольский п-ов, Россия. ~8-9 см. Образец: ФМ (№81181, Волошин А.А., 1981).
2. Повеллит (кристалл более 1 см). Нижняя Тунгуска р. (б-н), Ср. Сибирь, Россия. Образец:ФМ (экспозиция "Кристаллы"). 
3. Поллуцит. Шенгус \ Shengus, Скарду, Пакистан. Образец: Тусон-шоу-2009.
4. Повеллит на апофиллите. Район Насик \ Nasik (или Джалгаон\ Jalgaon ?), Махараштра шт., Индия. Образец: И.В. Пеков.
5. Перидот (ограненная вставка). Зебергед о., Красное море; Египет. Образец: ФМ.
6. [Перидот] Оливин с Cr-диопсидом (ксенолит в базальте). Виктория шт., Австралия. Образец: ФМ (колл.: Годовиков А.А.). Фото 1-2, 4-6: © А.. Евсеев.

 

МИНЕРАЛЫ и не только на druza: А - Б - В - Г - Д - Е - Ж - З - И - К - Л - М - Н - О - П - Р - С - Т - У - Ф - Х - Ц - Ч - ШЩ - Э - Ю - Я \\ Алфавитный список минералов (на geo.web.ru/druza)

см.на www.mindat.org \ A-B-C-D-E-F-G-H-I-J-K-L-M-N-O-P-Q-R-S-T-U-V-W-X-Y-Z

Минералы от A до Z - список IMA (Международной минералогической ассоциации)- http://pubsites.uws.edu.au/ima-cnmnc/

Комиссия по новым минералам, номенклатуре и классификации - http://pubsites.uws.edu.au/ima-cnmnc/ \\ The Commission on New Minerals, Nomenclature and Classification (CNMNC) of the International Mineralogical Association (IMA) was formed in July 2006 by a merger between the Commission on New Minerals and Mineral Names (CNMMN) and the Commission on Classification of Minerals, at the request of both commissions

Алфавитный список_ минералы: от А до Я (на русском языке) - более 4000 минералов ( 4976 страниц категории "Минералы") на http://wiki.web.ru/wiki/ \\ http://webmineral.com/Alphabetical_Listing.shtml

Все минералы мира (от A до Z) \ All Minerals of the World / Tous les mineraux de la terre http://euromin.w3sites.net/mineraux/accueil.html

Алфавитный список_ минералы от A до Z (на английском языке) и фото минералов - http://www.mineralatlas.com/ \\ фото минералов - http://www.cs.cmu.edu/~adg/adg-home.html (на сайте Alan Guisewite ) Список минералов - http://en.wikipedia.org/wiki/List_of_minerals

20-09-06

А

Авгит \\

Агат \\

1. Халцедон, выполняющий трещины разрыва в вариолитовом риолите. Каненмывеем, Чукотка. Более 10х10 см. Образец: Мин. музей им. А.Е. Ферсмана РАН (№83259. Полянцев, 1985). 2. Азурит. Конкреция с частичным замещением азурита малахитом. [очевидно, Попутное (Cu) месторождение] Сев. Казахстан. Образец: Мин. музей МГРИ (Р-3232. Дар: Соловьев Е.Б.). Более 7 см. Фото 1-2: © А.А. Евсеев.

Агреллит \ Agrellite NaCa2Si4O10F

- Россия: Мурунский м-в, СЗ Алдан, Вост. Сибирь, Россия

- Канада:  Kipawa alkaline complex, Les Lacs-du-Temiscamingue, Temiscamingue RCM, Abitibi-Temiscamingue, Quebec, Canada - первоначальное местонахождение \ Type Locality

- Таджикистан: Дара-и-Пиоз, Таджикистан \ Дара-и-Пиоз, Алайский хр., Таджикистан \\ Семенов Е.И., Дусматов В.Д. Агреллит – первая находка в СССР. - Минерал. Таджикистана (Душанбе), 1989, №8, с.3-5.

1. Агреллит. Мурунский м-в, СЗ Алдан, Вост. Сибирь, Россия. Образец: НЗМЛ (№14219. Дар: Н. Владыкин). 2. Агреллит. Дара-и-Пиоз, Таджикистан. 6х5 см. Образец: Мин. музей РГГРУ (Р-375. Пост. 2009 г.). 3. Агреллит, эвдиалит. Кипава м-в, Квебек, Канада. 4х2,5 см. Образец: Минер. музей РГГРУ ( Р-994. Евсеев А.А., 2011.07.23). Фото 1-3: © А.А. Евсеев.

Адамин \\

Адуляр \\ Азурит \\ Аквамарин \\ Аксинит \\

Алмаз \\

Альбит \\

1. Альбит (клевеландит ), мусковит. Минас-Жерайс, Бразилия. Более 10 см. Образец: Образец: ФМ (№87792. Приобретение на ярмарке, 1990 г.). 2. Гранат (альмандин) в породе. Станция Прогресс, оазис Ларсеманн-Хиллс = Ларсеман-Хиллс \ Larsemann Hills, Prydz Bay, Вост. Антарктида . Образец: Минер. музей МГРИ (Р-764. Дар: Калинин А.Г.). Фото 1-2: © А.А. Евсеев.

Альманах . Среди минералов М., 2001. – 196 стр. Оглавление

Альмандин \\

Амазонит

2

6

 

Фотографии минералов (и рис.) на странице - Ам - (http://geo.web.ru/druza/e-Am.htm) по регионам (2020.10)

Аметист \\ Амфиболы

Анальцим \\ Анатаз

Андрадит \\

-Япония: Kohse mineTenkawa villageYoshino districtNara PrefectureJapan -31 фото!

Анортит \ Anorthite --https://www.mindat.org/min-246.html

Антимонит

Апатит-(CaF) \ Apatite-(CaF) - наиболее обычный (распространенный) минерал в группе апатита.

Апофиллит \\

Арагонит \\ Арсенопирит \\

Астрофиллит

Аурипигмент

Б

Бабингтонит

Базы данных: http://www.mindat.org/ \\ http://webmineral.com

Барит \\

1. Барит. а) Гарц, Германия. б) Махув, Польша \ Machow, Tarnobrzeg, Польша. Минералы-спутники: Сера.
Поступил в музей в 1988 году. Витрина exp5-5 . 2. Барит. Сполука р-к, Болгария (№61778. Дорфман М.Д., 1960). Образцы: ФМ Фото: А. Евсеев.

Берилл

Бериллий_минералы \\ Библиография (популярные издания о камнях)- http://basik.ru/forum/index.php?showtopic=77

Библиотеки --РОССИЙСКАЯ ГОСУДАРСТВЕННАЯ БИБЛИОТЕКА--http://search.rsl.ru/ru

Бирюза

Бисмутотанталит \ Bismutotantalite Bi(Ta,Nb)O4

- Уганда:  Gamba Hill, Busiro Co. (Bushiro Co.), Wakiso, Central Region, Uganda; 0° 30' North , 32° 10' East (est.) - первоначальное местонахождение \ Type Locality - 5 фото (все фото для всего мира на 2020.10)

1. Бисмутотанталит. Синьцзян, Китай. Образец: Мин. музей им.А.Е. Ферсмана РАН (№66200, 1964). 2. Битовнит. Кратер Маникоуаган \ Manicouagan, Квебек, Канада. Более 8 см.Образец: ФМ (№73131. Erling D.L.,1970). Фото 1-2: © А.А. Евсеев.

БитовнитBytownite

Бор_минералогия и геохимия \ Борнит \\ Брошантит \\ Брукит

Буланжерит

В -

Вад - смесь порошковатых, рыхлых оксидов и гадроксидов марганца (КМС)

Вазы из поделочного камня

Ванадинит \ Vanadinite Pb5(VO4)3Cl \ более 3200 фото - www.mindat.org/gallery, из них более 2000 фото ванадинита из рудного района Мибладен - Mibladen mining district, Midelt Province, Draa-Tafilalet Region, Morocco ; 32° 46' 0'' North , 4° 37' 59'' West

- Марокко: Taouz, Errachidia Province, Draa-Tafilalet Region, Morocco

Ванадинит. Мибладен, Марокко. Кристаллы до 4 см. Образец: ФМ (№86087. Обмен с R. Triebl, 1988). Фото: © А.А. Евсеев.

- США: Apache Mine, Radium, Globe-Miami Mining District, Gila Co., Arizona, USA

Варисцит

Веб-сайт

-- http://petrographica.ru

Везувиан \\ Вивианит

Викимапия \ Wikimapia (карты мира и России)

Виллиомит \\

Включения в минералах и драг. камнях

Вторая находка минерала в мире

ВУЛКАНЫ \ минералогические находки

Вульфенит

Выставки минералов и поделочных камней

--ЗАНИМАТЕЛЬНАЯ МИНЕРАЛОГИЯ” В КАМНЕ ...Подробнее (pdf)

Г -

Галенит \\

Галит

Галогениды

Гематит

Геммы

- Неверов О.Я. Геммы античного мира

Генезис минералов

--Попов В.А. Практическая генетическая минералогия. - Екатеринбург: УрО РАН, 2011.- 167 с.

Геовикипедия \ GeoWiki Всё о геологии - http://wiki.web.ru/

Гётит \\

Гигантские и крупные кристаллы (индивиды) \\ См.: А.Е. Ферсман. Величина природных кристаллов // Природа, 1925, № 10/12, стлб. 103; его же. Кристаллы-гиганты и монолиты-гиганты // Природа, 1926, № 3/4, стлб. 86—88; его же. Пегматиты. Т. I. Гранитные пегматиты. M.—Д., 1940.

Гидроксилапатит \ Hydroxylapatite \ https://www.mindat.org/min-1992.html

Гипс

Глендонит

Горная энциклопедия - http://www.mining-enc.ru/ \\ http://dic.academic.ru/contents.nsf/enc_geolog/

Горный хрусталь \\

--Буканов В. В. Горный хрусталь Приполярного Урала. Л. Наука, 1974. 212 с.

--Костелов Н.П., Шатнов Ю.А. Хрусталеносные месторождения России и стран СНГ. - Александров, 2005. - 250 с.

Графит

Гроссуляр

Д

Данбурит \\ Датолит

Двойники \\ http://folk.ntnu.no/krill/mineralogee/8.htm \

Гипс. Сдвойникованные по типу "ласточкин хвост" кристаллы. Кальтанисетта, Сицилия, Италия. 1951. Высота более 20 см. Образец: ФМ (№52873. витрина exp5-6). Фото: А. Евсеев.

Дельхайелит \ Delhayelite (Na,K)10Ca5Al6Si32O80(Cl2,F2,SO4)3 · 18H2O

- Россия: Хибины!!! \\ фото: Кировский р-к \ Kirovskii apatite mine, Kukisvumchorr Mt, Khibiny Massif, Murmansk Oblast, Russia \\ Юкспор г. \ Yukspor Mt, Khibiny Massif, Murmansk Oblast, Russia \\ Коашва \ Koashva Open Pit, Koashva Mt, Khibiny Massif, Murmansk Oblast, Russia

 

- Италия: Пьян-ди-Челле, вулкан \ Pian di Celle Volcano, San Venanzo , Marsciano , Terni Province , Umbria , Italy \\ Шарыгин В.В. ДЕЛЬХАЙЕЛИТ ИЗ ПЕГМАТИТОВ ХИБИНСКОГО МАССИВА И ДЕЛЬХАЙЕЛИТОПОДОБНЫЙ МИНЕРАЛ ИЗ МЕЛИЛИТОЛИТОВ ВУЛКАНА ПИАН ДИ ЧЕЛЛЕ (САН-ВЕНАНЦО, ИТАЛИЯ). \\ http://geo.web.ru/conf/alkaline2002/abstracts/sharigin2.html

- ДР Конго: Шахеру г.*, Ньирагонго, вулк., Сев. Киву, ДР Конго \ Mount Shaheru, Nyiragongo VolcanoNyiragongo TerritoryNorth KivuDR Congo ; 1° 28' 59'' South , 29° 13' 59'' East--- Первоначальное местонахождение \ Type Locality \\ дельхайелит* \\ Sahama, T.G., Hytonen, K. (1959) Delhayelite, a new silicate from the Belgian Congo. Mineralogical Magazine: 32: 6-9.

Демантоид \\ Дендриты

Детский мир камня

--Геологическая школа МГУ -- О полевых практиках и экспедициях

--Школьный факультет РГГРУ - МГРИ \\ 60-летие - http://docplayer.ru/189496-60-let-shkolnomu-fakultetu-mgri-rggru-1947-2007-legendy-i-mify-shkolnogo-fakulteta.html \\

--Клуб юных геологов им. академика В.А. Обручева (Санкт-Петербург) - http://www.anichkov.ru/departments/lyceum/geology

--Ферсман А. Е. Путешествия за камнем. М. 1960 (веб-публикация) :

--Ферсман А.Е. Занимательная минералогия \\ читать

Диопсид

1. Диопсид. Тимптон, Алдан, Ю. Якутия, Россия. Образец: Геологический музей им. В.В. Ершова МГГУ. Слева направо: Т.Б. Здорик , Т.В. Дубровская. 2. Диопсид (виолан). Зернистый сиреневый агрегат. Сан-Марчель \ St Marcel, Val d'Aosta, Piemonte, Италия. Более 9 см. Образец: Мин. музей им.А.Е. Ферсмана РАН (№49493, ГИГХС, зап. 1950). Фото 1-2 © А. Евсеев, 2018.

Диоптаз -в фотографиях на странице http://www.mindat.org/min-1295.html Photos of Dioptase - 1958 фото на 2019.05. Из них:

--всего по два фото диоптаза из Европы (Италия - Cape Calamita Mine) и Австралии

--Казахстан - 215; ДР Конго - 127; DR Congo США - 292 ; Republic of Congo (Brazzaville) - 319 ; Намибия - 892 (из них 579 - Цумеб)

Доломит

Дравит

Драгоценные камни (д.к.)—литература о них (по минералам): http://www.geol.msu.ru/departments/mineral/Rus/Edu/deposit_liter_r.htm \\ списки месторождений по минералам (сост. И.А. Бакшеев) - http://www.geol.msu.ru/departments/mineral/Rus/Edu/deposits_r.htm

--Горная энциклопедия - о д.к.

--Пыляев М. И. «Драгоценные камни, их свойства, местонахождения и употребление» \\ http://www.vadim-blin.narod.ru/book/titl.htm \\ указатель (быстрый поиск по ключевым словам) - http://www.vadim-blin.narod.ru/book/glossary.html

Драгоценные камни (самоцветы)_география находок

--Генетическая минералогия драгоценных камней (лекции Э.М. Спиридонова) - http://spiridonov.mineralog.com/

Дымчатый кварц

Е -

Еремеевит - http://www.mindat.org/min-2090.html; фотографии: 52 фото (2008.09) \ 190 фото на 2018.04 - http://www.mindat.org/gallery.php?min=2090

Ж

Жадеит \\

Живопись в камне

Журналы для минералогов и коллекционеров \\ The Mineralogical Record, \\ Rocks & Minerals \\ Le Regne Mineral \\ Mineraux et Fossiles \\ Lapis \\ Mineralien Welt \\ Rivista Mineralogica Italiana \\ Revista de Minerales \\ MineralUp\\ Bocamina \\ UK Journal of Mines and Minerals

З

Закономерные срастания \\

Занимательная минералогия. По страницам знаменитой книги А. Е. Ферсмана Занимательная минералогия. Источник: https://www.e-reading.club

Знаменитые местонахождения минералов (от Конгсберга до Ору-Прету)

Золото

И -

Изумруд \\ Ильваит \\ Ильменит

Индивиды и агрегаты

--Годовиков А.А., Степанов В.И. Формы нахождения минералов. М. 2003. \\

--Макагонов Е.П.Симметрия сростков минеральных индивидов. Наука 1991

Интернет - минералогия \\ http://geo.web.ru/druza \\ https://webmineral.ru \\ https://www.mindat.org

Искусственные кристаллы \ минералы

Исландский шпат

История минералогии ( находки, открытия и др.)

- Харькив А. Д. , Зинчук Н. Н. , Зуев В. М. История алмаза. - М. : Недра, 1997. - 601 с.

- Годовиков А. А. Краткий очерк по истории минералогии. М.,1998. - 162 с.

История открытий

--Данилевский В.В. Русское Золото. История открытия и добычи до середины XIX в. 1959. - 380 с.

К -

Кавансит

Календари с минералами

Кальцит.

Камень в городе

--Книжная полка минералога \ камни на книжной полке

Камералка минералога \\

Каолинит

Карбонаты

Карта мира - http://maps-of-world.ru/inter.htm \\ http://geography_atlas.academic.ru/

Картирование, минералогическое

Картотека местонахождений минералов, начатая А. Евсеевым в 1967 г., насчитывает сегодня более 100 тыс. названий. Она строится по региональному принципу, внутри крупного региона местонахождения расположены по алфавиту. Для местонахождений приведены ссылки на литературу, авторов, образцы в собраниях музеев. Материалы картотеки используются в публикациях автора, на сайте http://geo.web.ru/druza/ и др.

Е - Ж - З - названия (минералы, местонахождения, авторы). Список на 2017.07

Карты \\ http://www.marshruty.ru/ \\ http://wikimapia.org/country/ \\ http://www.openstreetmap.org/ \\ http://ru.wikipedia.org/wiki/OpenStreetMap-- Карты мира, стран и городов - http://planetolog.ru/ \\ http://mapper.infomine.com/ \\ http://www.veslo.ru/maps.html \\ http://www.maphill.com

--http://wikimapia.org/

--карта мира и минералы (фото) - http://fotki.yandex.ru/users/ilm/map/view/recent

--реки (бассейны) -- http://www.riversnetwork.org/rbo/

Касситерит \\

--Разновидность касситерита - "Деревянистое олово"

Каталоги минералогических коллекций

Кварц \\ публикации - http://www.quartzpage.de/info_lit.html -- Экспресс-опрос -2011 (кварц) (на ответ давалось 2-3 мин. )

--Кварц по странам мира - http://www.mindat.org/mesg-95-139699.htm

 

1. Кварц. Скрученный кристалл. Пуйва, Прип. Урал, Россия (№89214. Романоа Д.А., Евсеев А.А., 1988). 2. Кварц. Индукционная штриховка. Парнук м-ние, Прип. Урал, Россия. (№46487. Трест №13, 1949). Образец 1-2: Минерал. музей им. А.Е. Ферсмана РАН. Фото: © А. Евсеев. \\ НМК-195

 

Киноварь \ Cinnabar \ https://www.mindat.org/min-1052.html - фото: весь мир - 1445 ; Китай - 370 (пров. Гуйчжоу - 244, из них Тонгрен - 129) \\ Испания - 233 (из них Альмаден - 158) \\ \\ Образцы киновари на витринах Мин. музея им. А.Е. Ферсмана РАН - https://fmm.ru/Киноварь

Клинохлор \\

Книжная полка минералога и коллекционера

--http://www.crystalclassicsminerals.com/books.php

Коллекционирование минералов

Степанов В.И. Шкала качества образцов (разработана им в 1970-ые гг.)

-- http://www.strahlen.org/

Колумбит \\ Группа колумбита - танталита \\ Справочник "Минералы" \\ М-2-3, с.303- 322

Конкреции \\ Кораллы \\

Кордиерит \ Cordierite (Mg,Fe)2Al3(AlSi5O18) - более 300 фото

- Норвегия: Cordierite occurrence, Sondeled, Risor, Aust-Agder, Norway - фото!!

- США : Richmond Soapstone Quarry, Richmond, Cheshire Co., New Hampshire, USA - фото

- Антарктида - Wilkes Land, Eastern Antarctica, Antarctica - фото (3 мм)

Корунд \\ сайт, посвященный корунду - http://www.corunduminium.com/index1.html

Кремень \\

Кридит

Кристаллы

Кристаллы и сростки рекордных размеров и др.

 

Крокоит \ Crocoite PbCr6+O4

- Россия: Березовское м-ние, Ср. Урал \ Berezovsk deposit, Beryozovsky, Sverdlovsk Oblast, Russia --фото

- Австралия: Adelaide Mine, Dundas mineral field, Zeehan District, West Coast municipality, Tasmania, Australia --фото

Крупные образцы минералов (рекордные размеры)

Куплетскит \\ Kupletskite - https://www.mindat.org/min-2290.html - 45 фото (2019.02).

Куприт

Л -

Лабрадор

Лабрадорит. Кристаллы-лапилли. Выброшены при извержении 1976 г.Южный прорыв БТТИ, вулкан Толбачик, Камчатка, Россия. Дар. Миронов С.М., 2015.

Лазулит \ Lazulite MgAl2(PO4)2(OH)

Лазурит

Лампрофиллит \ Lamprophyllite \ https://www.mindat.org/min-2315.html - 35 фото (2019.01)

Левин-(Ca) \ Levyne-Ca - https://www.mindat.org/min-7154.html \\ Весь мир - 103 фото : Исландия-1; Фареры-2; Чехия-7; Италия-13 (Сардиния-7) \\ Индия-1; Япония-1 \\ Австралия - 3; Нов. Зеландия-4 \\ США - 71 (Орегон - 70)

Лёд \\ http://www.mindat.org/min-2001.html \\ фотогалерея

Линарит \\ Лироконит

Литература о минералах и драгоценных камнях \\ Из публикаций о минералах зарубежных стран \\ Из публикаций о минералах России, а также СССР

Наша библиотека - Геологический музей им. В.В.Ершова - http://ershov-geomuz.narod.ru/libr.htm

Литература по геологии в бибиотеке ДВГИ ДВО РАН. \\ http://wiki.fegi.ru/index.php/

Лопарит

Лоренценит

Любители камня

Люминесцирующие (флюоресцирующие минералы) - тема выставки выставки Минер. музея им.А.Е. Ферсмана РАН

М -

Магнетит \\ Малахит

Марки \\ минералы на марках - Minerals on Stamps

Медь и минералы меди

Месторождения

Метеориты

- Иванов А.В., Ярошевский А.А., Иванова М.А. Минералы метеоритов – новый каталог // Геохимия. - 2019. - Т. 64. - №8. - C. 869-932. doi: 10.31857/S0016-7525648869-932 \\ текст - https://journals.eco-vector.com/0016-7525/article/view/15885

Метро и камень

Микроклин

Миндат.орг\ www.mindat.org - - крупнейшая база данных о минералах и местонахождениях. Её основатель - Джолиан Ральф \ Jolian Ralf .

Евсеев А.А. Минералогические находки (примеры). IV. Зарубежные страны (без республик быв. СССР). М., 2016. - 256 с.

Минералогический альманах (на сайте )

Минералогический альманах (на русском . яыке) - http://www.minbook.com/mineralogical_almanac_ru.html \

-- Mineralogical Almanac - http://www.minbook.com (на англ. яз.) - на английском языке \ Mineralogical Almanac (Россия \ Russia)

-- В мире минералов. Минералогический Альманах, том 21, выпуск 1, 2016. Подробнее..

-- Минералогический Альманах, том 22, выпуск 2, 2017 - оглавление

Минералогия_для студентов (фото минералов и рисунки кристаллов)- http://geoserv.krc.karelia.ru/geo/rus/ht

Минералогические словари

-- Кривовичев В.Г. Минералогический словарь - http://bibl.gorobr.ru/book/248/book.html (веб-публикация) \\ также - на сайте - http://mmus.geology.spbu.ru/programm

Минералогия

--Бетехтин А.Г. 'Курс минералогии' - Москва: Государственное издательство геологической литературы, 1951 - с.543 --веб-публикация

--Корбел П. и Новак М. . МИНЕРАЛЫ. Иллюстрированная энциклопедия. М.: "Лабиринт Пресс", 2004. - 296 с.

Минералы_список от А до Я - Википедия

МИНЕРАЛЫ (справочник) ------- http://www.geokniga.org/collections/3607 \\ т.2, вып.2

--Силикаты–справочник  краткий указатель - http://geo.web.ru/druza/m-miner_A-Ya_sil.htm  

--Минералы. Справочник. Том 3. Выпуск 1. Силикаты с одиночными и сдвоенными кремнекислородными тетраэдрами. Содержание

Минералы - спутники на расстоянии \\ Евсеев А.А. Минералы - спутники на расстоянии (2): Отдельные статьи Горного информационно-аналитического бюллетеня. - №12. - М.: Издательство "Горная книга", 2009. - 35 с.

МИР КАМНЯ \ WORLD OF STONES - научно-популярный журнал, посвященный минералогии \ Содержание журнала №№ 1-12 за 1993 – 1997 гг

Мозаика

Молибденит

Монацит

--Overstreet, W.C. (1967) The geologic occurrence of monazite. USGS Professional Paper 530: 114-118. \\ читать - https://pubs.usgs.gov/pp/0530/report.pdf

Морфология минералов

М у з е и

Степанов В. И. МИНЕРАЛЬНЫЕ ВИДЫ, ХРАНЯЩИЕСЯ В КРУПНЕЙШИХ МИНЕРАЛОГИЧЕСКИХ МУЗЕЯХ СССР . В кн. Старейшие минералогические музеи СССР.— М.: Нау­ ка, 1989.— Вып. 25.— 239 с. Очерки по истории геологических знаний. , стр.154-233. \\ читать - http://ginras.ru/library/pdf/1989_history_geology_issue25.pdf

--http://www.exmu.ru

Старейшие минералогические музеи СССР. - М.: Наука, 1989. - Вып. 25. - 239 с. Очерки по истории геологических знаний.

--В сборнике помещены материалы, освещающие историю создания и развития трех старейших минералогических музеев СССР, основанных в XVIII веке и ныне превратившихся в крупнейшие широко известные во всем мире собрания минералов. Проводимая таблица содержит полный перечень минеральных видов, хранящихся в этих музеях. Публикуемые фотографии наиболее интересных образцов способствуют лучшему восприятию текста. Книга предназначена для минералогов и историков науки, а также для самого широкого круга любителей камня. \\ Источник: https://fmm.ru/Издания

World Directory of Mineral Collections (Second Edition) Pieter C. Zwaan; Ole V. Petersen . Published by Commission on Museums of the International Mineralogical Association,, Copenhagen, 1977

Россия

- Список геологических музеев России - -http://webmineral.ru/museums/

- Естественно-научный музей Ильменского государственного заповедника \\ Адрес: 456317, Челябинская область, г. Миасс, Ильменский заповедник   - http://www.museum.ru/M3104

- Москва и область

--Екатеринбург

--Новосибирск \\ "В Центральном сибирском геологическом музее, который основан в июле 1958 года, есть образцы из 50 стран мира и всех регионов России. В коллекции около тысячи видов минералов видов, а общее количество экспонатов — около 20 тысяч." \\ Источник и подробнее - https://ria.ru/nsk/20131110/975805317.html

-- Санкт-Петербург \\

----Горный музей

----Санкт-Петербургский ун-т \\ Начало...

--Севастополь. Севастопольский музей камня \\ "В настоящее время музей располагает выставочной площадью 100 квадратных метров, в экспозиции представлено более 3000 экземпляров". Подробнее о музее

Болгария. "Национальный музей "Земля и Люди" является минералогическим музеем в центре Софии. Это один из крупнейших минералогических музеев во всем мире. Датой его основания считается 30 декабря 1985 года, а открыт для посещения он был в июне 1987 года. Инициатором создания музея был доктор наук Михаил Малеев. Музей расположен в оригинальном старинном и реконструированном здании, построенном в конце XIX века (1896-1898 год). Общая площадь музея составляет около 4 000 кв. м". Источник: https://www.rutraveller.ru/place/14261

Германия

Италия

--Неаполь_ Королевский минералогический музей в Неаполе - Real Museo Mineralogico - http://www.cmsnf.it/real-museo-mineralogico/

Китай

--Пекин. Геологический музей. Bancroft,P, Zhengzhi,H and Furui,W (1987) The Peking geological museum, China. Mineral.Record 18, 325-332.

Ливан

МИМ музей (минералогический), Бейрут, Ливан \\ Мим Музей - частный [минералогический] музей в Бейруте, Ливан. В музее более 2000 образцов, представляющих 450 различных видов из 70 стран. Он считается сегодня одной из самых значительных частных коллекций минералов в мире. Создатель музея - Салим Эдде \ Salim Edde, ученый, химик, педагог, коллекционер минералов. Музей был открыт 12 октября 2013 года в присутствии почетных гостей, включая президента Ливана. Подробнее: https://en.wikipedia.org/wiki/Mim_Museum

--репортаж Петера Ликберга - https://www.mindat.org/article.php/1807/The+MIM+Museum+opening%2C+Lebanon \\

--видеорепортажи: (7.36) https://www.youtube.com/watch?v=JKDsSHLu7pE \\ часть 1 (21.48)- https://www.youtube.com/watch?v=StatGGnqyY8 \\ часть 2 (24.43) - https://www.youtube.com/watch?v=qc28tOlGuvI

США

Франция.

--Париж. Национальный музей естественной истории ( фр. Museum national d'histoire naturelle - один из старейших в мире \\ Подробнее. В него входит Минералогическая галерея ( фр. Galerie de Mineralogie et de Geologie). Особая достопримечательность музея - коллекция гигантских кристаллов кварца из Бразилии \\ Подробнее_Википедия \\ http://www.museum-mineral.fr/home.php# \\

-- Минералогическая галерея. Национальный музей естественной истории_Париж. Франция.

1. Минералогическая галерея. Национальный музей естественной истории_Париж. Франция. 2. Родохрозит. Поперечный срез группы сталактитов. Капильитас, Катамарка, Аргентина. Высота более [60 см]. Образец: Национальный музей естественной истории, Париж. Фото 1-2: © Д. Тонкачеев.

--Париж.  l'Ecole des Mines \ Музей высшей горной школы http://www.musee.mines-paristech.fr/Accueil/ \\ фотогалерея- http://www.musee.mines-paristech.fr/Galerie/Photos/

Мусковит

Названия и привязка местонахождений минералов

Названия минералов

--Имена минералов. Как их называют Леенсон И.А. («Химия и Жизнь», 2012, №1) \\ веб-публикации: \\ Имена минералов. Как их называют январь №1 \\ Кто открыл, кто синтезировал? - февраль №2 \\ Петрологи, геологи, минералоги, кристаллографы - март №3 \\ Химики, физхимики и один математик - апрель №4 \\ Еще немного химиков и физхимиков - №5 \\ Космонавты, коллекционеры, поэты - №6

" Происхождение названия “иригинит" \ Iriginite (UO2)Mo2O7 · 3H2O , ” не имеет аналогов в истории минералогии - это название ничего не означает! Автор описания, Г.Ю.Эпштейн (персональное сообщение), дала минералу такое название просто потому, что ей понравилось звучание этого слова. TS: PMM 1257/2" \\ Источник: Pekov I.V. Minerals First Discovered on the Territory of the Former Soviet Union. Moscow, OP, 1998.- 369 pp

Митчелл Р.С. Названия минералов. Что они означают? - М.: "Мир", 1982. - 248 с.

Натролит

Недра - http://www.rosnedra.com/

Немалит (разновидность брусита)

Нефелин

Нефрит

Новые карты для минералога -

--Нов. карты 2019.07.01

--Нов. карты 2019.05.12-строки

Новые книги и публикации \\ см. также www.minbook.com/02.12.2016.(авторы со своими новыми книгами)

Новые минералы

Новые поступления в Мин.муз. им. А.Е. Ферсмана РАН

Нортупит

О

Облицовочные камни \\

Обсидиан

Одноимённые местонахождения

Окаменелое дерево

Окенит \\

Окно (камень у окна)

Оксиды

1. Кремень. [Илжа] Польша. 2. Опал, огненный. Близ м-ния Кара-Агач, Сев. Казахстан. (Дар: Спиридонов Э.М., 1963). Образец 1-2: ФМ Фото: © А.А. Евсеев.Образец: ФМ.

 

Онтогения минералов

Опал

Определение (диагностика) минералов

Ортоклаз

Осумилит \ Osumilite - 143 \ 163 фото (2019.04 \ 2020.09) - https://www.mindat.org/min-3039.html

- Россия : Челябинский буроугольный бассейн, Челябинская область, Южный Урал, Россия \\ Сокол Е.В. Новый генетический тип проявлений осумилита. - ЗРМО. 1997. Часть 126. Вып. 4, стр. 43-53 \\ Seryotkin, Y. et al. (2008): Pyrometamorphic osumilite: occurence, paragenesis, and crystal structure as compared to cordierite, European Journal of Mineralogy, Vol. 20, pp. 191-198

- СССР: Богданова Н.Г., Тронева Н.В., Заборовская Н.Б. и др. О первой находке метаморфического осумилита в СССР // Докл. АН СССР, 1980, т. 250, № 3, с. 690-693.

- Япония: Саккабира \ Sakkabira, Япония \  Sakkabira, Kagoshima Prefecture, Japan - первоначальное местонахождение \ Type Locality --Proc.Japan Acad.(1953) 29, 321-323 \\ Образец: ФМ (№69134. Sakurai I., 1966)

- Италия: Funtanafigu Quarry, Marrubiu, Oristano Province, Sardinia, Italy --фото

- Канада: Лабрадор \\ Berg, J., Wheeler, E.P. (1976): Osumilite of deep-seated origin in the contact aureole of the anorthositic Nain complex, Labrador, American Mineralogist, Vol. 61, pp. 20-37

Отенит \ Autunite Ca(UO2)2(PO4)2 · 10-12H2O \\ 888 фото (2020.09)

- Португалия: - Assuncao Mine, Aldeia Nova, Ferreira de Aves, Satao, Viseu, Portugal --фото

- Италия: Bric Colme, I Cardin, San Giacomo, Roburent, Cuneo Province, Piedmont, Italy --фото

- Франция: La Commanderie mine, Treize-Vents, La Roche-sur-Yon, Vendee, Pays de la Loire, France --фото

Открытки с камнем

Охотскит\ Okhotskite Ca2Mn2+Mn3+2[Si2O6OH][SiO4](OH)2(OH) \\ минерал назван по Охотскому морю, расположенному близ места его первой находки

- Япония: Охотскит - новый минерал из р-ка Кокурики, о. Хоккайдо, Япония \ Kokuriki mine, Kitami City, Okhotsk Subprefecture (Abashiri Province), Hokkaido Prefecture, Japan - первоначальное местонахождение \ Type Locality \\ Togari, K. & Akasaka, M. (1987): Okhotskite, a new mineral, a manganese ion(3+)-dominant member of the pumpellyite group, from the Kokuriki mine, Hokkaido, Japan. Mineralogical Magazine 51, 611-614.

- Россия: Аскизский руд. р-н, Хакассия, юг Ср. Сибири \ Askiz ore district: Chapsordag deposit \\ Malosyrsky deposi

- Италия: Valgraveglia Mine (Gambatesa Mine), Monte CopelloReppiaNeGenoaLiguriaItaly \\ Identification by EDS and PXRD as reported by Anatoly Kasatkin \ диагн. - А. Касаткин

П

Пегматиты \\ Ферсман А.Е. Пегматиты. М.: Изд-во АН СССР, 1940. Т.1.

Пейзажный камень

Первая находка минерала в быв. СССР и России

Первоначальные местонахождения \ type localities

--Евсеев А.А. Географическая привязка первоначальных местонахождений минералов. - Новые данные о минералах. М.: Экост, 2002. Вып. 38, c. 113-124

Переименования (географических названий)

Перидот \ хризолит

- США: Peridot Mesa (Peridot occurrence 38), San CarlosSan Carlos Indian ReservationGila Co.ArizonaUSA ; 33° 19' 49'' North , 110° 29' 35'' West \\ Это место было описано как наиболее продуктивное местонахождение в Сев. Америке \ This site has been described as the most productive peridot locality in North America.

--Koivula, John (1981), San Carlos peridot, Gems and Gemology: 17: 4: 205-214

--Hadnott B.A., Ehlmann B.L. and Jolliff B.L. (2017) Mineralogy and chemistry of San Carlos high-alkali basalts: Analyses of alteration with application for Mars exploration: American Mineralogist 102, 284-301. (individual microprobe analyses of all phases in the basalt plus a photo of the outcrop.)

Оливин (хризолит \ перидот) [в базальте]. Перидот-Меса, Сан-Карлос Резервация, округ Хила, Аризона, США. Образец: Мин. музей МГРИ (Р-1587). Фото: © А.А. Евсеев.

Перовскит \\ Песок и минералы россыпей \\ Петалит

Пещеры

Пирит!!

Пирит. 1. Амбасагуас, Логроньо, Испания. 2. Березовск, Ср. Урал, Россия. Образцы: ФМ. Фото: © А.А. Евсеев.

Пироморфит \

Пироп \\ http://www.mindat.org/min-3321.html \\ фото (27) - www.mindat.org \\

Пирротин \ Pyrrhotite Fe1-xS \\ 882 фото - www.mindat.org/gallery(2020.08)

Плагиоклазы\\ \\ альбит \\ анортит \\ беломорит \\ клевеландит \\ лабрадор \\

Повеллит

Поделочные камни \\ Полевые шпаты \\

Поллуцит

Cerny, P. , 1989. Поллуцит из протерозойских петалитсод. пегматитов Утё, Швеция \\ РЖ "Геология"-7В288-1990 г. \\ ЕК \\ см. также Pollucite from Uto Mines, Uto, Haninge, Stockholm County, Sweden - https://www.mindat.org/locentries.php?p=3194&m=3255

Породообразующие минералы

Пренит - http://www.mindat.org/min-3277.html \\ фото (1002) - http://www.mindat.org/gallery.php?min=3277 - на 2009.05.27

Преподавание минералогии

Псевдоморфозы \\ фотогалерея - http://www.mineralatlas.com/specials/pseudo.htm

--The Mineral News, 2004-2007 \\ Указатель публикаций по авторам \ местонахождениям \ минералам

Р

Радхакришнаит* \ Radhakrishnaite (TL) PbTe3(Cl,S)2

- Россия: Октябрьский р-к, Норильск, Ср. Сибирь, Россия \ Oktyabrsky Mine, Talnakh Cu-Ni Deposit, Noril'sk, Putoran Plateau, Taimyr Peninsula, Taymyrskiy Autonomous Okrug, Krasnoyarsk Krai, Russia - фото

--- Панаречка, Кольский п-ов \ Panarechka volcano \ Чернявский, А. В., Волошин, А. В., & Войтеховский, Ю. Л. (2013). ЗОЛОТОРУДНЫЕ ПРОЯВЛЕНИЯ ПАНАРЕЧЕНСКОЙ ВУЛКАНО-ТЕКТОНИЧЕСКОЙ СТРУКТУРЫ, КОЛЬСКИЙ РЕГИОН: ТИПЫ МИНЕРАЛИЗАЦИИ. МАТЕРИАЛЫ МЕЖДУНАРОДНОЙ КОНФЕРЕЦИИ, 197.

- Индия:* Champion lode, Central Schist Belt, Kolar Gold Fields, Kolar District, Karnataka, India (Type Locality) \\ Genkin A D, Safonov Y G, Vasudev V N, Rao B K, Boronikhin V A, Vyalsov L N, Gorshkov A I, Mokhov A V (1985) Kolarite PbTeCl2 and radhakrishnaite PbTe3(Cl,S)2, new mineral species from the Kolar Gold Deposit, India, The Canadian Mineralogist, 23, 501-506

- Китай: Dongping Mine, Dongping Au-Te ore field, Shuiquangou Complex, Chongli District, Zhangjiakou, Hebei, China

Разнообразие минералов Софийский симпозиум

Реальгар \ Realgar As4S4 \\ 936 фото - mindat (2020.09)

- Румыния: No. 5 Mine, Baia Sprie, Maramures, Romania --фото

- Швейцария: Lengenbach Quarry, Fald, Binn, Goms, Valais, Switzerland --фото

- Китай: Jiepaiyu Mine, Shimen deposit, Shimen Co., Changde, Hunan, China --фото

Региональная минералогия (заметки)

Р-коллекция \\ В феврале 2008 г. в Минералогическом музее РГГРУ (Москва) были записаны первые образцы в новую тематическую коллекцию "Региональная и всемирная минералогия" (сокращенно - Р-коллекция)

Резной камень \\ Рисунок и живопись в камне \\ http://www.minrec.org/artmuseum.asp

Рисунки минералов

Родонит \\

Брусницын А.И. Минералогия месторождений поделочных родонитовых пород Среднего Урала // ЗВМО, 1998. № 3. С. 1–11.

Родонит, кварц. Сан-Мартин р-к, Чиуруку, Анкаш деп. \ San Martin mine, Chiurucu, Ancash Dep., Перу. Образец: Мюнхен-шоу. 2018. Фото: © Автор West. Источник: http://webmineral.ru/

Родохрозит \\

Рутил

С - Се - Ск - Со - Ст

Самородные элементы

Сапфир

"Сборные" минералов по странам и регионам (10-15 избранных находок) \\ 1-е -в 2007 г .

Селен \\  http://www.mindat.org/loc-30078.html \\ фото селена - http://www.mindat.org/gallery.php?loc=30078

Селенит (разн. гипса) \\

Сера \\ Серандит \\

Серебро \\ silver - mindat --фото (1189), местонахождения (3716) -- на 2009.11.15

Силикаты от А-Я_краткий указатель к справочнику "Минералы"(том.III-V)

Симметрия в геологии, минералогии и не только

Скипетровидные кристаллы (в том числе обратные скипетры аметиста \ reverse sceptre из Боливии ( Esperanza Mine, near Bombori, Nor Potosi Province, Potosi Department) \\ http://www.mindat.org/ \\ http://www.mindat.org/photo-284819.html

Словари

--Кривовичев В.Г. Минералогический словарь.- СПб.: Изд-во С.-Петерб. ун-та, 2008. - 556 с. --СЛОВАРЬ МИНЕР. ВИДОВ - веб (В.Г. Кривовичев. Словарь минеральных видов. СПб, 2006)

--ГЕОЛОГИЧЕСКИЙ СЛОВАРЬ (включает раздел "МИНЕРАЛОГИЯ")

Смитсонит \\ Сода \\ Содалит \\

Спессартин \\ Сперрилит

Список минералов - http://en.wikipedia.org/wiki/List_of_minerals

Сподумен и его разновидности (кунцит, гидденит)

Справочник "Минералы"_краткий указатель к томам IV-V

Справочники

Ставролит

Ставролит выбран в 1976 г. минералом-символом шт. Джорджия (США)

Сталактиты и псевдосталактиты \\

Стеллерит \\ Стильбит \\ Стихтит \\ Сугилит \\

Сфалерит

Сферокристаллы --см. http://geo.web.ru/db/msg.html?mid=1179562. \\ Сферокристаллические сферолиты - http://geo.web.ru/db/msg.html?mid=1175869

Сферолиты

Т -

Тальк - распределение по странам фотографий (279) талька на сайте www.mindat.org -- см. карту http://geo.web.ru/druza/k-33_talc_fd_171014.jpg

Типоморфизм \\ Титанит

Толбачит \\ https://www.mindat.org/min-3990.html

Топаз \\

Топонимика (интересная для минералога) \\ Мурзаев Э.М. Словарь народных географических терминов. М.: Мысль, 1984. - 654 с. - электронная версия

Торбернит Торий_минералы_ география находок \\ Тремолит \\

Турмалин (группа) \\

У

Уваровит

Увит \\ Улексит \\ Уранинит \\ Уссингит

Ф -

Флюорит

- Ottens, B. (2005): Chinese Fluorite. The Mineralogical Record 36(1), 59-68

1. Флюорит. Аурахмат, Узбекистан \ Камбрия, Англия. Образцы: ФМ. . 2. Флюорит. Дэань (=Де`Ан) флюоритовый р-к, близ Вушань, уезд Дэань (=Де`Ан) \ De'an fluorite mine, Wushan, De'an Co.Jiujiang PrefectureJiangxi ProvinceChina. Образец: "Гемма"-2016.12. Фото 1-2: © А.А. Евсеев

Формы выделения минералов

Фото дня или на geo.web.ru/druza/ - "Вокруг света за 30 дней"

Фото дня на миндат.орг_ретроспектива - http://www.mindat.org/gallery.php?potd=1

Фото мест по всему миру - http://www.panoramio.com/map/

Фотоатлас минералов -- http://tw.strahlen.org/fotoatlas.html (834 minerals, 1148 photos)

Фотогалереи минералов - минералы от A до Z и число их фотографий - указатель для миндат.орг - http://www.mindat.org/photoindex.php--http://www.mineralatlas.com/ \\ http://kristallov.net/index.html \

Фотографии минералов - страница Б.З. Кантора на http://www.mindat.org/user-17280.html - 275 фото (2016.08)

Олег Лопаткин на -- http://www.mindat.org/user-10732.html

Фотосъёмка минералов \\ \\ http://klopotow.narod.ru/soveti/foto.html

--Фото минералов - впервые в рамках Фестиваля "Первозданная Россия" (2016) \\ Подробнее: http://ilm.narod.ru/

Фторапатит

Фульгурит     FULGURITE . Выдющийся по размерам (110 см) образец из новых поступлений в Минер. музей им. А.Е. Ферсмана (№ ОП-3091, коллекция "Образований и превращений минералов" ) \\ Серого цвета древовидный фульгурит - природное образование из переплавленного при ударе молнии в силикатное стекло (лешательерит) кварцевой составляющей песка с включениями непереплавленных песчаных частиц. Ветвистость обусловнена формой прошедшего через влажный песок электрического разряда. Размер образца по размаху ветвей ~ 110 х 50 х 10 см. Долина реки Селенги в окрестностях города Гусиноозёрск район, Бурятия, Россия. Дар. Белаковский Д.И. 2020.            

Х -

Халцедон \\ http://www.mindat.org/min-960.html ; фото (541) - http://www.mindat.org/gallery.php?min=960

Халькантит \\ Халькопирит \\

Холтит \ Holtite \\ https://www.mindat.org/min-1925.html

Хризопраз

Хризопраз. Скляры, Польша. Образец: Минералогический музей им. А.Е. Ферсмана РАН (№74805). Фото: © А.А. Евсеев.

Хризотил \ Chrysotile Mg3(Si2O5)(OH)4

- Канада: Тетфорд, Квебек, Канада \   Bell mine, Thetford Mines, Les Appalaches RCM, Chaudiere-Appalaches, Quebec, Canada : - первоначальное местонахождение \ Type Locality --фото

-- Thetford Mines, Les Appalaches RCM, Chaudiere-Appalaches, Quebec, Canada \\ Mine Lac d'Amiante, Saint-Joseph-de-Coleraine, Les Appalaches RCM, Chaudiere-Appalaches, Quebec, Canada --фото

- США: Salt River Mining District, Gila Co., Arizona, USA --фото

Хризотил-асбест \\

Хромит

Ц -

Цвета минералов

Цветные камни

--Буканов В.В. Энциклопедия "Цветные камни" - официальный сайт

Целестин

Цеолиты \\

- Tschernich, R. W., 1992, Zeolites of the world: Geoscience Press, Inc. [Phoenix, Ariz.], 563 p.

1. Морденит."Самый прекрасный в мире образец морденита". Рат`с-Нест майн, Чаллис, округ Кастер, Айдахо \ Rat`s Nest Mine, Challis, Custer Co., Айдахо, США. Образец: RM# 5639. Дар: Rudy Tschernich. Фото: © А. Петрова (2009). 2. Натролит. Путеличорр, Хибины, Кольский п-ов, Россия. Бесцветный полупрозрачный призматический кристалл 30х11х12 см. Образец: ФМ (№56544, Бородин Л.С., 1954). Фото: © А.А. Евсеев.

Церуссит \\ Циркон \\ Цитрин

Цоизит

Цоизит в амфиболите. Куртинское м-ние, Урал, Россия. Образец: Минерал. музей им. А.Е. Ферсмана.(№59430. Соколов Ю.А., 1957). Фото: © А. Евсеев.

Ч -

Чароит \\ Чароит. Сиреневое чудо Сибири. Иллюстрированное научно-популярное издание. - Иркутск6 изд-во "Петрографика", 2011. - 192 с. (авторы текстов: Рогова В.П., Воробьев Е.И. и др.)

ШЩ

Шары и яйца из камня

Шаттукит

Шахтёрская энциклопедия - MiningWiki — энциклопедия о шахтах и шахтёрах, создаваемая совместными усилиями горняцкого сообщества. 

Шеелит \\

Шерл

Шорломит

Шпинель

Шунгит

Щелочные массивы \\ XXV Всероссийский семинар с участием стран СНГ. Геохимия магматических пород. 23-26 мая 2008 г. Школа Щелочной магматизм Земли   \\ http://alkaline2008.narod.ru/ \\ Тезисы - http://alkaline2008.narod.ru/Abstract.htm

Э

Эвдиалит \\ \\ https://www.mindat.org/min-1420.html - 234 фото (2018.06): Россия - 64; Швеция - 15; Гвинея -1; ЮАР - 1; Мадагаскар - 2 ; Гренландия - 24; Канада - 82; США-41; Бразилия-3

Эвклаз

Эгирин \\ местонахождения (595) - http://www.mindat.org/min-31.html \\ фото (169) - http://www.mindat.org/gallery.php?min=31 (на 2009.03.22) \

Экскурсии_ минералогические экскурсии. \\ В Гос. геол. музей им. ВИ. Вернадского

Эльбаит \\

Эпидот \\

Эпидот на экспозиции "Разнообразие минералов". 1.Kharan, Пакистан. 2. Грин-Монстер Маунтин, Аляска, США. 3. Vohemar, Мадагаскар. Образцы: Минералогический музей им. А.Е. Ферсмана РАН. 2020.10. Фото: А. Евсеев.

Ю -

Я \\ Я_ Заметки geo.web.ru/druza

Янтарь \\

Ярмарки минералов и драгоценных камней \\

Ярозит \\

Яшма

ЯШМА В РОССИИ [по А.Е. Ферсману] - http://pictoris.ru/5/27/index.html

ОПИСАНИЕ РУССКИХ ЯШМ [по А.Е. Ферсману] - http://pictoris.ru/5/29/index.html

МЕСТОНАХОЖДЕНИЯ МИНЕРАЛОВ

- А-Я _Список местонахождений минералов России и республик бывшего СССР

- А-Я \ А-Z_Список местонахождений минералов, стран и регионов мира

Местонахождения минералов \ mineral localities на сайте и на страницах справочника Евсеев А.А. Географические названия в минералогии. Краткий указатель. Ч. I, М. , 2000. - 269 с.; Ч. II, М. , 2000. - 282 с.
Часть I и II (выборочно):

м-н-ния
А
Б
В
Г
Д
Е
Ж
:З
И
Й
К
Л
М
Н
О
П
Р
С
Т
У
Ф
Х
Ц
Ч
Ш
Щ
Э
Ю
Я
стр.
10-
26-
45-
54
-
63-
73-
75-
77-
81-
87-
88-
122-
132-
151-
160-
166-
180-
188-
213-
226-
234-
239-
247-
249-
255-
260
260-
265-
267-
Locality
A
B
C
D
E
F
G
H
I
J
K
L
M
N
O
P
Q
R
S
T
U
V
W
X
Y
Z
cтр.
9-
24-
44-
63-
71-
78-
86-
97-
108-
113-
118-
135-
148-
173-
181-
188-
203
204-
214-
243-
257-
260-
268-
275-
276-
278-

См. также http://www.mining-enc.ru

Северная Америка
2
33

Новые страницы из серии "Местонахождения минералов" на сайте http://geo.web.ru/druza/index.html за 2019 г.

А

Аделаида Майн, Дундас, Тасмания, Австралия

Адун-Чолон (= Адун-Чилон), Вост. Забайкалье , Россия

Айфель = Эйфель \ Eifel горы (палеовулкан), Рейнланд-Пфальц, Германия \ Eifel, Rheinland-Pfalz, Deutschland

Акжайляу, к В от г. Аягуз, Вост. Казахстан \\ апатит!!!--с александрит. эффектом; КВАРЦ!!!--xl 10 м; кристалл дымч. кварца 5,8 м в длину и 1, 5 м в поперечнике, весил около 90 т-находка в южной части массива (Ерджанов К.Н., 1963);

Акчатау \ Akchatau, Ц. Казахстан \\

Аллуайв, Ловозеро, Кольский п-ов, Россия. \\ 67°51` с. ш. 34°32` в. д.

Алту-Лигонья, Мозамбик

Альмаден, Испания

Арендаль, Ю. Норвегия.

Астафьевское м-ние, Ю. Урал, Россия\\ http://www.mindat.org/loc-192610.html

Ахалцихе (р-н), Грузия.

Ахматовская копь, Ю. Урал, Россия

Б - местонахождения минералов

Баженовское м-ние , г. Асбест, 60 км к СВВ от Екатеринбурга, Ср. Урал, РФ

--Юрий Викторович Ерохин. Минералогия родингитов Баженовского месторождения (Средний Урал).

Минералогический Альманах, том 22, выпуск 3, 2017. Москва: «Минералогический Альманах». 136 стр., 236 иллюстраций, из них 212 фото минералов.

Белореченское м-ние, Сев. Кавказ, Россия

Бербес, Астурия, Испания \ Berbes, Asturia, Spain \\ см. на карте

Березовское золоторудное месторождение, Средний Урал, Россия \

-- Поленов Ю. А., Огородников В. Н., Бабенко В. В. БЕРЕЗОВСКОЕ МЕСТОРОЖДЕНИЕ ЗОЛОТА – УНИКАЛЬНЫЙ ОБЪЕКТ ПОЛИ- ХРОННОГО И ПОЛИГЕННОГО РУДООБРАЗОВАНИЯ: научная монография / Ю. А. Поленов, В. Н. Огородников, В. В. Бабенко; под редакцией В. Н. Огородникова; Урал. гос. горный ун-т. – Екатеринбург: Изд-во УГГУ, 2015. – 150 с. \\ читать - http://www.geokniga.org/bookfiles/geokniga-berezovskoe-mestorozhdenie-zolota-unikalnyy-obekt-polihronnogo-i-poligenno.pdf

Биг-Фиш-Ривер \ Big Fish River, 70 км к СЗ от Аклавик, хр. Ричардсон, Юкон, Канада \\ *баричит; *виксит; *горманит!!; лазулит!!; *маричит; *нахпоит; * новые мин.—6 видов; *саттерлиит; MR, 1999, 50 \\ http://www.mindat.org/loc-628.html

Бинн дол., Валлис, Швейцария \ Binn ValleyValaisSwitzerland \\ на карте --1 - 2 - \\ минералы - 276 ; новые минералы - 53 ; фото минералов -  2857(на 2020.09) -  www.mindat.org \\ см. также Ленгенбах

- Graeser, S. (1965) Die Mineralfunde im Dolomit des Binnatales. Schweizerische mineralogische und petrographische Mitteilungen, 45, 597-795.

 

Бисби, Аризона, США

Борон, округ Керн, Калифорния, США \\ в этом же районе находится заброшенный ныне подземный р-к Бейкер майн \ Baker mine, U.S. Borax Mine (Pacific West Coast Borax; Pacific Coast Borax Co.; Boron Mine; U.S. Borax and Chemical Corp.; Kramer Mine; Baker Mine), Kramer Borate deposit, Boron, Kramer District \ подробнее - mindat

Брокен Хилл (Broken Hill), Н. Ю. Уэльс, Австралия, 31-57` ю. ш. , 141-26` в. д. \\ http://www.mindat.org/loc-72.html

--Панов Б.С. Мировой уникум Брокен-Хилл в наше время \ Известия ВУЗов. Геология и разведка, 2004, №4 

Брумаду \\ Бу-Аззер, Марокко \\ Бурпала , Прибайкалье (С), Россия

Бушвелд, интрузив, Южн. Африка

В

Ватиха, Мурзинка, Ср. Урал, Россия

Везувий и Монте-Сомма, Италия \\

Величка, Польша

Верхнекамское м-ние (Соликамский участок и др.) , 180 км к С от Перми, Приуралье, РФ \\ галит!!—xls< 10 см; гёргейит! (Чайковский И. И. , 2011); калистронцит (Чайковский И. И. , 2011); карналлит!!!--xls<8-9 см (техногенное образование) ; пирит!--xls; сильвин!; Смо, 355

Весселс \ Wessels mine, Калахари, Сев. Капская пров., ЮАР

Вишневые горы, Ю. Урал, Россия \\ фотогалерея и др. - http://webmineral.ru/

Водинское м-ние, к ССВ от Самары, Ср. Поволжье, Россия

--Сидоров А.А. Минералогия Водинского месторождения самородной сера Самарской области и история его окрытия. Учебное пособие. Самара: Самар. гос. техн. ун-т, 2011. - 189 с.

Володарск-Волынское пегм. поле, пос. Володарск-Волынский, к З от Житомира, Волынь , Украина \\ берилл!!!--ф; гетит!!!; кварц!!; керит!!; микроклин!; опал!; топаз!!!--xls>100 кг; фенакит!!

Воронцовское м-ние, Краснотурьинск, Сев. Урал, Россия \\ Подробнее: http://webmineral.ru/

Вороньи тундры, Кольский п-ов, Россия

Г

Горихо (Gorikho), м-ние, в ср. и ниж. теч. р. Горихо (приток р. Тола, басс. р. Селенга), 45 км к В от Урги [Улан-Батора], Монголия \\ берилл!; горный хрусталь!; топаз!!; флюорит!; Ф, 491; Ш, 28, 197

Горни-Славков ( (ныне) = Шлаггенвальд (быв.) (Horni Slavkov (now) = Schlaggenwald (form.)), 12 км к ЮЮЗ от гор. Карловы Вары , Богемия, Чехия

Гумешевский р-к, Ср. Урал, Россия

Д

Дальнегорск (и район), Приморье, Россия \\ Дальнегорск в www.mindat.org \\ на 2019. 01.08: минеральных видов - 175; новый минерал - 1(дальнегорскит); фото мин.-2108 \\ сравн. на 2008.08.04 - минер. видов - 170; фото мин.-545 \\ Источник: http://www.mindat.org/loc-2635.htm

- Бор к-р - Боросиликатное м-ние \ Второй Советский р-к \\ Николаевский р-к \ Верхний р-к

Дараи-Пиоз (= Дараи-Пиез = Дара-и-Пиоз = Дарапиоз) (Dara-Pioz) , 45 км к СВ от пос. Гарм и 35 км к ССВ от Таджикабада, Алайский хр. , Таджикистан; 39° 28' North , 70° 42' East \\ http://www.mindat.org/loc.php?loc=3241

- Ринкит (Y) - новый минерал из массива Дара-и-Пиоз, Таджикистан \ Pautov, L.A., Agakhanov, A.A., Karpenko, V.Y., Uvarova, Y.A., Sokolova, E., Hawthorne, F.C. (2019) Rinkite-(Y), Na2Ca4YTi(Si2O7)2OF3, a seidozerite-supergroup TS-block mineral from the Darai-Pioz alkaline massif, Tien-Shan mountains, Tajikistan: Description and crystal structure. Mineralogical Magazine: 83: 373-380.

- Ридмерджнерит\ Reedmergnerite NaBSi3O8 @ - первая находка в быв. СССР

Дашкесан, Азербайджан \\

Джезказган, Казахстан

Джоплин, Миссури, США

Дукат м-ние, 30 км к СЗ от пос. Омсукчан, Магаданская обл. , РФ (СВ) \\ агвиларит; гельвин!; манганит!; науманнит!; платинит!; родонит!; серебро!!; стуртит!; цианотрихит!; цинкит; энаргит!; ялпаит

Додо м-ние, Прип. Урал, Россия - http://www.polarquartz.ru/dep-dodo.html

Е

Ермаковское м-ние, Забайкалье, Россия

Ж

З

Зебергед о. \ Zabargad о., Красное море, Египет

Завитинское (Завитая), м-ние, Вост. Забайкалье , Россия \\ адуляр!; воробьевит!; касситерит!; кукеит!; петалит!!; ростерит!; сподумен!!; турмалин!!; Смо, 351

Змеиногорский р-к (Zmeinogorsk) = Змеиногорское м-ние, Алтай, Сибирь (ЮЗ), РФ

И

Ивигтут \ Ivigtut = Ivittuut, Ю. Гренландия \\ *(1997) йоргенсенит; криолит!!! (М 2-1); * новые мин.—17 видов; пахнолит!! (М 2-1)--xls<4, 5 см; разн.--около 100 мин.; сфалерит! (М 1-1); томсенолит!! (М 2-1); хиолит! (М 2-1); ярлит! (М 2-1); BBM, 68.

Идар-Оберштайн \ Idar-Oberstein Германия (ЮЗ) \\ агат!! \\ 500 лет (с 1375 г. по 1875 г) в этом районе разрабатывались месторождения агата, велась его обработка. Сегодня небольшой городок - крупнейший центр торговли минералами, драгоценными и поделочными камнями, его называют "самоцветной столицей мира." .

Изумрудные копи, Ср. Урал, Россия

Илимауссак, Ю. Гренландия

Ильмены. Ю. Урал, Россия \\ карта и др. http://reserves-park.ru/index/0-204 \\ http://nashural.ru/Mesta/ilmeni.htm

Индер (Inder) (= Индерское м-ние), 15 км к В от пос. Индерборский, 150 км к С от Атырау (= Гурьев (быв.)), Сев. Прикаспий, Казахстан

Итинокава, о. Сикоку, Япония.

Иультин, Чукотка, Россия

Касситерит. Иультин м-ние, Чукотка, Россия. Образец: ФМ (№83930, Годовиков А.А., 1986). Фото: © А.А. Евсеев.

 

Й - К

Каменушинское м-ние (Cu), к С от г. Салаир, Кемеровская обл., ЮЗ Сибирь, Россия

Кап-Гарон \ Cap Garonne, близ Le Pradet, 12 км к В от Тулона, Вар, Франция

Капильитас, Катамарка, Аргентина

Карадаг, Крым, Россия

Карамазар (Karamazar) рудный район, Сев. Таджикистан

Кара-Оба = Караоба \ Kara-Oba, м-ние (Mo-W), пос. Джамбул (47-11`N, 71-23`E), Ц. Казахстан 

Карнасурт, Ловозеро, Кольский п-ов

Кацна яма (копь), 15 км к СВ от Первоуральска, Ср. Урал, Россия \\ эпидот!! (“пушкинит”!!

Кемпирсайский массив, Южн. Урал; Казахстан \\ Юричев А.Н., Чернышов А.И., Корбовяк Е.В. Минералы платиновой группы из хромититов Кемпирсайского ультрамафитового массива (Мугоджары, Казахстан): новые данные. Записки Российского минералогического общества. 2019;148(2):76-86

Кент, м-ние, гранитный м-в и грейзенизированные гранитные пегматиты, 30 км к ЮВ от пос. Карагайлы и 50 км к ЮВ от Каркаралинска, Ц. Казахстан

Керченское м-ние, Крым, Россия \\ анапаит!!!; барит!! вивианит!!; * митридатит; родохрозит, Ca-вый!!--пс-зы по раковинам (ф); смайтит!; Смо, 352; Pk

Кипуши, ДР Конго \\

Кировский р-к, Кировский р-к, Кукисвумчорр, Хибины, Кольский п-ов, Россия

Клара р-к \ Clara Mine (=Clara Grube ), Шварцвальд, Германия --барит!!; клараит*; новые. минералы*!!--14 вид.; разнообразие!!-441 видов; хайдарканит!; флюорит!!; чухровит-(Ce)* \\ Clara Mine, Rankach valleyOberwolfachOrtenaukreisFreiburgBaden-Wurttemberg,Germany; 6126 фото минералов (2019.09) ; 48° 22' 59'' North , 8° 14' 47'' East - https://www.mindat.org/loc-1782.html

Ковдор \\

--Иванюк Г.Ю., Яковенчук В.Н. Минералы Ковдора. Апатиты: изд. Кольского научного центра РАН, 1997. 116 с.

--Иванюк Г.Ю., Яковенчук В.Н., Пахомовский Я.А. Ковдор / Kovdor. Апатиты: Минералы Лапландии, 2002. 326 с.

Конгсберг (Kongsberg), Норвегия \\ * конгсбергит; пренит!; серебро!!!; флюорит!—розовый; ВВМ, 68, 174, 176, 178, 179 \\ O. Johnsen, Mineralogical Record, 1986, 17, 19-36

Кондёр г. , м-в ул.-осн. и щел. пород (Kondoer = Konder), Алданский щит, 75 км к З от пос. Джигда и 100 км к ЗЮЗ от пос. Нелькан, ниж. теч. р. Маймакан, Хабаровский край, РФ \ фото 3D - http://www.mindat.org/photo-619937.html

Консельейру-Пена \ Conselheiro Pena District (пегматитовый район), 21 км к С от Дивину-да-Ларанжейрас, (р-н), Минас-Жерайс, Бразилия

Копейск, Челябинский угольный басс., Ю. Урал, РФ \\ *(1990) дмиштейнбергит—шх. 45; *(1986) копейскит; нашатырь!; * новые мин.--8 видов; *(1990) рорисит—шх.45; *(1989) святославит; * сребродольскит!; *(1988) тиннулкунит—шх.44; * флюорэллестадит--ф; Pk \\

Коршуновское м-ние, Иркутская обл., Вост. Сибирь, Росссия

Геденбергит. Коршуновское м-ние, Иркутская обл., Россия. Образец: Мин. музей им. А.Е. Ферсмана РАН №91771. Дар: Моисеев М.М., Никифоров А.Б., 2003). Фото: А. Евсеев, 2020.

 

Кремиковцы = Кремиковци (Kremikovtsi), ~ 15 км к СВ от Софии, Болгария \\ азурит!; барит!; витерит!!; гематит!!; гетит!!; кальцит!; лепидокрокит!; норсетит!! (ММ); родохрозит!!; романешит!!

Кубер-Педи , м-ние (Coober Pedy field), 180 км к С от гор. Туркула и 750 км СЗ от Аделаиды, Ю. Австралия \\ благородный опал!!!--пс-зы!! по раковинам, белемнитам и др

Кугда массив, 10 км к С от устья р. Котуйкан (прит. р. Котуй) и 150 км к ЮЮВ от Хатанги, Ср. Сибирь (С), Россия \\ вермикулит!; перовскит!; Ti-клиногумит!!--xls< 3 см; хризолит!!

Кукисвумчорр, Хибины, Кольский п-ов, Россия \\ Петараситовая жила, Тульйок река (верховья), Кукисвумчорр гора, Хибины, Кольский п-ов, Мурманская область, Россия

Кухилал (Kukhilal) = Кухи-Лал = Кугиляль = Кох-и-Лал, Памир (ЮЗ), Таджикистан

Л

Лаахерское оз. и другие знаменитые местонахождения минералов (примеры): Сент-Илер \ Илимауссак \ Ловозеро \ Хибины \ Лангезундфьорд \ Лаахерское оз. \ Фого вулк. \ Лос о-ва \ Арис --см. на карте

Лаврион = Лавриум, Греция \ Laurium (= Laurion = Lavrion (нем.)), Greece \\ адамин!!; аннабергит!!; арагонит!; кабрерит!; * (1887) лаурионит!; миксит (группа); * новые мин.-- 22 вида(2019.10); пенфильдит!!; разн. - 592 минер. вида (2019.10) * (1881) серпиерит!!; смитсонит; цианотрихит!!; * (1881) цинкалюминит; *(2000) цинквудвардит; MR, 1998, 508; мин. в иллюстрациях--список фото (по www.mindat.org - 340 фото на 22.03.2004 \\ 3796 фото минералов на 2018.10.30 \\ \\ фотогалерея--http://www.mineral-forum.com/ \\ фотогалерея минералов - http://www.mindat.org/g/554

The Lavrion District (also Laurion; Laurium) is situated in the southeastern corner of Attica (also Attika; Attiki) peninsula, around 40 km southeast of the city of Athens. It is a 150 square km area bordered by the cape of Sounion to the South (famous for its ancient Greek temple), the village of Plaka to the North (16 km north of Sounion), the town of Lavrion and the Aegean sea to the East and the area of Anavyssos to the West (around 10 km west of the town of Lavrion).
Lavreotiki municipality was established in 1890 under the name of Sounio, but renamed to Lavreotiki in 1891.

LavreotikiEast AtticaAtticaGreece \\ 684 минер. видов; в т.ч. 28 новых видов; 5963 фото минералов (2020.08.28) \\ Источник:  https://www.mindat.org/loc-14187.html \\ на карте - 01

--Чуканов Н., Пущаровский Д. ,  Зубкова Н. , Пеков И. и др. Цинколивенит CuZn(AsO4)(OH) – новый минерал группы адамина с упорядоченным распределением меди и цинка /  // Доклады Российской Академии наук. — 2007. — Т. 415, № 3. — С. 377–382.

Лакарги гора, Верхнечегемская вулканическая структура, Кабардино-Балкария, Сев. Кавказ, Россия \ Lakargi Mt., Verkhnechegemskaya caldera (Upper Chegem caldera) ; ксенолиты скарнов в игнимбритах; 43°17'N ; 43°6'E \

Лангезундфьорд = Лангесунн-фьорд (Langesund(s)fjord), Ю. Норвегия

"Фото дня" на сайте или "За месяц вокруг света". 2020.10. 02 Мелинофан. Арё о., Лангезундфьорд, Ю. Норвегия. Образец: Мин. музей им. А.Е. Ферсмана РАН (№18530, №18531. В.И. Вернадский, 1907). Фото: © А.А. Евсеев. 

Ленгенбах, Бинненталь, Швейцария \\ http://en.wikipedia.org/wiki/Lengenbach_Quarry

Ловозеро, Кольский п-ов, Россия

Ловозерский м-в в https://www.mindat.org

минералы - 394

новые минералы - 107

фото минералов - 1159

на 2020.08.21

Ловозеро.   www.mindat.org -- фото минералов -  1117 (на 2019.07.15)

- Палитра пегматит -Palitra pegmatite, Karnasurt mine, Kedykverpakhk Mountain, Lovozersky District, Murmansk Oblast, Russia

- Сергеванит \ Sergevanite Na15(Ca3Mn3)(Na2Fe)Zr3Si26O72(OH)3 · H2O - новый минерал группы эвдиалита \\ отвалы р-ка Карнасурт, Ловозеро \  Mine dump, Karnasurt mine, Karnasurt Mountain, Lovozersky District, Murmansk Oblast, Russia - первоначальное местонахождение \ Type Locality \\ Образец: ФМ (№ 97007, Пеков И.В., 2020)

**

Лонгбан, Вермланд, Швеция \\ 59°51'13"N , 14°15'34"E

М

Мало-Быстринское м-ние (= Малобыстринское), м-ние, 18 км к З от Слюдянки, Прибайкалье (ЮЗ), РФ \\ афганит!; * (1991) быстрит--ф; лазурит!!!; сера!; * тункит; Pk (ф)

Малханское м-ние , Забайкалье, Россия

Маунт-Кобальт, 120 км к Ю от Клонкерри, Квинсленд, Австралия \ Mount Cobalt ( Mt Cobalt Mine), Selwyn District , Mt Isa - Cloncurry area , Queensland , Australia -- http://www.mindat.org/ \\ фото: гетерогенит!-ф; кобальтин!--ф; мансфельдит (6); смольяниновит—пс-зы по эритрину (кр-лы до 2 мм (3); сферокобальтин!--ф; эритрин!!!—(10 фото);

Маунт-Малоса \ Mt. Malosa, близ Зомба, Малави, Вост. Африка \\ барилит!; микроклин!; миларит!; ниобофиллит!!--фото-- www.mindat.org/gallery1; ортоклаз!; паризит!!; разн. 48 мин. (44 достоверных вида); эгирин!!!—xls> 20 см; эпидидимит!!—xl 5, 4 см; D; L, 1999, №4, 22-32; 48 entries listed. 44 valid minerals-- www.mindat.org (2008.02.24)

--Cairncross, B. (2002). Aegirine and Associated Minerals from Mount Malosa, Malawi. Rocks & Minerals, 77(1), 31-37.

Машамба-Уэст р-к, Катанга, ДР Конго. \\ Везиньеит--ф; карнотит!--ф; кобальтодоломит!!--ф; кобальтокальцит!!-ф; колвезит!--ф; куприт!!-ф; малахит!!--ф; метатюямунит!--ф; планшеит!--ф \\ рудник начал работу в 1978 г. \\ Источник: http://www.mindat.org/loc-4334.htm

Меднорудянский р-к, Ниж. Тагил, Ср. Урал, Россия.

Мерек (= Мерекское), м-ние, ~40 км выше устья р. Мерек (приток р. Амгунь), близ ж.-д. ст. Эанга, к ЮВ от Чегдомына, 270 км к С от Хабаровска, Буреинский хр. , Хабаровский край, РФ \\ касситерит!!—xls \\ Мерек рудопр-ние, в верх. р. Мерек (левобережье р. Амгу)-касситерит!!-фото; рядом-пром. россыпи касситерита-- Расческин Е.В., 2004, 206-207 \\ Д..А. Петроченков. Касситерит [Мерек] и аммониты [Европ. Россия] в ювелирных изделиях--сообщ. в клубе друзей минералогии (2008.06.06)

Мерелани-Хиллс \ Merelani Hills, Танзания \\ алабандин!!!--xl 9x6x4 см; добыт в 2013 г.--фото www.mindat.org

Мибладен, Марокко \\ в поисках ванадинита - видеосюжет www.youtube.com/

Могок = Могоу (новое название, по Е.Я. Киевленко, 2001) (Mogok District), Мьянма (= Бирма (быв.)

1. Корунд (разн. рубин). Могок, Мьянма. Образец: ФМ (№50328. Ферсман А.Е., запись 1950 г.). Фото: © А.А. Евсеев. 2. Могок, Мьянма. Подробнее: Евсеев А.А. Атлас мира для минералога. М., 2004. - 284 с.

Мурзинка, Ср. Урал, Россия

Мурунский массив = Мурун (Murun), близ г. Мурун (1452 м), междуречье рр. Чара и Токко, ~50 км к ЗЮЗ от пос. Торго, Алдан (СЗ), Якутия (ЮЗ), РФ \\\\ Сиреневый Камень месторождение чароита --http://petrographica.ru/

Мусонои р-к \ Musonoi mine, ~25-30 км к З (по другим данным -10 км к СЗ ) от Колвези (10°41`S, 25°39`E), Катанга (быв. Шаба, ДР Конго (быв. Заир); \\ 10° 43' 37'' South , 25° 27' 10'' East - https://www.mindat.org/loc-4322.html

--Wilson, W.E. (2018) The Musonoi mine, Kolwezi District, Lualaba Province, Democratic Republic of the Congo. Mineralogical Record, 49, 236-304.

--Новые минералы - https://www.mindat.org/loc-4322.html (на 2019.07) : Demesmaekerite (TL) \\ Derriksite (TL)\\ Guilleminite (TL) !! \\ Kolwezite (TL)\\ Marthozite (TL) \\ Oosterboschite (TL) \\ Verbeekite (TL)\\ \\

Мусонои в www.mindat.org

минералы -81

новые минералы - 7

фото минералов - 737

на 2019.07.10

--Wilson, W. E. (2018) The Musonoi mine, Kolwezi District, Lualaba Province, Democratic Republic of the Congo. Mineralogical Record 49:236-304

Названия местонахождений - что они означают?--Андамука \ Andamooka - знаменитое месторождение благородного опала в Южн. Австралии (30° 27' 14'' S, 137° 10' 15'' E--mindat). Андамука на языке аборигенов означает "нет названия" \ "no name"

Найка, Чиуауа, Мексика \\

Насик (=Нашик) - Пуна \ Nashik distr. - Pune, Махараштра шт., Индия.

Неройка г., Прип. Урал, Россия \\ Додо м-ние

Никитовское ( = Никитовка), м-ние, ~ 6 км к СЗ от гор. Горловка [ в его черте ] , Донбасс, Украина \\ антимонит!!--xls< 18 см; киноварь!!; мелантерит!; * феррогексагидрит; Багатаев М. Н. , 1997 (МК, №12, 17-23; WS, №12, 10-14); Смо, 354; Pk

Норильский р-н, Ср. Сибирь, Россия

Н`Чванинг (N`Chwaning), р-ки (без уточнения) , к СЗ от Куруман, Калахари (Mn)-рудное поле, ЮАР \\ афвиллит!!!--xls< 1 см; браунит!!--xl 1, 6 см (ф); журавскит!--xls; кариопилит!!; лейкофеницит!--xls< 3 мм; портландит!!!--xls< 3 см; MR, 1992, v. 23, 436; MRI

О

Одихинча \ Odikhincha, м-в, р. Котуй, 110 км к ЮЮВ от Хатанги, Ср. Сибирь, Россия

"Фото дня" на сайте или "За месяц вокруг света". 2020.10. 08. Моримотоит. Одихинча м-в, Ср. Сибирь, Россия. "Гемма", 2014. 10. 04. Фото: © А. Евсеев. \\ По составу лишь наружная зона кристалла шириной несколько мм - титансод. андрадит (Ю. Гриценко).

Олдоиньо-Ленгаи\ Oldoinyo Lengaii = Ol Doinyo Lengai volcano, к СЗ от гор. Аруша, Танзания; "единственный в мире действующий карбонатитовый вулкан"(Keller J. et al., 1990); 2°44`S, 35°53`E (Dana, 1997)\\ \\ вишневит! (D); МЩ, 146; \\ http://www.mindat.org/min-4190.html \\

Ору-Прету (район), Минас-Жерайс, Бразилия

Отоме,, р-к (Otomezaka = Otome mine), Makioka-cho , Yamanashi City , Kinpuzan district, преф. Яманаси (Yamanashi Pref.), Япония \\ : http://www.mindat.org/loc-220223.html

Оутокумпу, рудное поле \ Outokumpu, Финляндия \ Outokumpu Cu-Co-Zn-Ni-Ag-Au ore field, North KareliaFinland \\ знаменитое местонахождение минералов \\ алабандин \ Alabandite; андуоит\ Anduoite; карелианит*(1963) \ Karelianite (TL) ; кобальт-пентландит* \ Cobaltpentlandite (TL) ; пентландит!--М-1-1, 181а); уваровит!!!--1) 68 фото 2) xls<4,6x2,6 см; ульманнит \ Ullmannite ; уранинит \ Uraninite ; хаапалаит* \ Haapalaite (TL) ; халькопирит; хром-диопсид!--28 фото ; цоизит \ Zoisite ; эпидот, Cr-сод.("тавмавит"); *(1958) эсколаит!!; \\ 82 мин. видов \ valid minerals. 4 (TL) - новых минералов \ type locality of valid minerals. \\ ВВМ, 74; R&M, 1998, 126 \\ \\ Подробнее: http://www.mindat.org/loc-6416.html

Охуэла р-к \ Ojuela mine, Мапими, Дуранго, Мексика \\ кобяшевит!!--новинка Тусон-шоу 2016 г.--фото- http://webmineral.ru/

П

Пайкс-Пик, округ Эль-Пасо, Колорадо, США \ Pikes Peak, El Paso Co., Colorado, USA ; 38° 50' 25'' North , 105° 2' 30'' West \\ амазонит!!!--27фд; сидерофиллит* \ Siderophyllite (TL)

Пала, округ Сан-Диего, Калифорния, США \\ берилл розовый!; кунцит!!; лепидолит!; эльбаит!!!

Палитра пегматит, Кедыкверпахк г., Ловозеро \\ PEKOV, I.V. (2006) The Palitra pegmatite, a newly discovered hyperalkaline pegmatite in the Lovozero massif, Kola Peninsula, Russia. Mineralogical Record, 36, 397-416.

Панашкейра \ Panasqueira; Португалия; 40°10`N , 7°46`W;

Педернейра, р-к (Pederneira mine), Минас-Жерайс, Бразилия \\ эльбаит!!!--xl 20 см (ф), MR, 2000, #1, 56 \\ 18° 10' 9'' South , 42° 10' 59'' West - www.mindat.org

Первомайский (= Трудолюбовский) к-р, 1, 5 км к В от с. Трудолюбовка, гора Кермен, 20 км к ЮЮЗ от Симферополя, Крым, Россия. \\ анальцим, бабингтонит; гидроксиапофиллит!!; гиролит!; окенит!; МК, 1996, №9, 9

Первоначальные местонахождения (type localities) минералов на карте мира

Перекатное м-ние, Алдан, Якутия, Россия. \\

Питкяранта, Сев. Приладожье, Ю. Карелия, РФ \\ См. http://karelnedra.karelia.ru/mnia/sn_karelia.htm

Плоская г. , Кейвы, Кольский п-ов, Россия; амазонитовые пегматиты с редкими минералами Y и Yb \\ Гора Плоская 2015 - фоторепортаж - http://webmineral.ru/

Пршибрам, рудное поле, Чехия \ \ Pribram ore field, Czech Republic

Пуйва, Прип. Урал, Россия \\ Пуна\ Poona = Pune (район Пуны), Индия

Р

Рай-Из гипербазитовый массив (район), хр. Марун-Кеу, ж.-д.. ст. Харп, ЯНАО, Тюменская обл., Пол. Урал, Россия

Расвумчорр, Хибины, Кольский п-ов, Россия

Ратнапура, Шри-Ланка

Роджерли майн\ Rogerley mine, Дарем, Камбрия, Англия, Великобритания

Рубцовское м-ние, , (рудник отработан и затоплен), 20 км к ЮВ от г. Рубцовск близ северной окраины дер. Потеряевка, Алтай, Россия; 51°28'14'' с.ш., 81°29'34'' в.д. \\ азурит!!; коннеллит!--фото ; йодаргирит!; куприт!!!; майерсит!!; маршит!!; медь!!; серебро!

Рудные горы, Гемания \ Чехия

С

Садбери Дистр. \ Sudbury District, OntarioCanada - 285 фото минералов - https://www.mindat.org/loc-571.html

Сан-Жозе-да-Сафира \ Sao Jose da Safira (San Jose de Safira), Минас-Жерайс, Бразилия - фото
http://www.hummingbirdminerals.com/IMG_2787zc.jpg \https://www.mindat.org/loc-571.html http://www.hummingbirdminerals.com/mixedminerals7page3.html \\ - фотогалерея - http://www.mindat.org/gallery.php?loc=5894 \ http://www.mindat.org/gallery.php?cform_is_valid=1&loc=5894&cf_pager_page=4

Санкт-Андреасберг, Гарц, Ниж. Саксония, Германия (33_5) \ St Andreasberg District, Harz Mts, Lower Saxony, Germany \\ апофиллит!!; *арсенолит; *брейтгауптит; *гармотом!!!; дискразит!!; кальцит!!!; миаргирит!; мышьяк!!; нов. мин.--4 вида; пираргирит!!!; прустит!; разн.-220 мин.(198 мин. вид.)--http://www.mindat.org/loc-22230.html (на 2008.09.04) ; * самсонит!!; стефанит!!; ВВМ, 46, 56, 240

Сарановское м-ние, Ср. Урал, Россия

--О.К. Иванов. Минералогия Сарановского хромитового месторождения, Урал. - Минералогический Альманах, том 21, выпуск 2, 2016 - http://www.minbook.com/book.php?book=120&russian=1

Сарбайский р-к \ Sarbayskii mine (= Сарбайское м-ние) и Соколовский р-к, гор. Рудный, 45 км к ЮЗ от Кустаная, Казахстан

Сент-Илер массив, Квебек, Канада; 45° 33' 11'' North , 73° 9' 7'' West - http://www.mindat.org/loc-123123.html

--Сент-Илер-- более 5369 фото минералов (на 2019.02). Из них : 306-серандит!!!; 200 -катаплеит!!!+Gui-72; 186-родохрозит;124-анальцим;111-карлетонит!!!;111-натролит; минералов - 415; новых минералов - 66 \ 415 valid minerals. 66 (TL) - type locality of valid minerals. Источник: https://www.mindat.org/loc-123123.html

Сёрлз озеро и р-к Ю.С. Боракс (Борон, Калифорния)

Сикуаньшань, Хунань, Китай

Слюдянка (и район) Словарь топонимов Слюдянского района - http://www.maxknow.ru/images/upload/articles7/468.htm

Солонго (= Магнетитовое) м-ние, Забайкалье, Бурятия, Россия

Суит-Хоум Майн, Алма, \ Sweet Home Mine, Alma, Колорадо, США

Сюебаодин \ Xuebaoding, горы, район Пинъу \ Pingwu, Сычуань, Китай

Сянхуалин \ Xianghualing (м-ние Sn-Pb-Zn), Хунань, Китай--балифолит*; гиббсит-26ф; либерит*; сянхуалинит*; таафеит!! ФЛЮОРИТ!!!--402фд; Liu, 2006, 201-215

Т

Талнах м-ние, Ср. Сибирь (С)

Таманский п-ов, между морями Черным и Азовским, Россия (Ю)

Тигриное м-ние, Приморье, Россия \\

--Попова В. И., Попов В. А., Коростелёв П. Г., Орловский В. В. Минералогия руд W-Sn-месторождения Тигриное и перспективы его освоения. Екатеринбург: УрО РАН, 2013 г. – 133 с.

Титовское м-ние, р. Догдо, хр. Тас-Хаяхтах, Пол. Якутия, Россия

Толбачик (= Толбачинский) (Tolbachinskii) вулкан, к ЮЗ от Ключевской Сопки, Камчатка, Россия \\ разнообразие - 232 мин.вида - http://www.mindat.org/loc-5602.html ; новые минералы - 123 вида; по числу новых минералов, открытых здесь, вулкан Толбачик занимает теперь 2-ое место в мире среди всех местонахождений минералов (данные И.В. Пекова, 2019.09)

Толбачик (= Толбачинский) (Tolbachinskii) вулкан, к ЮЗ от Ключевской Сопки, Камчатка \ Tolbachik volcano, Kamchatka KraiRussia - https://www.mindat.org/loc-5602.html - 55° 49' 59'' North , 160° 19' 59'' East; 501\ 528 фото минералов; 232 \ 260 минералов valid minerals; 123 \ 129 новых минералов  (TL) - type locality of valid minerals (2019.09.03 \ 2020.05.06)

--Большое трещинное извержение (БТТИ), Толбачик вулкан, Камчатский край, Россия

-- \ Second scoria cone, Northern Breakthrough, Great Fissure eruption, Tolbachik volcano, Kamchatka Krai, Russia \\

Johillerite \\ Tsumeb Mine, Tsumeb, Oshikoto Region, Namibia - первоначальное местонахождение \ Type Locality

Федотовит, эвхлорин. Арсенатная, фумарола, 2-й шлаковый конус, Северный прорыв, Северный прорыв, БТТИ, Толбачик, Камчатка, Россия.Изумрудно-зелёная кристаллическая корка эвхлорина с темно-зелёными пластинчатыми кристаллами федотовита размером до 5 мм. Образец: Минералогический музей им. А.Е. Ферсмана РАН (№95259. Дар: Пеков И.В., Агаханов А.А., Лыкова И.С., Варламов Д.А., Ханин Д.А., 2016). Фото: А. Евсеев, 2020. \\ НМК-195

Траверселла (Traversella), близ Ивреа, Пьемонт, Сев. Италия \\ аметист!!; доломит!; магнетит!!—xls< 3 см; пирит!; шеелит!!; эпидот!; ВВМ, 160, 234

Трепча, Косово (Trepca), 6 км к СВ от гор. Косовска-Митровица, (быв. авт. край Косово, Сербия, Югославия) \\ арсенопирит!!; буланжерит!; вивианит!; лудламит!!--xl 2 см; пирит!--пс-зы по пирротину; пирротин!!—xls< 16 см; сфалерит!; чилдренит!; ВВМ, 81, 83, 100 \\ см. на карте

Турьинские р-ки, Сев. Урал, Россия \\ Фёдоров Е. С., Никитин В. В. Богословский горный округ. Описание в отношении его топографии, минералогии, геологии и рудных месторождений. - СПб., 1901. - С. 92.

Тюямуюн, Киргизия

У

Уа-Уа Маунтинз, близ Delta, округа Бивер, Миллард и Айрон, Юта, США \ Wah Wah Mts, Millard Co. \ Beaver Co. \ Iron Co., Utah, USA \\ берилл!!!--xls, малиново-красный; гейкилит

Уансала, р-к (Pb-Zn) \ Huanzala mine, близ Уансала, 10 км к СЗ от гор. Уальянка, и 80 км к З от Уануко, деп. Уануко, Анкаш, Перу \\ пирит!!--xls < 20 см, друзы; флюорит!!--розовые xls< 5 см (MR, 1981, 12, 187), зеленые октаэдры < 10 см; MR, 1997, #4, 47 \\ \\ ExtraLapis, No. 11 Pyrit · Herbst 1996

Умбозерский р-к, г. Аллуайв, Ловозеро, Кольский п-ов, РФ

Ф.

Фрайберг (=Фрейберг), район.

Франклин, Нью-Джерси \ (Franklin), 80 км к СЗ от Нью-Йорка, округ Сассекс, Нью-Джерси, США \\ аллеганит! (М 3-1); виллемит!! (М 3-1)—xls<20 см; ганит! (М 2-3); гетеролит! (М 2-3); глаукохроит! (М 3-1); годжкинсонит! (М 3-1); ларсенит! (М 3-1); лейкофеницит! (М 3-1); *ленниленапеит (ММ); лёллингит! (М 1-1); * новые мин.—67 видов (вместе с м-нием Стерлинг-Хилл); норбергит! (М 3-1); пирохроит! (М 2-3); родонит!! (М 3-2); тефроит! (М 3-1); * франклинит!! (М 2-3)—xls< 15 см; хендриксит!; цинкит!!! (М 2-2); BG, 19, 21; MR, 1996, 226 (лит.)

Гардистонит \ Hardystonite (светло-серый), франклинит (черный) и др. Гардистонит люминесцирует в коротком диапазоне УФ \ Under short wave UV the hardystonite is blue/violet and the willemite is green --см. фото www.mindat.org \\ см. http://geo.web.ru/druza/m-lumin.htm

Х - местонахождения

Хагендорф-Зюд, Бавария, Германия

Хайдаркан, м-ние, Киргизия

Хибины, Кольский п-ов, Россия\ Khibiny massif - https://www.mindat.org/loc-2680.html : 523 минерал. вида ; 121 новые минерал. виды; 1081 фото минералов (в т.ч. эвдиалит - 52) на 2019.01.11  \\ карта Хибин \\ турист. схема

Хибины  www.mindat.org -- фото минералов -  1092 (на 2019.04.19)

Нормандит ("солнца" до 2 см). [Партомпорр], Хибины, Кольский п-ов, Россия. Образец: Минер. музей МГРИ (№1817). Фото: © А.А. Евсеев.

Хуанганг р-к \ Huanggang Mine (Huanggangliang Mine), Внутр. Монголия, Китай

--Ottens, B., and Neumeier, G. (2012): The Huanggang Mine, Inner Mongolia, China. Mineralogical Record 43, 529-563.

Ц

Цумеб \ Tsumeb и район, Намибия \\ (ГРЭ- III , 587-593); геол. карта р-на; геол. разрез); «скопления германита достигали веса в несколько сотен тонн» (с.589) ; \\ https://www.mindat.org/loc-43981.html - 7305 фото минералов; 311 мин. видов; 72 нов. минерал. видов (на 2019.01.23)

Ч

Челекен (Cheleken) , 70 км к Ю гор. Туркменбаши (= Красноводск (быв.)), Туркмения

Чукикамата, Chuquicamata (22°18`S, 68°55`W), 15 км к N от Каламы, Антофагаста, Чили \\ атакамит! (М 2-1); *(2011) бетпакдалит-NaNa; * (1811) блёдит; мендосавиллит*; маршит! (М 2-1); *1908-натрохальцит;(Gui-72); * новые мин.—12 видов; *1986-обрадовичит; * самплеит

Ш Щ

Шерловая Гора (= Шерлова гора = Ширлова гора) (Scherlovaya Gora), Вост. Забайкалье, РФ \ Sherlova Gora, Adun-Cholon Range, Nerchinsk Gem mines, Nerchinsk, Zabaykalsky Krai, Russia ; 50° 31' 12'' North , 116° 18' 0'' East \\ Минералогический Альманах, том 19, выпуск 2, 2014

- Японский двойник кварца(морион) -5 см --Пеков И.В., 2020 (колл.)

Шимен, Хунань, Китай

Шинколобве (Shinkolobwe), Верхняя Катанга, ДР Конго \\ 425 фото минералов ; 128 достоверных минералов \ valid minerals. 38 (TL) - новых минералов \ type locality of valid minerals (2019.01) - https://www.mindat.org/loc-4328.html \\ * (1922) беккерелит!; * биллиетит! (М 2-3); * ванденбрандеит! * вандендрисшеит! (М 2-3); ваэсит!!; * виартит!!; гетерогенит!!; зигенит!!; * купросклодовскит!!; * кюрит; настуран!!--крупное м-ние; * новые мин.—36 видов; * параскупит! (М 2-3); *пиретит (piretite); селенозигенит--М-1-1, 279а); * скупит! (М 2-3); * студтит!; уранинит!--xls; фурмарьерит!; BBM, 15, 92; Gui-72

Шкатулка, пегм. залежь, Умбозерский р-к, Аллуайв, Ловозеро, Кольский п-ов, РФ.

Шнееберг, Рудные горы, Саксония, Германия \\ 365 минералов, из них 299 достоверных видов, из них 43  новых вида ( type locality) на 2016.03.04\\ Источник: http://www.mindat.org/loc-1848.html

Шор-Су = Шорсу, м-ние, 30-35 км к ЮЮЗ от Коканда, Фергана (Ю), Узбекистан \\ озокерит!; сера!!!; целестин; МС-1, 278-279; Смо, 356

Шуньга, Карелия

Э

Эвеслогчорр, Хибины, Кольский п-ов, Россия

Элмвуд майн \ Elmwood Mine, Carthage, округ Смит, Теннесси, США \\ Эльба о., Италия \\ Эронго, Намибия.

Юбилейная залежь \ Jubilee( = Yubileinaya) pegmatite ), Карнасурт, Ловозеро, Кольский п-ов, Россия

Я

Яогансян р-к (W) \ Yaogangxian = Yao Guang Xiang, 40 км к ЮВ от Ченжоу, Хунань (Ю), Китай \ Yaogangxian = Yao Guang Xiang, Yizhang Co., Chenzhou Prefecture, Hunan; 25°35'N , 113°15'E \\ : http://www.mindat.org/loc-4549.html -- 1567 фото минералов (2019.02): арсенопирит!! -184; буланжерит!!--18; бурнонит!!! -141; джемсонит!!--26; станнин!!!--60; ферберит!!--109; шеелит!!--94 и др. \\ на карте

--Ottens, B. and Cook, R.B. (2005): The Yaogangxian tungsten mine, Yizhang County, Chenzhou, Hunan Province, China. Rocks & Minerals 80(1), 46-57.

--Ottens, B. (2011) The Yaogangxian mine, Hunan Province, China. Mineralogical Record, 42, 557-603.


Яхимов (Jachymov) (= быв. Иоахимсталь\ Joachimsthal), Западно-Чешский край, Богемия, Чехия \\ http://www.mindat.org/loc-158151.html \\

см. также--СПРАВОЧНИК МЕСТОНАХОЖДЕНИЙ МИНЕРАЛОВ И РУД - http://mineral.nsu.ru/educat/article/7/

СТРАНЫ и РЕГИОНЫ

Находки минералов по всему миру. Подробнее: Евсеев А.А. Атлас мира для минералога. М., 2004. - 284 с. \\ Евсеев А.А. Атлас для минералога. Россия и бывший СССР . М., 2011. – 248 с

СТРАНЫ от А до Я

находки минералов по листам карты мира: 1234567 891011121314151617181920212223242526272829303132 - 33

Викимапия \ Wikimapia (карты мира и России)

Сев. Америка (С)

Гренландия

Атлантика - Скандинавия - Кольский п-в

Урал
Ср. Сибирь
Якутия
СВ России

Сев. Америка (З - Сев. Америка (Кордильеры)

Сев. Америка (В)

Британ. о-ва, Пиренейский п-в - Зап. Европа - Вост. Европа

Казахстан, Ср. Азия

Юг Сибири
Забайкалье, Вост . Сибирь
Камчатка - Дальний Восток (Россия, Япония
Мексика
Кавказ, ЮЗ Азия
Афганистан, Пакистан
Индия
Монголия. Китай
ЮВ Азия - Тихий океан
Ю. Америка (СЗ) - Кордильеры
Бразилия

Африка - Сев. и Зап.Экв. и ЮжнВост.

Антарктида
Австралия

Тихий океан - Весь мир

Интересная подборка из 9 минералов региона получается если взять по одному из 9 его частей (центр, север, юг, запад, восток, СВ, ЮВ, ЮВ, СЗ)

Mineralienatlas - указатель по странам - https://www.mineralienatlas.de/

Северное полушарие

Арктика

Земля Франца-Иосифа, Северный Ледовитый океан, Арктика; Архангельская обл., Россия \\ Карбонатные (?) конкреции!!--о. Чамп; кварц (халедон) по дереву! - о. Мак-Клинтока о.; сера!

Северный Ледовитый океан - карта

Новая Земля

Восточное полушарие

Евразия

Россия и СССР

СССР (быв.) в /www.mindat.org

минералы - 2616

новые минералы - 963

фото минералов - 13997

на 2019.08.05

Россия в /www.mindat.org

минералы - 2378

новые минералы - 811

фото минералов - 12231

на 2019.08.05

--Минералы СССР, т.1 "Самородные элементы"/ под ред. А.Е.Ферсмана (редактор тома Н.А.Смольянинов), Изд.АН СССР Москва-Ленинград. 1940 г. - 328 с., тир. 3000 экз.

 

--Геологические памятники природы России "Природное наследие России" . Авторы: Карпунин А.М. , Мамонов С.В. , Мироненко О.А. , Соколов А.Р. Главный редактор - Орлов В.П. Санкт-Петербург, 1998 г.\\ веб-публикация

Физическая карта России - http://town-map.ru/346093.html

Карта России на сайте К.И. Клопотова

Кристаллы России в экспозиции Минералогического музея им. А.Е. Ферсмана РАН (кристаллы 5 см и более на выставке "Кристаллы")

10 замечательных минералов России (экспресс-опрос провел А. Евсеев)

Экспозиция "Замечательные минералы России". 2019 г. Мин. музей им.А.Е. Ферсмана РАН. Подробнее: https://www.fmm.ru/Exp17.

Экспозиция "Минералы России". Зал "Региональная и всемирная минералогия". Минерал. музей МГРИ.

Минералы России по числу ссылок (20 и более) в «Атласе мира для минералога»

Новые минералы ( СССР и Россия) \\ Список всех новых минералов, открытых на территории быв. СССР с 1766 до первой половины 2006 г. содержит 714 достоверных ( valid ) минеральных видов – см. Pekov I.V. New Minerals from Former Soviet Union Countries, 1998-2006 // Mineralogical Almanac, Vol. 11. Moscow, Mineralogical Almanac, 2007, 112 pp. (список - стр. 85-88)

Полезные ископаемые - Википедия

Минералы России в mindat.org - https://www.mindat.org/loc-14409.html

Карта "Самые замечательные месторождения минералов в Союзе" (фрагмент). Источник: Ферсман А.Е. Занимательная минералогия. М. -Л.: "Детская литература", 1937. - 240 с. Объяснения к карте - см. стр. 235-238. Подробнее

Коллекционные минералы из России - http://www.kristallemineralsrussia.com/

Кольский п-в и Карелия

В.В. Борисова, А.В. Волошин. Перечень минеральных видов Кольского полуострова. Изд. 4-е, испр. и доп. / – Апатиты: К&М, 2010. – 64 с.

В новом «Перечне…» приведён исправленный и дополненный список минеральных видов Кольского полуострова по классам. На сегодня он насчитывает 1070 минералов. Список минералов, впервые открытых на Кольском полуострове, содержит 256 наименований, расположенных в хронологическом порядке. Сводка рассчитана на широкий круг специалистов-геологов, минералогов и коллекционеров-любителей. Читать - http://geoksc.apatity.ru/images/stories/Print/p10.pdf

Перечень минеральных видов Кольского полуострова. Апатиты. 2010

Хибины и Ловозеро --карта (спутник)

Кольский п-в_фото минералов_Bernard - новая страница

-- В.В. Борисова, А.В. Волошин. Перечень минеральных видов Кольского полуострова. Изд. 4-е, испр. и доп. / – Апатиты: К&М, 2010. – 64 с

Минералы Кольского п-ва от A до Z \\ 1168 минералов; 835 минер. видов; 255 новых видов; фото минералов - 22181.(1-е - адамсит-(Y), 101- бахчисарайцевит и т.д.) \\ Источник: http://www.mindat.org/loc-2666.html (на 2014.06.19)

От Белого до Баренцева моря через Кольский полуостров.

Минералы Кольского п-ва от А до Я (по Борисовой В.В. и др., 2002 с доп.)

--Новые минералы---264 вида \\ Волошин А.В. , Пеков И.В., Борисова В.В. Минералы, впервые открытые в Кольском регионе: исторический обзор и статистические данные. - Минер. альманах. Т. 18, вып.2, 2013, с.107-123

Бураковская интрузия, Заонежье, Карелия, Россия \\ Балтийский щит

Карелия \\ http://mindat.ru/locathn/r_karel.htm \

- Атлас структур и текстур докембрийских вулканогенных пород Карелии \\ литература

Вост. Европа

Россия \ Russia

(3086 минералов); 1959 минер. видов; 255 новых видов; фото минералов - 8561(1-е - абрамовит, 101- Allochalcoselite и т.д.) \\ Источник: http://www.mindat.org/loc-14409.html (на 2014.06.19)

2468 минер. видов; 833 новых видов; фото минералов -12839 \\ Источник: http://www.mindat.org/loc-14409.html (на 2020.08.11)

2479 минер. видов; 844 новых видов; фото минералов -12921 \\ Источник: http://www.mindat.org/loc-14409.html (на 2020.10.20)

Минералы России в фотографиях : http://www.mindat.org (примеры из 100 новых фотографий по https://www.mindat.org/gallery.php?loc=14409&pco=1)

Кольский п-ов - расвумит

Пол., Сев. Урал - аксинит царегородцевит

Сред. Сибирь - сперрилит

СВ
Центр

Сред. Урал - малахит

Якутия - гроссуляр - алмаз

Камчатка - вантгоффит; софиит

Юг России - целлерит
Южн Урал - перовскит

Юг Сибири - нефрит

Дальний Восток - индит - пирротин

Местонахождения минералов России на сайте К.И. Клопотова

Европейская часть России

Европ. часть России (север) \\ Тиман \\ Сев. Тиман--путешествия \\ путешествия-2009 \\ схема

Архангельская обл.

Новгородская обл.

КМА \\ лизардит!--ЕК: 3.2512,1

Поволжье \

Подмосковье, Россия и Москва

Меллит. Малевка д., Тульская обл., Россия. ~4 см. Образец: ФМ (№53078, №53079. ГИГХС, 1951). Фото: © А. Евсеев.

Гжель , Московская обл.

--Гжельский карьер--эпсомит!--ФМ(№93438) \\ ярко-белые мелкозернистые агрегаты эпсомита на поверхности юрской глины. \\ Новый минерал для Подмосковья. Материал опубликован в статье М.М.Моисеева и И.А.Новикова Новые находки минералов в Подмосковье Минералогический альманах вып ___ 2011

 

Кремень. Гжель, к В от Москвы. Образец: Геол. музей им. В.В. Ершова МГГУ (Дар: Воларович Г.П.). 12х18 см. Фото: © А.В. Свердлов. См. " Мир камня \ World of Stones", 1993, №1, с.39).

Центр Европ. части России

Юг России

Крым

--Тищенко А.И. Минералы Крыма. - Симферополь: Бизнес-Информ, 2015. 304 с., 72 с. цв. вкл.

Сев. Кавказ, Россия

СЕРГЕЕВИТ              Ca2Mg11(CO3)13-x(HCO3)x(OH)x·nH2O  ?
Найден в зоне окисления богатого сульфидами измененного пироксен-гранатового скарна Sn-месторождения Малый Мукулан в южной части Тырныаузского рудного поля, левый борт долины р.Баксан, Кабардино-Балкария, С.Кавказ. Образует белые тонкозернистые плотные прожилки и желваки до 0.5 см [661]. Ассоциирует с хантитом, эпсомитом, халькантитом, брошантитом, малахитом, гипсом, лимонитом и др. Возможно, является гидратированным(?) хантитом, требует дополнительного изучения.
Название: в честь Евгения Михайловича Сергеева (1924-1997), специалиста в области инженерной геологии, академика АН СССР; Московский Университет.
TS: FM 80182,82947; PMM 1262/1 \\ Источник: Pekov I. V. Minerals First Discovered on the Territory of the former Soviet Union. Moscow, Ocean Pictures Ltd, 1998. -369 p.

--Яхонтова Л.К., Плюснина И.И., Столярова Т.И. и др. Сергеевит - новый водный карбонат магния и кальция. // ЗВМО, 1980, 109, 2, 217-223 \\ ФМ--№82947 (Яхонтова Л.К., 1984)

 

Урал на сайте /www.mindat.org (на 2016.01.25) : минералов - 1057, твердых видов - 727 ; новых минер. видов (type locality) - 81

- пока не найдены (не описаны для Урала на 2014 г.) : сподумен, эвдиалит...:

УРАЛ. Иллюстрированная краеведческая энциклопедия - http://quist.pro/books/ural_01.a.3.php

ПРИРОДНЫЕ ДОСТОПРИМЕЧАТЕЛЬНОСТИ УРАЛА - http://nashural.ru/mesta.htm

Рудники (и не только) Урала - фотогалереи \ видео "Планета Карабаш"

Пермский край, Россия \\ Геологические памятники - http://www.perm-kray.ru/index.htm

Полярный Урал, Россия \\ фото - http://polyarny.net/foto/

ПРИПОЛЯРНЫЙ УРАЛ \\ КЕММЕРИХ А. О.  ПРИПОЛЯРНЫЙ  УРАЛ. ПУТЕВОДИТЕЛЬ. ИЗДАТЕЛЬСТВО «ФИЗКУЛЬТУРА И СПОРТ». МОСКВА 1970 \ веб-публикация

СЕВЕРНЫЙ УРАЛ (64°00'—58°45' с. ш.)

--Минералы, названные в честь ученых, побывавших на Северном Урале - видео - www.youtube.com

Блог Михаила Цыганко - http://zolotoy-kamen.ru

СРЕДНИЙ УРАЛ (58°45' — 56°00' с.ш.

1. Турмалин в тальк-карбонатном метасоматите по гипербазитам. Шабровское м-ние, Ср. Урал, Россия. Образец: ФМ (№28075. Крыжановский В.И., 1926). 2. Барит. Изометричный кристалл. Карабаш, Ю. Урал, Россия. Образец: Минер. музей им. А.Е. Ферсмана РАН (№84294. Пелепенко В.А., 1986). Фото 1-2: © А. Евсеев.

ЮЖНЫЙ УРАЛ (56°00' — 51°00' с. ш.)

--Башкирия \\ Оренбургская обл. \\ Челябинская обл. \\ см. также http://webmineral.ru/deposits/item.php?id=60

Сибирь \ Сибирь в "Атласе мира для минералога". - Местонахождения минералов и примеры находок http://geo.web.ru/druza/L-AtE_Sib.htm \\

--Реутовский В.С. Полезные ископаемые Сибири. - СПб., 1905. - 874 с.: карта. Автор - инженер, редактор и издатель журнала "Вестник золотопромышленности и горного дела вообще" (Томск).

Дополнения к списку (Евсеев А.А. Минералогические находки. Краткий обзор. I. Сибирь. М., 2006. – 157 с. )

Зап. Сибирь

Ср. Сибирь

Красноярский край

--Минеральные ресурсы Красноярского края. Кн. 2. Кадастр месторождений полезных ископаемых. — Красноярск, КНИИГиМС, 2002. С.359

Таймыр п-ов

Нижняя Тунгуска р.

Якутия \\

--663 фото минералов; 595 мин. видов. 57 новых видов \ 595 valid minerals. 57 (TL) - type locality of valid minerals (на 2019.09.12) \\ Источник: http://www.mindat.org/loc-2644.html

- Минералы Якутии - на сайте К.И. Клопотова

--Месторождения - http://www.atlas-yakutia.ru/depositmap.html

Алдан, Якутия

Фрагмент из статьи ЛИЦАРЕВ М.А., ГЕРАСИМЕНКО В.Я., МОЧАЛОВ П.С., КУДАЕВ Э.Ш. Минералы Алданского щита. - Мир камня (World of Stones), 1997, №12, С. 26-36 (42-49).

Маршинцев В.К. Богатства недр Якутии. Полезные ископаемые, минерально-сырьевая база / В.К. Маршинцев, В.Г. Гадиятов ; Академия наук Республики Саха (Якутия). – Воронеж, 2020. – 320 с. + 16 отд. л. цв. ил. ISBN 978-5-9273-3019-5

В книге приведены общие сведения о полезных ископаемых, истории открытия и изучения месторождений Якутии, их геологическом строении, а также о состоянии минерально-сырьевой базы республики. Работа включает следующие разделы: горючие полезные ископаемые, чёрные, благородные и цветные металлы, горнорудное и химическое сырье, строительные материалы, подземные воды, лечебные грязи, цветные камни. По большинству полезных ископаемых даны запасы или ресурсы. Кроме того, по некоторым видам минерального сырья приведены объёмы мировой добычи и краткий обзор крупнейших месторождений страны и мира. Издание рассчитано на широкий круг читателей, специалистов, аспирантов и студентов геологоразведочных учебных заведений. Может использоваться в качестве справочника.

Хабаровский край, Россия

СВ России

--ГЕОЛОГИЯ И МИНЕРАЛЬНО-СЫРЬЕВЫЕ РЕСУРСЫ СЕВЕРО-ВОСТОКА РОССИИ Материалы всероссийской научно-практической конференции 1-3 апреля 2014 г. Якутск 2014. - http://www.diamond.ysn.ru/content/VNPK_Yakutsk_2014.pdf

Магаданская обл.

Агаты СВ России на выставке "Мир камня". Макет-карта. Магаданский областной краеведческий музей. Октябрь 2019 г. "На выставке представлен разнообразный по составу мир камня северо-востока России. Макет-карта дает наглядное представление о географии месторождений цветного и поделочного камня Охотско-Чукотского вулканогенного пояса, открытие которого способствовало зарождению и развитию камнерезного промысла. Искусство обработки камня художниками-камнерезами Магаданской области представлено полированными срезами агатов, шарами, декоративными предметами, скульптурой и картинами в стиле флорентийской мозаики" \\ https://www.2do2go.ru/events. Источник: https://www.culture.ru

Чукотка, Россия (СВ)

Вольфрамит, касситерит, аквамарин. Иультин, Чукотка, Россия. Образец: Музей Terra mineralia, Германия. Фото: © Д. Тонкачеев

Камчатка \\

Йохиллерит. Сиренево-голубой на вулканической бомбе. Фумарола Арсенатная, Второй шлаковый конус, Северный прорыв, Большое трещинное извержение (БТТИ), Толбачик вулкан, Мильковский район, Камчатска, Россия. Образец: Минералогический музей им. А.Е. Ферсмана РАН (№94929. Дар: Агаханов А.А., Пеков И.В.,Лыкова И.С., 2015). Фото: А.А. Евсеев.

Корякия \\ Курильские о-ва

-- Толбачик (= Толбачинский) (Tolbachinskii) вулкан, к ЮЗ от Ключевской Сопки, Камчатка \ Tolbachik volcano, Kamchatka KraiRussia - https://www.mindat.org/loc-5602.html - 55° 49' 59'' North , 160° 19' 59'' East; 501\ 528 фото минералов; 232 \ 260 минералов valid minerals; 123 \ 129 новых минералов  (TL) - type locality of valid minerals. (2019.09.03 \ 2020.05.06)

Дальний Восток

Дальний Восток (Россия) литература по геологии и пол. ископ. (в алфавите авторов) - http://wiki.fegi.ru/index.php/Амур р.

--Новые и редкие минералы Дальнего Востока. - Владивосток: ДВО АН СССР, 1987. - 128 с.

Амурская обл., Россия \\

Приморье, Россия \\

Гояцит Россия.  Бесцветные мелкие таблитчатые тригональные кр-лы (до 0.2 мм) на родохрозите.  2.0 см. М-ние Тигриное, центральный Сихоте-Алинь, Приморье, Россия. Образец: Минерал. музей им. А.Е. Ферсмана РАН (систематическая коллекция, №87743. Поступил в музей в 1991 году. Расположен на витрине exp64-1. Источник: https://www.fmm.ru/FMM_1_87743 . Фото: А. Евсеев, 2020. \\ НМК-196

 

Сахалин \\ фото - http://fotocult.ru/gallery/ \\

Хабаровский край и Еврейская АО, Россия

Ирнимит("синяя яшма "). Ир-Нимийское м-ние, Приохотье, Хабаровский край, Россия. Минералогический музей МГРИ- РГГРУ, №802. Фото: © А.А. Евсеев.

 

Юг Сибири

1. Стильбит. Саввинское м-ние, Кличка, Забайкалье, Россия (№89424, Никифоров А.Б., Шуппе Н.Г., 1987). 2. Клинохлор. Коршуновское м-ние, Иркутская обл., Россия (№92818. Дар: Белаковский Д.И., 2009). Образец 1-2: Минерал. музей им. А.Е. Ферсмана . Фото: © А. Евсеев

Алтай, Россия \ Казахстан \\

Горный Алтай

Восточная Сибирь

Забайкалье, Россия \\ фото - http://www.crystallika.com.postman.ru/

Забайкалье_местонахождения

--ОПИСАНИЕ МЕСТОРОЖДЕНИЙ ЗАБАЙКАЛЬЯ [А.Е. Ферсман]

- Юргенсон Г. А. Ювелирные и поделочные камни Забайкалья. Новосибирск: Наука, 2001. - 390 с.

Бурятия \ на карте 1 \ на карте

Иркутская обл. \\

Кемеровская обл. и Горная Шория

Красноярский край \\ минеральные ресурсы - http://nature.krasn.ru/content.ph

Прибайкалье

Саяны и Присаянье \\

Офит (эмалевидный серпентин). Ильчирский прииск, Вост. Саян, юг Ср. Сибири, Россия. Длина экспоната 16.5 см. Образец: Мин. музей им. А.Е. Ферсмана РАН (Сист. коллекция, №10131. Зикс. 1913). Фото: А. Евсеев, 2020.

Тува \\

Хакасия

--ЛИТЕРАТУРА О РЕСПУБЛИКЕ ХАКАСИЯ Библиографическийуказатель Том 1 Природа и природные ресурсы Хакасии, их охрана и рациональное использование (2-я половина XIX-XX в.)  - http://www.nbdrx.ru/razdeli/resursi/izd/bibukazatel/bib_ukazatel1.pdf

Зарубежные страны

Атлантика

Исландия

Европа

"Фото дня" на сайте или "За месяц вокруг света". 2020.10. 04. Миметезит ("кампилит"). Caldbeck Fell, Камбри, Англия, Великобритания. 8х7 см. Образец: Геолог. музей им. В.И. Вернадского (№22234). Фото: © А.А. Евсеев.

"Фото дня" на сайте или "За месяц вокруг света". 2020.10. 05. Молибденит. [Селимица\ Selimitsa], Витоша, Болгария. Более 6 см. Образец: ФМ. Фото: © А.А. Евсеев.

--Зап. Европа_минералогические особенности (в фотографиях образцов от А до Я) -- Европа_крупные кристаллы \\ Европа _кристаллы_5 см \\ Европа_кристаллы _10 с

Страны Европы в фотографиях минералов по https://www.mindat.org (2019.03.15) : Италия - 48953 фото; Германия - 34409; Франция - 28208; Великобритания - 19 375; Испания - 16809; Португалия -13685; Чехия - 8606 ; Швейцария - 8963

Европа (СЗ) \\ Скандинавия

Норвегия \\ Швеция \\ Финляндия

Норвегия в www.mindat.org

минералы - 921

новые минералы - 85

фото минералов - 5816

на 2019.07.12

Швеция в www.mindat.org

минералы - 898

новые минералы - 185

фото минералов - 3856

на 2019.07.12

Финляндия в www.mindat.org

минералы - 692

новые минералы - 34

фото минералов - 1115

на 2019.07.12

--Wilke, H.-J. (1997) Die Mineralien und Fundstellen von Schweden. Chr. Weise Verlag, Munchen, 200 pp. (in German).

Щелочной массив Ииваара, Финляндия \\ Paakkola Juhani,1970 . РЖ 4В520-1980

З а п. Е в р о п а

Британ. о-ва, Пиренейский п-в \\ Ирландия \\ Корнуолл, Англия

Испания \ Spain \ http://www.mindat.org/loc-5536.html - 16153 фото минералов (2018.11)

Австрия \\ Австрия \ карта и минералогические находки

Альпы \\ Альпы_карты для минералогов \\ The Alps, Europe - 1504 valid minerals. 224 (TL) - type locality of valid minerals; 4336 фото минералов - https://www.mindat.org/loc-292987.html.\\ От Acanthite до Zoisite (TL) \\ (2018.11.18)

--Gramaccioli, C.M. Minerali Alpini e Prealpini. Vol.1-2. Bergamo, 1975. - 473.

Бавария, Германия \\ Баден-Вюртемберг, Германия

Балканский п-ов \\

Бельгия \\ Болгария \\

Венгрия

- Речк, Венгрия \ Recsk Mine, Recsk, Heves County, Hungary

Парадшашварит \ Paradsasvarite - новый минерал группы малахит - розазит из Парадшашвар, горы Матра, Венгрия \\ https://www.mindat.org/min-43597.html

--Feher, B., Szakall, S., Zajzon, N., Mihaly, J. (2015): Paradsasvarite, a new member of the malachite-rosasite group from Paradsasvar, Matra Mountains, Hungary. Mineralogy and Petrology 109, 405-411. \\ Парадшашвар - https://www.rutraveller.ru/resort/3060

Германия \\ фото минералов \\ http://www.mindat.org/rloc.php?loc=Germany \\ http://www.mindat.org/loc-14244.html)

- Люнебург, Ниж. Саксония, Германия \ Luneburg District, Lower Saxony, Germany \\ борацит!!!*\ Boracite  -1) Bergmannisches Journal (1789 ) 2) 23 фото; калистронцит \ Kalistrontite; люнебургит* - 7 фото;

Сев. Рейн-Вестфалия (Германия)

Греция \ Greece - https://www.mindat.org/loc-14188.html - минералов - 807 (из них 37 новых видов) \\ 5775 фото минералов (2018.06)

--Stamatakis, M.G., Hall, A., and Hein, J.R. (1996) The zeolite deposits of Greece. Mineralium Deposita, 31, 473-481. \ цеолитовые м-ния

--Voudouris, P., Katerinopoulos, A., and Melfos, V. (2004) Alpine type fissure minerals in Greece. Doc. Natur. 151, 23-45. \\ Минералы альпийских трещин

Италия \ Italy. \\ в www.mindat.org \\ 1697 valid minerals. 364 (TL) - type locality of valid minerals. 7 (FRL) - first recorded locality of unapproved mineral/variety/etc. 8 erroneous literature entries.

Италия в www.mindat.org

минералы -1748

новые минералы - 379

фото минералов - 52343

на 2020.07.06

Италия в www.mindat.org

минералы -1730

новые минералы - 376

фото минералов - 50899

на 2020.03.10

Италия в www.mindat.org

минералы -1697

новые минералы - 364

фото минералов - 49474

на 2019.07.18

Италия --примеры минералов из списка http://www.mindat.org : Acanthite ; Acanthoide';  Acmonidesite (TL); Actinolite ... Godlevskite ; Godovikovite ; Goethite ; Gold ; Goldfieldite; ... Calciopetersite \ Calcite - 1482 фото \ Calderite; ..Cyrilovite ; Dachiardite-Ca (TL) ; Dachiardite-Na (TL) ; Dadsonite; Danburite..... Lusernaite-(Y) (TL) ; Luzonite ;  Macaulayite; Macdonaldite ? ; Macfallite .... Quadridavyne (TL) ; Quartz - 1858 фото ; Quintinite ; .... Szomolnokite; TacharaniteTadzhikite-(Ce); TaeniteTainiolite ; .... Zirconolite;  'Zirconolite-3T' ; Zirkelite;  Zoisite; var. Thulite

--Новые минералы, открытые в Италии \\ Marco E. Ciriotti, Lorenza Fascia, Marco Pasero. Italian Type Minerals. Pisa: Plus-Pisa university press, 2009, 357 pp. \\ О книге (А. Касаткин) - http://www.minbook.com/new_books_ru.html

Пьемонт, Сев. Италия

- Валь д`Ала (Ала = долина Ала = Валь-ди-Ала = Ала-Таль), к СЗ от Турина, Пьемонт, Сев. Италия \\ везувиан!!; гроссуляр (гессонит)!!!; диопсид!!; титанит!!--xls; Gr, 368-369 \\ на карте1 \ карте2

--- Piccoli G.C., Maletto G., Bosio P., Lombardo B. Minerali del Piemonte e della Valle d'Aosta. Associazione Amici del Museo "F. Eusebio" Alba, Ed., Alba (Cuneo), 2007. - 607 pp.

Сардиния \\ Сицилия \\ Тоскана

Карпаты \\ Македония \\

Польша

Румыния \ Romania \\ 7053 фото минералов (=фд) - https://www.mindat.org/loc-14254.html; 747 минер. видов \ valid minerals; 35 новых минералов (TL) - type locality (2019.07.18)

Сербия \\ Словакия \\ Словения

Франция

--Mineralogie de la France by Eric Asselborn, 2013. 242 pages.

Ле Бо м-ние бокситов, Франция \ Les Baux

Ле-Бо-де-Прованс, Прованс-Альпы-Лазурный Берег, Франция \\ Les Baux-de-Provence, Bouches-du-Rhone, Provence-Alpes-Cote d'Azur, France \\ боксит!! \\ бёмит* \ Bohmite (TL) - Mas Rouge, Les Baux-de-Provence, Bouches-du-Rhone, Provence-Alpes-Cote d'Azur, France

Чехия \ Czech Republic

Швейцария \\

Средиземноморье

Вост. Европа \

Белоруссия \\ Прибалтика

Украина

-- Местонахождения минералов Украины от А до Я

Украинский щит - геологические памятники - Google Maps

Волынь и СЗ Украина

Веберит\ Weberite. Перга, Житомирская обл., Украина. Образец: ФМ (№77577, А.А. Евсеев, 1976; находка и дар). Фото: © А.А. Евсеев.

Донбасс \

- Ликов О.И. Везувиан из скарнов с. Миколаiвки (ЮЗ окраина Донбасса). - Мат. з мiн Укр.. в.2, 1961, 112-115 \\ ЕК_3.1415

Приазовье

Прикарпатье \\ Закарпатье

Молдавия

Евразия

- Средиземноморье

Азия

 

"Фото дня" на сайте или "За месяц вокруг света". 2020.10. 13. Маршит. Частичная псевдоморфоза по конкреции азурита. Рубцовское м-ние,, Алтай, Россия. ~10 см. Образец: ФМ (ОП 2577. Дар: Аносов М.Ю., Левицкий В.В., Никифоров А.Б., 2010). Фото: © А.А. Евсеев

"Фото дня" на сайте или "За месяц вокруг света". 2020.10. 14. Малахит (сферокристаллы до 4 см). Джезказган, Казахстан. Образец: Мин. музей им. А.Е. Ферсмана РАН . Кол.: В.И. Степанов (Дар: Худодян К., 1972). Фото: © А.А. Евсеев.

"Фото дня" на сайте или "За месяц вокруг света". 2020.10. 15. Миметезит. Шах-Миле, Анарак, Исфахан пров.\ Chah Mileh, Anarak, Esfahan, Иран. Из коллекции А.В. Касаткина. Фото: © А. Евсеев. 2017.

"Фото дня" на сайте или "За месяц вокруг света". 2020.10. 16. Мезолит. [Пуна (район)], Махараштра шт., Индия. Более 10 см. Образец: ГГМ им. В.И. Вернадского. Фото: © А. Евсеев.

Минералогические находки Азии (примеры). Клиноцоизит. Алчури, \Alchuri Alpine cleft locality, Alchuri (Alchori; Aschudi)Shigar DistrictGilgit-BaltistanPakistan ; 35° 33' 37'' North , 75° 38' 49'' East . Образцы: ФМ Фото: © А.А. Евсеев.

Казахстан и Средняя Азия

Казахстан и Средняя Азия_А-Я_местонахождения минералов (на карте)

Казахстан \\

- Гаспарит-(La) \ Gasparite-(La) LaAsO4 - новый минерал \\ Vereshchagin, O.S., Britvin, S.N., Perova, E.N., Brusnitsyn, A.I., Polekhovsky, Y.S., Shilovskikh, V.V., Bocharov, V.N., van der Burgt, A., Cuchet, S., Meisser, N. (2019): Gasparite-(La), La(AsO4), a new mineral from Mn ores of the Ushkatyn-III deposit, Central Kazakhstan, and metamorphic rocks of the Wanni glacier, Switzerland. American Mineralogist 104: 1469-1480.

-- Ushkatyn No. 3 deposit, Ushkatyn deposits (Ushkatan), Zhayrem (Zhairem), Karazhal, Karaganda Region, Kazakhstan

--Евсеев А.А. Минералогические находки. Краткий обзор. II. Казахстан и Средняя Азия. М., 2010. - 153 с.

--Каюпова М.М. (1974) Минералогия железных и марганцевых руд Западного Атасу (Центральный Казахстан). Алма-Ата, Наука. 232 с. Митряева Н.М. (1979) Минералогия барито-цинково-свинцовых руд месторождений Атасуйского района. Алма-Ата, Наука. 219 с

--Рожнов А.А. (1982) Сравнительная характеристика марганцевых месторождений Атасуйского и Никопольско-чиатурского типов. Геология и геохимия марганца. М., Наука. 116–121.

Восточный Казахстан

Средняя Азия \\

Киргизия \

Путешествие вокруг Иссык-Куля, Киргизия, август 2019 г. (фото Е. Матвиенко).

Таджикистан \\ Памир \\

Эльбаит (полихромные кристаллы до 15-20 см) в кварце. Зап. Пуштиру, Туркестанский хр.(Ю), Таджикистан. Образец: ФМ (№46790, Беус А.А., 1949). Фото: © А.А. Евсеев.

 

Карамазар рудный район, Сев. Таджикистан: Адрасман (Adrasman) --Алтын-Топкан--Кансай --Кураминский хр

Туркмения \\ Узбекистан

Афганистан \ Afghanistan - http://www.mindat.org/

Пакистан

Кристалл вайриненита. Shengus, Pakistan. Образец: Тусон-шоу-2010. Источник: http://www.rusmineral.ru/

1. Брукит (кристалл более 3 см). Пакистан. Мюнхен-шоу-2007. Фото: © В. Левицкий. 2. Брусит (желтый!). Пакистан. "Гемма". 2018.03.31. Образец: "Русские минералы". Фото: © А.А. Евсеев.

 

Кавказ, ЮЗ Азия

Азербайджан \\

Армения \\

- Калькурмолит* \ Calcurmolite  (Ca,Na)2(UO2)3Mo2(O,OH)11 · nH2O - новый минерал (1958) - Каджаран м-ние, Кафанский рн, Армения \ Sokh-Karasu area, Kadzharan Molybdenum Deposit, Upper Okhca River, Kafan District (mindat.org)

- Зодское (= Зод) м-ние (Au), 10 км к В от пос. Варденис, 110 км к В от Еревана, Армения \\ * (1965) волынскит; мелонит!; * (1977) раклиджит; * смирнит; теллуровисмутит; * (1987) чеховичит; Pk 

--Zod Mine (Sotk deposit), Vardenis, Gegharkunik Province, Armenia

Грузия \\

Израиль

Халамиш вади, Хатрурим бссейн, Израиль \ Halamish wadi (?uq Tamrur), Hatrurim BasinTamar Regional CouncilSouthern District (HaDarom District)Israel ; 31° 9' 47'' North , 35° 17' 57'' East \\ анастасенкоит[ *]\ Anastasenkoite; геленит!; гмалимит* \ Gmalimite (TL); мурашкоит*\ Murashkoite (TL); назаровит* \ Nazarovite (TL) ; негевит* \ Negevite (TL) ; полеховскиит* \ Polekhovskyite (TL) ; халамишит*; Ellinaite *(TL); Zuktamrurite (TL)

- Britvin, S.N., Vapnik, Y., Polekhovsky, Y.S., Krivovichev, S.V., Krzhizhanovskaya, M.G., Gorelova, L.A., Vereshchagin, O.S., Shilovskikh, V.V., Zaitsev, A.N. (2019) Murashkoite, FeP, a new terrestrial phosphide from pyrometamorphic rocks of the Hatrurim Formation, South Levant. Mineralogy and Petrology: 113(2): 237-248.
- Britvin, S.N., Murasko, M.N., Vapnik, Y., Polekhovsky, Y.S., Krivovichev, S.V., Vereshchagin, O.S., Vlasenko, N.S., Shilovskikh, V.V., Zaitsev, A.N. (2019) Zuktamrurite, FeP2, a new mineral, the phosphide analogue of lollingite, FeAs2. Physics and Chemistry of Minerals: 46: 361–369.
- Britvin, S.N., Murashko, M.N., Vapnik, Y., Polekhovsky, Y.S., Krivovichev, S.V., Vereshchagin, O.S., Shilovskikh, V.V., Vlasenko, N.S., Krzhizhanovskaya, M.G. (2020) Halamishite, Ni5P4, a new terrestrial phosphide in the Ni–P system. Physics and Chemistry of Minerals: 47(1): 3.
- Krzatala, A.; Kruger, B.; Galuskina, I.; Vapnik, Y.; Galuskin, E. (2020) Walstromite, BaCa2(Si3O9), from Rankinite Paralava within Gehlenite Hornfels of the Hatrurim Basin, Negev Desert, Israel. Minerals: 10: 407.
- Britvin, S.N., Murashko, M.N., Vapnik, Ye., Polekhovsky, Y.S., Krivovichev, S.V., Vereshchagin, O.S., Shilovskikh, V.V., Krzhizhanovskaya, M.G. (2020) Negevite, the pyrite-type NiP2, a new terrestrial phosphide. American Mineralogist: 105(3): 422–427.

Иран \\ Йемен, Аравийский п-ов \\ Оман \\ Саудовская Аравия

Турция \\ минералы и местонахождения--см. http://www.mineralienatlas.de \\ Ryan C. W. Guide to the Known Minerals of Turkey. Ankara, 1960, 196 p.

- Лейцит и псеволейцит - Kirka-Afyon-Suhut-Isparta Volcanic Field

Индия, Непал, Шри-Ланка

Серебряная минерализация \\ кераргирит; аргентит

Goyal R.S., 1990. Серебряная минерализация в раннепротерозойских породах области Бхарак,.., Раджастхан, Индия... РЖ "Геология" 11Ж157-1991.

- Уваровит - фото- Bandihalli, Tumkur District, Karnataka, India

Индонезия \\

Шри-Ланка

Вост. Азия ( Китай и др.)

Япония \\ http://www.petrovrareminerals.com/articles02.html \\ http://www.mindat.org/loc-14488.htm

Китай \ China \\ www.mindat.org

Китай в https://www.mindat.org

минералы - 1331

новые минералы - 134

фото минералов - 15591

на 2019.07.11

Названия минералов и местонахождений Китая

Китай_географические названия \\ Особенности при переходе от английского варианта к русской транскрипции \\ несколько примеров (от атласа Encarta-2001 к "Атласу мира". М., 1997)

Mianyang Мяньян Xinjiang Синьцзян
Pingwu Пинъу Xixia Сися
Zagunao Дзагунао Xuanhua Сюаньхуа
Zouxian Цзоусянь Xuancheng Сюаньчэн

--фото минералов!!--http://www.williampinch.com/china/

Внутр. Монголия

Аргентотеннантит, кварц и др.. Shijiangshan mine (Dashishan mine)LinxiLinxi CountyChifeng City (Ulanhad League; Chifeng Prefecture)Inner MongoliaChina ; 43° 50' 49'' North , 118° 11' 49'' East \\ Shijiangshan Pb-Zn Mine. Skarn type mineralization rich in Boron minerals. Mining started in 2008. Located NE of the city of Linxi. Образец: ФМ (Дар Давыдов Д.В., 2019). Фото: © А. Евсеев. 2. Барит на горном хрустале. Jinkouhe, Ebian, Сычуань, Китай. Образец: Музей Terra mineralia, Германия. Фото: © Д. Тонкачеев.

Сычуань пров. новые минералы - 6 видов (на 2020.09) \\  www.mindat.org

Тибет , Китай

Хунань, провинция, Китай - http://www.mindat.org/loc-705.html

Флюорит \ Fluorite. Минганг р-к, Хэнань, Китай \ Minggang Mine, Shihe DistrictXinyangHenanChina. Более 20 см. Образец: "Русские минералы". Фото: © А.А. Евсеев. \\ 90 фото - www.mindat.org/gallery

 

Юньнань \ Yunnan \\ www.mindat.org \\ Флюорит_Китай и Монголия

Вьетнам \\ Индонезия - см. http://www.mineralienatlas.de/ \\ Камбоджа \\ Лаос\ Малайзия \\

Монголия \

- Khaldzan Buragtag massif, Myangad DistrictKhovd ProvinceMongolia ; 48° 24' 30'' North , 91° 57' 2'' East \\ Алюминоцерит-(Ce) \ Aluminocerite-(Ce) ; бацирит \ Bazirite; коронадит! \ Coronadite ; ферриалланит-(Ce) \ Ferriallanite-(Ce) (TL) ; хинганит-(Ce) \ Hingganite-(Ce) --фото!; чевкинит-(Ce)\ Chevkinite-(Ce) ; эльпидит \ var: Calcian Elpidite - фото!; энигматит \ Aenigmatite - фото

Мьянма (быв. Бирма)

- Авдеевит Avdeevite  (Na,Cs)(Be2Li)Al2(Si6O18)  - новый минерал из группы берилла \\ первоначальное местонахождение \ Type Locality -
  Palelni mine ("Kat Chay mine"), Khetchel village (Cache village; Khat Che village), Molo quarter, Momeik Township, Kyaukme District, Shan State, Myanmar \\ Agakhanov, A.A., Stepanenko, D.A., Zubkova, N.V., Pekov, I.V., Pautov, L.A., Kasatkin, A.V., Karpenko, V.Y., Agakhanova, V.A., Skoda, R. and Britvin, S.N. (2019) Avdeevite, IMA 2018-109. CNMNC Newsletter No. 47, February 2019, page 199; European Journal of Mineralogy, 31: 199–204

Таиланд \\ Флюорит!!--инкрустирует (!) кристаллы антимонита; м-ние не указано--фото--www.mindat.org \\ Unnamed quarry, Chiang Mai Province, Thailand

Филиппины \\

ЮВ Азия

Африка

Африка_Местонахождения минералов от А до Я (примеры) \\ новое на сайте!

Сев. Африка и Зап. Африка

Алжир \\ Гана \\ Гвинея \\ Египет \\

Либерия, Зап. Африка \\

Камерун \\ вивианит!!! Vivianite ; новые минералы - Mantienneite (TL) \ Remondite-(Ce) (TL)

Мали

Марокко

Марокко в www.mindat.org

минералы - 534

новые минералы - 28

фото минералов - 10159

на 2019.07.18

 

 

Нигерия: Ferronigerite-2N1S (TL) \\ Liebermannite (TL) \\ Zagamiite (TL)

Нигерия в www.mindat.org

минералы - 141

новые минералы - 3

фото минералов - 192

на 2019.07.10

 

 

Чад \\

Экв. и Южн. Африка

Ангола \\ Ботсвана \\

Габон

1. Шерветит* \ chervetite. Мунана\ Mounana*, Габон. Кристаллы до 1,5 см. (№73303). Образец: ФМ. Фото: © А.А. Евсеев. 2. "Изумруд в кварце. Кагем р-к, Замбия \ Kagem Mine, Zambia. Аналогичные образцы встречаются и у нас на Урале".(В. Левицкий ). Образец: Тусон-шоу-2010. Источник: http://www.rusmineral.ru/info/news.php

 

Замбия \ Zambia (ныне) = Сев. Родезия (быв.), Африка

Зимбабве \\ фото: бикитаит*--7; борнит!! - 3 (xl>7 см) ; хризоберилл!! - 10; александрит!! - 26; эвклаз!!--40; кермезит!!-14; кианит!--8; топаз--26; зимбабвеит* - 4

Зимбабве в www.mindat.org

минералы - 324

новые минералы - 3

фото минералов - 347

на 2019.07.18

Камерун

Камерун в www.mindat.org

минералы - 91

новые минералы - 2

фото минералов - 18

на 2019.07.10

 

 

Конго НР

Конго ДР (быв. Заир) \\ Buttgenbach H. Mineraux de Belgique et du Congo Belge. Liege, 1947, 590 p.

Алмаз. Кубообразные кристаллы.(20.15, 7.78, 55.70 кар.). Киншаса р-к \ Kinshasa mine, ДР Конго (быв. Заир). Образец: ФМ (МВХ 623\25, 26, 28). Фото: © А.А. Евсеев

- Катанга пров., ДР Конго \\ Катанга (фр. Katanga) — провинция Демократической Республики Конго. (до 2015 г.) \\ Источник - https://ru.wikipedia.org/wiki/Катанга_(провинция) \\ см. на карте 1 - 2 - 3 - 4 \\  С 1971 по 1997 год официально называлась провинция Шаба . \\ Выдающиеся находки минералов урана - ванденбрандеит \ Vandenbrandeite Cu(UO2)(OH)4; кюрит*\ Curite Pb3(UO2)8O8(OH)6·3H2O; кубические кристаллы уранинита, псевдоморфозы по ураниниту; сенжьерит!! \ Sengierite (TL)

    --В 2015 году провинция Катанга была упразднена, территория разделена между ТанганьикойВерхним ЛомамиЛуалабой и Верхней Катангой. \\ Источник (2018): https://ru.wikipedia.org/wiki/Катанга_(провинция)

Шахеру г.*, Ньирагонго, вулк., Сев. Киву, ДР Конго \ Mount Shaheru, Nyiragongo VolcanoNyiragongo TerritoryNorth KivuDR Congo ; 1° 28' 59'' South , 29° 13' 59'' East \\ гётценит* \ Gotzenite (TL) ; дельхайелит*; кирштейнит*\ Kirschsteinite (TL) ; комбеит* \ Combeite (TL) ;

-- Sahama, T.G., Hytonen, K. (1959) Delhayelite, a new silicate from the Belgian Congo. Mineralogical Magazine: 32: 6-9.

Намибия \\

- von Bezing, L., Bode, R., Jahn, S. (2016) Namibia Minerals and Localities II. Edition Kruger-Stiftung, Bode Verlag GmbH, Salzhemmendorf, Germany, 661 pages (in English).

Намибия в www.mindat.org

минералы - 783

новые минералы - 108

фото минералов - 14729

на 2019.07.30

Гетерозит \ Heterosite. Сандамап, Эронго, Намибия \ Sandamap pegmatite (Sandamab pegmatite), Sandamap North Farm 115 (Sandamab)DauresErongo RegionNamibia ; 21° 52' 41'' South , 15° 20' 42'' East (est.). Образец: "Русские минералы". Фото: © А. Евсеев

Экв. Гвинея

Ферроколумбит. Рио-Муни, Экв. Гвинея. Образец: Мин. музей им.А.Е. Ферсмана РАН ( №83196. Степанов В.И.). Фото: © А.А. Евсеев.

ЮАР

Южн. Африка в www.mindat.org

минералы - 911

новые минералы - 76

фото минералов - 5460

на 2019.07.18

Wilke D.P., 1963. Пегматитовые месторождения. Район Палакоп, Летаба, Трансвааль, ЮАР \\ РЖ "Геология" 11В374....

 

Вост. Африка \\ Бурунди \\ Кения

Мадагаскар \\ 352 достоверных вида, 15 новых видов и 2387 фото минералов на 2018.05

Мадагаскар в www.mindat.org

минералы - 369

новые минералы - 17

фото минералов - 3341

на 2019.07.12

Малави \\

Мозамбик \

Руанда \\ минералы - http://www.mindat.org/loc-21896.html \\ местонахождения - http://www.mindat.org/rloc.php?loc=Rwanda

Сомали \\ Судан

Танзания \\ http://www.mindat.org/loc-4384.html \\ м-н-ния - http://www.mindat.org/ \\ Танзания-2017_поездка минералогов --https://www.mineralatlas.eu/?l=11358

Уганда \\

Эфиопия

Австралия

Австралия и Новая Зеландия

--АВСТРАЛИЯ и НОВ. ЗЕЛАНДИЯ. Местонахождения минералов от А до Я (примеры)

Австралия в www.mindat.org

минералы - 1451

новые минералы - 174

фото минералов - 13394

на 2019.07.18

Новая Зеландия в www.mindat.org

минералы - 455

новые минералы - 13

фото минералов - 1687

на 2019.07.12

--Sutherland, F.L., Webb, G. (2014) Gemstones & Minerals of Australia. Reed New Holland, Chatswood, NSW, 144 pages and maps.

Зап. Австралия (С)
Северная территория
Квинсленд
Зап. Австралия (Ю)
Южная Австралия

Нов. Южн. Уэльс

Тасмания

 

 

Виктория, Австралия \ https://www.mindat.org/loc-195.html: 401 достовер. минерал. видов \ valid minerals. 18 (TL) - новых видов \ type locality of valid minerals.(2019.12), в том числе - бетпакдалит-FeFe* \ Betpakdalite-FeFe (TL); уайчпруфит (по КМС) \ Wycheproofite (TL)

Западная Австралия \ Western Australia \\ https://www.mindat.org/loc-15624.html \\ колорадоит!!-2фд--Калгурли

Западная Австралия в www.mindat.org

минералы - 702

новые минералы - 58

фото минералов - 1581

на 2019.07.18

Мукаит (яшма). Мука-[Стейшн] \ Mooka [Station], Kennedy Ranges near Gascoyne Junction, ~ 160 км к З от Карнарвон \ Carnarvon, Зап. Австралия. Образец: Музей Terra mineralia, Германия. Фото: © Д. Тонкачеев

Квинсленд

Новый Южный Уэльс \

Лабрадор!!--Hogarth Range labradorite, Mummulgum, Rous Co., New South Wales, Australia --фото (бесцветные обломки до 4 см; из выветрелых базальтов)

Северная территория \\

Needham R.S.,1988 \\ Аллигейтор-Ривер, Северная территория, Австралия. \\ РЖ "Геология"- 2Ж143-1992

Тасмания \\

Южная Австралия

Давидит-(La) \ Davidite-(La) La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38. . [Олари \ Olary], Ю. Австралия. Образец: ФМ (№54419. Колл.: Егоров К.Ф., 1952). Фото: © А.А. Евсеев.

Новая Зеландия

Восточное полушарие

Ю ж н о е _ п о л у ш а р и е

З а п а д н о е _ п о л у ш а р и е

Северная Америка \ Сев. Америка--фото минералов

Гренландия

Гренландия в https://www.mindat.org

минералы - 481

новые минералы - 84

фото минералов - 935

на 2019.04.11

--Petersen, O. V. & Johnsen, O. (2005): Mineral species first described from Greenland. Canadian Mineralogist, Special publication no. 8., 184p.

Скалистые горы \ Rocky Mountains, Канада \ США

Скалистые горы, Сев. Америка \ Rocky Mountains, North America \\ https://www.mindat.org/loc-301977.html \\ 1072 valid minerals. 768 (TL) - type locality of valid minerals \\ фото минералов - 10053 \\ 10 примеров: Abernathyite \\ Azurite \\ Dachiardite-Na \\ Dzharkenite \\ Mackayite \\ Muscovite\\ Tacharanite \\ Tyuyamunite ! \\ Zalesiite \\ Zwieselite (2020. 03)

Канада

Минералы Канады на странице https://www.mindat.org/loc-8188.html (на 2019.01.05 \ 2020.09.10): 1628 \ 1679 минеральных видов \ valid minerals; 247 \ 256 новых видов ; 21133 \ 22646 фото минералов

-- Трейл Р. Дж. Каталог минералов Канады. \ Trail R. J. Catalogue of Canadian Minerals. Revised 1980. Geol. Surv. of Canada Paper 80-18, 1983, 483 p.

США \\ http://www.mineralienatlas.de/lexikon/index.php/USA

США в https://www.mindat.org

минералы - 2645

новые минералы - 831

 

на 2019.05.10

American Mineral Treasures [Сокровища минералов Америки]. 2008. - 368 p. \\ Подробнее: http://www.lithographie.org/bookshop/hc_american_mineral_treasures.htm \\ см. также http://geo.web.ru/druza/l-USA_AMT.htm

Новые минералы - 830 видов (2019.01.15). Источник: https://www.mindat.org/loc-3366.html

Топографическая минералогия ( литература о местонахождениях по штатам) \\ http://www.minsocam.org/

Аляска - альмандин; Вашингтон; Орегон- Tschernichite; Айдахо

Монтана; Сев.и Ю. Дакота; Вайоминг - шортит*
Миннесота; Айова ;
Мичиган; оз. Верхнее

СВ, Коннектикут; Масс., Нью-Йорк, Мэн - колумбит-Mn; Нью-Джерси; Пенсильвания - самарскит-(Y)

Калифорния - гидроборацит; Невада; Аризона - гематит ; Юта
Колорадо-- самарскит-(Y) ; родохрозит ; Нью-Мексико

Оклахома; Миссури; Арканзас - алмаз ; Техас \\ вавеллит ; кварц ;

Огайо; Джорджия; Теннесси; Флорида

кальцит

Аппалачи; Виргиния - бирюза ; Сев. Каролина - бикитаит

Минералы США в фотографиях: http://www.mindat.org (примеры из 100 новых фотографий по https://www.mindat.org/gallery.php?loc=3366&pco=1 (на 2020.10.20)

 

Сев. Америка (С)

Аляска \\

Нунавут \\

Северо-Западные территории \ North-West Territories, Канада \\

1. Норденшельдин. Сьюард п-ов, Аляска, США. Образец: ФМ (№83167, Александров С.М., 1984). 2. Наньпинит. Старгайзер Клейм, О'Грейди батолит, Северо-Западные территории \ Stargazer Claim, O'Grady Lake area, Northwest Territories, Канада. Более 5 см. Образец: ФМ (Дар: Paterson J., 2000). Фото 1-2: © А.А. Евсеев.

Юкон

- LAFLAMME, J.H.G., ROBERTS, A.C., CRIDDLE, A.J. & CABRI, L.J. (1995): Owensite, (Ba,Pb)6(Cu,Fe,Ni)25S27, a new mineral species from the Wellgreen Cu-Ni-Pt-Pd deposit, Yukon. Canadian Mineralogist 33, 665-670.  \ Wellgreen Cu-Ni-PGE deposit, Kluane District, Whitehorse mining district, Yukon, Canada

Сев. Америка (В)

Сев. Америка (В)_находки крупных кристаллов (10 см и более)

Айова \\

Арканзас, США

Вермонт \\ Верхнее оз \\ Виргиния \\ Висконсин \\ Джорджия \\ Иллинойс \\ Индиана, США \\ http://www.mindat.org/loc-16287.html \\ более 100 фото минералов из осадочных пород (доломит, миллерит!!; целестин!; флюорит! и др.) www.mindat.org/gallery

Квебек \

Кентукки, США. \\ Коннектикут \\ Лабрадор \\

Манитоба пров., Канада - https://www.mindat.org/loc-20365.html \\ минералы - 300 видов; новые минералы -12 видов (бобфегусонит; воджинит; манитобаит; танкоит; черниит и др. ); фото минералов -424 \\ на 2019.05

Массачусетс \\

Миннесота \\ Миссури \\ Мичиган \\ Мэн \\

Мэриленд, США

Новая Шотландия, Канада \\ Нью-Брансуик пров., Канада\ New Brunswick \\

Нью-Гэмпшир, США \\ Нью-Джерси, США - http://www.mindat.org

Нью-Йорк \\

Огайо

Оклахома \\

Онтарио\ Ontario, Канада

Содалит. Банкрофт, Онтарио, Канада. Образец: ФМ (№41760. Обмен, 1940.). Фото: © А.А. Евсеев

Пенсильвания, США - http://www.mindat.org/loc-14026.html

--целестин*!! - параллельно-волокнистые агрегаты Bell's Mill, Bellwood, Blair Co., Pennsylvania, USA ; 40° 36' 21'' North , 78° 19' 23'' West - первоначальное местонахождение \ Type Locality - фото 

Сев. Каролина \\ Теннесси \\ Техас

Флорида

Сев. Америка (З)

Минералы запада США в фотографиях : http://www.mindat.org (примеры из 100 новых фотографий по https://www.mindat.org/gallery.php?loc=14409&pco=1 (на 2020.10.20.)

Аляска - альмандин ; Вашингтон - цектцерит; Орегон - Tschernichite

Айдахо - пироморфит

Монтана -Auriacusite - фото

Сев. и Южн. Дакота - монтгомериит; синканкасит
Калифорния - золото; бенитоит*

Невада - аметист

Вайоминг - шортит*; Колорадо-самарскит-(Y) ; родохрозит

Небраска; Канзас- галенит

Калифорния - гидроборацит

Юта; Аризона - гематит

Нью-Мексико - полилитионит

Техас - каломель

Айдахо, США \\

-- Peacock Mine, Cuprum, Seven Devils Mining District, Adams Co., Idaho, USA ; 45° 10' 8'' North , 116° 39' 3'' West \\ повеллит*\ Powellite (TL) Ca(MoO4)

Альберта, Канада

Аризона, США \\ на странице http://www.mindat.org/loc-3293.html \\ в сводке Anthony J.W. et al, 1995 --809 мнр. видов, из них 76 новых видов \\ Anthony, J.W., et al (1995), Mineralogy of Arizona, 3rd.ed.:

Аризона, США в https://www.mindat.org

минералы - 690

новые минералы - 46

 

на 2008 г.

Аризона, США в https://www.mindat.org

минералы - 842

новые минералы - 82

фото минералов - 10662

на 2015.09.27

Аризона в www.mindat.org

минералы - 913

новые минералы - 87

фото минералов - 16367

на 2019.08.07

Вайоминг, США

Колорадо \\ http://www.mindat.org

Колорадо шт. в https://www.mindat.org

минералы - 877

новые минералы - 84

фото минералов - 6996

на 2019.07.12

Минералы Колорадо в фотографиях http://www.mindat.org (5 примеров - A - D - M - T - Z): акантит \ Acanthite --фото \\ девиллин \ Devilline--фото \\ магнезиопаскоит \ Magnesiopascoite --фото \\ Тангеит \ Tangeite - фото \\ зуниит \ Zunyite (TL) - фото

--Колорадо, США \ карта и минералогические находки

Манитоба, Канада

Титановоджинит \ Titanowodginite. Mn2+TiTa2O8. Танко пегматит, Манитоба, Канада \ Tanco pegmatite, Bernik Lake, Manitoba, Канада. Черные идиоморфные зерна титановоджинита размером до 0.5см в кварц-мусковитовом агрегате. Образец 3 см. Размер кристаллов до 0.5 см. Образец: Мин. музей им.А.Е. Ферсмана РАН (№91854). Фото: https://www.fmm.ru/index.php?curid=351694

 

Монтана \\ Невада \\ Нью-Мексико, США \\

Нью-Мексико в www.mindat.org

минералы - 709

новые минералы - 17

фото минералов - 6752

на 2019.07.17

Саскачеван, Канада \\

Техас, США

Южная Дакота, США \\

Юта, США

Юта в www.mindat.org

минералы - 813

новые минералы - 113

фото минералов - 7817

на 2019.08.25

- Лисит * \ \ Leesite (TL) - новый минерал из Юты \\ Jomac Mine, White Canyon, San Juan Co., Utah, USA ; 37° 51' 42'' North , 110° 19' 9'' West
-- Olds, T.A., Plasil, J., Kampf, A.R., Spano, T., Haynes, P., Carlson, S.M., Burns, P.C., Simonetti, A., Mills, O.P. (2018): Leesite, K(H2O)2[(UO2)4O2(OH)5]•3H2O, a new K-bearing schoepite-family mineral from the Jomac mine, San Juan County, Utah, U.S.A. American Mineralogist, 103, 143-150. Назван в честь американского дилера и коллекционера минералов Брайана Лиса \ Named in honor of the American mineral dealer and collector Bryan K. Lees (born 1957)

Сев. Америка (Кордильеры)

Британская Колумбия, Канада - http://www.mindat.org/loc-14311.html \\ из новых минералов: Cowlesite (TL) \\ Ferrierite-Mg (TL) \\ Hedleyite (TL) \\ Mannardite (TL)\\ Tetraferroplatinum (TL) \\ Zoltaiite (TL)

- Кварц!!--японский двойник - Harrison Lake, Chilliwack, Regional District Fraser Valley, British Columbia  Canada (2008-2011) \ фото

Британская Колумбия в https://www.mindat.org

минералы - 510

новые минералы - 24

фото минералов - 1071

на 2019.07.13

Вашингтон, США \\ Cannon, B. (1975): Minerals of Washington: 53.

Указатель мест находок минералов в штате Вашингтон, США. Ream L. R., 1991 \\ РЖ"Геология" 4В347--1992

Орегон

Калифорния, США \\ http://www.mindat.org/loc-3424.html \\ фото \\ Калифорния_минералы по контуру

--Чемпион майн ("Чампион")., Калифорния, США \ Champion Mine, White Mountain Peak, White Mts, Mono Co., California, USA \\ андалузит!! --7фото ; аугелит!!! - 6 фото; кварц!--xls<10 см ; рутил!! -57 фото

Калифорния в www.mindat.org

минералы - 1068

новые минералы - 150

фото минералов - 10851

на 2019.08.07

Нью-Мексико в www.mindat.org

минералы - 710

новые минералы - 17

фото минералов - 6785

на 2019.08.07

- Дюмортьерит \ Dumortierite (Al,Fe3+)7(SiO4)3(BO3)O3 \ Dehesa Dumortierite deposit, Alpine, Laguna Mountains, San Diego County, California, USA

- Осарсит \ Osarsite \ (Os,Ru)AsS \ * Gold Bluff beach, Gold Bluffs, Orick, Orick Mining District, Humboldt Co., California, USA (Type Locality)

Гавайские о-ва \ Hawaii, Тихий океан; США

Мексика

Мексика в https://www.mindat.org

минералы - 759

новые минералы - 89

фото минералов - 17 203

на 2019.08.07

Болеит. [Санта-Росалия], Болео, Ниж. Калифорния Южн., Мексика. Дар: Кантор Б.З. (колл. Кантора Б.З., №3667, пост. 1980.12 от В.И. Степанова). Образец: Минер. музей МГРИ. Фото: © А.А. Евсеев.

1. Аметист. Piedra Parada, Las Vigas, Веракрус шт., Мексика. (Р-3125. Дар: Карен Хруби). Образец: Минер. музей МГРИ. 2. Ангидрит. Найка \ Naica, Чиуауа, Мексика. Сросток голубых слабо расщепленных кристаллов. Около 15 см. Образец: ФМ (№86161. Обмен: Бахати М., 1988). Фото 1-2: © А.А. Евсеев.

Центральная Америка \\

Куба

Гидросиликаты Ni

Южная Америка

Южная Америка_Местонахождения минералов от А до Я (примеры) \\ новое на сайте!

Анды.Южная Америка \ AndesSouth America. Короткий список минералов от A до Z (до 26 названий). Источник: https://www.mindat.org . Выборка: первый минерал на каждую букву английского алфавита в списке для страны. Сокращение: TL- type locality (новый минерал). Подробнее см  https://www.mindat.org/loc-332873.html \\ 1298  минералов \ valid minerals; 251- новые минералы \ (TL) - type locality of valid minerals; 16739 - фото минералов (2020.07.26) \\ Acanthite \ Adamite (TL) ; Babanekite; Cadmoselite; Danalite ; Edingtonite ; Fairfieldite ; Gadolinite-(Y) ; Hagendorfite ;  Idaite ;  'Jagueite' (FRL) \ Jahnsite-(CaMnMg) ; Kalinite; LacroixiteMackayiteNacrite ; Obradovicite-KCu (TL) ; PachnoliteQuartz ; Ramaccioniite (TL) ;  Safflorite ;Tacharanite ;  Uchucchacuaite (TL) ; Vaesite ; Wairakite ; Xanthoconite; Yavapaiite ; Zalesiite \\ 2020.07.26

Ю. Америка (СЗ)

Венесуэла \\

Поиски и добыча золота в Венесуэле. РЖ "Геология" -2Ж133-1992 г.

Гайана \ Guyana (до 1966 г. - Британская Гвиана) \\ Гондурас \\

Колумбия \\

Эквадор

Аргентина - www.mindat.org

Аргентина в www.mindat.org

минералы - 750

новые минералы - 53

фото минералов - 2464

на 2019.07.10

- Лома Бланка м-ние (бораты) \ Loma Blanca borate deposit, Coranzuli, Susques Department, Jujuy Province, Argentina \\ бура; иниоит \ Inyoite ; теруггит* \ Teruggite; улексит

Боливия \\ www.mindat.org : минералы - 499 ; новые минералы - 45 видов; фото минералов 5838 (на 209.05.15)

Перу \\

Аурипигмент на барите. Кирувилка р-к, Ла-Либертад, Перу \ Quiruvilca Mine, La Libertad, Peru. (В. Левицкий). Образец: Тусон-шоу-2010. Источник: "Русские минералы"  

Перу в www.mindat.org

минералы - 378

новые минералы - 29

фото минералов - 5133

на 2019.07.12

Чили

Чили \ Chilehttps://www.mindat.org/loc-638.html  \\ фото минералов -3908 \  минералы \valid minerals -741 ; новые минералы \ type locality of valid minerals -141 (TL) (на 2020.04.29)

Магнезиообертит \ Magnesioaubertite (Mg,Cu)Al(SO4)2Cl · 14H2O . Ла Вендида р-к, Сьерра-Горда, Антофагаста, Чили \ La Vendida Mine (Rio Tinto Mine), Sierra GordaAntofagasta ProvinceAntofagastaChile ; 22° 52' 36'' South , 69° 20' 27'' West. . Образец: ФМ (№95362. Дар: Пеков И.В., 2016.). Фото: © А.А. Евсеев \\ НМК-195

Метасидеронатрит \ Metasideronatrite Na2Fe(SO4)2(OH) · H2O . Коронель Мануэль Родригес р-к, Мехильонес п-ов, Антофагаста, Чили \ Coronel Manuel Rodriguez mine, Mejillones peninsulaMejillonesAntofagasta ProvinceAntofagastaChile. Образец: ФМ (№95380. Дар: Пеков И.В., 2016.). Фото: © А.А. Евсеев \\ НМК-195

Бразилия \\ минералы \ достоверные виды - 601 \ 854; новые виды - 51 \ 77; местонахождения \ localities - 843 \ ... ; фото минер. – 5430 \ 6613; фото мест – 74 \ 890 (на 2009.08.05 \ 2020.09.19) \\ Источник: http://www.mindat.org/loc-366.html \\ http://www.mindat.org/rloc.php?loc=Brazi

-- Franco, R.R. (editor) (1972) Minerals of Brazil. 3 Volumes, Editora Edgard Blucher, Sao Paolo, Brazil: 426 pp. [in English and Portuguese].

-- О` Тулле м-ние (Ni), Минас-Жерайс, Бразилия \ O'Toole depositFortaleza de MinasMinas GeraisBrazil ; 20° 53' 55'' South , 46° 42' 45'' West - первое в Бразилии сульфидно-никелевое м-ние--T. L. Brenner , N. A. Teixeira ,  J. A. L. Oliveira , N. D. Franke ,  J. F. H. Thompson The O'Toole nickel deposit, Morro do Ferro greenstone belt, Brazil. - Economic Geology (1990) 85 (5): 904-920 \\ ирарсит \ Irarsite ; котульскит \ Kotulskite; пентландит \ Pentlandite ; рениит \ Rheniite \\ ЕК \\ https://pubs.geoscienceworld.org

Баия, Бразилия

- Carnaiba mining district, Pindobacu, Bahia, Brazil

Минас-Жерайс шт. \\ минералов - 713, из них твердых видов - 491, из них новых видов - 46 (на 2015.09. 30) \\ источник: http://www.mindat.org

- Menezes, L.A., Martins, J.M. (1984) The Jacupiranga mine, Sao Paulo (Brazil). Mineralogical Record: 15(5):261-270.

Параиба \\

Крупный (около 5 см) кристалл редкого танталового минерала ринерсонита. Frei Martinho, Параиба, Бразилия.(В. Левицкий). Образец: Мюнхен-шоу-1010. Фото: http://www.rusmineral.ru/info/news.php

Риу-Гранди-ду-Норти, Бразилия \\ Риу-Гранди-ду-Сул, Бразилия \\ Сан-Паулу

Агат двухкамерный с псевдосталактитом. Бразилия. Образец: ФМ (ОП-1582). Фото: © А.А. Евсеев.

Хризоберилл. Колатина \ Colatina, Эспириту-Санту, Бразилия. Образец: Тусон-шоу-2015. Фото: © И. Лыкова \\ Известное местонахождение хризоберилла - 22 фото www.mindat.org

Уругвай

АНТАРКТИДА \\

Антарктида в www.mindat.org

минералы - 345

новые минералы - 18

фото минералов - 71

на 2019.07.19

Новые минералы из Антарктиды (18 видов на 2019.07.19): Antarcticite (TL) \\ Boralsilite (TL) \\ Chopinite (TL) \\ Dissakisite-(Ce) (TL) \\ Earlandite (TL) \\ Ernstburkeite (TL) \\ Ferri-kaersutite (TL) \\ Gottardiite (TL) \\ Хмаралит Khmaralite (TL) \\ Kushiroite (TL) \\ Magnesiohogbomite-2N4S (TL) \\ Mutinaite (TL) \\ Spheniscidite (TL) \\ Stornesite-(Y) (TL) \\ Tassieite (TL) \\ Terranovaite (TL) \\ Wassonite (TL) \\ Weddellite (TL)\\

Rosenberg Phillip E., 1988. Aluminum fluoride hydrates, volcanogenic salts from Mount Erebus, Antarctica. - American Mineralogist (1988) 73 (7-8): 855–860. \\ текст

Вокруг Антарктиды (прилегающие территории)_минералогические находки

Океаны

Атлантический океан

Тихий океан

Новая Гвинея о., Океания, Тихий океан; Индонезия \ Папуа - Новая Гвинея \\ второй по величине остров Земли (после Гренландии) \\ Новая Каледония -- геология и пол. ископаемые

Гавайские о-ва \ Hawaii, Тихий океан; США

- палагонит в туфах вулкана Оаху \\ справ. "Минералы" (М-4-2, 110)

Таити о., Франц. Полинезия

Фиджи, Тихий океан

Южное полушарие

Весь мир

"Вокруг света"_ 6 фотографий минералов со страниц http://geo.web.ru/druza/in_NMK.htm

"Вокруг света" - 6 минералов с 5 пяти материков. 1. Содалит. Канада. 2. Барит. Сев. Кавказ. Корунд. Ольхон о., оз.Байкал . 4. Кунцит. Бразилия. 5. Ванадини. Мибладен, Марокко. 6. Малахит. Австралия

"Вокруг света" - 6 минералов с 5 пяти материков.

1. Тремолит. Балмат, округ Сент-Лоренс, Нью-Йорк, США. Редкая огранка из прозрачного тремолита, обогащенного Mn (разн."гексагонит"). Образец: Музей штата Нью-Йорк \ New York State Museum (г. Олбани). Фото: © "Русские минералы". 2. АльмандинСросток трех ромбододекаэдрических кристаллов (до 12 см) в мусковитовом сланце. Макзапахк (= Макзабак), Кейвы, Кольский п-ов, Россия. Образец: ФМ (№92295, Аносов М.Ю., 2007). 3. Андрадит-гроссуляр. Дашкесан, Азербайджан. Кристаллы до 2 см. Образец и фото: © Б.З.Кантор. 4. Топаз. Минас-Жерайс, Бразилия. Образцы: ФМ. 5. Мунанаит. Мунана, Габон. Образец: ФМ (№74691. Поступл. 1973 г.). 6. Варисцит ( зеленые прожилки), фоггит (белые оторочки по краям прожилков). Milgun Station, Австралия. 4х5 см. Образец: ФМ (№77879, Kristiansen R., 1976). Фото 2, 4-6: © А.А. Евсеев.

"Вокруг света"_ 6 фотографий минералов со страницы 33_fo_325.htm

1. Целестин. Клей Сентер, Огайо, США. Высота более 15 см. Образец: "Русские минералы". 2. Виллиомит. Коашва р-к, Хибины, Кольский п-ов, Россия. Просвечивающий спайный выколок. Около 5 см. Образец: ФМ (№89837). 3. Киноварь. Китай. Кристаллы-двойники до 2-3 см. Айупин, Китай. Образец: ФМ (№66939). 3. Аметист и розовый кварц (кристаллы!) из Бразилии. Кварц с включениями гётита из Казахстана. Образцы: ФМ. 5. Ванадинит. Мибладен, Марокко. Кристаллы до 4 см. Образец: ФМ (№86087. Обмен с R. Triebl, 1988). 6. Фото: © А.А. Евсеев 6. Опал (благородный опал). Квинсленд, Австралия. Образец: ФМ. (№10921, горн. инж. Иосса В.А., 1918). Фото 1-6: © А.А. Евсеев.

Страны мира и регионы на страницах базы данных о минералах www.mindat.org (примеры)

Страна, регион, м-ние минералы новые виды фото минералов дата
Камчатский край, Россия
555
158
599
20.10.07
- Толбачик, Камчатка
278
129
532
20.10.07
Италия
1753
381
52977
20.10.07
Япония
1353
151
2034
20.10.07
Канада
1679
256
22768
20.10.07
Калифорния, США
1074
152
11570
20.10.07
Австралия
1480
179
14166
20.10.07
Бразилия
854
77
16066
20.10.07
Антарктида
370
18
78
20.10.07

***

1. Эритрин. Маунт-Кобальт Майн \ Mount Cobalt Mine, Cloncurry, Клонкарри, Квинсленд, Австралия. Образец: Музей Terra mineralia, Германия. Фото: © Д. Тонкачеев. 2. Крокоит . Аделаида Майн, Дундас, Тасмания, Австралия. Кристаллы до 10 см. Образец: John Cornish Minerals. Денвер-шоу, 2013.09. Фото: © А. Евсеев.

Минералогические находки крокоита и эритрина в фотографиях www.mindat.org , с дополнениями.
Составил  А. Евсеев, 2020.

1. Молибденит. [Селимица\ Selimitsa], Витоша, Болгария. Образец: ФМ. Фото: © А..А. Евсеев. 2. Демантоид (разн. андрадита). Полдневая д., Ср. Урал, Россия. Образец: ФМ (№49848, пост. 1950 г.). Фото: © А.А. Евсеев 3. Морганит. Моховая ж., Малханский хр., Забайкалье, Россия. Образец: ФМ (№87636, приобретение 1990 г.)  4. Родохрозит. Суит-Хоум Майн \ Sweet Home Mine, Колорадо, США. Образец: Денвер-шоу-2008. Фото: © М. Моисеев. 5. Воробьевит (морганит). Anjanabonoina, Мадагаскар. Образец: ФМ (№25065, Лакруа А., 1925). Фото 1-2: © А.А. Евсеев. 6. Мезолит. Пуна (р-н), Индия. Образец: Минералогический музей им. А.Е. Ферсмана РАН (ST 3178). Фото1-3, 5,6: © А.А. Евсеев.

***

--Рудные месторождения России и Мира. Справочник и учебное пособие / Л.Т. Шевырёв. А.Д. Савко. – Труды НИИ геологии ВГУ. – Выпуск 70.– Воронеж: Воронежский государственный университет, 2012. – 284 с., библиография 682 названия. \\ читать - http://www.geokniga.org/bookfiles/geokniga-rudnye-mestorozhdeniya-rossii-i-mira-spravochnik-i-uchebnoe-posobie.pdf \\ Шевырёв Л.Т., Савко А.Д., 2012 - читать .

Фото дня или "За месяц вокруг света" - - 2020.10 - 2020.09 - 2020.08 - 2020. 07 - 2020. 06 - 2020. 05 - 2020. 04 - 2020. 03 - 2020. 02 - 2020. 01 \\ 2019.12 - 2019.11 - 2019.10 - 2019.09 - 2019.08 - 2019.07 - 2019.06 - 2019.05 - 2019.04 - 2019.03 - 2019.02 - 2019.01 \\ 2018.12 - 2018.11 - 2018.10 - 2018.09 - 2018.08 - 2018.07 - 2018.06 - 2018.05 - 2018.04 - 2018.03 - 2018.02 - 2018.01 \\ 2017.12 - 2017.11 - 2017.10 - 2017.09 - 2017.08 -  2017.07 - 2017.06 - 2017.05 - 2017.04 - 2017.03  - 2017.02  - 2017.01  \\ 2016.12- 2016.11- 2016.10 - 2016.09 - 2016.08 - 2016.07 - 2016.06 - 2016.05 -2016.04 -2016.03 - 2016.02 - 2016.01 - 2015.12 - 2015.11 - 2015.10 - 2015.09 - 2015.08 - 2015.07 - 2015.06 - 2015. 05 - 2015. 04 - 2015. 03 - 2015. 02 - 2015. 01 - 2014.11-12 -  

Всемирная минералогия-32 - по одному минералу от региона

А.А. Евсеев. Минералогические находки вокруг света вдоль 40-ой параллели. - Минералогический альманах, т.13, 2008, с. 76-85.
\\ Краткий вариант статьи \\ Полный текст статьи \\ Фотогалерея \\

--Кристаллы пяти континентов_экспозиция в Минералогическом музее им. А.Е. Ферсмана РАН \\ текст

--Минералы- спутники на расстоянии (минералы-телеспутники)

--Журнал "Вокруг света" - http://www.vokrugsveta.ru/

--Институт географии РАН _Информационный портал

--находки минералов по всему миру - https://www.mineralienatlas.de  

Путешествия за камнем

 

--Ферсман А.Е. "Путешествия за камнем" \\ читать

--В.А. Обручев. Мои путешествия по Сибири \\ читать

МИНЕРАЛЫ \

5 замечательных находок \ Европа - Азия - Африка - Австралия - Сев. Америка - Южн. Америка (выборка: по одному образцу из северной, южной, западной, восточной и центральной части каждого регион). Случайная выборка

Вторые находки минерала в мире, ставшие лучшими

"Сборные" минералов по странам и регионам (10-15 избранных находок) \\ 1-е -в 2007 г.

По 2 минерала от континента за 2 минуты (экспресс-опрос)

Ареалы находок минералов (основные находки ряда минералов, вынесенные на карту мира)

Кристаллы пяти континентов_выставка в Минералогическом музее им. А.Е. Ферсмана РАН

--Евсеев А.А. Географическая привязка первоначальных местонахождений минералов. \\ Новые данные о минералах. М.: ЭКОСТ, 2003. Вып. 38, с. 113-124.

--А.А. Евсеев. Минералогические находки вокруг света вдоль 40-ой параллели с. ш.

Океаны

Острова (от Гренландии до Мадагаскара) \ минералогические находки

Луна \\ минералогия - http://luna-mineralogiya.ru/index.html

АВТОРЫ \ \ А – Л | М - Я | A - Z Анастасенко| | Г.П. Барсанов || И.В. Бельков || В.И. Вернадский || А.В. Волошин || В.И. Воробьев | Гиймен К. \ Guillemin C.| | А.А. Годовиков || Б.З. Кантор | К.И. Клопотов || Ю.С. Кобяшев || П.А. Кочубей | Крыжановский В.И. || А.Н. Лабунцов | М.Н. Малеев || В.А. Мальцев || Л.А.Паутов || И.В. Пеков || В.А. Пелепенко || В.В. Пономаренко | | В.А. Слётов | Э.М. Спиридонов | | В.И. Степанов | А.Е. Ферсман | А.П. Хомяков || Б.В. Чесноков || Н.В. Чуканов || Н.П. Юшкин и другие

Из публикаций: А - Б - В - Г - Д - ЕЁ - Ж - З - И - К - Л - М - Н - О - П - Р - С - Т - У - Ф - Х - Ц - Ч - ШЩ - ЭЮ - Я - AZ \\ A - B - C - D - E - F - G - H - I - J - K - L - M - N - O - P - Q - R - S - T - U - V - W - X - Y - Z

 

МИР КАМНЯ В ЛИЦАХ

1. Александр Подлесный. Коашва, Хибины. 2007.09.06. Фото: © А.А. Евсеев. 2. Виктор Пономаренко (справа) и Александр Жаринов. Бескемпир, Мангышлак, Казахстан, 2003 г. 3. Елена Владимировна Пряхина. 4. Михаил Попов. Мин. музей им. А.Е Ферсмана РАН. 2012.04.14. Фото: А. Евсеев

Е.А. Борисова, М.И. Новгородова, М.Н. Малеев. Москва.[ГГМ им. В.И. Вернадского, 2009.10.14].

Исследователи самоцветов Сибири - http://lavrovit.ru/?page_id=271

Фотографы минералов и не только

Биографии минералогов и коллекционеров - см. The Mineralogical Record Biographical Archive - http://www.minrec.org/labelarchive.asp

Чилдрен, Джон Джордж \ John George Children (1777.05.18 – 1852.01.01), английский химик, минералог и зоолог; хранитель минералогической коллекции Британского музея естественной истории. В его честь назван минерал чилдренит.

ОКТЯБРЬ \ в тот день

В ТОТ ГОД...

1920-ые годы

Рис.1.8. Участники первых Хибинских экспедиций 1920-1923 годов: Сидят в первом ряду: Вера Александровна Унковская, Владимир Ильич Крыжановский, Генрих Степанович Тщасковский; сидят во втором ряду: Екатерина Евтихиевна Костылева, Елена Павловна Кесслер и зам. начальника экспедиций Борис Михайлович Куплетский; стоят - Эльза Максимовна Бонштедт, Александр Евгеньевич Ферсман, Нина Николаевна Гуткова, Андрей Владимирович Терентьев и Зоя Александровна Лебедева, фото из архива Е.А.Каменева. Источник: http://geoksc.apatity.ru/images/stories/Print/zhirov/books/Rug_Geo_Murm.pdf

1931, 15 января - в Ларкинвилле \ Larkinville (близ Widgiemooltha, Зап. Австралия) 17-летний юноша Джеймс Ларкомб (James Larcombe) нашел самородок золота весом 32 177 г, получивший название "Золотой орел". Это самый крупный самородок, найденный в Австралии в XX веке. В годы великой депрессии он был переплавлен. http://farm1.static.flickr.com/91/219105672_8afcec4c10_b.jpg \\ Подробнее: THE EAGLE'S NEST. Larkinville, the Golden Eagle, and the Great Depression by Bridge, Peter J.

Книга Питера Бриджа THE EAGLE'S NEST. Larkinville, the Golden Eagle, and the Great Depression

2019

Иванов А.В., Ярошевский А.А., Иванова М.А. Минералы метеоритов – новый каталог // Геохимия. - 2019. - Т. 64. - №8. - C. 869-932. doi: 10.31857/S0016-7525648869-932 \\ текст - https://journals.eco-vector.com/0016-7525/article/view/15885

2020

Анастасенкоит \ Anastasenkoite- CaFe2+(P2O7) - новый минерал из формации Хатрурим, Израиль \\ Первый пирофосфат, богатый железом \ First Fe-rich pyrophosphate mineral to date. \\ A.: Anastasenkoite, IMA 2020-026, in: CNMNC Newsletter 56, Eur. J. Mineral." 32 \ https://doi.org/10.5194/ejm-32-443-2020, 2020 \ Britvin, S. N., Murashko, M. N., Vapnik, Y., Vlasenko, N. S., Vereshchagin, O. S., Bocharov, V. N., Krzhizhanovskaya, M. G., Lozhkin, M. S., Zolotarev, A. \\ Образец--ФМ № 97001 - зерно анастасенкоита размером менее 0.1 мм на капилярной нити. Голотип. Halamish wadi, Negev Desert, Израиль. Оригинал исследования. Бритвин С.., Мурашко М.Н., Вапник Е. 2020.

Новая книга! Б.З. Кантор. Коллекционирование минералов. Школа начинающего коллекционера. 2020. Фото: https://www.facebook.com/MineralogicalAlmanac \\ о книге - https://rusmineral.ru/info/nastolnaya-kniga-kol.aspx

Маршинцев В.К. Богатства недр Якутии. Полезные ископаемые, минерально-сырьевая база / В.К. Маршинцев, В.Г. Гадиятов ; Академия наук Республики Саха (Якутия). – Воронеж, 2020. – 320 с. + 16 отд. л. цв. ил. ISBN 978-5-9273-3019-5

В книге приведены общие сведения о полезных ископаемых, истории открытия и изучения месторождений Якутии, их геологическом строении, а также о состоянии минерально-сырьевой базы республики. Работа включает следующие разделы: горючие полезные ископаемые, чёрные, благородные и цветные металлы, горнорудное и химическое сырье, строительные материалы, подземные воды, лечебные грязи, цветные камни. По большинству полезных ископаемых даны запасы или ресурсы. Кроме того, по некоторым видам минерального сырья приведены объёмы мировой добычи и краткий обзор крупнейших месторождений страны и мира. Издание рассчитано на широкий круг читателей, специалистов, аспирантов и студентов геологоразведочных учебных заведений. Может использоваться в качестве справочника.

The New IMA List of Minerals – A Work in Progress – Updated: September 2020 - http://cnmnc.main.jp/IMA_Master_List

В октябре 2020 г. исполнилось 20 лет Mindat.org - вероятно, крупнейшему минералогическому справочнику в интернете. \ 20 Years of Mindat.org! Mindat.org is probably the largest mineralogical reference on the internet. Currently there are 53116 different minerals, varieties and synonyms listed, and information on 1337920 mineral occurrences worldwide, from 364905 different sites! [В настоящий момент в нем числятся 53116 различных минералов, разновидностей и синонимов, а также информация о 1337920 местонахождениях минералов по всему миру, из 364905 различных мест]. Источник: https://www.mindat.org/design2000.php

В мире минералов. Минералогический Альманах, том 25, выпуск 1, 2020

МИНЕРАЛОГИЧЕСКИЙ УНИВЕРСИТЕТ

КЛУБ ДРУЗЕЙ МИНЕРАЛОГИИ

В зеркале камня

Юрий Никулин.  Почти серьезно . М. Изд-во "Пресса", 1992.

В молодости Николай Акимович выступал как соло-жонглер на лошади. (Впоследствии он этот номер передал Николаю Ольховикову.) Я номера не видел, не застал. Но один старый артист с восхищением рассказывал мне:
       - Понимаешь, работал Никитин поразительно. И что любопытно - трюков-то у него сногсшибательных не было. Но какой артист! Выйдет на манеж, постоит секунду, посмотрит в зал, сделает легкий поклон публике - и аплодисменты. Так держался, такое у него обаяние, просто удивительно! Это от бога...
       Я же застал Никитина (занимался в то время в студии), когда он, как у нас говорят, "работал конюшню".
       Среднего роста, сутуловатый, седые волосы гладко зачесаны
       назад, типичное русское лицо.
       Почти бесцветные, наверное, в молодости были голубые, глаза. На манеж выходил в ярко-синем пиджаке, бриджах и черных лаковых сапогах. Белый шелковый галстук закалывал булавкой с крупным бриллиантом.
       Помню, спрашивали у него:
       - Николай Акимович, брильянт-то настоящий?
       А он посмотрит сурово и ответит басом:
       - Поддельные носят только конюхи
.

ххх  

Мне рассказывали, как в начале войны, работая в Магнитогорске, Никитин на одной из репетиций резко щелкнул шамбарьером, и из его перстня вылетел камень. С перстнем Никитин никогда не расставался. Черный бриллиант в четыре с половиной карата представлял огромную ценность. Найти его на манеже было нелегко. И Никитин объявил:
      - Кто бриллиант найдет, плачу тысячу рублей!
      Все бросились искать камень. Униформисты и артисты буквально просеяли опилки через решето, но камень не нашли. Николай Акимович ходил злой, ни с кем не разговаривал и работал в тот вечер хуже, чем всегда.
      На другой день было обычное представление.
      Последним номером в первом отделении шли "Икарийские игры". Участники номера - мальчики десяти-двенадцати лет. Самый маленький из них - его все почему-то звали Чапаем, делая сальто-мортале, вдруг увидел, что у самого барьера в опилках что-то блеснуло. Сделав в сторону барьера два "колесика", Чапай поднял блестящий камушек, засунул его за щеку и продолжал номер.
      Бриллиант понесли Никитину всей гурьбой. Мальчишки договорились, что тысячу рублей, которую Никитин обещал за находку, разделят между собой, и заранее предвкушали, сколько они смогут накупить на эти деньги полезных вещей.
      Никитин же впустил к себе в гардеробную только Чапая, а перед остальными захлопнул дверь. Минут двадцать ожидали ребята выхода своего товарища. Чапай вышел и дико захохотал. Оказывается, когда он вошел в гардеробную, Никитин, взяв у него камень, долго рассматривал его около лампочки, наслаждаясь блеском и игрой граней.
      - Ну, ты молодец. Просто молодец... Садись.- Николай Акимович указал Чапаю на стул.
      Затем, звеня ключами, он долго открывал замок массивного, окованного железом старинного сундука. Чапай ожидал увидеть в сундуке толстые пачки денег, а там оказались старые костюмы, коробки, шляпы...
      Со дна сундука Никитин достал початую бутылку коньяка и две потертые серебряные стопки. Осторожно, чтобы ни капли не пролить, он наполнил стопки коньяком и, торжественно протянув одну из них Чапаю, сказал:
      - Ну, ты молодец. Просто удалец. За это можешь выпить.
      Парень сделал глоток, закашлялся и отставил стопку, А Никитин выпил свой коньяк до дна.
      - Ты коньяк-то цени. Он старый, еще довоенный.- А затем встал, похлопал мальчика по плечу и добавил: - Молодец ты, иди с богом! - и подтолкнул парня к дверям.

Читать книгу : https://modernlib.net/books/nikulin_yuriy/pochti_serezno/read/

В. Высоцкий

Да ладно — потерял алмаз в опилках,
Ну ладно — что на финише другой,
Да ладно — потащили на носилках, —
Скажи ещё спасибо, что живой!

(1969)

читать - https://rustih.ru/vladimir-vysockij

КИНО_В зеркале камня

***

И. Анненский \\\ И. Бродский \\ И.А. Бунин \\ Ю.И. Визбор \\ М.А. Врубель \\ В.С. Высоцкий \\ П.А. Вяземский \\ И.-В. Гёте \\ И.А. Гончаров \\ В. Маяковский \\ А.C. Пушкин \\ И. Северянин \\ Л. Толстой \\ А.П.Чехов \\ Агат \\ Алмаз \\ Апатит \\ Бирюза \\ Жемчуг \\ Опал \\ Топаз

СТРАНЫ от А до Я

находки минералов по листам карты мира: 1234567 891011121314151617181920212223242526272829303132 - 33

Минераландия

НЕ ТОЛЬКО МИНЕРАЛЫ: А - Б - В - Г - Д - Е - Ж - З - И - К - Л - М - Н - О - П - Р - С - Т - У - Ф - Х - Ц - Ч - ШЩ - Э - Ю - Я

местонахождения минералов - | - mineral localities : А Б В ГДЕ Ж З И Й К Л М Н О ПР С Т У Ф Х Ц ЧШ Щ Э Ю Я || A B C D E F G H I J K L M N O P R S T U V W X Y Z
Сев. Америка (С)

Гренландия

Атлантика - Скандинавия - Кольский п-в

Урал
Ср. Сибирь
Якутия
СВ России

Сев. Америка (З - Сев. Америка (Кордильеры)

Сев. Америка (В)

Британ. о-ва, Пиренейский п-в - Зап. Европа - Вост. Европа

Казахстан, Ср. Азия

Юг Сибири
Забайкалье, Вост . Сибирь
Камчатка - Дальний Восток (Россия, Япония
Мексика
Кавказ, ЮЗ Азия
Афганистан, Пакистан
Индия
Монголия. Китай
ЮВ Азия - Тихий океан
Ю. Америка (СЗ) - Кордильеры
Бразилия

Африка - Сев. и Зап.Экв. и ЮжнВост.

Антарктида
Австралия

Тихий океан - Весь мир

Заметки на geo.web.ru/druza

От А до Я

РЖ-70х-80х-90х

№104 №112
2014 №114
№126 №131
№146
№163 №166
2020 №193    

Кристаллы пяти континентов

Заметки - А - Б - В - Г - Д - Е - Ж - З - И - Й - К - Л - М- Н -О - П - Р - С - Т - У -Ф - Х - Ц - Ч - Ш Щ - Э - Ю - Я - za - zaa

обновление: 2020. 10. 16

© Александр Евсеев, 2003 - 2020. © Фото: принадлежит авторам, 2020