обновление: 2018. 04. 17

местонахождения А Б В ГДЕ Ж З И Й К Л М Н О ПР С Т У Ф Х Ц ЧШ Щ Э Ю Я || A B C D E F G H I J K L M N O P R S T U V W X Y Z \\ регионы мира: 1234567 891011121314151617181920212223242526272829303132 - 33 || Россия \ Европа \ Азия \ Африка \ Австралия \ Северная Америка \ Южная Америка \

ВСЕ КАМНИ МИРА165 - В ДВЕ СТРОКИ

или НОВЫЙ МИР КАМНЯ \ АПРЕЛЬ, 2018

янв
фев
март
апр
май
июнь
июль
авг
сен
окт
нояб
дек
2004
2005
2006
2007
2008
2009
2010
2011
2012
2013
№104 №112
2014 №114
2015
№126 №131
2016
№146
2017
2018
№163                

МИНЕРАЛЫ и не только на druza: А - Б - В - Г - Д - Е - Ж - З - И - К - Л - М - Н - О - П - Р - С - Т - У - Ф - Х - Ц - Ч - ШЩ - Э - Ю - Я \\ Алфавитный список минералов (на geo.web.ru/druza)

см.на www.mindat.org \ A-B-C-D-E-F-G-H-I-J-K-L-M-N-O-P-Q-R-S-T-U-V-W-X-Y-Z

Минералы от A до Z - список IMA (Международной минералогической ассоциации)- http://pubsites.uws.edu.au/ima-cnmnc/

Комиссия по новым минералам, номенклатуре и классификации - http://pubsites.uws.edu.au/ima-cnmnc/ \\ The Commission on New Minerals, Nomenclature and Classification (CNMNC) of the International Mineralogical Association (IMA) was formed in July 2006 by a merger between the Commission on New Minerals and Mineral Names (CNMMN) and the Commission on Classification of Minerals, at the request of both commissions

Алфавитный список_ минералы: от А до Я (на русском языке) - более 4000 минералов ( 4976 страниц категории "Минералы") на http://wiki.web.ru/wiki/ \\ http://webmineral.com/Alphabetical_Listing.shtml

Все минералы мира (от A до Z) \ All Minerals of the World / Tous les mineraux de la terre http://euromin.w3sites.net/mineraux/accueil.html

Алфавитный список_ минералы от A до Z (на английском языке) и фото минералов - http://www.mineralatlas.com/ \\ фото минералов - http://www.cs.cmu.edu/~adg/adg-home.html (на сайте Alan Guisewite ) Список минералов - http://en.wikipedia.org/wiki/List_of_minerals

А -

Авантюрин \\

Авгит

Агат \\

1. Агат. Семипалатинская обл. (на границе с Павлодарской обл.), Казахстан. 5 см. 2. Азурит в породе [мергель]. Malbunka Copper Mine, Areyonga, Северная территория, Австралия. ~8 см. Образец: Мин. музей МГРИ- РГГРУ. Фото 1-2: © А.А. Евсеев

Адамин \\ Адуляр \\

Азурит

Аквамарин

Алмаз \\ Альбит \\ Альмандин \\

Алюминий самородный. Булла о., Апшеронский п-ов, Каспийское море; Азербайджан. Образец: Минералогический музей "Штуфной кабинет", Североуральск. 2017.04.17. Фото: © А. Евсеев

Амазонит \\

Аметист \\ Аметрин

1. Аметист. Риу-Гранди-ду-Сул. шт., Бразилия. Высота более 70 см. 2. Адуляр на кристалле кварца. Алдан, Ю. Якутия, Россия. Образец: Минер. музей РГГРУ (Р-1441. Евсеев А., 2012). Фото 1-2: © А.А. Евсеев.

Амфиболы
--Hawthorne, F.C., Oberti, R., Harlow, G.E., Maresch, W.V., Martin, R.F., Schumacher, J.C., Welch, M.D. (2012) Nomenclature of the amphibole supergroup. American Mineralogist: 97: 2031-2048.

Анапаит

Анатаз \\

Андалузит

"Фото дня" на сайте или "За месяц вокруг света". 2018.04.05

Андалузит. Боденмайс, Бавария, Германия. Высота ~18 см. Образец: Минер. музей им. А.Е. Ферсмана РАН. Фото: © А.А. Евсеев.

Андрадит \\

Антимонит

Апатит-(CaF) \ Apatite-(CaF) - наиболее обычный (распространенный) минерал в группе апатита.

Апофиллит \\

Арагонит \\

Арсенопирит \\

Арсенопирит. Сросток расщепленных короткопризматических кристаллов. Кара-Оба, Центр. Казахстан. 4-5 см. Образцы: Мин. музей им.А.Е. Ферсмана РАН (№83782.Годовиков А.А.). Фото: © А. Евсеев (2018).

Аурипигмент

А-минералы на сайте http://geo.web.ru/druza (примеры). От астрофиллита (Хибины, Кольский п-ов) до анортоклаза (Вулкан Эребус, Росс о., Антарктида). Составил: А. Евсеев.

Б -

Бабингтонит

Базы данных: http://www.mindat.org/ (на 2011.09.25) \\ http://webmineral.com

Барит

Без названия

Берилл

"Фото дня" на сайте или "За месяц вокруг света". 2018.04.13

Берилл (кристалл более 10 см) на кварце. Абчада, Сев. Прибайкалье, Россия. Образец: Минер. музей МГРИ-РГГРУ (Дар: Е.Б. Соловьёв, 2018.03. Его находка 1985 г.). Фото: © А.А. Евсеев.

Бериллий_минералы \\ Библиография (популярные издания о камнях)- http://basik.ru/forum/index.php?showtopic=77

Библиотеки --РОССИЙСКАЯ ГОСУДАРСТВЕННАЯ БИБЛИОТЕКА--http://search.rsl.ru/ru

Бирюза

Бор_минералогия и геохимия \ Борнит \\ Брошантит

Брукит

В -

Вад - смесь порошковатых, рыхлых оксидов и гадроксидов марганца (КМС)

Вагнерит

Вазы из поделочного камня

Ванадинит \\

Веб-сайт

-- http://petrographica.ru

Везувиан \ Вивианит

Викимапия \ Wikimapia (карты мира и России)

Виллиомит

Висмут

Включения в минералах и драг. камнях

Волконскоит*

Воробьевит (морганит) - разновидность берилла

Вторая находка минерала в мире

ВУЛКАНЫ \ минералогические находки

Вульфенит \\

Выставки минералов и поделочных камней

--ЗАНИМАТЕЛЬНАЯ МИНЕРАЛОГИЯ” В КАМНЕ ...Подробнее (pdf)

Г -

Гакманит

Галенит

Галит \

Гейландит

Гельвин

Гематит

Гемиморфит

Геммы

- Неверов О.Я. Геммы античного мира

Генезис минералов

--Попов В.А. Практическая генетическая минералогия. - Екатеринбург: УрО РАН, 2011.- 167 с.

Геовикипедия \ GeoWiki Всё о геологии - http://wiki.web.ru/

Гётит \\

Гигантские и крупные кристаллы (индивиды) \\ См.: А.Е. Ферсман. Величина природных кристаллов // Природа, 1925, № 10/12, стлб. 103; его же. Кристаллы-гиганты и монолиты-гиганты // Природа, 1926, № 3/4, стлб. 86—88; его же. Пегматиты. Т. I. Гранитные пегматиты. M.—Д., 1940.

Гидроксилапатит \ Hydroxylapatite \ https://www.mindat.org/min-1992.html

Гипс \\ Глендонит

Горная энциклопедия - http://www.mining-enc.ru/ \\ http://dic.academic.ru/contents.nsf/enc_geolog/

Горный хрусталь \\

--Буканов В. В. Горный хрусталь Приполярного Урала. Л. Наука, 1974. 212 с.

--Костелов Н.П., Шатнов Ю.А. Хрусталеносные месторождения России и стран СНГ. - Александров, 2005. - 250 с.

Гранат \\ Графит \\ Гринокит

Гроссуляр

Д -

Данбурит \\ Датолит \\

Двойники \\ http://folk.ntnu.no/krill/mineralogee/8.htm \\

Декоративный камень

Демантоид \\ Дендриты

Детский мир камня \

--Геологическая школа МГУ -- О полевых практиках и экспедициях

Юные геологи (Геологическая школа, МГУ). 1. Г. Абрамов, И.Ткаченко, И. Филимонова. Щелково, Московская обл., 1968 г. 2. Люба Ушанова, Марина Щукина, Оля Хохлова, Ира Евтеева, Андрей Карасев. Раточка, Верея. Май 1968 г.

 

--Школьный факультет РГГРУ - МГРИ \\ 60-летие - http://docplayer.ru/189496-60-let-shkolnomu-fakultetu-mgri-rggru-1947-2007-legendy-i-mify-shkolnogo-fakulteta.html \\

--Клуб юных геологов им. академика В.А. Обручева (Санкт-Петербург) - http://www.anichkov.ru/departments/lyceum/geology

--Ферсман А. Е. Путешествия за камнем. М. 1960 (веб-публикация) :

--Ферсман А.Е. Занимательная минералогия \\ читать

Диопсид

--Виолан - разн. допсида \\ первое место находки - Праборна р-к!!, Сан-Марчель, Аоста дол., Сев. Италия \ Prabornaz Mine, Saint-Marcel, Aosta Valley, Italy--36фото - www.mindat.org

Доломит \\

--Онотское месторождение, Черемховский район, Иркутская область, Востю Саян, Ср. Сибирь (Ю), Россия; 52°38'59'' с.ш., 102°1'10'' в.д. - по http://webmineral.ru/

Дравит \

Драгоценные камни (д.к.)—литература о них (по минералам): http://www.geol.msu.ru/departments/mineral/Rus/Edu/deposit_liter_r.htm \\ списки месторождений по минералам (сост. И.А. Бакшеев) - http://www.geol.msu.ru/departments/mineral/Rus/Edu/deposits_r.htm

--Горная энциклопедия - о д.к.

--Пыляев М. И. «Драгоценные камни, их свойства, местонахождения и употребление» \\ http://www.vadim-blin.narod.ru/book/titl.htm \\ указатель (быстрый поиск по ключевым словам) - http://www.vadim-blin.narod.ru/book/glossary.html

Драгоценные камни (самоцветы)_география находок

--Генетическая минералогия драгоценных камней (лекции Э.М. Спиридонова) - http://spiridonov.mineralog.com/

Дымчатый кварц

Е -

Еремеевит - http://www.mindat.org/min-2090.html; фотографии: 52 фото (2008.09) \ 190 фото на 2018.04 - http://www.mindat.org/gallery.php?min=2090

1. Еремеевит. Эронго горы, Намибия. Образец: Тусон-шоу-2008. Фото: © В. Левицкий. 2. Еремеевит. Кристалл толщиной 1,5 мм. Пегматит Фантазия, Вост. Памир, Таджикистан.Фото: Н. Пекова. Источник: Мнер. альманах, 2000, в. 3.3. Еремеевит. Pantahole mine, Momeik, Mogok, Sagaing District, Mandalay Division, Мьянма. 22х5 мм. Образец и фото: http://www.rusmineral.ru/ 4. Еремеевит. Соктуй г., Вост. Забайкалье, Россия. Крупный кр-л 2,5х1 см. Образец: Горный музей (СПГГИ). №412\1. Фото: © А.В. Свердлов. См. " Мир камня \ World of Stones", 1994, №3, с.18).

1. Находки еремеевита (указаны стрелкой). Составил А.Евсеев. 2. Еремеевит. Соктуй г., Вост. Забайкалье, Россия. Крупный кр-л 2,5х1 см. Образец: Горный музей (СПГГИ). №412\1. Фото: © А.В. Свердлов. См. " Мир камня \ World of Stones", 1994, №3, с.18).

Ж -

Живопись в камне

Журналы для минералогов и коллекционеров \\ The Mineralogical Record, \\ Rocks & Minerals \\ Le Regne Mineral \\ Mineraux et Fossiles \\ Lapis \\ Mineralien Welt \\ Rivista Mineralogica Italiana \\ Revista de Minerales \\ MineralUp\\ Bocamina \\ UK Journal of Mines and Minerals

З -

Закономерные срастания \\

Занимательная минералогия. По страницам знаменитой книги А. Е. Ферсмана Занимательная минералогия. Источник: https://www.e-reading.club

"Конечно, при всяком сборе возникает вопрос: в каком виде и сколько брать? На эти вопросы трудно ответить с достаточной полнотой, так как правильный и хороший сбор минералогического материала дается лишь долгим опытом и большим знанием природы. Нужно известное художественное чутье, чтобы взятый образец по своим соотношениям форм и красок оттенял именно тот материал, для которого он взят. Надо стараться брать типичные образцы достаточных размеров, чтобы не вырвать минерала из той обстановки, в которой он находился в природе. При этом желательно образцы (за исключением, конечно, отдельных кристаллов) форматизировать, придавая им более правильную плоскопараллелепипедальную форму, причем за минимальный размер надо принять 6x9 см, а для минералов, образующих большие копления, 9x12 см.

Как часто из экскурсий приносят маленькие бесформенные осколки, которые не имеют ровно никакой ценности и только обременяют музеи и собрания! Но не надо впадать и в другую крайность и, из желания придать образцам единообразную форму, губить красивые и интересные штуфы, форматизируя их".

"Полнота и точность записей в записной книжке — лучший показатель сознательного и толкового коллекционирования, и ценность каждого сбора находится в тесной зависимости от характера записи. Одним из губительнейших недостатков очень многих сборов, к сожалению — особенно коллекционеров-любителей, является надежда на свою память. Сколько интересных вещей оказались лишенными этикеток и потому обесцененными, сколько неточного и прямо ошибочного вносится позднее, когда по прошествии нескольких месяцев экскурсант по памяти, исправляет и дополняет то, что не было записано на месте! Надо помнить, что коллекцию может разбирать кто-нибудь посторонний, и потому всегда надо стремиться к такой точности и ясности записи, чтобы ею можно было легко пользоваться другому лицу".

 

Знаменитые местонахождения минералов

Знаменитые местонахождения минералов. Педернейра \ Pederneira claim, Минас-Жерайс, Бразилия--фд: индиголит-36;родохрозит-2; эльбаит!!!-283 \\ ПАНАШКЕЙРА, Португалия--апатит!!; арсенопирит!!; ферберит!!! \\ Кухилал, Памир, Таджикистан--шпинель!!!!; форстерит!!--огр.-Ту-17-ф; магниоколумбит* - Музейная ж. Составил: А. Евсеев, 2018.

Золото

И -

Изумруд \\

Ильваит \\

Ильменит \\

Индивиды и агрегаты \\ Годовиков А.А., Степанов В.И. Формы нахождения минералов. М. 2003. \\ Макагонов Е.П.Симметрия сростков минеральных индивидов. Наука 1991

Интернет - минералогия

Искусственные кристаллы \ минералы

Исландский шпат

История минералогии ( находки, открытия и др.)

К -

Кавансит

Календари с минералами

Кальцит

Камень в городе

Камень в городе. Парк Зарядье, Москва. 2018.04.08. Фото: А. Евсеев.

--Книжная полка минералога \ камни на книжной полке

Камералка минералога \\

Карбонаты

 

Карлетонит \ Carletonite \\ Карналлит

Карта мира - http://maps-of-world.ru/inter.htm \\ http://geography_atlas.academic.ru/

Картирование, минералогическое

Картотека местонахождений минералов, начатая А. Евсеевым в 1967 г., насчитывает сегодня более 100 тыс. названий. Она строится по региональному принципу, внутри крупного региона местонахождения расположены по алфавиту. Для местонахождений приведены ссылки на литературу, авторов, образцы в собраниях музеев. Материалы картотеки используются в публикациях автора, на сайте http://geo.web.ru/druza/ и др.

Е - Ж - З - названия (минералы, местонахождения, авторы). Список на 2017.07

Карты \\ http://www.marshruty.ru/ \\ http://wikimapia.org/country/ \\ http://www.openstreetmap.org/ \\ http://ru.wikipedia.org/wiki/OpenStreetMap-- Карты мира, стран и городов - http://planetolog.ru/ \\ http://mapper.infomine.com/ \\ http://www.veslo.ru/maps.html \\ http://www.maphill.com

--http://wikimapia.org/

--карта мира и минералы (фото) - http://fotki.yandex.ru/users/ilm/map/view/recent

--реки (бассейны) -- http://www.riversnetwork.org/rbo/

Касситерит \\

--Разновидность касситерита - "Деревянистое олово"

Каталоги минералогических коллекций

Кварц \\ публикации - http://www.quartzpage.de/info_lit.html -- Экспресс-опрос -2011 (кварц) (на ответ давалось 2-3 мин. )

--Кварц по странам мира - http://www.mindat.org/mesg-95-139699.html

Кианит

Клинохлор \\

Книги для минералогов и коллекционеров

--http://www.crystalclassicsminerals.com/books.php

Книжная полка минералога и коллекционера

Коллекционирование минералов

Степанов В.И. Шкала качества образцов (разработана им в 1970-ые гг.)

1. Виллиомит. Зерно 9х6 см из уртитового пегматита. Из виллиомитсодержащего пегматита в Магистральном туннеле, 4 км от входа. Расвумчорр р-к, Хибины, Кольский п-ов, Россия. Образец: ФМ (Коллекция В.И. Степанова. ST 1292 ). 2. Арагонит. Ансамбль геликтитов, кристалликтитов. Хайдаркан, Киргизия. Образец: Мин. музей им.А.Е. Ферсмана РАН (коллекция: В.И. Степанов). Фото 1-2: © А.А. Евсеев.

--Лыкова И. С., Пеков И. В., Щипалкина Н. В. Коллекция В.И. Степанова (Минералогический музей им. А.Е. Ферсмана РАН, Москва) как источник новых минералогических открытий // Минеральное разнообразие: исследование и сохранение. — Т. 8. — Земля и люди София, 2016. — С. 59–61.

-- http://www.strahlen.org/

Колумбит \\

Конкреции \\

Кораллы \\ Кордиерит \\

Корунд \\ сайт, посвященный корунду - http://www.corunduminium.com/index1.html

Кремень \\ Кридит

Кристаллы и сростки \\

Крокоит

Крупные образцы минералов (рекордные размеры)

Куприт

Л -

Лабрадор \\ Лазулит \ Лазурит \\

Лёд \\ http://www.mindat.org/min-2001.html \\ фотогалерея

Лироконит

Литература о минералах и драгоценных камнях \\ Из публикаций о минералах зарубежных стран \\ Из публикаций о минералах России, а также СССР

Наша библиотека - Геологический музей им. В.В.Ершова - http://ershov-geomuz.narod.ru/libr.htm

Литература по геологии в бибиотеке ДВГИ ДВО РАН. \\ http://wiki.fegi.ru/index.php/

Лоренценит

Любители камня

Люминесцирующие (флюоресцирующие минералы) - тема выставки выставки Минер. музея им.А.Е. Ферсмана РАН

М -

Магнетит

Магнетит. Кубовидные кристаллы на ангидрите). Балмат, округ Сент-Лоренс, Нью-Йорк, США. Образец: ФМ (№88260. Дар: W.de Lorraine, 1995). Фото: © А. Евсеев (2018).

Малахит

Марки \\ минералы на марках - Minerals on Stamps

Медь и минералы меди

Кристаллический дендрит самородной меди, состоящий из ряда вытянутых двойников. Турьинские рудники (Урал). Бетехтин А.Г. Курс минералогии. 1951. Источник: http://iznedr.ru/books/

Месторождения

Метеориты \

Метро и камень

Микроклин

Миндат.орг\ www.mindat.org - - крупнейшая база данных о минералах и местонахождениях. Её основатель - Джолиан Ральф \ Jolian Ralf .

Евсеев А.А. Минералогические находки (примеры). IV. Зарубежные страны (без республик быв. СССР). М., 2016. - 256 с.

Минералогический альманах \ Mineralogical Almanac (Россия \ Russia) \ http://www.minbook.com/mineralogical_almanac_ru.html

--В мире минералов. Минералогический Альманах, том 21, выпуск 1, 2016. Подробнее..

--Минералогический Альманах, том 22, выпуск 2, 2017 - оглавление

Минералогия_для студентов (фото минералов и рисунки кристаллов)- http://geoserv.krc.karelia.ru/geo/rus/ht

Минералогические словари

-- Кривовичев В.Г. Минералогический словарь - http://bibl.gorobr.ru/book/248/book.html (веб-публикация) \\ также - на сайте - http://mmus.geology.spbu.ru/programm

Минералогия

--Бетехтин А.Г. 'Курс минералогии' - Москва: Государственное издательство геологической литературы, 1951 - с.543 --веб-публикация

--Корбел П. и Новак М. . МИНЕРАЛЫ. Иллюстрированная энциклопедия. М.: "Лабиринт Пресс", 2004. - 296 с.

Минералы_список от А до Я - Википедия

МИНЕРАЛЫ (справочник) ------- http://www.geokniga.org/collections/3607 \\ т.2, вып.2

--Силикаты–справочник  краткий указатель - http://geo.web.ru/druza/m-miner_A-Ya_sil.htm  

--Минералы. Справочник. Том 3. Выпуск 1. Силикаты с одиночными и сдвоенными кремнекислородными тетраэдрами. Содержание

Минералы - спутники на расстоянии \\ Евсеев А.А. Минералы - спутники на расстоянии (2): Отдельные статьи Горного информационно-аналитического бюллетеня. - №12. - М.: Издательство "Горная книга", 2009. - 35 с.

Мозаика \\

Морфология минералов

М у з е и

World Directory of Mineral Collections (Second Edition) Pieter C. Zwaan; Ole V. Petersen . Published by Commission on Museums of the International Mineralogical Association,, Copenhagen, 1977

Россия

--Список геологических музеев России - -http://webmineral.ru/museums/

--Барнаул, Россия \\ Музей "Мир камня" - http://www.stonemir.ru/

--Кировск, Мурманская обл., Россия \ Музейно-выставочный центр АО «Апатит» - http://welcomekirovsk.ru/archives/842

--Москва и область

----Минералогический музей им. А.Е. Ферсмана РАН \\ Сайт музея - https://www.fmm.ru \\ Адрес: Москва, Ленинский проспект, 18, кор. 2. Телефон для справок: 8(495) 954-39-00 . Телефон для записи на экскурсию: 8(925)-246-62-82 или 8(916)-629-80-52 \\ https://www.fmm.ru

Мы работаем со среды по воскресенье с 11:00 до 17:00. Вход для посетителей до 16:30. По субботам работаем с 11:00 до 19:00, вход до 18:30. Информация о работе в праздничные дни представлена на нашем сайте! Источник: https://vk.com/minmuseum

----Музей «Самоцветы» (Москва) - http://gemmuseum.ru

--Новосибирск \\ "В Центральном сибирском геологическом музее, который основан в июле 1958 года, есть образцы из 50 стран мира и всех регионов России. В коллекции около тысячи видов минералов видов, а общее количество экспонатов — около 20 тысяч." \\ Источник и подробнее - https://ria.ru/nsk/20131110/975805317.html

--Санкт-Петербургский ун-т \\ Начало...

--Серпухов. Серпуховский геолого-минералогический музей \\ Сайт музея- http://www.минералмузей.рф/

--Челябинск. «Южно-Уральский государственный университет» (национальный исследовательский университет)
ФГБОУ ВПО «ЮУрГУ» (НИУ) \\ Геологический музей - http://old.susu.ru/ru/gallery/geologicheskiy-muzey

--Владивосток. Дальневосточное отделение РАН. Дальневосточный геологические институт. Музей ДВГИ:-- http://www.fegi.ru/images/Museum_ru.pdf

Болгария. "Национальный музей "Земля и Люди" является минералогическим музеем в центре Софии. Это один из крупнейших минералогических музеев во всем мире. Датой его основания считается 30 декабря 1985 года, а открыт для посещения он был в июне 1987 года. Инициатором создания музея был доктор наук Михаил Малеев. Музей расположен в оригинальном старинном и реконструированном здании, построенном в конце XIX века (1896-1898 год). Общая площадь музея составляет около 4 000 кв. м". Источник: https://www.rutraveller.ru/place/14261

Китай

--Пекин. Геологический музей. Bancroft,P, Zhengzhi,H and Furui,W (1987) The Peking geological museum, China. Mineral.Record 18, 325-332.

Франция. Париж. Национальный музей естественной истории ( фр. Museum national d'histoire naturelle - один из старейших в мире \\ Подробнее. В него входит Минералогическая галерея ( фр. Galerie de Mineralogie et de Geologie). Особая достопримечательность музея - коллекция гигантских кристаллов кварца из Бразилии \\ Подробнее_Википедия \\ http://www.museum-mineral.fr/home.php#

Минералогическая галерея. Национальный музей естественной истории_Париж. Франция.

Названия и привязка местонахождений минералов

--Андамука \ Andamooka, Австралия --знаменитое месторождение благородного опала!!; 30° 27' 14'' S, 137° 10' 15'' E--по mindat ; "Андамука" - на языке аборигенов означает "нет названия" \ "no name"

Названия минералов

--Афмит \ Afmite --назван в честь Французской Микроминералогической Ассоциии \ Named after the Association Francaise de Micromineralogie (AFM)\\ Источник: https://www.mindat.org/min-40242.html

---Имена минералов. Как их называют Леенсон И.А. («Химия и Жизнь», 2012, №1) \\ веб-публикации: \\ Имена минералов. Как их называют январь №1 \\ Кто открыл, кто синтезировал? - февраль №2 \\ Петрологи, геологи, минералоги, кристаллографы - март №3 \\ Химики, физхимики и один математик - апрель №4 \\ Еще немного химиков и физхимиков - №5 \\ Космонавты, коллекционеры, поэты - №6

Митчелл Р.С. Названия минералов. Что они означают? - М.: "Мир", 1982. - 248 с.

Натролит

Натрон (сода)

Недра - http://www.rosnedra.com/

Нефелин

1. Нефелин. Банкрофт, Онтарио, Канада. Кристалл более 10 см. Образец: ФМ (№82389). 2. Нефелин (кристаллы более 2 см), апатит. Кировский р-к. Хибины, Кольский п-ов, Россия. Образец: В.Г. Гришин (его находка 1995 г.). 3. Нефелин (кристалл). Одихинча м-в, Ср. Сибирь (С), Россия. ~4 см. Образец: Минер. муз. МГРИ - РГГРУ. (Р-3393. Дар: А. Евсеев, 2017.12). Фото 1-3: © А.А. Евсеев

 

Новые книги и публикации \\ см. также www.minbook.com/02.12.2016.(авторы со своими новыми книгами)

Новые минералы--обзор за февраль-май 2012 г. - http://www.mindat.org/forum.php

Новые поступления в Мин.муз. им. А.Е. Ферсмана РАН

О

Облицовочные камни \\

Обсидиан

Одноимённые местонахождения \

Окаменелое дерево

Окенит \\

Окно (камень у окна) \\

Олово самородное

Онтогения минералов

--Жабин А.Г. Онтогения минералов: Агрегаты. М.: Наука, 1979. С. 276.

--Краснова Н.И., Петров Т.Г. Генезис минеральных индивидов и агрегатов. Санкт-Петербург: Невский курьер, 1997. С. 228.

Опал

Определение (диагностика) минералов

Ортоклаз

Открытки с камнем

П -

Пегматиты

- Ферсман А.Е. Пегматиты. М.: Изд-во АН СССР, 1940. Т.1.

Первая находка минерала в быв. СССР и России

Первоначальные местонахождения \ type localities

--Евсеев А.А. Географическая привязка первоначальных местонахождений минералов. - Новые данные о минералах. М.: Экост, 2002. Вып. 38, c. 113-124

Знаменитые первоначальные местонахождения \ type localities минералов (примеры). Хибины и Ловозеро, Россия. Ленгенбах, Швейцария. Хагендорф, Германия. Яхимов, Чехия. Везувий и Монте Сомма, Италия. Кобокобо и Шинколобве, ДР Конго. Цумеб, Намибия. Составил А. Евсеев, 2018.

Переименования (географических названий)

Перидот \ хризолит \\ Перовскит

Песок и минералы россыпей \\ Петалит

Пирит!! \

Пироморфит \

Пирофиллит

Пироп \\ http://www.mindat.org/min-3321.html \\ фото (27) - www.mindat.org \\

Плагиоклазы\\ \\ альбит \\ анортит \\ беломорит \\ клевеландит \\ лабрадор \\

Поделочные камни \\

Полевые шпаты \\

 

Породообразующие минералы

Пренит - http://www.mindat.org/min-3277.html \\ фото (1002) - http://www.mindat.org/gallery.php?min=3277 - на 2009.05.27

Псевдоморфозы \\ фотогалерея - http://www.mineralatlas.com/specials/pseudo.htm

Публикации

--The Mineral News, 2004-2007 \\ Указатель публикаций по авторам \ местонахождениям \ минералам

Р

Разнообразие минералов Софийский симпозиум

Региональная минералогия (заметки)

--В.И. ВЕРНАДСКИЙ И РЕГИОНАЛЬНАЯ (ТОПОГРАФИЧЕСКАЯ) МИНЕРАЛОГИЯ.

----В своих работах В.И. Вернадский обычно использует термин «топографическая минералогия», а не региональная минералогия. Это практически одно и то же изучение «частей земной коры» (или земной поверхности). Размеры объекта, масштаб, детальность исследований могут быть разными. Точное изучение территории России «с точки зрения ее химических процессов» В.И. Вернадский считал одной из задач минералогов страны. «Для такого изучения у нас не хватает документов. И теперь пропадает - иногда безвозвратно - огромный материал, ежечасно выбрасываемый в рудниках и каменоломнях, в оврагах, по берегам рек». (Вернадский, 1901). Для решения этой задачи В.И. Вернадский придавал большое значение развитию музеев и частных минералогических собраний. «Научное исследование России в значительной мере зависит от распространения местных собраний и от развития в образованном обществе научного интереса, в этом смысле научное коллектирование не является простым спортом; оно всегда дает драгоценные данные для познания естеcтвенной истории местности, без него почти немыслимо точное решение многих вопросов описательных естественных наук. Только при широком развитии частных собраний могут развиваться и расти в стране публичные научные музеи» (Вернадский, 1898) \\ Читать статью http://mineraldiversity.org/papers/smrb07/7BK015_Evseev.pdf

Р-коллекция \\ В феврале 2008 г. в Минералогическом музее РГГРУ (Москва) были записаны первые образцы в новую тематическую коллекцию "Региональная и всемирная минералогия" (сокращенно - Р-коллекция)

Резной камень \\

Рисунок и живопись в камне \\ http://www.minrec.org/artmuseum.asp

Родонит \\

Родохрозит

Родохрозит из Капильитас, Аргентина (слева) и района Хотазел, ЮАР. Образцы: Мин. музей им.А.Е. Ферсмана РАН. Фото: © А. Евсеев (2018)

Рутил

С -

Санидин

Сапфир

"Сборные" минералов по странам и регионам (10-15 избранных находок) \\ 1-е -в 2007 г .

Селенит (разн. гипса) \\

Сера \

Серебро \\ silver - mindat --фото (1189), местонахождения (3716) -- на 2009.11.15

Серпентин

Сидерит

Силикаты от А-Я_краткий указатель к справочнику "Минералы"(том.III-V)

Силлиманит

Силлиманит. Кяхтинское м-ние, Забайкалье, Россия. ~7x5 см. Образец: Минер. музей им. А.Е. Ферсмана РАН (№84121. Смирнов И.А., 1986). Фото: © А.А. Евсеев.

Симметрия в геологии, минералогии и не только

Сингенит

Скаполит \\

Скелетные кристаллы

Скипетровидные кристаллы (в том числе обратные скипетры аметиста \ reverse sceptre из Боливии ( Esperanza Mine, near Bombori, Nor Potosi Province, Potosi Department) \\ http://www.mindat.org/ \\ http://www.mindat.org/photo-284819.html

Сколецит

Словари

--Кривовичев В.Г. Минералогический словарь.- СПб.: Изд-во С.-Петерб. ун-та, 2008. - 556 с. --СЛОВАРЬ МИНЕР. ВИДОВ - веб (В.Г. Кривовичев. Словарь минеральных видов. СПб, 2006)

--ГЕОЛОГИЧЕСКИЙ СЛОВАРЬ (включает раздел "МИНЕРАЛОГИЯ")

Смитсонит

Сода

Содалит \\

1. Спессартин. Лолиондо \ Loliondo, [~200 км к СЗ о г.Аруша], Танзания. Образец: Минер. музей РГГРУ (Р-881. Дар: Минер. альманах, 2011). 2. Содалит. Вишневые горы, Ю. Урал, Россия. Минер. музей РГГРУ (№2065.Дар: И. Клочков). Фото 1-2: © А.А. Евсеев.

1. Содалит. "Баия", Бразилия. Образец: ФМ (№81736, Богуцкий И.Ф., 1982). 2. Спессартин в кварце. Сай Пуштиру, ущ. Тро, Туркестанский хр.(Ю), Таджикистан. (№90481, сбор музея: Белаковский Д.И., Шкурский Б.Б., 1989). Фото 1-2: © А.А. Евсеев. .

Спессартин \\

Сперрилит

Список минералов - http://en.wikipedia.org/wiki/List_of_minerals

Сподумен

Справочник "Минералы"_краткий указатель к томам IV-V

Справочники

Ссылки: http://www.insminerals2005.narod.ru/

Ставролит

Ставролит выбран в 1976 г. минералом-символом шт. Джорджия (США)

Сталактиты и псевдосталактиты \\

Станнин

Стеллерит.

Стильбит \\ Стихтит \\ Сугилит

Суйсеки (камни для созерцания) – это камни причудливой формы, которую им придала вода в естественных условиях \\ Подробнее: http://mirvkamne.ru/

Сферокристаллы --см. http://geo.web.ru/db/msg.html?mid=1179562. \\ Сферокристаллические сферолиты - http://geo.web.ru/db/msg.html?mid=1175869

Сферолиты

Т -

Тальк - распределение по странам фотографий (279) талька на сайте www.mindat.org/

Таумасит

Тетраэдрит

1. Тетраэдрит. Двойники кристаллов со сфалеритом и пиритом на кварце. Кавник, Румыния. 1949. Более 10 см. Образец: Минер. музей им.А.Е. Ферсмана РАН (№47957). Фото: А. Евсеев, 2018. 2. Тетраэдрит. Кирувилка, Ла-Либертад, Перу. Образец: Музей Terra mineralia, Германия. Фото: © Д. Тонкачеев

 

Тинценит \\ Типоморфизм \\

Титанит

Топаз \\

Топазы Урала. Образцы: Минер. музей им.А.Е. Ферсмана РАН. Более 12х6 см. Фото: А. Евсеев, 2018.

 

Топонимика (интересная для минералога) \\ Мурзаев Э.М. Словарь народных географических терминов. М.: Мысль, 1984. - 654 с. - электронная версия

Торбернит \\ Торий_минералы_ география находок \\

Тремолит \\

 

Турмалин (группа) \\

У -

Увит \\ Улексит \\ Уранинит

Уссингит

Ф -

Фаялит \\

Флогопит \\

Флюорит

Фольбортит

Формы выделения минералов

1. Гематит на коралле. Ормуз о., Hormoz Island, Иран. Из коллекции А.В. Касаткина. 2. Пирит в конкреции фосфорита. Соловьев овраг, окр-ти Ульяновска, Россия. Образец: Минер. музей им. А.Е. Ферсмана РАН (№42743. Кабанов К.А., 1940). Фото 1-2: © А.А. Евсеев

Фото дня или на geo.web.ru/druza/ - "Вокруг света за 30 дней"

Фото дня на миндат.орг_ретроспектива - http://www.mindat.org/gallery.php?potd=1

Фото мест по всему миру - http://www.panoramio.com/map/

Фотоатлас минералов -- http://tw.strahlen.org/fotoatlas.html (834 minerals, 1148 photos)

Фотогалереи минералов - минералы от A до Z и число их фотографий - указатель для миндат.орг - http://www.mindat.org/photoindex.php--http://www.mineralatlas.com/ \\ http://kristallov.net/index.html \

Фотографии минералов - страница Б.З. Кантора на http://www.mindat.org/user-17280.html - 275 фото (2016.08)

Олег Лопаткин на -- http://www.mindat.org/user-10732.html

Фотосъёмка минералов \\ \\ http://klopotow.narod.ru/soveti/foto.html

--Фото минералов - впервые в рамках Фестиваля "Первозданная Россия" (2016) \\ Подробнее: http://ilm.narod.ru/

Фторапатит

Х -

Халцедон \\ http://www.mindat.org/min-960.html ; фото (541) - http://www.mindat.org/gallery.php?min=960

Халькопирит

Хризоколла

Хуанхэит-(Ce)

Ц -

Цвета минералов

Цветные камни \\

--Буканов В.В. Энциклопедия "Цветные камни" - официальный сайт

Целестин

Цеолиты \\

Церуссит

Циркон

Цитрин

Ч -

Чароит \\ Чароит. Сиреневое чудо Сибири. Иллюстрированное научно-популярное издание. - Иркутск6 изд-во "Петрографика", 2011. - 192 с. (авторы текстов: Рогова В.П., Воробьев Е.И. и др.)

ШЩ

Шары и яйца из камня

Шахтёрская энциклопедия - MiningWiki — энциклопедия о шахтах и шахтёрах, создаваемая совместными усилиями горняцкого сообщества. 

Шеелит \\

Шерл \\

Шорломит \\

Шпинель

Щелочные массивы \\ XXV Всероссийский семинар с участием стран СНГ. Геохимия магматических пород. 23-26 мая 2008 г. Школа Щелочной магматизм Земли   \\ http://alkaline2008.narod.ru/ \\ Тезисы - http://alkaline2008.narod.ru/Abstract.htm

Э

Эвдиалит

Эгирин \\ местонахождения (595) - http://www.mindat.org/min-31.html \\ фото (169) - http://www.mindat.org/gallery.php?min=31 (на 2009.03.22) \

Экскурсии_ минералогические экскурсии. \\ В Гос. геол. музей им. ВИ. Вернадского

Эльбаит \

Эльпидит

Эпидот \\

Эрионит

Ю -

Я \\ Я_ Заметки geo.web.ru/druza

Янтарь \\

Ярмарки минералов и драгоценных камней \\

Ярозит \\

Яшма

ЯШМА В РОССИИ [по А.Е. Ферсману] - http://pictoris.ru/5/27/index.html

ОПИСАНИЕ РУССКИХ ЯШМ [по А.Е. Ферсману] - http://pictoris.ru/5/29/index.html

1. Флогопит. Gould Lake Mining Lots, Frontenac Co., Онтарио, Канада. Образец: Мин. музей им. А.Е. Ферсмана РАН (№12441. В.И. Вернадский, 1911). 2. На книжной полке минералога. Медь (Рубцовское м-ние, Алтай), японский двойник кварца. Образцы: И.В. Пеков. 2014. Фото 1-2: © А..А. Евсеев.

МЕСТОНАХОЖДЕНИЯ МИНЕРАЛОВ

Местонахождения минералов \ mineral localities на сайте и на страницах справочника Евсеев А.А. Географические названия в минералогии. Краткий указатель. Ч. I, М. , 2000. - 269 с.; Ч. II, М. , 2000. - 282 с.
Часть I и II (выборочно)
:

м-н-ния
А
Б
В
Г
Д
Е
Ж
:З
И
Й
К
Л
М
Н
О
П
Р
С
Т
У
Ф
Х
Ц
Ч
Ш
Щ
Э
Ю
Я
стр.
10-
26-
45-
54
-
63-
73-
75-
77-
81-
87-
88-
122-
132-
151-
160-
166-
180-
188-
213-
226-
234-
239-
247-
249-
255-
260
260-
265-
267-
Locality
A
B
C
D
E
F
G
H
I
J
K
L
M
N
O
P
Q
R
S
T
U
V
W
X
Y
Z
cтр.
9-
24-
44-
63-
71-
78-
86-
97-
108-
113-
118-
135-
148-
173-
181-
188-
203
204-
214-
243-
257-
260-
268-
275-
276-
278-

См. также http://www.mining-enc.ru

А

Адун-Чолон (= Адун-Чилон), Вост. Забайкалье , Россия

Айфель = Эйфель \ Eifel горы (палеовулкан), Рейнланд-Пфальц, Германия \ Eifel, Rheinland-Pfalz, Deutschland

Акжайляу, к В от г. Аягуз, Вост. Казахстан.апатит!!!--с александрит. эффектом; КВАРЦ!!!--xl 10 м; кристалл дымч. кварца 5,8 м в длину и 1, 5 м в поперечнике, весил около 90 т-находка в южной части массива (Ерджанов К.Н., 1963);

Акчатау \ Akchatau, Ц. Казахстан \\

Аллуайв, Ловозеро, Кольский п-ов, Россия. \\ 67°51` с. ш. 34°32` в. д.

Альмаден, Испания

Арендаль, Ю. Норвегия.

Астафьевское м-ние, Ю. Урал, Россия\\ http://www.mindat.org/loc-192610.html

Ахалцихе (р-н), Грузия.

Ахматовская копь, Ю. Урал, Россия

Б - местонахождения минералов

Баженовское м-ние , г. Асбест, 60 км к СВВ от Екатеринбурга, Ср. Урал, РФ

1.

1. Брусит. Баженовское м-ние, Ср. Урал, Россия. Образец: ФМ.. 2. Тетраэдрит. Берёзовский зав., Ср. Урал, Россия. Более 6 см. Образец: ФМ. Фото 1-2: © А.А. Евсеев

Березовское золоторудное месторождение, Средний Урал, Россия

Биг-Фиш-Ривер \ Big Fish River, 70 км к СЗ от Аклавик, хр. Ричардсон, Юкон, Канада \\ *баричит; *виксит; *горманит!!; лазулит!!; *маричит; *нахпоит; * новые мин.—6 видов; *саттерлиит; MR, 1999, 50 \\ http://www.mindat.org/loc-628.html

Борон, округ Керн, Калифорния, США \\ в этом же районе находится заброшенный ныне подземный р-к Бейкер майн \ Baker mine, U.S. Borax Mine (Pacific West Coast Borax; Pacific Coast Borax Co.; Boron Mine; U.S. Borax and Chemical Corp.; Kramer Mine; Baker Mine), Kramer Borate deposit, Boron, Kramer District \ подробнее - mindat

Брокен-Хилл (быв.) = Кабве (ныне) р-к, Центральная пров., Замбия \ Kabwe Mine (Broken Hill Mine), Kabwe (Broken Hill), Central Province, Zambia; 14°29'S , 28°25'E - http://www.mindat.org/loc-4341.html \\

Брокен Хилл (Broken Hill), Н. Ю. Уэльс, Австралия, 31-57` ю. ш. , 141-26` в. д. \\ http://www.mindat.org/loc-72.html \\

--Панов Б.С. Мировой уникум Брокен-Хилл в наше время \ Известия ВУЗов. Геология и разведка, 2004, №4 

Брумаду \

Бу-Аззер, Марокко \\

Бурпала , Прибайкалье (С), Россия

В

Ватиха, Мурзинка, Ср. Урал, Россия

Везувий и Монте-Сомма, Италия \\

Величка, Польша

Верхнекамское м-ние, Пермский край, Россия

Весселс \ Wessels mine, Калахари, Сев. Капская пров., ЮАР

--Кейрнкроссит - новый минерал из р-ка Весселс, Ю. Африка \\ Giester, G., Lengauer, C.L., Pristacz, H., Rieck, B., Topa, D., and von Bezing, K.-L. (2016) Cairncrossite, a new phyllosilicate from the Wessels Mine, Kalahari Manganese Field, South Africa. European Journal of Mineralogy: 28: 495-505.

--Лавинскиит - новый минерал из р-ка Весселс, Ю. Африка \\ Yang, H., Downs, R.T., Evans, S.H., and Pinch, W.W. (2014) Lavinskyite, K(LiCu)Cu6(Si4O11)2(OH)4, isotypic with plancheite, a new mineral from the Wessels mine, Kalahari Manganese Fields, South Africa. American Mineralogist: 99: 525-530.

--Циприн - новый минерал группы везувиана из р-ка Весселс, Ю. Африка \\ Panikorovskii, T.L., Shilovskikh, V.V., Avdontseva, E.Yu., Zolotarev, A.A., Pekov, I.V., Britvin, S.N., and Krivovichev, S.V. (2017) Cyprine, Ca19Cu2+(Al,Mg,Mn)12Si18O68(OH)10, a new vesuvianite-group mineral from the Wessels mine, South Africa. European Journal of Mineralogy: 29: 295-306.

Сугилит.[Весселс р-к\ Wessels mine, Калахари, Сев. Капская пров.,] ЮАР. Образец: ФМ (№87731. Обмен, 1990). Фото: © А.А. Евсеев.

Вишневые горы, Ю. Урал, Россия \\ фотогалерея и др. - http://webmineral.ru/

Водинское м-ние, к ССВ от Самары, Ср. Поволжье, Россия

--Сидоров А.А. Минералогия Водинского месторождения самородной сера Самарской области и история его окрытия. Учебное пособие. Самара: Самар. гос. техн. ун-т, 2011. - 189 с.

Володарск-Волынское пегм. поле, пос. Володарск-Волынский, к З от Житомира, Волынь , Украина \\ берилл!!!--ф; гетит!!!; кварц!!; керит!!; микроклин!; опал!; топаз!!!--xls>100 кг; фенакит!!

Вороньи тундры, Кольский п-ов, Россия

Вулькано о. \ Vulcano Isl., Липарские о-ва, 50 км к З от Мессины, у сев.-вост. побережья Сицилии, Италия \

Г

Гаурдак, Туркмения

Горихо (Gorikho), м-ние, в ср. и ниж. теч. р. Горихо (приток р. Тола, басс. р. Селенга), 45 км к В от Урги [Улан-Батора], Монголия \\ берилл!; горный хрусталь!; топаз!!; флюорит!; Ф, 491; Ш, 28, 197

Горни-Славков ( (ныне) = Шлаггенвальд (быв.) (Horni Slavkov (now) = Schlaggenwald (form.)), 12 км к ЮЮЗ от гор. Карловы Вары , Богемия, Чехия

Гумешевский р-к, Ср. Урал, Россия

Д

Дальнегорск (и район), Приморье, Россия

- Боросиликатное м-ние \ Второй Советский р-к \\ Николаевский р-к

- Верхний р-к

Дараи-Пиоз (= Дараи-Пиез = Дара-и-Пиоз = Дарапиоз) (Dara-Pioz) , 45 км к СВ от пос. Гарм и 35 км к ССВ от Таджикабада, Алайский хр. , Таджикистан \\ http://www.mindat.org/loc.php?loc=3241

Дашкесан, Азербайджан

Джезказган, Казахстан

Джоплин, Миссури, США

Додо м-ние, Прип. Урал, Россия - http://www.polarquartz.ru/dep-dodo.html

Е

Ермаковское м-ние, Забайкалье, Россия

Ж

З

Завитинское (Завитая), м-ние, Вост. Забайкалье , Россия \\ адуляр!; воробьевит!; касситерит!; кукеит!; петалит!!; ростерит!; сподумен!!; турмалин!!; Смо, 351

Змеиногорский р-к (Zmeinogorsk) = Змеиногорское м-ние, Алтай, Сибирь (ЮЗ), РФ \

И

Ивигтут \ Ivigtut = Ivittuut, Ю. Гренландия \\ *(1997) йоргенсенит; криолит!!! (М 2-1); * новые мин.—17 видов; пахнолит!! (М 2-1)--xls<4, 5 см; разн.--около 100 мин.; сфалерит! (М 1-1); томсенолит!! (М 2-1); хиолит! (М 2-1); ярлит! (М 2-1); BBM, 68.

Идар-Оберштайн \ Idar-Oberstein Германия (ЮЗ) \\ агат!! \\ 500 лет (с 1375 г. по 1875 г) в этом районе разрабатывались месторождения агата, велась его обработка. Сегодня небольшой городок - крупнейший центр торговли минералами, драгоценными и поделочными камнями, его называют "самоцветной столицей мира." .

Изумрудные копи, Ср. Урал, Россия

Илимауссак, Ю. Гренландия

Ильмены. Ю. Урал, Россия \\ карта и др. http://reserves-park.ru/index/0-204 \\ http://nashural.ru/Mesta/ilmeni.htm

Индер (Inder) (= Индерское м-ние), 15 км к В от пос. Индерборский, 150 км к С от Атырау (= Гурьев (быв.)), Сев. Прикаспий, Казахстан \\

Итинокава, о. Сикоку, Япония.

Иультин, Чукотка, Россия

 

Й - К

Каменушинское м-ние (Cu), к С от г. Салаир, Кемеровская обл., ЮЗ Сибирь, Россия

Кап-Гарон \ Cap Garonne, близ Le Pradet, 12 км к В от Тулона, Вар, Франция

Капильитас, Катамарка, Аргентина

Карамазар (Karamazar) рудный район, Сев. Таджикистан

Кара-Оба = Караоба \ Kara-Oba, м-ние (Mo-W), пос. Джамбул (47-11`N, 71-23`E), Ц. Казахстан

Карнасурт, Ловозеро, Кольский п-ов

Кацна яма (копь), 15 км к СВ от Первоуральска, Ср. Урал, Россия \\ эпидот!! (“пушкинит”!!

Кент, м-ние, гранитный м-в и грейзенизированные гранитные пегматиты, 30 км к ЮВ от пос. Карагайлы и 50 км к ЮВ от Каркаралинска, Ц. Казахстан

Керченское м-ние, Крым, Россия \\ анапаит!!!; барит!! вивианит!!; * митридатит; родохрозит, Ca-вый!!--пс-зы по раковинам (ф); смайтит!; Смо, 352; Pk

Кипуши, ДР Конго \\

Кировский р-к, Кировский р-к, Кукисвумчорр, Хибины, Кольский п-ов, Россия

Клара р-к \ Clara Mine (=Clara Grube ), Шварцвальд, Германия --барит!!; новые. минералы*!!--13 вид.; разнообразие!!-414 видов; хайдарканит!; флюорит!!; чухровит-(Ce)*

Ковдор \\

Конгсберг (Kongsberg), Норвегия \\ * конгсбергит; пренит!; серебро!!!; флюорит!—розовый; ВВМ, 68, 174, 176, 178, 179 \\ O. Johnsen, Mineralogical Record, 1986, 17, 19-36

Кондёр г. , м-в ул.-осн. и щел. пород (Kondoer = Konder), Алданский щит, 75 км к З от пос. Джигда и 100 км к ЗЮЗ от пос. Нелькан, ниж. теч. р. Маймакан, Хабаровский край, РФ \ фото 3D - http://www.mindat.org/photo-619937.html

Монтичеллит. Кондёр, массив, Алданский щит, Хабаровский край, Россия. Образец: ФМ (№90030. 2012 г.). Фото: А. Евсеев, 2018.

Консельейру-Пена \ Conselheiro Pena District (пегматитовый район), 21 км к С от Дивину-да-Ларанжейрас, (р-н), Минас-Жерайс, Бразилия

Коршуновское м-ние, Иркутская обл., Вост. Сибирь, Росссия

Кремиковцы = Кремиковци (Kremikovtsi), ~ 15 км к СВ от Софии, Болгария \\ азурит!; барит!; витерит!!; гематит!!; гетит!!; кальцит!; лепидокрокит!; норсетит!! (ММ); родохрозит!!; романешит!!

Кубер-Педи , м-ние (Coober Pedy field), 180 км к С от гор. Туркула и 750 км СЗ от Аделаиды, Ю. Австралия \\ благородный опал!!!--пс-зы!! по раковинам, белемнитам и др

Кугда массив, 10 км к С от устья р. Котуйкан (прит. р. Котуй) и 150 км к ЮЮВ от Хатанги, Ср. Сибирь (С), Россия \\ вермикулит!; перовскит!; Ti-клиногумит!!--xls< 3 см; хризолит!!

 

Кукисвумчорр, Хибины, Кольский п-ов, Россия \\ Петараситовая жила, Тульйок река (верховья), Кукисвумчорр гора, Хибины, Кольский п-ов, Мурманская область, Россия

Кухилал (Kukhilal) = Кухи-Лал = Кугиляль = Кох-и-Лал, Памир (ЮЗ), Таджикистан

Л

Лаврион = Лавриум, Греция \ Laurium (= Laurion = Lavrion (нем.)), Greece \\ фотогалерея--http://www.mineral-forum.com/ \\ фотогалерея минералов - http://www.mindat.org/g/554

Лакарги гора, Верхнечегемская вулканическая структура, Кабардино-Балкария, Сев. Кавказ, Россия \ Lakargi Mt., Verkhnechegemskaya caldera (Upper Chegem caldera) ; ксенолиты скарнов в игнимбритах; 43°17'N ; 43°6'E \

Лангезундфьорд = Лангесунн-фьорд (Langesund(s)fjord), Ю. Норвегия

Ленгенбах, Швейцария \\ http://en.wikipedia.org/wiki/Lengenbach_Quarry

Ловозеро, Кольский п-ов, Россия

Лонгбан, Вермланд, Швеция \\ 59°51'13"N , 14°15'34"E

М

Мави р-к, Лагман пров., Афганистан

Маданский рудный район, ( = Маданское рудное поле (Pb-Zn)(Madan ore field), р-н пос. Мадан, 200 км к ЮВ от Софии, Болгария \\ галенит!!--xls< 20 см; манганильваит* (= ильваит-Mn); родохрозит!; пирротин!; сфалерит!; ферройохансенит!; халькопирит!; церуссит!! \\ http://www.mindat.org/loc-459.html

Маджуба-Хилл Майн. округ Першинг, Невада, США \\ * (1978) гоудейит \ goudeyite; клиноклаз!; * (1978) парноит; страшимирит!! \\ http://www.mindat.org/loc-3924.html

Мало-Быстринское м-ние (= Малобыстринское), м-ние, 18 км к З от Слюдянки, Прибайкалье (ЮЗ), РФ \\ афганит!; * (1991) быстрит--ф; лазурит!!!; сера!; * тункит; Pk (ф)

Малханское м-ние , Забайкалье, Россия

Малый Пункаруайв г., Ловозеро, Кольский п-ов, Россия

Маунт-Кобальт, 120 км к Ю от Клонкерри, Квинсленд, Австралия \ Mount Cobalt ( Mt Cobalt Mine), Selwyn District , Mt Isa - Cloncurry area , Queensland , Australia -- http://www.mindat.org/ \\ фото: гетерогенит!-ф; кобальтин!--ф; мансфельдит (6); смольяниновит—пс-зы по эритрину (кр-лы до 2 мм (3); сферокобальтин!--ф; эритрин!!!—(10 фото);

Маунт-Малоса \ Mt. Malosa, близ Зомба, Малави, Вост. Африка \\ барилит!; микроклин!; миларит!; ниобофиллит!!--фото-- www.mindat.org/gallery1; ортоклаз!; паризит!!; разн. 48 мин. (44 достоверных вида); эгирин!!!—xls> 20 см; эпидидимит!!—xl 5, 4 см; D; L, 1999, №4, 22-32; 48 entries listed. 44 valid minerals-- www.mindat.org (2008.02.24)

--Cairncross, B. (2002). Aegirine and Associated Minerals from Mount Malosa, Malawi. Rocks & Minerals, 77(1), 31-37.

Машамба-Уэст р-к, Катанга, ДР Конго. \\ Везиньеит--ф; карнотит!--ф; кобальтодоломит!!--ф; кобальтокальцит!!-ф; колвезит!--ф; куприт!!-ф; малахит!!--ф; метатюямунит!--ф; планшеит!--ф \\ рудник начал работу в 1978 г. \\ Источник: http://www.mindat.org/loc-4334.htm

Меднорудянский р-к, Ниж. Тагил, Ср. Урал, Россия

Мерек (= Мерекское), м-ние, ~40 км выше устья р. Мерек (приток р. Амгунь), близ ж.-д. ст. Эанга, к ЮВ от Чегдомына, 270 км к С от Хабаровска, Буреинский хр. , Хабаровский край, РФ \\ касситерит!!—xls \\ Мерек рудопр-ние, в верх. р. Мерек (левобережье р. Амгу)-касситерит!!-фото; рядом-пром. россыпи касситерита-- Расческин Е.В., 2004, 206-207 \\ Д..А. Петроченков. Касситерит [Мерек] и аммониты [Европ. Россия] в ювелирных изделиях--сообщ. в клубе друзей минералогии (2008.06.06)

Мерелани-Хиллс \ Merelani Hills, Танзания \\ алабандин!!!--xl 9x6x4 см; добыт в 2013 г.--фото www.mindat.org

Мибладен, Марокко \\ в поисках ванадинита - видеосюжет www.youtube.com/

Могок = Могоу (новое название, по Е.Я. Киевленко, 2001) (Mogok District), Мьянма (= Бирма (быв.)

Мурзинка, Ср. Урал, Россия

Топаз, дымчатый кварц, альбит (клевеландит). [Мокруша], Мурзинка, Ср. Урал, Россия. Кристалл более 5 см. Образец: Геолог. музей им.В.В. Ершова (Горный ин-т), Москва. Фото: А. Евсеев, 2018.04.06.

Мурунский массив = Мурун (Murun), близ г. Мурун (1452 м), междуречье рр. Чара и Токко, ~50 км к ЗЮЗ от пос. Торго, Алдан (СЗ), Якутия (ЮЗ), РФ \\\\ Сиреневый Камень месторождение чароита --http://petrographica.ru/

Мусонои р-к \ Musonoi mine, ~25-30 км к З (по другим данным -10 км к СЗ ) от Колвези (10°41`S, 25°39`E), Катанга (быв. Шаба, ДР Конго (быв. Заир); 10°42`S, 25°23`E \\

Найка, Чиуауа, Мексика

Насик (=Нашик)-Пуна \ Nashik distr. - Pune, Махараштра шт., Индия.

Неройка г., Прип. Урал, Россия \\ Додо м-ние \

Норильский р-н, Ср. Сибирь, Россия

Н`Чванинг (N`Chwaning), р-ки (без уточнения) , к СЗ от Куруман, Калахари (Mn)-рудное поле, ЮАР \\ афвиллит!!!--xls< 1 см; браунит!!--xl 1, 6 см (ф); журавскит!--xls; кариопилит!!; лейкофеницит!--xls< 3 мм; портландит!!!--xls< 3 см; MR, 1992, v. 23, 436; MRI

О

Одихинча \ Odikhincha, м-в, р. Котуй, 110 км к ЮЮВ от Хатанги, Ср. Сибирь, Россия

Ору-Прету (район), Минас-Жерайс, Бразилия

Отоме,, р-к (Otomezaka = Otome mine), Makioka-cho , Yamanashi City , Kinpuzan district, преф. Яманаси (Yamanashi Pref.), Япония \\ : http://www.mindat.org/loc-220223.html

Охуэла р-к \ Ojuela mine, Мапими, Дуранго, Мексика \\ кобяшевит!!--новинка Тусон-шоу 2016 г.--фото- http://webmineral.ru/

П

Пала, округ Сан-Диего, Калифорния, США \\ берилл розовый!; кунцит!!; лепидолит!; эльбаит!!!

Палитра пегматит, Кедыкверпахк г., Ловозеро

Панашкейра \ Panasqueira; Португалия; 40°10`N , 7°46`W;

1. Ферберит. Панашкейра, Португалия. Образец: Геолог. музей им. В.В. Ершова. 2. Шпинель. Кухилал, ЮЗ Памир, Таджикистан. Фрагменты более 1 см. Образец: музей "Самоцветы". 3. Кварц. Перекатное м-ние, Алдан, Якутия, Россия. Более 25 см. Образец: Уральский минералогический музей В.А. Пелепенко. Екатеринбург. Фото (1-3): © А.А. Евсеев. 4. Эльбаит (с лепидолитом). Педернейра р-к, Минас-Жерайс, Бразилия. ~8 см.. Образец: Мюнхен-шоу-2008. Фото: М. Моисеев.

Педернейра, р-к (Pederneira mine), Минас-Жерайс, Бразилия \\ эльбаит!!!--xl 20 см (ф), MR, 2000, #1, 56 \\ 18° 10' 9'' South , 42° 10' 59'' West - www.mindat.org

Первоначальные местонахождения (type localities) минералов на карте мира

Перекатное м-ние, Алдан, Якутия, Россия.

Питкяранта, Сев. Приладожье, Ю. Карелия, РФ \\ См. http://karelnedra.karelia.ru/mnia/sn_karelia.htm

Плоская г. , Кейвы, Кольский п-ов, Россия; амазонитовые пегматиты с редкими минералами Y и Yb \\ Гора Плоская 2015 - фоторепортаж - http://webmineral.ru/

Пршибрам, рудное поле, Чехия \ \ Pribram ore field, Czech Republic

Пуйва, Прип. Урал, Россия.

Пуна\ Poona = Pune (район Пуны), Индия \\

Р

Рай-Из гипербазитовый массив (район), хр. Марун-Кеу, ж.-д.. ст. Харп, ЯНАО, Тюменская обл., Пол. Урал, Россия \\

Расвумчорр, Хибины, Кольский п-ов, Россия

Ратнапура, Шри-Ланка

Рубцовское м-ние, , (рудник отработан и затоплен), 20 км к ЮВ от г. Рубцовск близ северной окраины дер. Потеряевка, Алтай, Россия; 51°28'14'' с.ш., 81°29'34'' в.д. \\ азурит!!; коннеллит!--фото ; йодаргирит!; куприт!!!; майерсит!!; маршит!!; медь!!; серебро!

Рудные горы, Гемания \ Чехия

С

Сан-Жозе-да-Сафира \ Sao Jose da Safira (San Jose de Safira), Минас-Жерайс, Бразилия - фото
http://www.hummingbirdminerals.com/IMG_2787zc.jpg \ http://www.hummingbirdminerals.com/mixedminerals7page3.html \\ - фотогалерея - http://www.mindat.org/gallery.php?loc=5894 \ http://www.mindat.org/gallery.php?cform_is_valid=1&loc=5894&cf_pager_page=4

Санкт-Андреасберг, Гарц, Ниж. Саксония, Германия (33_5) \ St Andreasberg District, Harz Mts, Lower Saxony, Germany \\ апофиллит!!; *арсенолит; *брейтгауптит; *гармотом!!!; дискразит!!; кальцит!!!; миаргирит!; мышьяк!!; нов. мин.--4 вида; пираргирит!!!; прустит!; разн.-220 мин.(198 мин. вид.)--http://www.mindat.org/loc-22230.html (на 2008.09.04) ; * самсонит!!; стефанит!!; ВВМ, 46, 56, 240 \\

Сарановское м-ние, Ср. Урал, Россия

Новые образцы из Сарановского м-ния поступили в Минер. музей им. А.Е. Ферсмана РАН

Сарбайский р-к \ Sarbayskii mine (= Сарбайское м-ние) и Соколовский р-к, гор. Рудный, 45 км к ЮЗ от Кустаная, Казахстан

Сент-Илер массив, Квебек, Канада \\ http://www.mindat.org/loc-123123.html

Сикуаньшань, Хунань, Китай

Слюдянка (и район) Словарь топонимов Слюдянского района - http://www.maxknow.ru/images/upload/articles7/468.htm

Солонго (= Магнетитовое) м-ние, Забайкалье, Бурятия, Россия

 

Суит-Хоум Майн, Алма, \ Sweet Home Mine, Alma, Колорадо, США \\

Сюебаодин \ Xuebaoding, горы, район Пинъу \ Pingwu, Сычуань, Китай

--Ottens,B (2005) Xuebaoding, Pingwu county, Sichuan province, China. Mineral.Record 36, 45-57.

Сянхуалин \ Xianghualing (м-ние Sn-Pb-Zn), Хунань, Китай--балифолит*; гиббсит-26ф; либерит*; сянхуалинит*; таафеит!! ФЛЮОРИТ!!!--402фд; Liu, 2006, 201-215

Т

Талнах м-ние, Ср. Сибирь (С)

Тигриное м-ние, Приморье, Россия \\

--Попова В. И., Попов В. А., Коростелёв П. Г., Орловский В. В. Минералогия руд W-Sn-месторождения Тигриное и перспективы его освоения. Екатеринбург: УрО РАН, 2013 г. – 133 с.

Титовское м-ние, р. Догдо, хр. Тас-Хаяхтах, Пол. Якутия, Россия

Толбачик (= Толбачинский) (Tolbachinskii) вулкан, к ЮЗ от Ключевской Сопки, Камчатка, Россия\\ разнообразие - более 240 видов; новые минералы - более 75 видов; по числу новых минералов, открытых здесь, вулкан Толбачик занимает теперь 3-ье место в мире среди всех местонахождений минералов (данные И.В. Пекова, 2015.10) \\ См. также http://www.mindat.org/loc-5602.html

--Арсенатная фумарола, Второй шлаковый конус, Северный прорыв, Большое трещинное извержение (БТТИ), вулкан Толбачик, Камчатка, Россия

--Большое трещинное извержение (БТТИ), Толбачик вулкан, Камчатский край, Россия

Траверселла (Traversella), близ Ивреа, Пьемонт, Сев. Италия \\ аметист!!; доломит!; магнетит!!—xls< 3 см; пирит!; шеелит!!; эпидот!; ВВМ, 160, 234

Турьинские р-ки, Сев. Урал, Россия \\ Фёдоров Е. С., Никитин В. В. Богословский горный округ. Описание в отношении его топографии, минералогии, геологии и рудных месторождений. - СПб., 1901. - С. 92.

Тюямуюн, Киргизия

У

Уа-Уа Маунтинз, близ Delta, округа Бивер, Миллард и Айрон, Юта, США \ Wah Wah Mts, Millard Co. \ Beaver Co. \ Iron Co., Utah, USA \\ берилл!!!--xls, малиново-красный; гейкилит

Уансала, р-к (Pb-Zn) \ Huanzala mine, близ Уансала, 10 км к СЗ от гор. Уальянка, и 80 км к З от Уануко, деп. Уануко, Анкаш, Перу \\ пирит!!--xls < 20 см, друзы; флюорит!!--розовые xls< 5 см (MR, 1981, 12, 187), зеленые октаэдры < 10 см; MR, 1997, #4, 47 \\ \\ ExtraLapis, No. 11 Pyrit · Herbst 1996 -

Умбозерский р-к, г. Аллуайв, Ловозеро, Кольский п-ов, РФ

Ушкатын-III, м-ние (Fe-Mn), близ пос. Жайрем, Атасуйский р-н (З), Ц. Казахстан \\ бементит!; брандтит!; браунит!; вульфенит; гаусманнит; кентролит!; пеннантит!; родохрозит!!; тодорокит!!; церуссит!!; якобсит

Ф

Фрайберг (=Фрейберг), район.

Франклин, Нью-Джерси \ (Franklin), 80 км к СЗ от Нью-Йорка, округ Сассекс, Нью-Джерси, США \\ аллеганит! (М 3-1); виллемит!! (М 3-1)—xls<20 см; ганит! (М 2-3); гетеролит! (М 2-3); глаукохроит! (М 3-1); годжкинсонит! (М 3-1); ларсенит! (М 3-1); лейкофеницит! (М 3-1); *ленниленапеит (ММ); лёллингит! (М 1-1); * новые мин.—67 видов (вместе с м-нием Стерлинг-Хилл); норбергит! (М 3-1); пирохроит! (М 2-3); родонит!! (М 3-2); тефроит! (М 3-1); * франклинит!! (М 2-3)—xls< 15 см; хендриксит!; цинкит!!! (М 2-2); BG, 19, 21; MR, 1996, 226 (лит.)

Х - местонахождения

Хагендорф, Бавария, Германия

Хайдаркан, м-ние, Киргизия

Хибины, Кольский п-ов, Россия \\ карта Хибин \\ турист. схема

 

Хуанганг р-к \ Huanggang Mine (Huanggangliang Mine), Внутр. Монголия, Китай

--Ottens, B., and Neumeier, G. (2012): The Huanggang Mine, Inner Mongolia, China. Mineralogical Record 43, 529-563.

Ц

Цумеб \ Tsumeb и район, Намибия \\ (ГРЭ- III , 587-593); геол. карта р-на; геол. разрез); «скопления германита достигали веса в несколько сотен тонн» (с.589) ; новые минералы- 71 мин. вид - см. www.mindat.org

 

Ч

Челекен (Cheleken) , 70 км к Ю гор. Туркменбаши (= Красноводск (быв.)), Туркмения \\

Чукикамата, Chuquicamata (22°18`S, 68°55`W), 15 км к N от Каламы, Антофагаста, Чили \\ атакамит! (М 2-1); *(2011) бетпакдалит-NaNa; * (1811) блёдит; мендосавиллит*; маршит! (М 2-1); *1908-натрохальцит;(Gui-72); * новые мин.—12 видов; *1986-обрадовичит; * самплеит

Ш Щ

Шерловая Гора (= Шерлова гора = Ширлова гора) (Scherlovaya Gora), Вост. Забайкалье, РФ \\
Минералогический Альманах, том 19, выпуск 2, 2014 \\

Шимен, Хунань, Китай

Шкатулка, пегм. залежь, Умбозерский р-к, Аллуайв, Ловозеро, Кольский п-ов, РФ.

Шнееберг, Рудные горы, Саксония, Германия \\ 365 минералов, из них 299 достоверных видов, из них 43  новых вида ( type locality) на 2016.03.04\\ Источник: http://www.mindat.org/loc-1848.html

Шор-Су = Шорсу, м-ние, 30-35 км к ЮЮЗ от Коканда, Фергана (Ю), Узбекистан \\ озокерит!; сера!!!; целестин; МС-1, 278-279; Смо, 356

Шуньга, Карелия

Э

Эвеслогчорр, Хибины, Кольский п-ов, Россия

Эльба о., Италия

Эронго, Намибия.

Юбилейная залежь \ Jubilee( = Yubileinaya) pegmatite ), Карнасурт, Ловозеро, Кольский п-ов, Россия

Я

Яогансян р-к (W) \ Yaogangxian = Yao Guang Xiang, 40 км к ЮВ от Ченжоу, Хунань (Ю), Китай \ Yaogangxian = Yao Guang Xiang, Yizhang Co., Chenzhou Prefecture, Hunan; 25°35'N , 113°15'E \\ : http://www.mindat.org/loc-4549.html \\ Ottens, B. and Cook, R.B. (2005): The Yaogangxian tungsten mine, Yizhang County, Chenzhou, Hunan Province, China. Rocks & Minerals 80(1), 46-57.

Яхимов (Jachymov) (= быв. Иоахимсталь\ Joachimsthal), Западно-Чешский край, Богемия, Чехия \\ http://www.mindat.org/loc-158151.html \\

см. также--СПРАВОЧНИК МЕСТОНАХОЖДЕНИЙ МИНЕРАЛОВ И РУД - http://mineral.nsu.ru/educat/article/7/

СТРАНЫ и РЕГИОНЫ

Находки минералов по всему миру. Подробнее: Евсеев А.А. Атлас мира для минералога. М., 2004. - 284 с. \\ Евсеев А.А. Атлас для минералога. Россия и бывший СССР . М., 2011. – 248 с

СТРАНЫ от А до Я

находки минералов по листам карты мира: 1234567 891011121314151617181920212223242526272829303132 - 33

Викимапия \ Wikimapia (карты мира и России)

Сев. Америка (С)

Гренландия

Атлантика - Скандинавия - Кольский п-в

Урал
Ср. Сибирь
Якутия
СВ России

Сев. Америка (З - Сев. Америка (Кордильеры)

Сев. Америка (В)

Британ. о-ва, Пиренейский п-в - Зап. Европа - Вост. Европа

Казахстан, Ср. Азия

Юг Сибири
Забайкалье, Вост . Сибирь
Камчатка - Дальний Восток (Россия, Япония
Мексика
Кавказ, ЮЗ Азия
Афганистан, Пакистан
Индия
Монголия. Китай
ЮВ Азия - Тихий океан
Ю. Америка (СЗ) - Кордильеры
Бразилия

Африка - Сев. и Зап.Экв. и ЮжнВост.

Антарктида
Австралия

Тихий океан - Весь мир

Интересная подборка из 9 минералов региона получается если взять по одному из 9 его частей (центр, север, юг, запад, восток, СВ, ЮВ, ЮВ, СЗ)

Mineralienatlas - указатель по странам - https://www.mineralienatlas.de/

Арктика

Земля Франца-Иосифа, Северный Ледовитый океан, Арктика; Архангельская обл., Россия \\ Карбонатные (?) конкреции!!--о. Чамп; кварц (халедон) по дереву! - о. Мак-Клинтока о.; сера!

Северный Ледовитый океан - карта

Новая Земля

Восточное полушарие

Евразия

 

Россия и СССР

--Минералы СССР, т.1 "Самородные элементы"/ под ред. А.Е.Ферсмана (редактор тома Н.А.Смольянинов), Изд.АН СССР Москва-Ленинград. 1940 г. - 328 с., тир. 3000 экз.

--Геологические памятники природы России "Природное наследие России" . Авторы: Карпунин А.М. , Мамонов С.В. , Мироненко О.А. , Соколов А.Р. Главный редактор - Орлов В.П. Санкт-Петербург, 1998 г.\\ веб-публикация

Города России - на карте - http://town-map.ru/index.html

Реки России - сайт - http://vsereki.ru

Физическая карта России - http://town-map.ru/346093.html

Карта России на сайте К.И. Клопотова

Кристаллы России в экспозиции Минералогического музея им. А.Е. Ферсмана РАН (кристаллы 5 см и более на выставке "Кристаллы")

10 замечательных минералов России (экспресс-опрос провел А. Евсеев)

Минералы России по числу ссылок (20 и более) в «Атласе мира для минералога»

Новые минералы ( СССР и Россия) \\ Список всех новых минералов, открытых на территории быв. СССР с 1766 до первой половины 2006 г. содержит 714 достоверных ( valid ) минеральных видов – см. Pekov I.V. New Minerals from Former Soviet Union Countries, 1998-2006 // Mineralogical Almanac, Vol. 11. Moscow, Mineralogical Almanac, 2007, 112 pp. (список - стр. 85-88)

Полезные ископаемые - Википедия

Разнообразие минералов (2017 г.) : достоверные виды -2182; новые виды - 764; фото минералов - 10847 ( на 2017.12.05)

Разнообразие минералов (2011 г.) - 2889 ; из них достоверные виды - 1796; новые виды - 614; фото минералов - 5724; фото мест - 85 (на 2011.05.03) \\ Источник: http://www.mindat.org/loc-14409.html

Основные структурно-минерагенические провинции цветных камней России - http://www.lavrovit.narod.ru/kamni/provincia.htm

Карта "Самые замечательные месторождения минералов в Союзе" (фрагмент). Источник: Ферсман А.Е. Занимательная минералогия. М. -Л.: "Детская литература", 1937. - 240 с. Объяснения к карте - см. стр. 235-238. Подробнее Коллекционные минералы из России - http://www.kristallemineralsrussia.com/

Кольский п-в и Карелия \\

Хибины и Ловозеро --карта (спутник)

Кольский п-в_фото минералов_Bernard - новая страница

-- В.В. Борисова, А.В. Волошин. Перечень минеральных видов Кольского полуострова. Изд. 4-е, испр. и доп. / – Апатиты: К&М, 2010. – 64 с

Минералы Кольского п-ва от A до Z \\ 1168 минералов; 835 минер. видов; 255 новых видов; фото минералов - 22181.(1-е - адамсит-(Y), 101- бахчисарайцевит и т.д.) \\ Источник: http://www.mindat.org/loc-2666.html (на 2014.06.19)

От Белого до Баренцева моря через Кольский полуостров.

Минералы Кольского п-ва от А до Я (по Борисовой В.В. и др., 2002 с доп.)

--Новые минералы---264 вида \\ Волошин А.В. , Пеков И.В., Борисова В.В. Минералы, впервые открытые в Кольском регионе: исторический обзор и статистические данные. - Минер. альманах. Т. 18, вып.2, 2013, с.107-123

"Фото дня" на сайте или "За месяц вокруг света". 2018.04.03

Аметист. Кристаллы до 2 см. Мыс Корабль, Кольский п-ов, Россия. Образец: ФМ. Фото: © А.А. Евсеев.

 

Карелия \\ http://mindat.ru/locathn/r_karel.htm \

- Атлас структур и текстур докембрийских вулканогенных пород Карелии \\ литература

Вост. Европа

Россия \\ 3086 минералов; 1959 минер. видов; 255 новых видов; фото минералов - 8561(1-е - абрамовит, 101- Allochalcoselite и т.д.) \\ Источник: http://www.mindat.org/loc-14409.html (на 2014.06.19)

Местонахождения минералов России на сайте К.И. Клопотова

Европейская часть России

Архангельская обл.

КМА \\ Европ. часть России (север) \\

Тиман \\ Сев. Тиман--путешествия \\ путешествия-2009 \\ схема

Поволжье \

Подмосковье, Россия и Москва

Центр Европ. части России

Юг России

Крым

--Тищенко А.И. Минералы Крыма. - Симферополь: Бизнес-Информ, 2015. 304 с., 72 с. цв. вкл.

Сев. Кавказ, Россия

Урал на сайте /www.mindat.org (на 2016.01.25) : минералов - 1057, твердых видов - 727 ; новых минер. видов (type locality) - 81

- пока не найдены (не описаны для Урала на 2014 г.) : сподумен, эвдиалит...:

УРАЛ. Иллюстрированная краеведческая энциклопедия - http://quist.pro/books/ural_01.a.3.php

ПРИРОДНЫЕ ДОСТОПРИМЕЧАТЕЛЬНОСТИ УРАЛА - http://nashural.ru/mesta.htm

Рудники (и не только) Урала - фотогалереи \ видео "Планета Карабаш"

Пай-Хой

Пермский край, Россия \\ Геологические памятники - http://www.perm-kray.ru/index.htm

Полярный Урал, Россия \\ фото - http://polyarny.net/foto/

ПРИПОЛЯРНЫЙ УРАЛ \\ КЕММЕРИХ А. О.  ПРИПОЛЯРНЫЙ  УРАЛ. ПУТЕВОДИТЕЛЬ. ИЗДАТЕЛЬСТВО «ФИЗКУЛЬТУРА И СПОРТ». МОСКВА 1970 \ веб-публикация

СЕВЕРНЫЙ УРАЛ (64°00'—58°45' с. ш.)

--Минералы, названные в честь ученых, побывавших на Северном Урале - видео - www.youtube.com

Блог Михаила Цыганко - http://zolotoy-kamen.ru

СРЕДНИЙ УРАЛ (58°45' — 56°00' с.ш.

ЮЖНЫЙ УРАЛ (56°00' — 51°00' с. ш.)

Колисниченко С.В.. Гиганты в мире минералов на Южном Урале (2009 г.):

Сайт "Минералы Челябинской области" - http://www.chelmineral.ru/ \\ местонахождения - http://www.chelmineral.ru/?page=deposits

Сибирь \ Сибирь в "Атласе мира для минералога". - Местонахождения минералов и примеры находок http://geo.web.ru/druza/L-AtE_Sib.htm \\

--Реутовский В.С. Полезные ископаемые Сибири. - СПб., 1905. - 874 с.: карта. Автор - инженер, редактор и издатель журнала "Вестник золотопромышленности и горного дела вообще" (Томск).

Дополнения к списку (Евсеев А.А. Минералогические находки. Краткий обзор. I. Сибирь. М., 2006. – 157 с. )

Зап. Сибирь

Ср. Сибирь \\

Нижняя Тунгуска р.

Якутия 591 минералов; 459 минер. видов; 50 новых видов; фото минералов - 403 \ 591 entries listed. 459 valid minerals. 50 type localities (valid minerals). \\ http://www.mindat.org/loc-2644.html (на 2012.03.13)

"Фото дня" на сайте или "За месяц вокруг света". 2018.04.09

Везувиан (вероятно, вилуит). Вилюй р., у впадения в нее р. Ахтаранда, Якутия, Россия. Образец: Мин. музей им. А.Е. Ферсмана РАН . Фото: © А.А. Евсеев.

- Минералы Якутии - на сайте К.И. Клопотова

--Месторождения - http://www.atlas-yakutia.ru/depositmap.html

Алдан, Якутия \ Хабаровский край, Россия.

 

СВ России

--ГЕОЛОГИЯ И МИНЕРАЛЬНО-СЫРЬЕВЫЕ РЕСУРСЫ СЕВЕРО-ВОСТОКА РОССИИ Материалы всероссийской научно-практической конференции 1-3 апреля 2014 г. Якутск 2014. - http://www.diamond.ysn.ru/content/VNPK_Yakutsk_2014.pdf

Магаданская обл. \\

"Фото дня" на сайте или "За месяц вокруг света". 2018.04.10

Серебро. Дукат м-ние, Магаданская обл., Россия (СВ). 1980-ые гг. Мюнхен-шоу-2007. Фото: © М. Моисеев

 

Чукотка, Россия (СВ)

Камчатка \

 

Вулкан Мутновский

Корякия

\\ Курильские о-ва

Дальний Восток

Дальний Восток (Россия) литература по геологии и пол. ископ. (в алфавите авторов) - http://wiki.fegi.ru/index.php/Амур р.

--Новые и редкие минералы Дальнего Востока. - Владивосток: ДВО АН СССР, 1987. - 128 с.

Амурская обл., Россия \\ Приморье, Россия \\ Сахалин \\ фото - http://fotocult.ru/gallery/

Хабаровский край и Еврейская АО, Россия \\

Юг Сибири

Алтай, Россия \ Казахстан

Горный Алтай

--Чаган-Узун, Горный Алтай, Россия

Бурятия

Восточная Сибирь

Горная Шория, географическая область, Сибирь (ЮЗ), Кемеровская обл., Россия

Енисейский кряж

Забайкалье, Россия \\ фото - http://www.crystallika.com.postman.ru/

Забайкалье_местонахождения

--ОПИСАНИЕ МЕСТОРОЖДЕНИЙ ЗАБАЙКАЛЬЯ [А.Е. Ферсман]

Иркутская обл. \\

Агат. Непа р., лев. прит. р. Нижн. Тунгуска (в её верховьях), Иркутская обл. (С), Вост. Сибирь, Россия. Более 6х8 см. Образец: Минер. музей МГРИ-РГГРУ. Фото: © А. Евсеев. \\ НМК-165

Кемеровская обл. и Горная Шория

Красноярский край \\ минеральные ресурсы - http://nature.krasn.ru/content.ph

Прибайкалье

Диопсид (разн. виолан). Довырен г., Йоко-Довыренский массив, Сев. Прибайкалье, Россия. Образец: ФМ (№76876, Перцев Н.Н., 1975). Фото: © А.А. Евсеев

Саяны и Присаянье

Тува \\ Хакасия

--ЛИТЕРАТУРА О РЕСПУБЛИКЕ ХАКАСИЯ Библиографическийуказатель Том 1 Природа и природные ресурсы Хакасии, их охрана и рациональное использование (2-я половина XIX-XX в.)  - http://www.nbdrx.ru/razdeli/resursi/izd/bibukazatel/bib_ukazatel1.pdf

xxx

Атлантика

Исландия

"Фото дня" на сайте или "За месяц вокруг света". 2018.04.01

Томсонит. Фарерские о-ва, Атлантический океан; Дания. Образец: ФМ (Jan Kaspar, 1957) Фото: © А.А. Евсеев.

 

Европа

--Зап. Европа_минералогические особенности (в фотографиях образцов от А до Я) -- Европа_крупные кристаллы \\ Европа _кристаллы_5 см \\ Европа_кристаллы _10 см

Европа. Первоначальные местонахождения минералов \ type localities (примеры из находок за 2004-2013 гг.--по Bernard, 2013 и др.). Составил: А. Евсеев, 2018. Местонахождения минералов от А д оЯ \ A-Z \\ Аллуайв-аллуайвит*; дуалит*; елисеевит*; катаплеит!!-фд; манганоэвдиалит*; Умбозерский р-к -уссингит!!!; стенструпин!!; терскит!!; эльпидит!!! \\ Anna Mine, Alsdorf, Aachen--андросит-(Fe) \\ Аспедаммен \ Aspedammen, близ Halden--aspedammite*; iangreyite* \\ Бэица Бихорулуй \ Baita Bihorului--гемимор- фит*- 2фд; грацианит*; cuproneyite*; cupromakovickyite*; ссайбелиит*-3фд \\ Валлетта р-к \ Valletta Mine, Vallone della Valletta, Canosio-нов.мин.: Braccoite *; Canosioite*; Castellaroite*+; Grandaite*; Lombardoite*; Piccoliite*; Rudlingerite* \\ Лаврион--адамин!!; аттикаит*(2007); новые мин.*!!; леграндит--ф; Zincolivenite*-5фд; разн.-366 мин--Bern-04 \\ Ла Фосса \ La Fossa crater, Vulcano --нов. мин.--33 вид.; андраносит-(Fe)*; влодавецит\\ Монте-Неро р-к \ Monte Nero Mine, Rocchetta Vara--Castellaroite*+; coralloite* \\ Оскаген к-р (Аскаген к-р) \ Askagen quarry, Hallefors--allanite- (Nd), askagenite-(Nd) \\ Aitern South Mine, Шёнау \ Schonau--Plumboagardite (TL)*--K. Walenta, 2005 \\ Apikia (Apoikia), Vasilikon Mt, Andros Isl.--абсвурмбахит\ -Abswurmbachite*; браунит; пьемонтит; шаттукит...--mindat.org \\ Baccu Locci mine, near Villaputzu--sarrabusite*\\ Vasilikon Mt, Андрос о. -манганиандросит-(La)*--Petalon Peak \\ Bern-2013_A-loc_2018. 04.09

Европа (СЗ)

Скандинавия \\ Норвегия \\ Финляндия \\

Швеция

Гарпенберг Норра р-к, Бергслаген пров., Швеция \ Garpenberg Norra mine, Bergslagen ore province, Sweden \\ www.mindat.org

--Барисилит \\ Kolitsch, U. and Holtstam, D. (2002) Barysilite from Garpenberg Norra, Dalarna, Sweden: occurrence and crystal structure refinement. Mineralogical Magazine: 66: 353-363.

--Иетманит и магнуссонит \\ Nysten, P. (2003) Yeatmanite and magnussonite from the Garpenberg Norra mine, Bergslagen ore province, Sweden. Canadian Mineralogist: 41: 201-206.

--Ринманит - новый минерал \ Holtstam, D., Gatedal, K. Soderberg, K. and Norrestam, R. (2001) Rinmanite, Zn2Sb2Mg2Fe4O14(OH)2, a new mineral species with a nolanite-type structure from the Garpenberg Norra mine, Dalarna, Sweden. Canadian Mineralogist: 39: 1677-1685.

"Фото дня" на сайте или "За месяц вокруг света". 2018.04.02

Кобальтин в сульфидной руде. Тунаберг, Бергслаген, Швеция. Образец: ФМ (№27495). Фото: © А.А. Евсеев.

З а п. Е в р о п а

Британ. о-ва, Пиренейский п-в

Andrew G. Tindle (2008) Minerals of Britain and Ireland

Ирландия

Корнуолл, Англия

Испания \

Испания и Португалия, Пиренейский п-ов. Минералогические находки (примеры). Местонахождения от А до Я: Альмаден--киноварь!!!, каломель!!--ММЕ, 258ф- xls<1 см; ртуть!\ Аскарате к-р, Эуги \ Azkarate Quarry, Eugui --ДОЛОМИТ!!!--130фд; бариосинкосит \ bariosincosite!--фд \\ А Франкейра \ A Franqueira, A Caсiza, Pontevedra--фд: изумруд-12; фенакит-3, xl 4 см; хризоберилл \ александрит-1 \\ Барросу-Альван \ Barroso-Alvao pegmatite field \ пегм.поле--петалит!; сподумен!; ставролит; танталит-(Mn); эвкриптит! -mindat \\ Бербес--барит!; флюорит!! \\ Иенделаэнсина \ Hiendelaencina--фрейеслебенит!!--ММЕ, 267 \\ Карчелехо \ Oficarsa Quarry, Carchelejo --пренит!!--148фд \\ Линарес--линарит*-mindat \\ Лугар да Наве \ Lugar da Nave Q. сиен.к-р), Monchique--фд: анальцим-12;гоннардит-2+; натролит- 33; \\ Мингланилья--арагонит!! \\ Молина-де-Арагон--арагонит!!*--Gallo River(TL), пров.Гвадалахара \\ Мончике \ Моншике Monchique лакколит--1-е фойяиты (+ жилы фойяит. пегматитов) и мончикиты; тингуаиты \\ Навахун \ Navajun--пирит!!!-177фд; ГНМ-1 \\ Орначуэлос \Hornachuelos--андалузит!!--Gui-72 \\ Панашкейра --апатит!!; арсенопирит!!; ферберит!!! \\ Сабугаль\ Sabugal--отенит!!; сабугалит* \\ Сантьяго-де-Компостела-- кварц!!; ставролит!; хиастолит \\ Таиян, Валенса ду Минью \ Taiao, Valenзa do Minho--амазонит!--3фд \\ Col d'Urdach, Aramits, Франция --фд: корунд!-3; сапфир-10; самарскит-0; чевкинит-0; эшинит-0 \\ Яросо овраг--La Estrella mine, Jaroso Ravine--ярозит*. Составил: А. Евсеев, 2018. Внимание: название и привязка (положение на карте) некоторых местонахождений требует уточнения (показаны на карте красными и коричневыми значками). Карты предназначены только для образовательных целей. Подробнее: Евсеев А.А. Атлас мира для минералога. М., 2004. - 284 с. Сокращение: фд - фото минерала на www.mindat.org

"Фото дня" на сайте или "За месяц вокруг света". 2018.04.04

Глауберит. Консуэло р-к \ Consuelo mine, Мадрид (р-н), Испания. Кристалл более 2 см. Образец: Минер. музей им. А.Е. Ферсмана РАН (из поступлений 2012 г.). Фото: © А. Евсеев.

Португалия

Австрия \\ Австрия \ карта и минералогические находки

 

Альпы \\ Альпы_карты для минералогов

Бавария, Германия \\ Баден-Вюртемберг, Германия

Балканский п-ов

Бельгия \\

Болгария \\ минералов - 428; мин. видов - 353; нов. видов - 8; фото минералов - 556 (на 2011.11.01) \\ Источник: http://www.mindat.org/loc-14255.html

Венгрия

Германия \\ фото минералов \\ http://www.mindat.org/rloc.php?loc=Germany \\ http://www.mindat.org/loc-14244.html)

Сев. Рейн-Вестфалия (Германия)

Греция

Греция. Первоначальные местонахождения минералов \ type localities(примеры). Лаврион--адамин!!; аттикаит*(2007); новые мин.*!!; леграндит--ф; Zincolivenite*-5фд; разн.-366 мин--Bern-04 \\ Apikia (Apoikia), Vasilikon Mt, Andros Isl.--абсвурмбахит\ -Abswurmbachite*; браунит; пьемонтит; шаттукит...--mindat.org \\ Vasilikon Mt, Андрос о. -манганиандросит-(La)*--Petalon Peak. Составил* А. Евсеев, 2018. Внимание: название и привязка (положение на карте) некоторых местонахождений требует уточнения (показаны на карте красными и коричневыми значками). Карты предназначены только для образовательных целей. Подробнее: Евсеев А.А. Атлас мира для минералога. М., 2004. - 284 с.

 

Италия \\ в миндат \\ \\ 2291 минералов \ entries listed. 1340 достоверных видов \valid minerals. 266 новых видов \ type localities (valid minerals). 5 type localities (others).(на 2011.07.30)

--Кораллоит* – новый минерал из Италии (Monte Nero Mine*, Rocchetta VaraLa Spezia ProvinceLiguriaItaly)
\\  Callegari, A.M., Boiocchi, M., Ciriotti, M.E., Balestra, C. (2012) Coralloite, Mn2+Mn3+2(AsO4)2(OH)2•4H2O, a new mixed valence Mn hydrate arsenate: Crystal structure and relationships with bermanite and whitmoreite mineral groups. American Mineralogist, 97, 727-734.

--Валлетта р-к, Пьемонт, Италия \ Valletta Mine, Vallone della Valletta, Canosio, Maira Valley, Cuneo Province, Piedmont--новые минералы: Braccoite *; Canosioite*; Castellaroite*+; Grandaite*; Lombardoite*; Piccoliite*; Rudlingerite* \\ Источник и подробнее - https://www.mindat.org/loc-259564.html

--Новые минералы, открытые в Италии \\ Marco E. Ciriotti, Lorenza Fascia, Marco Pasero. Italian Type Minerals. Pisa: Plus-Pisa university press, 2009, 357 pp. \\ О книге (А. Касаткин) - http://www.minbook.com/new_books_ru.html

--Фотогалерея микроминералов Италии - Итальянская Микроминералогическая Ассоциация \ Galleria fotografica dell'AMI - Associazione Micromineralogica Italiana - http://imgdb.amiminerals.it/

Пьемонт, Сев. Италия

Тоскана

Карпаты \\ Македония \\ Польша \\

Румыния \\

--Грацианит - новый минерал из скарнов Бэица-Бихор \ Baita Bihor, Румыния \\ Ciobanu, C.L., Brugger, J., Cook, N.J., Mills, S.J., Elliott, P., Damian, G., Damian, F. (2014): Gratianite, MnBi2S4, a new mineral from the Baita Bihor skarn, Romania. American Mineralogist, 99, 1163-1170.

Сербия \\ Словакия \\ Словения

Франция

--Mineralogie de la France by Eric Asselborn, 2013. 242 pages.

--Deliens, M. et al. (1990). "Mineraux des gisements d'uranium du Lodevois." Ed. Association Francaise de Micromineralogie, 1-61.

Чехия \\

Швейцария \\

--Клейсонит \ Cleusonite - новый минерал из Швейцарии \\ - Cleuson lakeNendaz Valley, Валлис \  Wallis (Valais)Switzerland ; 46° 6' 40'' North , 7° 19' 33'' East - по www.mindat.org \\ Wulser, P.-A., Meisser, N., Brugger, J., Schenk, K., Ansermet, S., Bonin, M., Bussy, F. (2005): Cleusonite, (Pb,Sr)(U4+,U6+)(Fe2+,Zn)2(Ti,Fe2+,Fe3+)18(O,OH)38, a new mineral species of the crichtonite group from the western Swiss Alps. European Journal of Mineralogy 17, 933-942

Средиземноморье

Вост. Европа \\

Белоруссия \\ Прибалтика

Украина

-- Местонахождения минералов Украины от А до Я

--Прудянский к-р, Черкасская обл., Украина \\ Апофиллит, редкоземельный

Украинский щит - геологические памятники - Google Maps

Волынь и СЗ Украина

Донбасс \ Приазовье

Прикарпатье \\ Закарпатье

Молдавия

Евразия

Азия

Япония \\ http://www.petrovrareminerals.com/articles02.html \\ http://www.mindat.org/loc-14488.htm

Корейский п-ов

Казахстан и Средняя Азия Казахстан и Средняя Азия_А-Я_местонахождения минералов (на карте)

Казахстан \\ Восточный Казахстан

Средняя Азия \\

Киргизия \\

Таджикистан \\

--Кухи-Малик уроч., над бывшим кишлаком Рават, напротив устья реки Габеруд, Ц. Таджикистан \\ селен сам.--ФМ--образец №96145 - Щетки черных призматических кристаллов селена (длиной до 0.5 мм) на обожженной осадочной породе. Дар: Паутов Л.А.,Мираков М.А., Файзиев А.Р. 2018

----Белаковский Д.И., Москалев И.В. Аммониевая селитра из продуктов угольного пожара в урочище Кухи-Малик (Ц. Таджикистан) // Нов. данные о минералах. М.: «Наука», 1988, №35, с. 191-194.

Памир

Карамазар рудный район, Сев. Таджикистан: Адрасман (Adrasman) --Алтын-Топкан--Кансай --Кураминский хр --

Туркмения \\ Узбекистан \\

Афганистан \ Afghanistan - http://www.mindat.org/

Пакистан

"Фото дня" на сайте или "За месяц вокруг света". 2018.04.14. Брусит (желтый!). [Килла Сайфуллах Дистр.], Белуджистан, Пакистан\ Killa Saifullah Distr., Balochistan "Гемма". 2018.03.31. Образец: "Русские минералы". Фото: © А.А. Евсеев. Подробнее: 50 фото - www.mindat.org

 

Кавказ, ЮЗ Азия

Азербайджан \\ Армения \\ Грузия \\

Израиль \\ Иордания \\ Палестина

Иран \\

"Фото дня" на сайте или "За месяц вокруг света". 2018.04.15.

Гематит на коралле. Ормуз о., Hormoz Island, Иран. Из коллекции А.В. Касаткина. Фото: © А. Евсеев. 2017.

 

Йемен, Аравийский п-ов \\ Оман \\ Саудовская Аравия \\ Сирия

Турция \\ минералы и местонахождения --см. http://www.mineralienatlas.de/ \\ Ryan C. W. Guide to the Known Minerals of Turkey. Ankara, 1960, 196 p.

Индия, Непал, Шри-Ланка

Индия - http://www.mindat.org/loc-16773.html

"Фото дня" на сайте или "За месяц вокруг света". 2018.04.16.

Апофиллит, гейландит. Савда \ Sawda, Джалгаон, Махараштра, Индия. Образец: Музей Terra mineralia, Германия. Фото: © Д. Тонкачеев

 

Шри-Ланка

Вост. Азия ( Китай и др.)

Китай \ China \\ www.mindat.org

Названия минералов и местонахождений Китая

Китай_географические названия \\ Особенности при переходе от английского варианта к русской транскрипции \\ несколько примеров (от атласа Encarta-2001 к "Атласу мира". М., 1997)

Mianyang Мяньян Xinjiang Синьцзян
Pingwu Пинъу Xixia Сися
Zagunao Дзагунао Xuanhua Сюаньхуа
Zouxian Цзоусянь Xuancheng Сюаньчэн

--фото минералов!!--http://www.williampinch.com/china/

Внутр. Монголия \\ Ганьсу пров. \\ Гуандун \\ Гуанси-Чжуанский автономный район \\ Гуйчжоу \\

Нефрит и жад \\ http://www.chinahighlights.com/travelguide/culture/jade-articles.htm

Синьцзян-Уйгурский автономный район; Китай

Сычуань, Китай \\ Тибет \\ Фуцзянь, провинция \\ Хайнань \\

Хубэй \\ Хунань, провинция, Китай - http://www.mindat.org/loc-705.html

Хэбэй пров. \\ Цинхай \\ Цзянси пров. \\ Шаньси \\ Юньнань \ Yunnan \\ www.mindat.org

Юньнань

Флюорит_Китай и Монголия

Вьетнам \\

Индонезия - см. http://www.mineralienatlas.de/

Камбоджа \\

Лаос

\ Малайзия \\

Монголия

Мьянма (быв. Бирма) \\

"Фото дня" на сайте или "За месяц вокруг света". 2018.04.17.

Шпинель (кристалл 5 мм) в мраморе. Могок (р-н), Мьянма. Образец: Минер. музей РГГРУ (Р-1217. Пост. 2011 г. ). Фото: © А. Евсеев.

Таиланд \\ Филиппины \\

ЮВ Азия

Африка

Африка. Первоначальные местонахождения минералов \ type localities (примеры из находок за 2004-2013 гг.--по Bernard, 2013 и др.). Составил: А. Евсеев, 2018. Местонахождения минералов от А д оЯ \\

Алжир \\ Гвинея \\

Египет \\

"Фото дня" на сайте или "За месяц вокруг света". 2018.04.18.

Перидот (хризолит). Зебергед о., Красное море, Египет. Образец: Мин. муз. им. А.Е. Ферсмана РАН. Фото: © А. Евсеев

 

Мали \\

--Currier, R. H., Pohl, D., (2011), Mineral Collecting in Mali, Mineralogical Record: 42(3): 231-250

Марокко

Нигер

Чад.

Экв. и Южн. Африка

Ангола \\

Ботсвана

Габон

Замбия \ Zambia (ныне) = Сев. Родезия (быв.), Африка

Зимбабве

Камерун

Конго НР

Конго ДР (быв. Заир) \\ Buttgenbach H. Mineraux de Belgique et du Congo Belge. Liege, 1947, 590 p.

--Кобокобоит - новый минерал из пегматита Кобокобо(ДР Конго) \\ Mills, S. J., Birch, W. D., Kampf, A. R. & van Wambeke, L. (2010) Kobokoboite, Al6(PO4)4(OH)6•11H2O, a new mineral from the Kobokobo pegmatite, Democratic Republic of the Congo. European Journal of Mineralogy, 22(2), 305–308.

Намибия

Эллингсенит. Арис к-р, близ Виндхука, Намибия. Образец: Мин. музей им.А.Е. Ферсмана РАН (Дар: Д.И. Белаковский, 2013). Фото: © А. Евсеев (2018).\\ НМК-165

Экв. Гвинея

ЮАР

--Gasparrini, E. and Hiemstra, S.A. (1975) Paolovite (Pd2Sn) from the Atok mine in the Merensky Reef. Transactions of the Geological Society of South Africa, 78, 167-169.

--Циприн - новый минерал группы везувиана из р-ка Весселс, Ю. Африка \\ Panikorovskii, T.L., Shilovskikh, V.V., Avdontseva, E.Yu., Zolotarev, A.A., Pekov, I.V., Britvin, S.N., and Krivovichev, S.V. (2017) Cyprine, Ca19Cu2+(Al,Mg,Mn)12Si18O68(OH)10, a new vesuvianite-group mineral from the Wessels mine, South Africa. European Journal of Mineralogy: 29: 295-306.

Вост. Африка \\ Бурунди \\

Кения

--Цаворит \\ www.mindat.org

--Feneyrol, J., Giuliani, G., Ohnenstetter, D., Rondeau, B., Fritsch, E., Fallick, A.E., Ichang'i, D., Omito, E., Rakotondrazafy, M., Ranatsenho, M., Lallier, F. (2014) New typology and origin of tsavorite based on trace-element chemistry. European Journal of Mineralogy: 26(2): 293-308.

Мадагаскар \\ 516 минералов и разновидностей, 323 достоверных видов, 12 новых видов \\ 516 entries listed. 323 valid minerals. 12 type localities (valid minerals) на 2012.10.13 .\\ http://www.mindat.org/loc-2247.html \\ лондонит!!; пеццоттаит* ; родицит!!; скиавинатоит \ schiavinatoite*

Малави \\

--Гарсон М.С. Карбонатиты Малави. Карбонатиты. М.: Мир, 1969. С. 50-86.

Мозамбик

--Минералы Мозамбика в фотографиях – 285 фото на 2017.09.05  в www.mindat.org

Руанда \\ минералы - http://www.mindat.org/loc-21896.html \\ местонахождения - http://www.mindat.org/rloc.php?loc=Rwanda \\

Сомали \\ Судан

1. Эгирин. Маунт-Малоса, Малави, Вост. Африка. 8,5х0,7 см. Образец: Минер. музей МГРИ-РГГРУ (Р-1084. А. Евсеев. 2011.10.07) . Фото: © А. Евсеев.2. Mn-содержащий кианит. Лолиондо, Танзания. Образцы: Тусон-шоу-2010. Фото: М.С. Алферова

Танзания \\ http://www.mindat.org/loc-4384.html \\ м-н-ния - http://www.mindat.org/

--Танзания-2017_поездка минералогов

--Ол-Доиньо-Ленгаи или Олдоиньо-Ленгаи (Ol Doinyo Lengai) — стратовулкан на севере Танзании. Один из самых молодых и, возможно, самый активный вулкан Восточной Африки. Имеет уникальный карбонатитовый состав лавы. На языке местного племени масаев название вулкана означает «гора Бога». Находится около озера Натрон и является частью вулканической системы Великой рифтовой долины в Восточной Африке.\\ 2°45?50? ю. ш. 35°54?50? в. д. \\ Источник: https://ru.wikipedia.org/wiki/Ол-Доиньо-Ленгаи

--Dawson, J.B. and Hll, P.G. (1998). Mineral chemistry of peralkaline combeite-lamprophyllite nephelinite from Oldoinyo Lengai, Tanzania. Min. Mag.: 62: 179-96.

--Mitchell, R.H. (2006). Mineralogy of stalactites formed by subaerial weathering of natrocarbonatite hornitos at Oldoinyo Lengai, Tanzania. Min. Mag.: 70: 437-44

--https://www.mineralatlas.eu/?l=11358

Извержение. Свежий кратер на вулкане Ол-Доиньо-Ленгаи, Сев.Танзания. Фото: Д. Тонкачеев, 2017.10.08

Уганда \\

Эфиопия

Австралия \ Австралия и Новая Зеландия

Виктория \\

Западная Австралия

Квинсленд \\ Новый Южный Уэльс

Северная территория \\

Тасмания \\

Южная Австралия

Новая Зеландия

Восточное полушарие

Ю ж н о е _ п о л у ш а р и е

З а п а д н о е _ п о л у ш а р и е

Северная Америка

Канада \\

-- Трейл Р. Дж. Каталог минералов Канады. \ Trail R. J. Catalogue of Canadian Minerals. Revised 1980. Geol. Surv. of Canada Paper 80-18, 1983, 483 p.

США \\ http://www.mineralienatlas.de/lexikon/index.php/USA

American Mineral Treasures [Сокровища минералов Америки]. 2008. - 368 p. \\ Подробнее: http://www.lithographie.org/bookshop/hc_american_mineral_treasures.htm \\ см. также http://geo.web.ru/druza/l-USA_AMT.htm

Топографическая минералогия ( литература о местонахождениях по штатам) \\ http://www.minsocam.org/

Сев. Америка (С)

Аляска \\ Нунавут \\

Северо-Западные территории \ North-West Territories, Канада

 

Юкон

Гренландия \\

--Дравит!!--xls<10 см--2фд - mindat из Qarusulik, Ameralik Fjord, ЮЗ Гренландия \\ Petersen, O. et al., 2002, Dravite from Qarusulik, Ameralik Fjord in Southwestern Greenland, extraLapis 3, p.42-46.

- Petersen, O. V. & Johnsen, O. (2005): Mineral species first described from Greenland. Canadian Mineralogist, Special publication no. 8., 184p.

Сев. Америка (В)

Сев. Америка (В)_находки крупных кристаллов (10 см и более)

Айова \\ Вермонт \\ Верхнее оз \\ Виргиния \\ Висконсин

Джорджия \\ Иллинойс \\ Индиана, США \\ http://www.mindat.org/loc-16287.html \\ более 100 фото минералов из осадочных пород (доломит, миллерит!!; целестин!; флюорит! и др.) www.mindat.org/gallery

Квебек \\

Йейтс р-к (U)\ Yates mine (U), Оттер-Лейк, округ Понтиак, Квебек, Канада \\ флогопит!!-прозр. коричневые, почти черные кр-лы до 7 см в длину (Dana,1997); ; фторапатит!! \\ ЕК

Кентукки, США.

--Агаты!! - http://www.kentuckyagaterocks.com

Коннектикут \\ Лабрадор \\

Манитоба \\ Массачусетс \\ Миннесота \\ Миссури \\

Мичиган \\

Мэн \\

Новая Шотландия, Канада \\

Нью-Брансуик пров., Канада\ New Brunswick, Canada \\ Нью-Гэмпшир, США \\

Нью-Джерси, США - http://www.mindat.org \\

Нью-Йорк \\

Онтарио\ Ontario, Канада \\

Пенсильвания, США - http://www.mindat.org/loc-14026.html \\

--Матулаит* и другин минералы \\ Bachman Mine, Hellertown, Northampton Co., Pennsylvania, США--фото www.mindat.org: афмит\ afmite!-3; какоксен!!-15; кобокобоит; матулаит*\ matulaite--16; штренгит--4; элеонорит--3 и др. \\ Kampf, A.R., Mills, S.J., Rumsey, M.S., Spratt, J. and Favreau, G. (2012) The crystal structure determination and redefinition of matulaite, Fe3+Al7(PO4)4(PO3OH)2(OH)8(H2O)8•8H2O. Mineralogical Magazine, 76(3), 517–534.

Сев. Каролина

Теннесси \\ Флорида

Сев. Америка (З)

Айдахо, США \\ Альберта, Канада

Аризона, США \\ на странице http://www.mindat.org/loc-3293.html (на 2015.09.27) -- 1242 минерала (842 вида) из них - 82 новых мин. вида \\ для сравнения на 2008 г. - 887 минералов (690 видов). из них 46 новых видов \\ в сводке Anthony J.W. et al, 1995 --809 мнр. видов, из них 76 новых видов \\ Anthony, J.W., et al (1995), Mineralogy of Arizona, 3rd.ed.:

Арканзас, США \\ Вайоминг, США

Колорадо \\ http://www.mindat.org/rloc

--Burro Mine (C-SR-13 Mesa ), Slick Rock Distr., San Miguel Co., Colorado, США--аммониоласалит-ФМ-№96107

---новые минералы:

----Kampf, A.R., Nash, B.P., Hughes, J.M., and Marty, J. (2017) Burroite, Ca2(NH4)2(V10O28)·15H2O, A New Decavanadate Mineral From the Burro Mine, San Miguel County, Colorado. Canadian Mineralogist: 55: 473-481.

----Kampf, A.R., Plasil, J., Olds, T.A., Nash, B.P., and Marty, J. (2017) Ammoniozippeite, IMA 2017-073. CNMNC Newsletter No. 40, December 2017, page 1579, Mineralogical Magazine: 81: 1577–1581.

----Kampf, A.R., Plasil, J., Nash, B.P. and Marty, J. (2017) Ammoniomathesiusite, IMA 2017-077. CNMNC Newsletter No. 40, December 2017, page 1580; Mineralogical Magazine: 81: 1577–1581.

--Колорадо, США \ карта и минералогические находки

Монтана \\ Невада \\

Нью-Мексико, США

Оклахома

Саскачеван, Канада

Техас, США \\

Южная Дакота, США \\

Юта, США \\

Сев. Америка (Кордильеры)

Британская Колумбия, Канада - http://www.mindat.org/loc-14311.html

Вашингтон, США \\ Cannon, B. (1975): Minerals of Washington: 53.

Орегон

Калифорния, США \\ http://www.mindat.org/loc-3424.html \\ фото \\ Калифорния_минералы по контуру

Гавайские о-ва \ Hawaii, Тихий океан; США \\

Мексика

Мексика - 9 минералов \\ Мексика_крупные кристаллы \\ Мексика_крупные кристаллы_5 с

Центральная Америка

Куба

Южная Америка

Ю. Америка (СЗ)

Венесуэла \\ Гайана \ Guyana (до 1966 г. - Британская Гвиана) \\

Колумбия \\

Эквадор \\

--Галапагос о-ва \ Galapagos, Тихий океан; Эквадор \\ о нек. минералах --Dziadik G., 1949 (R&M, 1949, v.20, p.7-9) \\ ЕК

Аргентина

Минералогия Аргентины - веб- публикация - http://ama.gl.fcen.uba.ar/index.php/publicaciones/

 

Боливия \\

Перу \\

--Минералы Перу --в фотографиях www. mindat.org - 4820 фото на 2018.02.25 (все минералы) \\ Из них (примеры): аурипигмент - 169; гюбнерит - 255; кварц - 191; пирит - 520

Сайт о минералах Перу на Facebook: https://www.facebook.com/MineralesPeruanos

Список минералов (A-Z)+ фото - http://www.mindat.org/locdetailed-5869.html

Чили

Цезийфармакосидерит \ Caesiumpharmacosiderite - новый минерал из Wendy open pit (Wendy pit), Tambo MineEl Indio depositElqui ProvinceCoquimbo RegionChile  \\ Mills, S.J., Petrini, E., Bellatreccia, F., Schlu?ter, J., Kampf, A.R., Rumsey, M.S., Dini, M. and Spratt, J . (2013) Caesiumpharmacosiderite, IMA 2013-096. CNMNC Newsletter No. 18, December 2013, page 3257; Mineralogical Magazine, 77, 3249-3258
https://www.mindat.org/min-46008.html

--Уникальная комбинация элементов. Первый цезийсодержащий арсенатный минерал " First Cs-bearing arsenate mineral. Sixth natural crystalline oxysalt (discluding silicates) with species-defining Cs, the other species of this group being cesiodymite (sulphate), londoniteramanite-(Cs) (borates), margaritasite (vanadate), and mccrillisite (phosphate)" - Источник:.https://www.mindat.org/min-46008.html

Wendy open pit (Wendy pit), Tambo Mine, El Indio dep., Elqui Prov.,Coquimbo Reg., Чили - первоначальное местонахождение(type locality) цезийфармакосидерита и ещё 4 новых минералов (metatamboite*; tamboite*, walfordite*; telluromandarinoite*). Составил: А. Евсеев, 2018.04.

Back, M.E., Grice, J.D., Gault, R.A., Criddle, A.J. & Mandarino, J.A. (1999): Walfordite, a new tellurite from the Wendy open pit, El Indio - Tambo mining property, Chile. Canadian Mineralogist: 37: 1261-1268

Back, M.E., Grice, J.D., Gault, R.A., Cooper, M.A., Walford, P.C. & Mandarino, J.M. (2017): Telluromandarinoite, a new tellurite mineral from the El Indio-Tambo mining property, Andes Mountains, Chile. Canadian Mineralogist: 55: 21-28.

 

Бразилия \\ минералы -787 ; достоверные виды - 601 \ 620; новые виды - 51 \ 53; местонахождения \ localities - 843 \ 1008 ; фото минер. – 5430 \ 6613; фото мест – 74 \ 115 (на 2009.08.05 \ 2010.05.06) \\ Источник: http://www.mindat.org/loc-366.html \\ http://www.mindat.org/rloc.php?loc=Brazi

Баия, Бразилия

--Cassedanne, J.P. & Cassedanne, J.O. (1978): Famous mineral localities: The Brumado district, Bahia , Brazil. Mineralogical Record 9 : 196-205

Мату-Гросу шт.

Минас-Жерайс шт. \\ минералов - 713, из них твердых видов - 491, из них новых видов - 46 (на 2015.09. 30) \\ источник: http://www.mindat.org

Параиба \\ Риу-Гранди-ду-Норти, Бразилия \\ Риу-Гранди-ду-Сул, Бразилия \\ Сан-Паулу

Уругвай

АНТАРКТИДА \\

Вокруг Антарктиды (прилегающие территории)_минералогические находки

Океаны

Тихий океан \\

Новая Гвинея о., Океания, Тихий океан; Индонезия \ Папуа - Новая Гвинея \\ второй по величине остров Земли (после Гренландии)

Новая Каледония -- геология и пол. ископаемые

Гавайские о-ва \ Hawaii, Тихий океан; США \\

Таити о., Франц. Полинезия

Фиджи, Тихий океан

Южное полушарие

Весь мир

Фото дня или "За месяц вокруг света" - 2014.11-12 - 2015. 01 - 2015. 02 - 2015. 03 - 2015. 04 - 2015. 05 - 2015.06 - 2015.07 - 2015.08 - 2015.09- 2015.10 - 2015.11 - - 2015.12 - 2016.01 - 2016.02 - 2016.03 - 2016.04 - 2016.05 - 2016.06 - 2016.07 - 2016.08 - 2016.09 - 2016.10 - 2016.11 - 2016.12

Всемирная минералогия-32 - по одному минералу от региона

А.А. Евсеев. Минералогические находки вокруг света вдоль 40-ой параллели. - Минералогический альманах, т.13, 2008, с. 76-85.
\\ Краткий вариант статьи \\ Полный текст статьи \\ Фотогалерея \\

--Кристаллы пяти континентов_экспозиция в Минералогическом музее им. А.Е. Ферсмана РАН \\ текст

--Минералы- спутники на расстоянии (минералы-телеспутники)

--Журнал "Вокруг света" - http://www.vokrugsveta.ru/

--Институт географии РАН _Информационный портал

--находки минералов по всему миру - https://www.mineralienatlas.de  

Путешествия за камнем

--Ферсман А.Е. "Путешествия за камнем" \\ читать

--В.А. Обручев. Мои путешествия по Сибири \\ читать

МИНЕРАЛЫ \

5 замечательных находок \ Европа - Азия - Африка - Австралия - Сев. Америка - Южн. Америка (выборка: по одному образцу из северной, южной, западной, восточной и центральной части каждого регион). Случайная выборка

Вторые находки минерала в мире, ставшие лучшими

"Сборные" минералов по странам и регионам (10-15 избранных находок) \\ 1-е -в 2007 г.

По 2 минерала от континента за 2 минуты (экспресс-опрос)

Ареалы находок минералов (основные находки ряда минералов, вынесенные на карту мира)

Кристаллы пяти континентов_выставка в Минералогическом музее им. А.Е. Ферсмана РАН

--Евсеев А.А. Географическая привязка первоначальных местонахождений минералов. \\ Новые данные о минералах. М.: ЭКОСТ, 2003. Вып. 38, с. 113-124.

--А.А. Евсеев. Минералогические находки вокруг света вдоль 40-ой параллели с. ш.

Океаны

Острова (от Гренландии до Мадагаскара) \ минералогические находки

Луна \\ минералогия - http://luna-mineralogiya.ru/index.html

АВТОРЫ \ \ А – Л | М - Я | A - Z Анастасенко| | Г.П. Барсанов || И.В. Бельков || В.И. Вернадский || А.В. Волошин || В.И. Воробьев | Гиймен К. \ Guillemin C.| | А.А. Годовиков || Б.З. Кантор | К.И. Клопотов || Ю.С. Кобяшев || П.А. Кочубей | Крыжановский В.И. || А.Н. Лабунцов | М.Н. Малеев || В.А. Мальцев || Л.А.Паутов || И.В. Пеков || В.А. Пелепенко || В.В. Пономаренко | | В.А. Слётов | Э.М. Спиридонов | | В.И. Степанов | А.Е. Ферсман | А.П. Хомяков || Б.В. Чесноков || Н.В. Чуканов || Н.П. Юшкин и другие

Из публикаций: А - Б - В - Г - Д - ЕЁ - Ж - З - И - К - Л - М - Н - О - П - Р - С - Т - У - Ф - Х - Ц - Ч - ШЩ - ЭЮ - Я - AZ \\ A - B - C - D - E - F - G - H - I - J - K - L - M - N - O - P - Q - R - S - T - U - V - W - X - Y - Z

Бетехтин А.Г. Минералогия. — М.: Государственное издательство геологической литературы, 1950. — 956 c. \\ веб-публикация \\

Смирнов В.И. Геология полезных ископаемых — M.: «Недра», 1982. — 669 c. \\ веб-публикация

Ферсман А.Е. Путешествия за камнем (веб-публикация) \\ http://lib.rus.ec/b/284737/read#r10 ; также http://prozaik.in/aleksandr-fersman-puteshestviya-za-kamnem.html?page=1

МИР КАМНЯ В ЛИЦАХ

Исследователи самоцветов Сибири - http://lavrovit.ru/?page_id=271

Фотографы минералов

lБиографии минералогов и коллекционеров -см. The Mineralogical Record Biographical Archive - http://www.minrec.org/labelarchive.asp

Гагарин Григорий Григорьевич, художник и коллекционер // МИНИНА Е.Л., СТАРОДУБЦЕВА И.А. Коллекция князей Гагариных в собрании Государственного геологического музея им. В.И. Вернадского. // Мир камня, 1995, № 7/8, С. 25-27 (World of Stones, 1995, № 7, С. 20-23).

Гагарин Григорий Григорьевич (младший), сын Г.Г. Гагарина // МИНИНА Е.Л., СТАРОДУБЦЕВА И.А. Коллекция князей Гагариных в собрании Государственного геологического музея им. В.И. Вернадского. // Мир камня, 1995, № 7/8, С. 25-27 (World of Stones, 1995, № 7, С. 20-23).

Гагарин Георгий Григорьевич, сын Г.Г. Гагарина (младшего), коллекционер // МИНИНА Е.Л., СТАРОДУБЦЕВА И.А. Коллекция князей Гагариных в собрании Государственного геологического музея им. В.И. Вернадского. // Мир камня, 1995, № 7/8, С. 25-27 (World of Stones, 1995, № 7, С. 20-23).

Гагарин Григорий Георгиевич, сын Г.Г. Гагарина, геолог и минералог // МИНИНА Е.Л., СТАРОДУБЦЕВА И.А. Коллекция князей Гагариных в собрании Государственного геологического музея им. В.И. Вернадского. // Мир камня, 1995, № 7/8, С. 25-27 (World of Stones, 1995, № 7, С. 20-23).

Илюхин, Владимир Валентинович (1934-1982), выдающийся советский кристаллограф, доктор физико-математических наук – сотрудник Института кристаллографии АН СССР, "автор более 450 научных публикаций, среди которых фундаментальные работы по методологии расшифровки кристаллических структур, кристаллохимии гидросиликатов кальция и минералов с гетерополиэдрическими каркасами. Талантливый ученый обладал неиссякаемой энергией, с его именем связано становление в СССР спелеологии и развитие спелеотуризма. Яркая жизнь Илюхина трагически оборвалась в возрасте 48 лет во время спасательной миссии в Абхазии. С тех пор система пещер на Гагрском хребте носит имя В.В. Илюхина..." . \\ Источник: http://www.mk.ru/science/2015/11/27

В честь В.В. Илюхина назван новый минерал илюхинит, открытый на горе Кукисвумчорр, Хибины, Кольский п-ов (Чуканов Н.В. и др., 2016).

Илюхинит* - новый минерал из Хибин (г. Кукисвумчорр). Образец: Минер. музей им.А.Е. Ферсмана РАН . Фото: А. Евсеев.

Кампф, Энтони \ Kampf, A.R., крупный американский минералог, автор открытия многих новых минералов, почетный куратор Музея естественной истории (Лос Анджелес) \ Curator Emeritus, Natural History Museum of Los Angeles County \\ https://www.researchgate.net/profile/Anthony_Kampf

Энтони Кампф (в центре) и его жена (справа). Музей Колорадской горной школы. Голден, Колорадо, США. 2013.09. 11. Фото: © А. Евсеев.

--Kampf, A.R., Housley, R.M., Marty, J. (2017): Dagenaisite, A New Zinc Tellurate From the Gold Chain Mine, Tintic, Utah, U.S.A. Canadian Mineralogist, 55, 867-873.

--Kampf, A.R., Mills, S.J., Nash, B.P. (2016): Pauladamsite, Cu4(SeO3)(SO4)(OH)4·2H2O, a new mineral from the Santa Rosa mine, Darwin district, California, USA. Mineralogical Magazine, 80: 949-958.

Неверов Олег Яковлевич (1934-2014), историк, искусствовед, античник, сотрудник Эрмитажа. О нём - https://igorkurl.livejournal.com \\ http://bioslovhist.spbu.ru/person

Олег Яковлевич Неверов

Слева направо - Майк Рамзи, куратор Лондонского музея естественной истории; Марк Фейнглос и Брент Торн, коллекционер из Юты. В их честь названы рамзиит, фейнглосит и торнеит.Тусон-шоу-2018. Фото: © Almaz. Источник: http://webmineral.ru

Биографии ученых Геовики

Сотрудники кафедры минералогии МГУ - www.geol.msu.ru

АПРЕЛЬ \ в тот день

 

В ТОТ ГОД...

 

Медь. Самородок "Медвежья шкура" весом 860 кг (по другим данным - 842 кг). Степановский р-к Попова, быв. Каркаралинский уезд, Казахстан. Владельцами рудника принесен в дар Александру II, который в 1858 г. распорядился направить его в Горный музей (Санкт-Петербург). \\ Купффер, 1911, 13 \\ Экспонируется в "Малахитовом" зале музея. Фото: А.Евсеев. Подробнее: http://www.gorny-ins.ru/cgi-bin/index.cgi?lang=1 \\ http://www.gorny-ins.ru/cgi-bin/index.cgi?id=76&lang=1

1. Юра Иванов, студент МГУ, будущий кристаллограф. На геологической практике. Крым, 1967. Фото: В. Лисицын. 2. Инна Лыкова. Р-к " Плакалница ", р-н г. Враца, Болгария. 2011.10. Фото: А. Евсеев.

2017 - Танзания-2017_поездка минералогов

Селфи с фламинго К. Власов. Ол-Доиньо-Ленгаи вулк. и оз. Натрон, Сев.Танзания. Фото: Д. Тонкачеев, 2017.10

2018 г.

--апрель 2018 г.

Главная страница нового сайта http://lovozerie-mineral.ru/, посвященного удивительному феномену природы – Ловозерскому щелочному массиву. Автор сайта - Виктор Григорьевич Гришин, минералог-любитель и коллекционер. \\ 2018. 04. 07

В. Гришин. Ловозеро, Кольский п-ов, Россия. 2012. 08. Фото: И. Лыкова

Виктор Григорьевич Гришин - минералог-любитель, коллекционер, знаток минералогии Ловозерского массива и других местонахождений Кольского п-ова, на которых неоднократно бывал. Живет в пос. Ревда (Мурманская обл., Россия). В его честь назван новый минерал вигришинит. \\ Из минералогической коллекции В.Г. Гришина

МИНЕРАЛОГИЧЕСКИЙ УНИВЕРСИТЕТ

КЛУБ ДРУЗЕЙ МИНЕРАЛОГИИ

Встречи в клубе друзей минералогии (Москва) и не только

2018.04. 06. Сергей Сколотнев. Два морских геологических похода на Северный полюс и два на поднятие Менделеева . Встреча состоялась в Геолог. музее им.В.В. Ершова (Горный ин-т), Москва.

1. Высокоширотная арктическая глубоководная экспедиция 2007 г. Руководитель экспедиции А.Н. Чилингаров. 2. С.Г. Сколотнев выступает в . Геолог. музее им.В.В. Ершова (Горный ин-т), Москва. 2018.04.06. Фото: А. Евсеев.

С.Г. Сколотнев (справа), Т.В. Дубровская (в центре) и др. Геолог. музей им.В.В. Ершова (Горный ин-т), Москва. 2018.04.06. Фото: А. Евсеев.

А.Н. Анискин, С.Г. Сколотнев, Н.М. Куницына у входа в Геолог. музей им.В.В. Ершова (Горный ин-т), Москва. 2018.04.06. Фото: А. Евсеев.

 

В зеркале камня

И. Анненский \\\ И. Бродский \\ И.А. Бунин \\ Ю.И. Визбор \\ М.А. Врубель \\ В.С. Высоцкий \\ П.А. Вяземский \\ И.-В. Гёте \\ И.А. Гончаров \\ В. Маяковский \\ А.C. Пушкин \\ И. Северянин \\ Л. Толстой \\ А.П. Чехов \\ Агат \\ Алмаз \\ Апатит \\ Бирюза \\ Жемчуг \\ Опал \\ Топаз \\

Леонид УТЁСОВ - Заветный камень \\ Музыка Борис Мокроусов, стихи Александр Жаров.

 

Александр Городницкий

Скажи, Улисс, о чем поют сирены?
Чем песня их пьянящая манит,
Когда штормит и струи белой пены
Секут волну, как кварц сечет гранит?

Улисс \\ http://www.bards.ru/archives/part.php?id=4538

Мне геолог рассказал
За столом, по пьяни,
Что назвали перевал
Мною на Саяне.
Там закат пылает, ал,
Меж лесного гуда.
Только я там не бывал
И уже не буду.
Мне поведал альпинист
Всё о перевале:
Как там воздух горный чист,
Как сияют дали.
Там блестят на гранях скал
Золотые руды.
Только я там не бывал
И уже не буду.
Перевал сейчас пурга
Заметает снегом.
Там олень несёт рога,
Задевая небо.
Мной назвали перевал,
Каменную груду.
Только я там не бывал
И уже не буду.
Там в заснеженном краю,
У подножья ели,
Парни песенку мою
На привале пели.
Мной назвали перевал,
Видный отовсюду.
Только я там не бывал
И уже не буду.
Потому что век иной
Нынче на пороге.
Перевал мой за спиной, –
Нет туда дороги.

15.04.2006 \\ https://45parallel.net/

Игорь Северянин
И разве муж был виноват,
Что сделалась его женою
Лилиесердная Лилит?
Летит любви аэролит.
Поберегись-ка ты, прохожий:
Ты выглядишь, как краснокожий,
Когда аэролит летит…

ххх

Ах, больше Крыма и Кавказа
Очаровал меня Урал!
Для большей яркости рассказа
На нем я сделаю привал.
В двух-трех словах, конечно, трудно
Воспеть красоты этих гор.
Их тоны сине-изумрудны:
На склонах мачтовидный бор.

ххх

Вдоль малахитовой Ангары,
Под выступами скользких скал,
Неслись, тая в душе разгары;
А вот — и озеро Байкал.

Роса оранжевого часа, 1923

 Александр Суханов

В глубинах метрополитена
Блеск и холодное тепло,
Дыханье мраморного плена,
Гранит закованный в стекло.

В глубинах метрополитена ... \\ http://bards.ru

В якутском аэропорту из Ан-12, следовавшего рейсом в Красноярск, частично прямо на взлётно-посадочную полосу, частично за её пределами вывалилось несколько тонн золотых слитков.

Якутия – страна чудес.
Там полюс холода, алмазы,
Там слитки падают с небес –
По двадцать килограмм, заразы!..
А тут, в столице, лишь
Одни сосульки с крыш…

Аристарх Зоилов-II \ Источник: http://lgz.ru/article/-12-6636-21-03-2018/fotoship-12-2018/

 

КИНО_В зеркале камня

СТРАНЫ от А до Я

находки минералов по листам карты мира: 1234567 891011121314151617181920212223242526272829303132 - 33

Минераландия

НЕ ТОЛЬКО МИНЕРАЛЫ: А - Б - В - Г - Д - Е - Ж - З - И - К - Л - М - Н - О - П - Р - С - Т - У - Ф - Х - Ц - Ч - ШЩ - Э - Ю - Я

местонахождения минералов - | - mineral localities : А Б В ГДЕ Ж З И Й К Л М Н О ПР С Т У Ф Х Ц ЧШ Щ Э Ю Я || A B C D E F G H I J K L M N O P R S T U V W X Y Z
Сев. Америка (С)

Гренландия

Атлантика - Скандинавия - Кольский п-в

Урал
Ср. Сибирь
Якутия
СВ России

Сев. Америка (З - Сев. Америка (Кордильеры)

Сев. Америка (В)

Британ. о-ва, Пиренейский п-в - Зап. Европа - Вост. Европа

Казахстан, Ср. Азия

Юг Сибири
Забайкалье, Вост . Сибирь
Камчатка - Дальний Восток (Россия, Япония
Мексика
Кавказ, ЮЗ Азия
Афганистан, Пакистан
Индия
Монголия. Китай
ЮВ Азия - Тихий океан
Ю. Америка (СЗ) - Кордильеры
Бразилия

Африка - Сев. и Зап.Экв. и ЮжнВост.

Антарктида
Австралия

Тихий океан - Весь мир

янв
фев
март
апр
май
июнь
июль
авг
сен
окт
нояб
дек
2004
2005
2006
2007
2008
2009
2010
2011
2012
2013
№104 №112
2014 №114
2015
№126 №131
2016
№146
2017
2018
№163                

Заметки - А - Б - В - Г - Д - Е - Ж - З - И - Й - К - Л - М- Н -О - П - Р - С - Т - У -Ф - Х - Ц - Ч - Ш Щ - Э - Ю - Я.

обновление: 2018. 04. 21

© Александр Евсеев, 2003 - 2018. © Фото: принадлежит авторам, 2018