старт
где? - АЯ - где?-1 - что?- АЯ-
кто?
когда?
литература---W
Новый мир камня
ФМ = МФ- В зеркале камня
клуб

геовики - Р-коллекция

фототека
новое фото
новое на сайте- 2016
музеи | сокращения
обновление: 2016. 07. 31

местонахождения А Б В ГДЕ Ж З И Й К Л М Н О ПР С Т У Ф Х Ц ЧШ Щ Э Ю Я || A B C D E F G H I J K L M N O P R S T U V W X Y Z \\ регионы мира: 1234567 891011121314151617181920212223242526272829303132 - 33 || Россия \ Европа \ Азия \ Африка \ Австралия \ Северная Америка \ Южная Америка \

ВСЕ КАМНИ МИРА144 - В ДВЕ СТРОКИ

или НОВЫЙ МИР КАМНЯ \ ИЮЛЬ, 2016

1. Пурпурит и темно-желтые фосфаты Mn. [Buranga] "Burundi", Руанда. Фрагмент~5х2,5 см. (Коллекция В.И. Степанова, ST 7403. Дар: Титов И.Н., 1987. Из коллекции В.А. Ярмолюка). 2 . Лазулит. Вкрапления в гнейсовидном кварците с метаварисцитом?, аугелитом?, андалузит. Фрагмент ~6х3 см. Судан. (Коллекция В.И. Степанова ST 7436. Груздев В.С., 1974). 3. Анапаит. Друза сферокристаллов. 2-ой Черноморский р-к, Керчь (р-н), Крым, Россия. ~7х4 см (╧90786. Сбор музея: Абрамов Д.В., 1986). Образец 1-3: Минер. музей им.А.Е. Ферсмана РАН . Фото и монтаж: ╘ А.А. Евсеев.

янв
фев
март
апр
май
июнь
июль
авг
сен
окт
нояб
дек
2004
2005
2006
2007
2008
2009
2010
2011
2012
2013
╧104 ╧112
2014 ╧114
2015
╧126 ╧131
2016
           

Из фотографий "Нового мира камня" ╧144 (смотрите на этой странице)

МИНЕРАЛЫ и не только на druza: А - Б - В - Г - Д - Е - Ж - З - И - К - Л - М - Н - О - П - Р - С - Т - У - Ф - Х - Ц - Ч - ШЩ - Э - Ю - Я \\ Алфавитный список минералов (на geo.web.ru/druza)

см.на www.mindat.org \ A-B-C-D-E-F-G-H-I-J-K-L-M-N-O-P-Q-R-S-T-U-V-W-X-Y-Z

Минералы от A до Z - список IMA (Международной минералогической ассоциации)- http://pubsites.uws.edu.au/ima-cnmnc/

Комиссия по новым минералам, номенклатуре и классификации - http://pubsites.uws.edu.au/ima-cnmnc/ \\ The Commission on New Minerals, Nomenclature and Classification (CNMNC) of the International Mineralogical Association (IMA) was formed in July 2006 by a merger between the Commission on New Minerals and Mineral Names (CNMMN) and the Commission on Classification of Minerals, at the request of both commissions

Алфавитный список_ минералы: от А до Я (на русском языке) - более 4000 минералов ( 4976 страниц категории "Минералы") на http://wiki.web.ru/wiki/ \\ http://webmineral.com/Alphabetical_Listing.shtml

Все минералы мира (от A до Z) \ All Minerals of the World / Tous les mineraux de la terre http://euromin.w3sites.net/mineraux/accueil.html

Алфавитный список_ минералы от A до Z (на английском языке) и фото минералов - http://www.mineralatlas.com/ \\ фото минералов - http://www.cs.cmu.edu/~adg/adg-home.html (на сайте Alan Guisewite ) Список минералов - http://en.wikipedia.org/wiki/List_of_minerals

А -

Авантюрин \\

Авгит

Агат

Адамин \\ Адуляр \\

Азурит \\

Аквамарин \\

Александрит

Александрит в слюдите. Малышевское м-ние, Изумрудные копи, Ср. Урал, Россия. ~5х7 см. Образец: Минер. музей им. А.Е. Ферсмана РАН ( ╧80258. Хохлов О.И. и др., запись 1980 г.). 1. При дневном освещении. 2. При вечернем освещении (лампах накаливания). Фото: А. Евсеев (1), М.А. Богомолов (2).

--Александрит из Зимбабве (Novello Mine, Masvingo(Fort Victoria) \ замечательное фото (александритовый эффект!) - www.mindat.org/photo

Алмаз \\

Алтаит* ════ PbTe

Альбит \\ Альмандин

Амазонит \\ Вохменцев А. Я., Остроумов М. Н., Попов В. А. и др. Амазонит. М.: Недра. 1989. √ 192 с.

Аметист

Анапаит

Анапаит на буром железняке. Мыс Железный Рог, Таманский п-ов (ЮЗ), юг России. Фото: В. В. Аристов и клуб юных геологов (Москва).

Анатаз \\ Андалузит \\ Андрадит

Апатит-(CaF) \ Apatite-(CaF) - наиболее обычный (распространенный) минерал в группе апатита.

Апатит. Круглые конкреции скрытокристаллического франколита (диаметром до 3,5 см) в фосфоритизированном лигните по древесине. Вятско-Камское м-ние, Кировская обл., Россия. Образец: Минер. музей им.А.Е. Ферсмана РАН. ST 7488. Из первой коллекции В.И. Степанова (╧467). Сбор: Степанов В.И., 1950. Фото: ╘ А. Евсеев

Апофиллит \\ Арагонит \\ Арсенопирит

Б -

Бабингтонит

Базы данных: http://www.mindat.org/ (на 2011.09.25) \\ http://webmineral.com

Барит \\ Берилл \\
Бериллий_минералы \\ Библиография (популярные издания о камнях)- http://basik.ru/forum/index.php?showtopic=77

Библиотеки --РОССИЙСКАЯ ГОСУДАРСТВЕННАЯ БИБЛИОТЕКА--http://search.rsl.ru/ru

Бирюза \ Бор_минералогия и геохимия \ Борнит

В -

Вад - смесь порошковатых, рыхлых оксидов и гадроксидов марганца (КМС)

Вазы из поделочного камня \\ Ванадинит \\

Веб-сайт

-- http://petrographica.ru

Везувиан \\

Вивианит

Вивианит. Мыс Железный Рог, Таманский п-ов (ЮЗ), юг России. Фото: В. В. Аристов и клуб юных геологов (Москва).

Викимапия \ Wikimapia (карты мира и России)

Виллиомит \\

Включения в минералах и драг. камнях \

Кварц в кварце: кристалл цитрина, проросший кристаллом горного хрусталя. Ольховское м-ние, Северный Урал, Россия. 12х10 см. Образец: В.А. Пелепенко. Фото: ╘ А.А. Евсеев.

Волконскоит* \\ Вольфрамит.

Вторая находка минерала в мире

ВУЛКАНЫ \ минералогические находки

Вульфенит \\

Выставки минералов и поделочных камней

--ЗАНИМАТЕЛЬНАЯ МИНЕРАЛОГИЯ■ В КАМНЕ ...Подробнее (pdf)

Г -

Галенит \\

Галит \\

Гельвин

Гематит \\

Генезис минералов

--Попов В.А. Практическая генетическая минералогия. - Екатеринбург: УрО РАН, 2011.- 167 с.

Геовикипедия \ GeoWiki Всё о геологии - http://wiki.web.ru/

Гётит \\

Гигантские и крупные кристаллы (индивиды) \\ См.: А.Е. Ферсман. Величина природных кристаллов // Природа, 1925, ╧ 10/12, стлб. 103; его же. Кристаллы-гиганты и монолиты-гиганты // Природа, 1926, ╧ 3/4, стлб. 86≈88; его же. Пегматиты. Т. I. Гранитные пегматиты. M.≈Д., 1940.

1. Касситерит (кристалл ~15х12х8 см). Кара-Су, Туркестанский хр. (С), Киргизия. (╧50580, Гинзбург А.И., 1950). 2. Кварц скрученный. Пуйва г., Припол. Урал, Россия. 16х19 см. (╧ 40913, Леммлейн Г.Г., 1939). Образец 1-2: Мин. музей им. А.Е. Ферсмана РАН. Фото 1-2: ╘ А.А. Евсеев.

Кварц (более 1 м, вес ~500 кг). Неройка г., Прип. Урал, Россия. Образец: ФМ (╧44181, А.Н. Алёшков, запись1945 г.). Фото: ╘ А.А. Евсеев, 2016.

Гипс \\

Горная энциклопедия - http://www.mining-enc.ru/ \\ http://dic.academic.ru/contents.nsf/enc_geolog/

Горный хрусталь \\

Гроссуляр

Д -

Данбурит \\ Датолит \\

Двойники \\ http://folk.ntnu.no/krill/mineralogee/8.htm \\

Декоративный камень

Демантоид \\

--Мексика \\ Cerro De La Concordia, Piedra Parada, Mun. de Tatatila, Veracruz, Mexico--кристаллы (до 6 мм) на породе -- фото - www.mindat.org

Дендриты

Детский мир камня \\

--Геологическая школа МГУ -- О полевых практиках и экспедициях

--Школьный факультет РГГРУ - МГРИ

--Клуб юных геологов им. академика В.А. Обручева (Санкт-Петербург) - http://www.anichkov.ru/departments/lyceum/geology

--Ферсман А. Е. Путешествия за камнем. М. 1960 (веб-публикация) :

--Ферсман А.Е. Занимательная минералогия (веб-публикация) \\ читать

Диоптаз

1. Диоптаз. Алтын-Тюбе, Казахстан. Кристаллы до 1 см, образец 30х22 см. Минералогический музей РГГРУ. Фото: ╘ А.А. Евсеев2. Диоптаз. Tantara Mine, Shinkolobwe, Katanga Copper Crescent, Katanga (Shaba), Democratic Republic of Congo (Zaire) \ Катанга, ДР Конго Size 5 х 5 х 3 см. Фото: ╘ О. Лопаткин \\ Подробнее: http://www.pegmatite.ru

Доломит \\

Дравит \\

Драгоценные камни (д.к.)≈литература о них (по минералам): http://www.geol.msu.ru/departments/mineral/Rus/Edu/deposit_liter_r.htm \\ списки месторождений по минералам (сост. И.А. Бакшеев) - http://www.geol.msu.ru/departments/mineral/Rus/Edu/deposits_r.htm

--Горная энциклопедия - о д.к.

--Пыляев М. И. ╚Драгоценные камни, их свойства, местонахождения и употребление╩ \\ http://www.vadim-blin.narod.ru/book/titl.htm \\ указатель (быстрый поиск по ключевым словам) - http://www.vadim-blin.narod.ru/book/glossary.html

Драгоценные камни (самоцветы)_география находок

--Генетическая минералогия драгоценных камней (лекции Э.М. Спиридонова) - http://spiridonov.mineralog.com/

--Самые дорогие драгоценные камни \ top 10 most expensive Gemstones in the world - https://www.youtube.com/watch?v=UV-jYew4Ous

Дымчатый кварц

Е -

Еремеевит

Ж -

Живопись в камне

Журналы для минералогов и коллекционеров \\ The Mineralogical Record, \\ Rocks & Minerals \\ Le Regne Mineral \\ Mineraux et Fossiles \\ Lapis \\ Mineralien Welt \\ Rivista Mineralogica Italiana \\ Revista de Minerales \\ MineralUp\\ Bocamina \\ UK Journal of Mines and Minerals

Лейбов М.Б. (Минералогический Альманах). Обзор популярных минералогических журналов мира - смотреть видео

З -

Закономерные срастания

Заратит--см. фото выше

Золото

И -

Изумруд \\ Ильваит \\

Ильменит \\

Индивиды и агрегаты \\ Годовиков А.А., Степанов В.И. Формы нахождения минералов. М. 2003. \\ Макагонов Е.П.Симметрия сростков минеральных индивидов. Наука 1991

Интернет - минералогия

1. Джолион Ральф. Портал mindat.org и будущее печатных минералогических изданий. Смотреть 2. Кирилл Власов. Минералогический сегмент Рунета: состояние и перспективы развития. 2015.12.15. Минер. музей им. А.Е.Ферсмана РАН \\ смотреть -www.youtube.com

 

Искусственные кристаллы \ минералы

Исландский шпат

История минералогии ( находки, открытия и др.)

К -

Календари с минералами

Кальцит

Камень в городе \\

Ковдорский вермикулит как почва для цветов. Выставка "Рациональное использование природных ресурсов Кольского полуострова". КНЦ РАН, Апатиты. 2012.09. 06. Фото: ╘ А.А. Евсеев.

Камень\ минерал в доме

Камералка минералога \\

Карбонаты

Карта мира - http://maps-of-world.ru/inter.htm \\ http://geography_atlas.academic.ru/

Картирование, минералогическое

Карты \\ http://www.marshruty.ru/ \\ http://wikimapia.org/country/ \\ http://www.openstreetmap.org/ \\ http://ru.wikipedia.org/wiki/OpenStreetMap-- Карты мира, стран и городов - http://planetolog.ru/ \\ http://mapper.infomine.com/ \\ http://www.veslo.ru/maps.html \\ http://www.maphill.com

--http://wikimapia.org/

--карта мира и минералы (фото) - http://fotki.yandex.ru/users/ilm/map/view/recent

--реки (бассейны) -- http://www.riversnetwork.org/rbo/

Касситерит \\

--Разновидность касситерита - "Деревянистое олово"

Каталоги минералогических коллекций

Кварц \\ публикации - http://www.quartzpage.de/info_lit.html -- Экспресс-опрос -2011 (кварц) (на ответ давалось 2-3 мин. )

--Кварц по странам мира - http://www.mindat.org/mesg-95-139699.html

--японские двойники до 20 см, скипетровидные кристаллы, в том числе обратные скипетры и др. - \\ Several thousand specimens of japanese law twin quartz, up to 25 cm large, were uncovered by the company Tropic Stone SARL, from june 2000 to february 2001 in a breccia complex, north of the village of Andilamena, north of Ambatondrazaka. The mineralization is linked to a hydrothermal acitivity associated with tectonics in a metamorfic conext (Forner et al 2001). \\ Источник: /www.mindat.org/

-Andilamena, Andilamena District, Alaotra-Mangoro Region, Toamasina Province, Madagascar

--Кварц псевдокубический --фото - www.mindat.org \\ Artesia, Eddy Co., New Mexico, USA--ф-мд \\ Tarr, W.A. y Lonsdale, J.T. (1929). Pseudo-cubic quartz crystals from Artesia, New Mexico. American Mineralogist, 14, 50-53.

--Кварц--скипетровидный и обратные скипетры \\ Liliana Mine, Mun. de Chihuahua, Chihuahua, Mexico

Кварц с включениями

Клинохлор \\

Книги для минералогов и коллекционеров

--http://www.crystalclassicsminerals.com/books.php

Книжная полка минералога и коллекционера

Коллекционирование минералов

Степанов В.И. Шкала качества образцов (разработана им в 1970-ые гг.)

-- http://www.strahlen.org/

Колумбит \\

Конкреции \\ Остров Чампа, Земля Франца-Иосифа и другие места - http://nnm.me/blogs/thread1/myachi-bogov/

--Сребродольский Б.И. Конкреционные образования в серных месторождениях. - Конкреции и конкреционный анализ. -Л., 1970, 118-121.

Кораллы \\

Кордиерит \\

Корунд \\ сайт, посвященный корунду - http://www.corunduminium.com/index1.html.

Кремень \\

Кристаллы и сростки

Кристобалит \\ Куприт

Л -

Лабрадор \\

Лабунцовит

Лазулит \\

Лазурит \\

Лампрофиллит \\ Ловозеро, Кольский п-ов, Россия--индивиды до 20 см (Pekov, 1998) \\ Сент-Илер массив, Квебек, Канада - всего 2 фото для знаменитого местонахождения (и для всей Канады)--кр-лы до 2 мм-- в www.mindat.org

Лампрофиллит. Минералогические находки (по═www.mindat.org)

Лепидолит \\

Лёд \\ http://www.mindat.org/min-2001.html \\ фотогалерея

Лироконит

Лироконит. Корочки мелких кристаллов на агрегате фармакосидерита. Более 7х4 см. Образец: Минер. музей им.А.Е. Ферсмана РАН. Коллекция В.И. Степанова (ST 7135. Обмен, 1954). Фото: ╘ А.А. Евсеев.\\ НМК-144

Литература о минералах и драгоценных камнях \\ Из публикаций о минералах зарубежных стран \\ Из публикаций о минералах России, а также СССР

Наша библиотека - Геологический музей им. В.В.Ершова - http://ershov-geomuz.narod.ru/libr.htm

Литература по геологии в бибиотеке ДВГИ ДВО РАН. \\ http://wiki.fegi.ru/index.php/

Ломонтит \\

Лопарит

 

Лоренценит

Любители камня

Люминесцирующие (флюоресцирующие минералы) - тема выставки выставки Минер. музея им.А.Е. Ферсмана РАН

М -

Магнетит \\

Малахит.

Малахит. Катанга, ДР Конго. 20 мм. Фото: Н. Колтовой

Марки \\ минералы на марках - Minerals on Stamps

Медь и минералы меди

Месторождения

Метахьюэттит

Метеориты \\

--"Палласово железо" - видео - https://www.youtube.com/

Микроклин

Миндат.орг\ www.mindat.org - - крупнейшая база данных о минералах и местонахождениях. Её основатель - Джолиан Ральф \ Jolian Ralf . Минералогический альманах \ Mineralogical Almanac (Россия \ Russia) \ http://www.minbook.com/mineralogical_almanac_ru.html Минералогия_для студентов (фото минералов и рисунки кристаллов)- http://geoserv.krc.karelia.ru/geo/rus/ht

Минералогический альманах -

--Новые выпуски

--В мире минералов. Минералогический Альманах, том 21, выпуск 1, 2016. Подробнее..

Минералогические словари

-- Кривовичев В.Г. Минералогический словарь - http://bibl.gorobr.ru/book/248/book.html (веб-публикация)

Минералогия

--Бетехтин А.Г. 'Курс минералогии' - Москва: Государственное издательство геологической литературы, 1951 - с.543 --веб-публикация

--Корбел П. и Новак М. . МИНЕРАЛЫ. Иллюстрированная энциклопедия. М.: "Лабиринт Пресс", 2004. - 296 с.

МИНЕРАЛЫ (справочник) ------- http://www.geokniga.org/collections/3607 \\ т.2, вып.2

--Силикаты√справочник ═краткий указатель - http://geo.web.ru/druza/m-miner_A-Ya_sil.htm

--Минералы. Справочник. Том 3. Выпуск 1. Силикаты с одиночными и сдвоенными кремнекислородными тетраэдрами. Содержание

Минералы - спутники на расстоянии \\ Евсеев А.А. Минералы - спутники на расстоянии (2): Отдельные статьи Горного информационно-аналитического бюллетеня. - ╧12. - М.: Издательство "Горная книга", 2009. - 35 с.

Мозаика \\

Фото: А. Евсеев

М у з е и

--

World Directory of Mineral Collections (Second Edition) Pieter C. Zwaan; Ole V. Petersen . Published by═Commission on Museums of the International Mineralogical Association,, Copenhagen, 1977

Россия

-- Минер. музей им. А.Е. Ферсмана РАН, Москва

-- Музей ╚Самоцветы╩ (Москва) - http://gemmuseum.ru

Санкт-Петербургский ун-т \\ Начало...

--Хандыга пос., Якутия \\ Горно-геологический музей, предприятие "Восточно-Якутское" \\ серебро--самородки с м-ниф на хр. Сетте-Дабан (Расческин Е., 2004, с. 179)

Лондон, Великобритания \\ Музей естественной истории \ The Natural History Museum, London - -фоторепортаж Джолиона Ральфа (2016) - www.mindat.org

Н -

Названия и привязка местонахождений минералов

--Географические названия России (в том числе, месторождений полезных ископаемых) - http://russia.yaxy.ru/subdmn/russia/geo-nm.html

Названия минералов

- Беусит, открытый в пегматитах Аргентины, назван в честь советского минералога и геохимика Алексея Александровича Беуса (1923 - 1994), ученого секретаря ИМГРЭ и зав. отделом геохими на первом этапе развития института (1956-1966 гг.).

Ненашева С.Н. МИНЕРАЛЫ, НАЗВАННЫЕ В ЧЕСТЬ СОТРУДНИКОВ МИНЕРАЛОГИЧЕСКОГО МУЗЕЯ ИМ. А.Е. ФЕРСМАНА РОССИЙСКОЙ АКАДЕМИИ НАУК - http://geo.web.ru/druza/m-Mus-FM_pers_m.htm

---Имена минералов. Как их называют Леенсон И.А. (╚Химия и Жизнь╩, 2012, ╧1) \\ веб-публикации: \\ Имена минералов. Как их называют январь╧1 \\ Кто открыл, кто синтезировал? - февраль╧2 \\ Петрологи, геологи, минералоги, кристаллографы - март╧3 \\ Химики, физхимики и один математик - апрель ╧4 \\ Еще немного химиков и физхимиков - ╧5 \\ Космонавты, коллекционеры, поэты - ╧6

Митчелл Р.С. Названия минералов. Что они означают? - М.: "Мир", 1982. - 248 с.

Натролит

Натюрморт с камнем

Недра - http://www.rosnedra.com/

Нептунит в системат. коллекции Минер. музея им. А.Е. Ферсмана (до ╧93794)

1. Нептунит. Ангвундасчорр г., Ловозеро, Кольский п-ов, Россия. Образец: ФМ (╧56823, Ненадкевич К.А., 1954). 2. Нептунит. Сан-Бенито, Калифорния, США. (╧81503). Образцы 1-2: Мин. музей им. А.Е. Ферсмана РАН . Фото 1-2: ╘ А.А. Евсеев.

--Ловозеро--5+: Ангвундасчорр-3; Аллуайв-3; Азимут р., верх.--1 ; Карнасурт--1; Лепхе-Нельм--1; Пункаруайв--3; Тавайок--2; Юбилейная--2

--Хибины--1+: Маннепахк--3 ; Нептунитовая лощина--1

Дара-и-Пиоз, Алайский хр., Таджикистан--13

Гренландия, Дания: Kringlerne, Kangerdluarssuk, Ilimaussaq \ Илимауссак--1 ; Нарсарсук--3

Сан-Бенито округ, Калифорния, США--3 \\ Benitoite gem mine, San Benito Co.--2

Нефелин

Новое на сайте (по декабрь 2012)

Новые книги и публикации \\ см. также www.minbook.com/02.12.2016.(авторы со своими новыми книгами)

Специальный═выпуск═Минералогического Альманаха (том 21-2) О.К. Иванов ╚Минералогия Сарановского месторождения (Урал)╩ в серии ╚Знаменитые минералогические объекты России╩ . Содержание

Фото на обложке. Щетка тонкоигольчатых кристаллов редледжеита на хромите с уваровитом и хлоритом. 7х3,5 см. Сарановское с-ние, Ср. Урал, Россия. Образец: И.В. Пеков, ╧12772. Фото: М. Лейбов.

--Каталог экспозиции Геологического музея им. В.В. Ершова. - М., НИТУ "МИСиС", Горный институт, 2016.- 140 с. Составлен Т.В. Дубровской, А. Е. Корольковым.

--100 новых минералов, открытых А.П. Хомяковым. М., ИМГРЭ, 2016.

--Cурков А.В. Шальное золото тайги. - М.: Волшебный фонарь. 2016. - 322 с.

--Minerals and Their Localities -- THIRD EDITION by Jan H. Bernard and Jaroslav Hyrsl \\ Hardcover, 912 pages 3 edition, 2015. Published by Granit
ISBN 978-80-7296-098-9 \\ Источник и подробнее: www.mineralogicalrecord.com

 

--Moore's Compendium of Mineral Discoveries 1960-2015 by Thomas P. Moore. \\ 1644 pages ═1 edition, 2016. Published by Mineralogical Record, Inc.\\ Источник и подробнее: www.mineralogicalrecord.com/

 

Новые минералы--обзор за февраль-май 2012 г. - http://www.mindat.org/forum.php

Новые поступления в Мин.муз. им. А.Е. Ферсмана РАН

О -

Облицовочные камни \\

Обсидиан

Одноимённые местонахождения \ Одноименные географические названия

Окенит \\ Окно (камень у окна) \\

Онтогения минералов

--Жабин А.Г. Онтогения минералов: Агрегаты. М.: Наука, 1979. С. 276.

--Краснова Н.И., Петров Т.Г. Генезис минеральных индивидов и агрегатов. Санкт-Петербург: Невский курьер, 1997. С. 228.

Опал

Определение (диагностика) минералов

Ортоклаз

Открытки с камнем

П -

Первая находка минерала в быв. СССР и России

Пегматиты

- Ферсман А.Е. Пегматиты. М.: Изд-во АН СССР, 1940. Т.1.

Переименования (географических названий)

Перидот \ хризолит

Песок и минералы россыпей \\ Петалит

Пирит!! \\

Пирит. Березовское м-ние, Ср. Урал, Россия. 11х8 см. Образец: Минер. музей им. А.Е. Ферсмана РАН (╧73338). Фото: А. Евсеев.

Пироморфит \\

Пироп \\ http://www.mindat.org/min-3321.html \\ фото (27) - http://www.mindat.org/gallery.php?min=3321

Пирротин

Плагиоклазы\\ \\ альбит \\ анортит \\ беломорит \\ клевеландит \\ лабрадор \\

Поделочные камни \\ Полевые шпаты \\

Породообразующие минералы

Пренит - http://www.mindat.org/min-3277.html \\ фото (1002) - http://www.mindat.org/gallery.php?min=3277 - на 2009.05.27

Псевдоморфозы \\ фотогалерея - http://www.mineralatlas.com/specials/pseudo.htm

Миметезит по галениту (частичная псевдоморфоза). Верхний р-к, Дальнегорск, Приморье. Россия. Образец: Минер. музей им.А.Е. Ферсмана РАН. Коллекция В.И. Степанова ST 7112 (Бородаев Ю., 1957). Фото: ╘ А.А. Евсеев

Публикации

--The Mineral News, 2004-2007 \\ Указатель публикаций по авторам \ местонахождениям \ минералам

Пурпурит

1. Пурпурит. Силти-Ойва, пегматит. жила ╧3, СЗ Кольского п-ва, Россия. Ксеноморфные спайные монокристаллы (3х1,5 см...) и зерна пурпурита с включениями феррисиклерита, псевдоморфоза по трифилину? в шерл-кварцевом симплектите с альбитом, мусковит. 2. Пурпурит и темно-желтые фосфаты Mn. "Burundi, Руанда" ~6х7 см. Образец: Минер. музей им.А.Е. Ферсмана РАН. Коллекция В.И. Степанова, ST 7403. Дар: Титов И.Н., 1987 (из коллекции В.А. Ярмолюка). Фото: ╘ А.А. Евсеев. \\ НМК-144

Р -

Разнообразие минералов Софийский симпозиум

Региональная минералогия (заметки)

Р-коллекция \\ В феврале 2008 г. в Минералогическом музее РГГРУ (Москва) были записаны первые образцы в новую тематическую коллекцию "Региональная и всемирная минералогия" (сокращенно - Р-коллекция).

Из поступлений в Р-коллекцию Минер. музея МГРИ-РГГРУ (за 2014-2016 гг.и др.). Фото: А. Евсеев.

Резной камень \\

Рисунок и живопись в камне \\ http://www.minrec.org/artmuseum.asp

Цветные камни в акварельных рисунках. Музей камня (Барнаул). Фото: ╘ Е. Матвиенко, 2015.

Роговая обманка \\

Родонит \\

Родохрозит \\

Рутил

Рутил (кристалл ~4 см), кварц. Капыджик ( = Капуджук), Зангезурский хр., Азербайджан. Образец: ФМ. Фото: ╘ А.А. Евсеев. \\ НМК-144

С -

"Сборные" минералов по странам и регионам (10-15 избранных находок) \\ 1-е -в 2007 г .

Селенит (разн. гипса) \\ Сера \\ Серандит \\

Серебро \\ silver - mindat --фото (1189), местонахождения (3716) -- на 2009.11.15

Силикаты от А-Я_краткий указатель к справочнику "Минералы"(том.III-V)

Симметрия в геологии, минералогии и не только

Скаполит \\ Скелетные кристаллы

Скипетровидные кристаллы (в том числе обратные скипетры аметиста \ reverse sceptre из Боливии ( Esperanza Mine, near Bombori, Nor Potosi Province, Potosi Department) \\ http://www.mindat.org/ \\ http://www.mindat.org/photo-284819.html

Сколецит

Словари

--Кривовичев В.Г. Минералогический словарь.- СПб.: Изд-во С.-Петерб. ун-та, 2008. - 556 с. --СЛОВАРЬ МИНЕР. ВИДОВ - веб (В.Г. Кривовичев. Словарь минеральных видов. СПб, 2006)

--ГЕОЛОГИЧЕСКИЙ СЛОВАРЬ (включает раздел "МИНЕРАЛОГИЯ")

Слюды

Смитсонит \\ Содалит \\ Спессартин \\ Сперрилит.

Список минералов - http://en.wikipedia.org/wiki/List_of_minerals

Сподумен

Справочник "Минералы"_краткий указатель к томам IV-V

Справочники

Ссылки: http://www.insminerals2005.narod.ru/

Ставролит

Сталактиты и псевдосталактиты

Стеллерит. Стильбит

1. Стильбит. Нижняя Тунгуска, Ср. Сибирь, Россия. Длина 6,5 см. Образец и фото: ╘ Б.З.Кантор. 2. Стеллерит. Корка сферолитов в полости пиритизированной породы. Рудный г., Кустанайская обл., Казахстан. Более 20 см. Образец: Уральский минералогический музей В.А. Пелепенко (╧162). Фото: ╘ А.А. Евсеев.

 

Суйсеки (камни для созерцания) √ это камни причудливой формы, которую им придала вода в естественных условиях \\ Подробнее: http://a-stones.net/mMain.aspx?ChapterID=37 \\

Сульфиды \\ Сфалерит \\

Сферокристаллы --см. http://geo.web.ru/db/msg.html?mid=1179562. \\ Сферокристаллические сферолиты - http://geo.web.ru/db/msg.html?mid=1175869

Сферолиты

Т -

Тальк

Теллуриды и другие минералы теллура

Типоморфизм

Титанит \\ Тодорокит \\

Топаз \\

Топонимика (интересная для минералога) \\ Мурзаев Э.М. Словарь народных географических терминов. М.: Мысль, 1984. - 654 с. - электронная версия

Торбернит \\ Торий_минералы_ география находок \\ Тремолит \\

Турмалин (группа) \\

У -

Увит \\ Улексит \\ Уранинит

Ф -

Фаялит \\ Флогопит \\

Флюорит

Формы выделения минералов

Фото дня или на geo.web.ru/druza/ - "Вокруг света за 30 дней"

Фото дня на миндат.орг_ретроспектива - http://www.mindat.org/gallery.php?potd=1

Фото мест по всему миру - http://www.panoramio.com/map/

Фотоатлас минералов -- http://tw.strahlen.org/fotoatlas.html (834 minerals, 1148 photos)

Фотогалереи минералов - минералы от A до Z и число их фотографий - указатель для миндат.орг - http://www.mindat.org/photoindex.php--http://www.mineralatlas.com/ \\ http://kristallov.net/index.html \

Фотографии минералов - страница Б.З. Кантора на http://www.mindat.org/user-17280.html

Фотосъёмка минералов \\ \\ http://klopotow.narod.ru/soveti/foto.html

--Фото минералов - впервые в рамках Фестиваля "Первозданная Россия" (2016)\\ Подробнее: http://ilm.narod.ru/

Выставка "Фотограф А. В. Свердлов" в Мин. музее МГРИ-РГГРУ

Фторапатит

Х -

Халцедон \\ http://www.mindat.org/min-960.html ; фото (541) - http://www.mindat.org/gallery.php?min=960 \\

Халькопирит \\ Хромит

Ц -

Цвета минералов

Цветные камни \\

--Буканов В.В. Энциклопедия "Цветные камни" - официальный сайт

Целестин

Целестин. Бейнеу-Кыр, Туркмения. Кристаллы до 3 см. Жеода диаметром ~20 см. Образец: ФМ (). Фото: ╘ А.А. Евсеев.

Цеолиты \\ Циркон

Ч -

Чароит \\ Чароит. Сиреневое чудо Сибири. Иллюстрированное научно-популярное издание. - Иркутск6 изд-во "Петрографика", 2011. - 192 с. (авторы текстов: Рогова В.П., Воробьев Е.И. и др.)

ШЩ -

Шары и яйца из камня

Шахтёрская энциклопедия - MiningWiki═≈ энциклопедия о шахтах и шахтёрах, создаваемая совместными усилиями горняцкого сообщества.═

Шеелит \\

Шерл \\

Шорломит \\ Шпинель

Щелочные массивы \\ XXV Всероссийский семинар с участием стран СНГ. Геохимия магматических пород. 23-26 мая 2008 г. Школа Щелочной магматизм Земли   \\ http://alkaline2008.narod.ru/ \\ Тезисы - http://alkaline2008.narod.ru/Abstract.htm

Э -

Эвдиалит \\

Эгирин \\ местонахождения (595) - http://www.mindat.org/min-31.html \\ фото (169) - http://www.mindat.org/gallery.php?min=31 (на 2009.03.22) \\

Экскурсии_ минералогические экскурсии. \\ В Гос. геол. музей им. ВИ. Вернадского

Эльбаит \\ Эпидот \\

Ю -

--Wise, W.S. (1978): Yugawaralite from Bombay, India. Mineralogical Record 9 (5): 296

Я

Янтарь \\

Ярмарки минералов и драгоценных камней \\

Ярозит \\ Яшма

ЯШМА В РОССИИ [по А.Е. Ферсману] - http://pictoris.ru/5/27/index.html

ОПИСАНИЕ РУССКИХ ЯШМ [по А.Е. Ферсману] - http://pictoris.ru/5/29/index.html

Фото: А. Евсеев

 

МЕСТОНАХОЖДЕНИЯ МИНЕРАЛОВ

Местонахождения минералов \ mineral localities на сайте и на страницах справочника Евсеев А.А. Географические названия в минералогии. Краткий указатель. Ч. I, М. , 2000. - 269 с.; Ч. II, М. , 2000. - 282 с.
Часть I и II (выборочно)
:

м-н-ния
А
Б
В
Г
Д
Е
Ж
:З
И
Й
К
Л
М
Н
О
П
Р
С
Т
У
Ф
Х
Ц
Ч
Ш
Щ
Э
Ю
Я
стр.
10-
26-
45-
54
-
63-
73-
75-
77-
81-
87-
88-
122-
132-
151-
160-
166-
180-
188-
213-
226-
234-
239-
247-
249-
255-
260
260-
265-
267-
Locality
A
B
C
D
E
F
G
H
I
J
K
L
M
N
O
P
Q
R
S
T
U
V
W
X
Y
Z
cтр.
9-
24-
44-
63-
71-
78-
86-
97-
108-
113-
118-
135-
148-
173-
181-
188-
203
204-
214-
243-
257-
260-
268-
275-
276-
278-

См. также http://www.mining-enc.ru

А

Адун-Чолон (= Адун-Чилон), Вост. Забайкалье , Россия

Айфель = Эйфель \ Eifel горы (палеовулкан), Рейнланд-Пфальц, Германия \ Eifel, Rheinland-Pfalz, Deutschland

Акжайляу, к В от г. Аягуз, Вост. Казахстан.апатит!!!--с александрит. эффектом; КВАРЦ!!!--xl 10 м; кристалл дымч. кварца 5,8 м в длину и 1, 5 м в поперечнике, весил около 90 т-находка в южной части массива (Ерджанов К.Н., 1963);

Акчатау \ Akchatau, Ц. Казахстан \\

Аллуайв, Ловозеро, Кольский п-ов, Россия. \\ 67╟51` с. ш. 34╟32` в. д.

Альмаден, Испания

Арендаль, Ю. Норвегия.

Астафьевское м-ние, Ю. Урал, Россия\\ http://www.mindat.org/loc-192610.html

Ахалцихе (р-н), Грузия.

Ахматовская копь, Ю. Урал, Россия

Б - местонахождения минералов

Баженовское м-ние , г. Асбест, 60 км к СВВ от Екатеринбурга, Ср. Урал, РФ

Баласаускандык, СЗ Каратау, Казахстан \\ * (1959) альванит; * (1963) бокит; * казахстанит; * карбонат-цианотрихит; * новые мин.-->10 видов; роскоэлит; * русаковит;* (1959) сатпаевит; * (1972) черныхит--ф; Pk (ф)

Банкрофт, Онтарио, Канада \\ Rocks and minerals for the collector: Bancroft - Parry Sound area and southern Ontario; Sabina, A P. Geological Survey of Canada, Miscellaneous Report 39, 1986, ; 182 pages

Белореченское м-ние, 70 км к Ю от Майкопа, Сев. Кавказ, Россия \\ Levitskii V.V. Journey to the Belorechenskoye Deposit. Mineralogical Almanac, vol. 13c, 2008 , p. 62-71 \\ Подробнее: /webmineral.ru/

Березовское золоторудное месторождение, Средний Урал, Россия

Биг-Фиш-Ривер \ Big Fish River, 70 км к СЗ от Аклавик, хр. Ричардсон, Юкон, Канада \\ *баричит; *виксит; *горманит!!; лазулит!!; *маричит; *нахпоит; * новые мин.≈6 видов; *саттерлиит; MR, 1999, 50 \\ http://www.mindat.org/loc-628.html

Борон, округ Керн, Калифорния, США \\ в этом же районе находится заброшенный ныне подземный р-к Бейкер майн \ Baker mine, U.S. Borax Mine (Pacific West Coast Borax; Pacific Coast Borax Co.; Boron Mine; U.S. Borax and Chemical Corp.; Kramer Mine; Baker Mine), Kramer Borate deposit, Boron, Kramer District \ подробнее - mindat

Брокен-Хилл (быв.) = Кабве (ныне) р-к, Центральная пров., Замбия \ Kabwe Mine (Broken Hill Mine), Kabwe (Broken Hill), Central Province, Zambia; 14╟29'S , 28╟25'E - http://www.mindat.org/loc-4341.html \\

Брокен Хилл (Broken Hill), Н. Ю. Уэльс, Австралия, 31-57` ю. ш. , 141-26` в. д. \\ http://www.mindat.org/loc-72.html \\

Брумаду \ Бу-Аззер, Марокко \\

Бурпала , Прибайкалье (С), Россия

В

Ватиха, Мурзинка, Ср. Урал, Россия.

Везувий и Монте-Сомма, Италия \\

Величка, Польша

Верхнекамское м-ние, Пермский край, Россия

Вишневые горы, Ю. Урал, Россия \\ фотогалерея и др. - http://webmineral.ru/

Монацит-(Ce). Метакристалл с отдельностью в фените. Вишневые горы, Южн. Урал, Россия. Образец: Минер. музей им.А.Е. Ферсмана РАН. (Коллекция В.И. Степанова ST 7361. Жабин А.Г. Сбор 1954 г. ) Фото: ╘ А.А. Евсеев \\ НМК-144

 

 

Водинское м-ние, к ССВ от Самары, Ср. Поволжье, Россия

--Сидоров А.А. Минералогия Водинского месторождения самородной сера Самарской области и история его окрытия. Учебное пособие. Самара: Самар. гос. техн. ун-т, 2011. - 189 с.

Володарск-Волынское пегм. поле, пос. Володарск-Волынский, к З от Житомира, Волынь , Украина \\ берилл!!!--ф; гетит!!!; кварц!!; керит!!; микроклин!; опал!; топаз!!!--xls>100 кг; фенакит!!

--Lyckberg, P., Chornousenko, V. & Wilson, W. E. (2009): Volodarsk-Volynski, Zhitomir Oblast, Ukraine. Mineralogical Record: 40: 473-506.

Вороньи тундры, Кольский п-ов, Россия

Вулькано о. \ Vulcano Isl., Липарские о-ва, 50 км к З от Мессины, у сев.-вост. побережья Сицилии, Италия \

Г

Гаурдак, Туркмения

Горихо (Gorikho), м-ние, в ср. и ниж. теч. р. Горихо (приток р. Тола, басс. р. Селенга), 45 км к В от Урги [Улан-Батора], Монголия \\ берилл!; горный хрусталь!; топаз!!; флюорит!; Ф, 491; Ш, 28, 197

Горни-Славков ( (ныне) = Шлаггенвальд (быв.) (Horni Slavkov (now) = Schlaggenwald (form.)), 12 км к ЮЮЗ от гор. Карловы Вары , Богемия, Чехия

Гумешевский р-к, Ср. Урал, Россия

Д

Дальнегорск (и район), Приморье, Россия - рекордные кристаллы на сайте - http://giantcrystals.strahlen.org/asia/dalnegorsk.htm \\

-- Боросиликатное м-ние \ Верхний р-к \\ Николаевский р-к

Ильваит (черные блестящие кристаллы) инкрустирует крупные (до 25 см) пластинчатые кристаллы кальцита. Николаевский р-к, Дальнегорск, Приморье, Россия. Образец: В.А. Пелепенко. Фото: ╘ А.А. Евсеев

 

Дараи-Пиоз (= Дараи-Пиез = Дара-и-Пиоз = Дарапиоз) (Dara-Pioz) , 45 км к СВ от пос. Гарм и 35 км к ССВ от Таджикабада, Алайский хр. , Таджикистан \\ http://www.mindat.org/loc.php?loc=3241

Дашкесан, Азербайджан

Джезказган, Казахстан

Додо м-ние, Прип. Урал, Россия - http://www.polarquartz.ru/dep-dodo.html

Е

Ермаковское м-ние, Забайкалье, Россия.

Ж

З

Завитинское (Завитая), м-ние, Вост. Забайкалье , Россия \\ адуляр!; воробьевит!; касситерит!; кукеит!; петалит!!; ростерит!; сподумен!!; турмалин!!; Смо, 351

Заги \ Zagi Mountain, 30 km NW of Peshawar, 4 km S of Warsak (34╟09`N, 71╟24`E), близ Kafoor Dheri, р-н Пешавара, Северо-Западная Пограничная провинция, Пакистан;

Змеиногорский р-к (Zmeinogorsk) = Змеиногорское м-ние, Алтай, Сибирь (ЮЗ), РФ \

И

Идар-Оберштайн \ Idar-Oberstein Германия (ЮЗ) \\ агат!! \\ 500 лет (с 1375 г. по 1875 г) в этом районе разрабатывались месторождения агата, велась его обработка. Сегодня небольшой городок - крупнейший центр торговли минералами, драгоценными и поделочными камнями, его называют "самоцветнной столицей мира." .

Изумрудные копи, Ср. Урал, Россия

Эвклаз (кристалл ~3 см). Изумрудные копи, Ср. Урал, Россия. Образец: В.А. Пелепенко. Фото: ╘ А.А. Евсеев.

 

Илимауссак, Ю. Гренландия

Ильмены. Ю. Урал, Россия \\ карта и др. http://reserves-park.ru/index/0-204 \\ http://nashural.ru/Mesta/ilmeni.htm

Индер (Inder) (= Индерское м-ние), 15 км к В от пос. Индерборский, 150 км к С от Атырау (= Гурьев (быв.)), Сев. Прикаспий, Казахстан \\

Итинокава, о. Сикоку, Япония.

Иультин, Чукотка, Россия

Й - К

Кап-Гарон \ Cap Garonne, близ Le Pradet, 12 км к В от Тулона, Вар, Франция

Капильитас, Катамарка, Аргентина

Карадаг, Крым, Россия \ Карадагский вулканический массив═(= гора Карадаг = горная группа Карадаг) √ Восточный Крым, между пос. Курортное и Коктебель (бывш. Планерское)\\ http://www.sevstone.ru/collection/all/all/crimea-karadag/

Карамазар (Karamazar) рудный район, Сев. Таджикистан

Кара-Оба = Караоба \ Kara-Oba, м-ние (Mo-W), пос. Джамбул (47-11`N, 71-23`E), Ц. Казахстан

Вольфрамит, кварц. Кара-Оба, Ц. Казахстан. Образец: Мин. музей им. А.Е. Ферсмана РАН. Фото: ╘ А.А. Евсеев.

Карнасурт, Ловозеро, Кольский п-ов

Кацна яма (копь) , 15 км к СВ от Первоуральска, Ср. Урал, Россия \\ эпидот!! (⌠пушкинит■!!

Кент, м-ние, гранитный м-в и грейзенизированные гранитные пегматиты, 30 км к ЮВ от пос. Карагайлы и 50 км к ЮВ от Каркаралинска, Ц. Казахстан \\

Керченское м-ние, Крым, Россия \\ анапаит!!!; барит!! вивианит!!; * митридатит; родохрозит, Ca-вый!!--пс-зы по раковинам (ф); смайтит!; Смо, 352; Pk \\

Кипуши, ДР Конго \\

Кировский р-к, Кировский р-к, Кукисвумчорр, Хибины, Кольский п-ов, Россия

Ковдор \\

-- БалабонинН.Л.,═Волошин═A.B., Пахомовский Я.А. Редкие сульфиды в породах Ковдорского массива. Минеральные комплексы и.═минералы═Кольского полуострова. Апатиты: изд-во КФ АН═СССР, 1980. С. 88-92.

--Соколов═C.B. Шортит ≈ первая находка в карбонатитах // Доклады Академии Наук СССР. 1979. Том 247. ╧ 5. С. 1253-1256.

--Соколов═C.B. Ошортите массива Ковдор // Доклады Академии Наук СССР. 1981. Том 259. ╧ 2. С. 466-469.



Луешит (кр-коричневый) в томсоните. Слюда р-к, Ковдор, Кольский п-ов, Россия. 3 см. Образец: Минер. музей РГГРУ (Р-437. Дар: Моисеев М.М., 2009). Фото: ╘ А. Евсеев.

Конгсберг (Kongsberg), Норвегия \\ * конгсбергит; пренит!; серебро!!!; флюорит!≈розовый; ВВМ, 68, 174, 176, 178, 179 \\ O. Johnsen, Mineralogical Record, 1986, 17, 19-36

Кондёр г. , м-в ул.-осн. и щел. пород (Kondoer = Konder), Алданский щит, 75 км к З от пос. Джигда и 100 км к ЗЮЗ от пос. Нелькан, ниж. теч. р. Маймакан, Хабаровский край, РФ \ фото 3D - http://www.mindat.org/photo-619937.html

Консельейру-Пена \ Conselheiro Pena District (пегматитовый район) 21 км к С от Дивину-да-Ларанжейрас, (р-н), Минас-Жерайс, Бразилия

Коршуновское м-ние, Иркутская обл., Вост. Сибирь, Росссия

Кремиковцы = Кремиковци (Kremikovtsi), ~ 15 км к СВ от Софии, Болгария \\ азурит!; барит!; витерит!!; гематит!!; гетит!!; кальцит!; лепидокрокит!; норсетит!! (ММ); родохрозит!!; романешит!!

Кубер-Педи , м-ние (Coober Pedy field), 180 км к С от гор. Туркула и 750 км СЗ от Аделаиды, Ю. Австралия \\ благородный опал!!!--пс-зы!! по раковинам, белемнитам и др

Кукисвумчорр, Хибины, Кольский п-ов, Россия \\ Петараситовая жила, Тульйок река (верховья), Кукисвумчорр гора, Хибины, Кольский п-ов, Мурманская область, Россия

Кухилал (Kukhilal) = Кухи-Лал = Кугиляль = Кох-и-Лал, Памир (ЮЗ), Таджикистан

Кырк-Булак, Туркестанский хр. (С) \\ андалузит!!-паралл. сростки xls до 18 см; арроядит!; берилл!!; беусит! - выдел. до неск. см; грифит!!--1-я нах. в СССР; кордиерит!; крыжановскит!!; *магниотриплит!; манганоконинкит!; поллуцит!; саркопсид!; синканкасит! (ФМ); спессартин!!; трифилин!; цвизелит

Л

Лаврион = Лавриум, Греция \ Laurium (= Laurion = Lavrion (нем.)), Greece \\ фотогалерея--http://www.mineral-forum.com/ \\ фотогалерея минералов - http://www.mindat.org/g/554

Лакарги гора, Верхнечегемская вулканическая структура, Кабардино-Балкария, Сев. Кавказ, Россия \ Lakargi Mt., Verkhnechegemskaya caldera (Upper Chegem caldera) ; ксенолиты скарнов в игнимбритах; 43╟17'N ; 43╟6'E \

Ирина Галускина, Александр Задов (в центре), Виктор Газеев.═Лакарги═гора, Верхнечегемская вулканическая структура, Сев. Кавказ, Россия. 2009 г. Фото: ╘ Е.В. Галускин.

Лангезундфьорд = Лангесунн-фьорд (Langesund(s)fjord), Ю. Норвегия Ленгенбах, Швейцария \\ http://en.wikipedia.org/wiki/Lengenbach_Quarry

Ловозеро, Кольский п-ов, Россия

Липовка, Ср. Урал, Россия

Лонгбан, Вермланд, Швеция \\ 59╟51'13"N , 14╟15'34"E

М

Мави р-к, Лагман пров., Афганистан

Маданский рудный район, ( = Маданское рудное поле (Pb-Zn)(Madan ore field), р-н пос. Мадан, 200 км к ЮВ от Софии, Болгария \\ галенит!!--xls< 20 см; манганильваит* (= ильваит-Mn); родохрозит!; пирротин!; сфалерит!; ферройохансенит!; халькопирит!; церуссит!! \\ http://www.mindat.org/loc-459.html

Маджуба-Хилл Майн. округ Першинг, Невада, США \\ * (1978) гоудейит \ goudeyite; клиноклаз!; * (1978) парноит; страшимирит!! \\ http://www.mindat.org/loc-3924.html

Мало-Быстринское м-ние (= Малобыстринское), м-ние, 18 км к З от Слюдянки, Прибайкалье (ЮЗ), РФ \\ афганит!; * (1991) быстрит--ф; лазурит!!!; сера!; * тункит; Pk (ф)

Малханское м-ние , Забайкалье, Россия

Малый Пункаруайв г., Ловозеро, Кольский п-ов, Россия

Маунт-Кобальт, 120 км к Ю от Клонкерри, Квинсленд, Австралия \ Mount Cobalt ( Mt Cobalt Mine), Selwyn District , Mt Isa - Cloncurry area , Queensland , Australia -- http://www.mindat.org/ \\ фото: гетерогенит!-ф; кобальтин!--ф; мансфельдит (6); смольяниновит≈пс-зы по эритрину (кр-лы до 2 мм (3); сферокобальтин!--ф; эритрин!!!≈(10 фото);

Маунт-Малоса \ Mt. Malosa, близ Зомба, Малави, Вост. Африка \\ барилит!; микроклин!; миларит!; ниобофиллит!!--фото-- www.mindat.org/gallery1; ортоклаз!; паризит!!; разн. 48 мин. (44 достоверных вида); эгирин!!!≈xls> 20 см; эпидидимит!!≈xl 5, 4 см; D; L, 1999, ╧4, 22-32; 48 entries listed. 44 valid minerals-- www.mindat.org (2008.02.24)

Машамба-Уэст р-к, Катанга, ДР Конго. \\ Везиньеит--ф; карнотит!--ф; кобальтодоломит!!--ф; кобальтокальцит!!-ф; колвезит!--ф; куприт!!-ф; малахит!!--ф; метатюямунит!--ф; планшеит!--ф \\ рудник начал работу в 1978 г. \\ Источник: http://www.mindat.org/loc-4334.htm

Меднорудянский р-к, Ниж. Тагил, Ср. Урал, Россия

Н. Д. Чудинова. На заднем плане - выдающаяся по размерам глыба малахита из Меднорудянского м-ния. Музей природы. Нижний Тагил, 2014.07.22 Фото: ╘ А.А. Евсеев

Псевдомалахит. Сферолитовая корка псевдомалахита (элита) с вросшими мембранными трубками на поверхности агрегата. Меднорудянск, г. Высокая, Ниж. Тагил, Ср. Урал, Россия. ~6 см. Образец: Минер. музей им.А.Е. Ферсмана РАН. (Коллекция В.И. Степанова ST 7429. 1984 г.) Фото: ╘ А.А. Евсеев.

Мерек (= Мерекское), м-ние, ~40 км выше устья р. Мерек (приток р. Амгунь), близ ж.-д. ст. Эанга, к ЮВ от Чегдомына, 270 км к С от Хабаровска, Буреинский хр. , Хабаровский край, РФ \\ касситерит!!≈xls \\ Мерек рудопр-ние, в верх. р. Мерек (левобережье р. Амгу)-касситерит!!-фото; рядом-пром. россыпи касситерита-- Расческин Е.В., 2004, 206-207 \\ Д..А. Петроченков. Касситерит [Мерек] и аммониты [Европ. Россия] в ювелирных изделиях--сообщ. в клубе друзей минералогии (2008.06.06)

Мерелани-Хиллс \ Merelani Hills, Танзания \\ алабандин!!!--xl 9x6x4 см; добыт в 2013 г.--фото www.mindat.org

Мибладен, Марокко \\ в поисках ванадинита - видеосюжет www.youtube.com/

Могок = Могоу (новое название, по Е.Я. Киевленко, 2001) (Mogok District), Мьянма (= Бирма (быв.)

Мурзинка, Ср. Урал, Россия

Мурунский массив = Мурун (Murun), близ г. Мурун (1452 м), междуречье рр. Чара и Токко, ~50 км к ЗЮЗ от пос. Торго, Алдан (СЗ), Якутия (ЮЗ), РФ \\\\ Сиреневый Камень месторождение чароита

--http://petrographica.ru/

1. Чароит. Мурунский м-в, Алдан (СЗ), Якутия. Поле изображения~30х20 см. Образец: ФМ. Фото: ╘ А.А. Евсеев.| 2. Купросклодовскит. [Мусонои], Катанга, ДР Конго. Образец: У. Пинч \ W.W. Pinch. Фото: ╘ М. Моисеев.

Мусонои р-к \ Musonoi mine, ~25-30 км к З (по другим данным -10 км к СЗ ) от Колвези (10╟41`S, 25╟39`E), Катанга (быв. Шаба, ДР Конго (быв. Заир); 10╟42`S, 25╟23`E \\

--Сульфиды и селениды \\ Pirard, C. & F. Hatert (2008): The sulfides and selenides of the Musonoi Mine, Kolwezi, Katanga, Democratic Republic of Congo. Canadian Mineralogist. 46, 19-31.

Найка, Чиуауа, Мексика

Неройка г., Прип. Урал, Россия \\ Додо м-ние \\

Норильский р-н, Ср. Сибирь, Россия

Спиридонов═Э.═М., Гриценко═Ю.═Д.═Эпигенетический низкоградный метаморфизм и Co-Ni-Sb-As минерализация в Норильском рудном поле. ≈ Научный мир Москва, 2009. ≈ С.═218.

Н`Чванинг (N`Chwaning), р-ки (без уточнения) , к СЗ от Куруман, Калахари (Mn)-рудное поле, ЮАР \\ афвиллит!!!--xls< 1 см; браунит!!--xl 1, 6 см (ф); журавскит!--xls; кариопилит!!; лейкофеницит!--xls< 3 мм; портландит!!!--xls< 3 см; MR, 1992, v. 23, 436; MRI

--Гвидоттиит (гуидоттиит)* - новый минерал из N'Chwaning II Mine \\ Wahle, M.W., Bujnowski, T.J., Guggenheim, S., Kogure, T. (2010): Guidottiite, the Mn-analogue of cronstedtite: A new serpentine group mineral from South Africa. Clays and Clay Minerals, 58, 364-378. \\

О

Одихинча \ Odikhincha, м-в, р. Котуй, 110 км к ЮЮВ от Хатанги, Ср. Сибирь, Россия

Апатит. Лучистый агрегат апатита с меланитом в интерстициях на крупнокристаллическом диопсиде, замещаемом минерадом Х ? . Одихинча массив, Сред. Сибирь (С), Красноярский край, Россия. Образец: Минер. музей им.А.Е. Ферсмана РАН. Коллекция В.И. Степанова ST 7478. Буканов В.В., 21 экспедиция, Ленинград, 1975. Фото: ╘ А.А. Евсеев. \\ НМК-144

Ору-Прету, Минас-Жерайс, Бразилия

Отоме,, р-к (Otomezaka = Otome mine), Makioka-cho , Yamanashi City , Kinpuzan district, преф. Яманаси (Yamanashi Pref.), Япония \\ : http://www.mindat.org/loc-220223.html

Охуэла р-к \ Ojuela mine, Мапими, Дуранго, Мексика \\ кобяшевит!!--новинка Тусон-шоу 2016 г.--фото- http://webmineral.ru/

П

Пала, округ Сан-Диего, Калифорния, США \\ берилл розовый!; кунцит!!; лепидолит!; эльбаит!!!

Палитра пегматит, Кедыкверпахк г., Ловозеро

Панашкейра \ Panasqueira; Португалия; 40╟10`N , 7╟46`W;

--Gaines, R.W. & Thadeu, D. (1971). The minerals of Panasqueira, Portugal. Mineralical Record, 2(2), 73-78.

Педернейра, р-к (Pederneira mine), Минас-Жерайс, Бразилия \\ эльбаит!!!--xl 20 см (ф), MR, 2000, #1, 56

Перекатное м-ние, Алдан, Якутия, Россия.

Питкяранта, Сев. Приладожье, Ю. Карелия, РФ \\ См. http://karelnedra.karelia.ru/mnia/sn_karelia.htm

Плоская г. , Кейвы, Кольский п-ов, Россия; амазонитовые пегматиты с редкими минералами Y и Yb \\ Гора Плоская 2015 - фоторепортаж - http://webmineral.ru/

Полковник г.., Орск, Ю. Урал, Россия

Пршибрам, рудное поле, Чехия \ \ Pribram ore field, Czech Republic

Пуйва, Прип. Урал, Россия.

Пуна\ Poona = Pune (район Пуны), Индия \\

Р

Рай-Из гипербазитовый массив (район), хр. Марун-Кеу, ж.-д.. ст. Харп, ЯНАО, Тюменская обл., Пол. Урал, Россия \\

Расвумчорр, Хибины, Кольский п-ов, Россия

Ратнапура, Шри-Ланка

Рубцовское м-ние, 20 км к ЮВ от г. Рубцовск близ северной окраины дер. Потеряевка, Алтай, Россия; 51╟28'14'' с.ш., 81╟29'34'' в.д. \\ азурит!!; коннеллит!--фото ; йодаргирит!; куприт!!!; майерсит!!; маршит!!; медь!!; серебро!

Рудные горы, Гемания \ Чехия

С

Санкт-Андреасберг, Гарц, Ниж. Саксония, Германия (33_5) \ St Andreasberg District, Harz Mts, Lower Saxony, Germany \\ апофиллит!!; *арсенолит; *брейтгауптит; *гармотом!!!; дискразит!!; кальцит!!!; миаргирит!; мышьяк!!; нов. мин.--4 вида; пираргирит!!!; прустит!; разн.-220 мин.(198 мин. вид.)--http://www.mindat.org/loc-22230.html (на 2008.09.04) ; * самсонит!!; стефанит!!; ВВМ, 46, 56, 240 \\

Сарановское м-ние, Ср. Урал, Россия

Сарбайский р-к \ Sarbayskii mine (= Сарбайское м-ние) и Соколовский р-к, гор. Рудный, 45 км к ЮЗ от Кустаная, Казахстан

Сент-Илер массив, Квебек, Канада \\ http://www.mindat.org/loc-123123.html

Сикуаньшань, Хунань, Китай

Слюдянка (и район) Словарь топонимов Слюдянского района - http://www.maxknow.ru/images/upload/articles7/468.htm

Солонго (= Магнетитовое) м-ние, Забайкалье, Бурятия, Россия

Суит-Хоум Майн, Алма, \ Sweet Home Mine, Alma, Колорадо, США \\

Сюебаодин \ Xuebaoding, горы, район Пинъу \ Pingwu, Сычуань, Китай

Т

Талнах м-ние, Ср. Сибирь (С)

--Маяк р-к, Талнахское м-ние, Талнах, Норильский р-н, Ср. Сибирь (С), Россия. \\ новые минералы - годлевскит*; манганшадлунит:; маякит*(1976); плюмбопалладинит*; полярит*; таймырит*; талкусит*; урванцевит*; шадлунит* (Pekov, 1998) \\ ЕК

Терлингуа м-ние, Теха, США \\ Origlieri M. Famous mineral localities: Terlingua, Texas. - Mineralogical Record, 1990, 21(3), pp:221-234

1. Клейнит. Терлингуа, Техас, США. Образец: Пеков И.В., 2008. Фото: ╘ А.А. Евсеев. 2. Кристаллы терлингуаита. Терлингуа, Техас, США. Источник: справочник "Минералы" (т.2, в.1, с.173). 2

 

Тигриное м-ние, Приморье, Россия \\ Попова В. И., Попов В. А., Коростелёв П. Г., Орловский В. В. Минералогия руд W-Sn-месторождения Тигриное и перспективы его освоения. Екатеринбург: УрО РАН, 2013 г. √ 133 с. \\ П

Титовское м-ние, р. Догдо, хр. Тас-Хаяхтах, Пол. Якутия, Россия

Толбачик (= Толбачинский) (Tolbachinskii) вулкан, к ЮЗ от Ключевской Сопки, Камчатка, Россия\\ разнообразие - более 240 видов; новые минералы - более 75 видов; по числу новых минералов, открытых здесь, вулкан Толбачик занимает теперь 3-ье место в мире среди всех местонахождений минералов (данные И.В. Пекова, 2015.10) \\ См. также http://www.mindat.org/loc-5602.html

--Большое трещинное извержение (БТТИ), Толбачик вулкан, Камчатский край, Северо-Восточный регион, Россия

-- Второй шлаковый конус, Северный прорыв, Большое трещинное извержение, Толбачик, Камчатка \ Second scoria cone, Northern Breakthrough, Great Fissure eruption, Tolbachik volcano \ www.mindat.org

Траверселла (Traversella), близ Ивреа, Пьемонт, Сев. Италия \\ аметист!!; доломит!; магнетит!!≈xls< 3 см; пирит!; шеелит!!; эпидот!; ВВМ, 160, 234

Турьинские р-ки, Сев. Урал, Россия \\ Фёдоров Е. С., Никитин В. В. Богословский горный округ. Описание в отношении его топографии, минералогии, геологии и рудных месторождений. - СПб., 1901. - С. 92.

Тюямуюн, Киргизия

У

Уа-Уа Маунтинз, близ Delta, округа Бивер, Миллард и Айрон, Юта, США \ Wah Wah Mts, Millard Co. \ Beaver Co. \ Iron Co., Utah, USA \\ берилл!!!--xls, малиново-красный; гейкилит

Удачная трубка, Якутия, Россия

Умбозерский р-к, г. Аллуайв, Ловозеро, Кольский п-ов, РФ

Ушкатын-III, м-ние (Fe-Mn), близ пос. Жайрем, Атасуйский р-н (З), Ц. Казахстан \\ бементит!; брандтит!; браунит!; вульфенит; гаусманнит; кентролит!; пеннантит!; родохрозит!!; тодорокит!!; церуссит!!; якобсит

Ф

Фрайберг (=Фрейберг), район.

Франклин, Нью-Джерси \ (Franklin), 80 км к СЗ от Нью-Йорка, округ Сассекс, Нью-Джерси, США \\ аллеганит! (М 3-1); виллемит!! (М 3-1)≈xls<20 см; ганит! (М 2-3); гетеролит! (М 2-3); глаукохроит! (М 3-1); годжкинсонит! (М 3-1); ларсенит! (М 3-1); лейкофеницит! (М 3-1); *ленниленапеит (ММ); лёллингит! (М 1-1); * новые мин.≈67 видов (вместе с м-нием Стерлинг-Хилл); норбергит! (М 3-1); пирохроит! (М 2-3); родонит!! (М 3-2); тефроит! (М 3-1); * франклинит!! (М 2-3)≈xls< 15 см; хендриксит!; цинкит!!! (М 2-2); BG, 19, 21; MR, 1996, 226 (лит.)

Х - местонахождения

Хагендорф, Бавария, Германия

Хайдаркан, м-ние, Киргизия

Хибины, Кольский п-ов, Россия \\ карта Хибин \\ турист. схема

--Килманит-(Ce) \ Kihlmanite-(Ce) --новый минерал из Хибин(2014) \\ Yakovenchuk, V. N., Krivovichev, S. V., Ivanyuk, G. Y., Pakhomovsky, Ya. A., Selivanova, E. A.,Zhitova, E. A., Kalashnikova,G. O., Zolotarev, A. A., Mikhailova, J. A., Kadyrova, G. I. (2014): Kihlmanite-(Ce), Ce2TiO2[SiO4](HCO3)2(H2O), a new rare-earth mineral from the pegmatites of the Khibiny alkaline massif, Kola Peninsula, Russia. Mineralogical Magazine, 78, 483-496. \\ подробнее \\ www.mindat.org

--Зайцев═А.Н. Минералогия карбонатитов Хибинского массива и основные черты их генезиса. Автореферат диссертации канд. геол.-мин. наук. СПб: СПбГУ, 1992. 16 с. \ ═http://www.dissercat.com/

--Пеков═И.В., Чуканов Н.В., Беловицкая Ю.В.═Ханнешит═и петерсенит-(Се) из Хибин // Записки Всесоюзного минералогического общества. 1998. Часть 127. ╧ 2. С. 92-100.

Хуанганг р-к \ Huanggang Mine (Huanggangliang Mine), Внутр. Монголия, Китай

Ц

Цумеб \ Tsumeb и район, Намибия \\ (ГРЭ- III , 587-593); геол. карта р-на; геол. разрез); ╚скопления германита достигали веса в несколько сотен тонн╩ (с.589) ; новые минералы- 71 мин. вид - см. www.mindat.org

Ч

Челекен (Cheleken) , 70 км к Ю гор. Туркменбаши (= Красноводск (быв.)), Туркмения \\ Современное гидротермальное образование--образцы сборов Л.М. Лебедева (поступили в ФМ в 1969 г. )\\ алуноген!; арагонит!; барит!!; болеит!; галенит!!--ф; галотрихит!; гипс!; кокимбит! (Будько В.Н., 1962л); копиапит!; куменгит; метавольтин!; озокерит!!; паракокимбит!; псевдоболеит; ремерит!; свинец!!; сфалерит!!; тамаругит!; ярозит!;

Чукикамата, Chuquicamata (22╟18`S, 68╟55`W), 15 км к N от Каламы, Антофагаста, Чили \\ атакамит! (М 2-1); *(2011) бетпакдалит-NaNa; * (1811) блёдит; мендосавиллит*; маршит! (М 2-1); *1908-натрохальцит;(Gui-72); * новые мин.≈12 видов; *1986-обрадовичит; * самплеит

Ш Щ

Шерловая Гора (= Шерлова гора = Ширлова гора) (Scherlovaya Gora), Вост. Забайкалье, РФ \\ Шерловая Гора \\ Г.А. Юргенсон, О.В. Кононов═.Шерловая Гора: месторождение самоцветов и редких металлов \\
Минералогический Альманах, том 19, выпуск 2, 2014 \\

Шимен, Хунань, Китай

Шкатулка, пегм. залежь, Умбозерский р-к, Аллуайв, Ловозеро, Кольский п-ов, РФ. Рудник в настоящее время затоплен. Уссингитовое ядро пегматита "...имеет форму извилистой линзы, протяженностью более 12 м при мощности до 2,5-3 м. Теперь уже не возникает сомнения, что именно "Шкатулка" и есть крупнейшее в мире уссингитовое тело"(Пеков И.В. 2001, с. 359)

Шнееберг, Рудные горы, Саксония, Германия \\ 365 минералов, из них 299 достоверных видов, из них 43═ новых вида ( type locality) на 2016.03.04\\ Источник: http://www.mindat.org/loc-1848.html

Шор-Су = Шорсу, м-ние, 30-35 км к ЮЮЗ от Коканда, Фергана (Ю), Узбекистан \\ озокерит!; сера!!!; целестин; МС-1, 278-279; Смо, 356

Э

Эвеслогчорр, Хибины, Кольский п-ов, Россия

Эльба о., Италия

Эронго, Намибия.

Эрцберг \ Erzberg близ Eisenerz, 11 км к ЮВ от Hieflau, Штирия \\ анкерит*; АРАГОНИТ!!!

Юбилейная залежь \ Jubilee( = Yubileinaya) pegmatite ), Карнасурт, Ловозеро, Кольский п-ов, Россия

Юкспор, Хибины, Кольский п-ов, Россия

Верховья долины Гакмана (Юкспор, Хибины). Фото : ╘ А.А. Евсеев

Я

Яогансян р-к (W) \ Yaogangxian = Yao Guang Xiang, 40 км к ЮВ от Ченжоу, Хунань (Ю), Китай \ Yaogangxian = Yao Guang Xiang, Yizhang Co., Chenzhou Prefecture, Hunan; 25╟35'N , 113╟15'E \\ : http://www.mindat.org/loc-4549.html \\ Ottens, B. and Cook, R.B. (2005): The Yaogangxian tungsten mine, Yizhang County, Chenzhou, Hunan Province, China. Rocks & Minerals 80(1), 46-57.

Яхимов (Jachymov) (= быв. Иоахимсталь\ Joachimsthal), Западно-Чешский край, Богемия, Чехия \\ http://www.mindat.org/loc-158151.html \\

см. также--СПРАВОЧНИК МЕСТОНАХОЖДЕНИЙ МИНЕРАЛОВ И РУД - http://mineral.nsu.ru/educat/article/7/

 

СТРАНЫ и РЕГИОНЫ

Находки минералов по всему миру. Подробнее: Евсеев А.А. Атлас мира для минералога. М., 2004. - 284 с. \\ Евсеев А.А. Атлас для минералога. Россия и бывший СССР . М., 2011. √ 248 с

СТРАНЫ от А до Я

находки минералов по листам карты мира: 1234567 891011121314151617181920212223242526272829303132 - 33

Викимапия \ Wikimapia (карты мира и России)

Сев. Америка (С)

Гренландия

Атлантика - Скандинавия - Кольский п-в

Урал
Ср. Сибирь
Якутия
СВ России

Сев. Америка (З - Сев. Америка (Кордильеры)

Сев. Америка (В)

Британ. о-ва, Пиренейский п-в - Зап. Европа - Вост. Европа

Казахстан, Ср. Азия

Юг Сибири
Забайкалье, Вост . Сибирь
Камчатка - Дальний Восток (Россия, Япония
Мексика
Кавказ, ЮЗ Азия
Афганистан, Пакистан
Индия
Монголия. Китай
ЮВ Азия - Тихий океан
Ю. Америка (СЗ) - Кордильеры
Бразилия

Африка - Сев. и Зап.Экв. и ЮжнВост.

Антарктида
Австралия

Тихий океан - Весь мир

Интересная подборка из 9 минералов региона получается если взять по одному из 9 его частей (центр, север, юг, запад, восток, СВ, ЮВ, ЮВ, СЗ)

Mineralienatlas - указатеь по странам - https://www.mineralienatlas.de/

Арктика

Земля Франца-Иосифа, Северный Ледовитый океан, Арктика; Архангельская обл., Россия \\ Карбонатные (?) конкреции!!--о. Чамп; кварц (халедон) по дереву! - о. Мак-Клинтока о.; сера!

Северный Ледовитый океан - карта

Новая Земля

Восточное полушарие

Евразия

Арагонит. Япония. Образец: Геолог. музей им. В.И. Вернадского. . 2. Эгирин. Восточный р-к, Коашва, Хибины, Кольский п-ов, Россия. Более 10 см. Образец : Музей геологии и минералогии им. И.В. Белькова Геологического института КНЦ РАН. 2012.09. Фото 1-2: ╘ А.А. Евсеев.

Россия и СССР

фотоконкурс 2015 г. - http://www.ntv.ru/novosti/1558667/

--Ферсман А. Е. Геохимия России. Петроград, 1922. Вып. 1. 214 с.

--Минералы СССР, т.1 "Самородные элементы"/ под ред. А.Е.Ферсмана (редактор тома Н.А.Смольянинов), Изд.АН СССР Москва-Ленинград. 1940 г. - 328 с., тир. 3000 экз.

--Геологические памятники природы России "Природное наследие России" . Авторы: Карпунин А.М. , Мамонов С.В. , Мироненко О.А. , Соколов А.Р. Главный редактор - Орлов В.П. \\ веб-публикация

Города России - на карте - http://town-map.ru/index.html

Реки России - сайт - http://vsereki.ru

Физическая карта России - http://town-map.ru/346093.html

Карта России на сайте К.И. Клопотова

Кристаллы России в экспозиции Минералогического музея им. А.Е. Ферсмана РАН (кристаллы 5 см и более на выставке "Кристаллы")

10 замечательных минералов России (экспресс-опрос провел А. Евсеев, на ответ давалось несколько минут. 1 октября- 9 ноября 2010 \\ 44 участника на 2010.11.09. \\ 111 чел. на 2011.03. 23. Самыми популярными минералами по числу голосов оказались кварц и малахит. Всего было названо более 200 минералов и цветных камней (2011.03.23)

Минералы России по числу ссылок (20 и более) в ╚Атласе мира для минералога╩

Новые минералы ( СССР и Россия) \\ Список всех новых минералов, открытых на территории быв. СССР с 1766 до первой половины 2006 г. содержит 714 достоверных ( valid ) минеральных видов √ см. Pekov I.V. New Minerals from Former Soviet Union Countries, 1998-2006 // Mineralogical Almanac, Vol. 11. Moscow, Mineralogical Almanac, 2007, 112 pp. (список - стр. 85-88)

Полезные ископаемые - Википедия

Разнообразие минералов - 2889 ; из них достоверные виды - 1796; новые виды - 614; местонахождения - \ localities - ; фото минер. - 5724; фото мест - 85 (на 2011.05.03) \\ Источник: http://www.mindat.org/loc-14409.html

Разнообразие минералов - 2067 ; из них достоверные виды - 1652; новые виды - 576; местонахождения - \ localities - ; фото минер. - 3322; фото мест - 67 (на 2009.01.28) \\ Источник: http://www.mindat.org/loc-14409.html

Основные структурно-минерагенические провинции цветных камней России - http://www.lavrovit.narod.ru/kamni/provincia.htm

Карта "Самые замечательные месторождения минералов в Союзе" (фрагмент). Источник: Ферсман А.Е. Занимательная минералогия. М. -Л.: "Детская литература", 1937. - 240 с. Объяснения к карте - см. стр. 235-238. Подробнее Коллекционные минералы из России - http://www.kristallemineralsrussia.com/

Кольский п-в и Карелия \\

Хибины и Ловозеро --карта (спутник)

Кольский п-в_фото минералов_Bernard - новая страница

-- В.В. Борисова, А.В. Волошин. Перечень минеральных видов Кольского полуострова. Изд. 4-е, испр. и доп. / √ Апатиты: К&М, 2010. √ 64 с

Минералы Кольского п-ва от A до Z \\ 1168 минералов; 835 минер. видов; 255 новых видов; фото минералов - 22181.(1-е - адамсит-(Y), 101- бахчисарайцевит и т.д.) \\ Источник: http://www.mindat.org/loc-2666.html (на 2014.06.19)

От Белого до Баренцева моря через Кольский полуостров.

Минералы Кольского п-ва от А до Я (по Борисовой В.В. и др., 2002 с доп.)

--Новые минералы---264 вида \\ Волошин А.В. , Пеков И.В., Борисова В.В. Минералы, впервые открытые в Кольском регионе: исторический обзор и статистические данные. - Минер. альманах. Т. 18, вып.2, 2013, с.107-123

--Кейвы \\ Кейвский рудный район - http://discoverkola.com/lovozero/

--Неблогорский р-к (заброшенный) \ фоторепортаж-- http://exploration51.net/archives/476

Карелия \\ http://mindat.ru/locathn/r_karel.htm \

- Атлас структур и текстур докембрийских вулканогенных пород Карелии \\ литература

Вост. Европа

Россия \\ 3086 минералов; 1959 минер. видов; 255 новых видов; фото минералов - 8561.(1-е - абрамовит, 101- Allochalcoselite и т.д.) \\ Источник: http://www.mindat.org/loc-14409.html (на 2014.06.19)

Местонахождения минералов России на сайте К.И. Клопотова

Европейская часть России

Архангельская обл.

КМА \\ Европ. часть России (север) \\

Тиман \\ Сев. Тиман--путешествия \\ путешествия-2009 \\ схема

Пейзаж. Печорская Пижма (средний Тиман). 2008 г. Фото: ╘ В. Мальцев. Источник: http://geo-art.ru/

Поволжье \\

--Царев метеорит,═Ленинский район,═Волгоградская область - webmineral.ru

Подмосковье, Россия и Москва

Центр Европ. части России

Юг России

Крым

--Тищенко А.И. Минералы Крыма. - Симферополь: Бизнес-Информ, 2015. 304 с., 72 с. цв. вкл.

Тамань

--Железный Рог, Таманский полуостров. Поездки клуба юных геологов (рук. В.В. Аристов), 2012 и 2014 гг.

Мыс Железный Рог, Таманский п-ов (ЮЗ), юг России. 2014.03.22. Фото: В. В. Аристов и клуб юных геологов (Москва)

Мыс Железный Рог, Таманский п-ов (ЮЗ), юг России. 2012.03.24 Фото: В. В. Аристов и клуб юных геологов (Москва).

Сев. Кавказ, Россия

--Садон м-ние, Сев. Осетия, Сев. Кавказ, Россия \\ арсенопирит--М-1-1, 312а; вольтцит--М-1-1, 207; гемиморфит--М-3-1, 623; гринокит!--ФМ; кнебелит!--М-3-1, 205, Вост. уч., шт ╧42--Радкевич, 1966л; мышьяк--М-1-1, 182, почковидный

Урал на сайте /www.mindat.org (на 2016.01.25) : минералов - 1057, твердых видов - 727 ; новых минер. видов (type locality) - 81

Сайт "Рудники Урала" - http://uralmines.ru

- пока не найдены (не описаны для Урала на 2014 г.) : сподумен, эвдиалит...:

--Знаменитые месторождения Урала. Ч.II Д.А. Клейменов, В.Г. Альбрехт, А.Г. Талалай, В.А. Коротеев и др. Издательство: "Уральский рабочий", 2007 г., С. 240 \\ Во второй книги из серии "Знаменитые месторождения Урала" приведены сведения об истории открытия, геологии и минералогии Высокогорского, Гороблагодатского, Медноруднянского, Саткинского, Соль-Илецкого, Учалинского, Узельгинского, Молодёжного, Таш-Тау, Яр-Бишкадакского месторождений

ПРИРОДНЫЕ ДОСТОПРИМЕЧАТЕЛЬНОСТИ УРАЛА - http://nashural.ru/mesta.htm

Рудники (и не только) Урала - фотогалереи \ видео "Планета Карабаш"

Пай-Хой

Пермский край, Россия \\ Геологические памятники - http://www.perm-kray.ru/index.htm

Полярный Урал, Россия \\ фото - http://polyarny.net/foto/

ПРИПОЛЯРНЫЙ УРАЛ \\ КЕММЕРИХ А. О. ═ПРИПОЛЯРНЫЙ ═УРАЛ. ПУТЕВОДИТЕЛЬ. ИЗДАТЕЛЬСТВО ╚ФИЗКУЛЬТУРА И СПОРТ╩. МОСКВА 1970 \ веб-публикация

СЕВЕРНЫЙ УРАЛ (6400'≈5845' с. ш.)

Блог Михаила Цыганко - http://zolotoy-kamen.ru

Пещера Старателей на реке Сосьва - читать

СРЕДНИЙ УРАЛ (5845' ≈ 5600' с.ш.

--Pekov, I. V., Yakubovich, O.V., Massa, W., Chukanov, N. V., Kononkova, N.N., Agakhanov, A. A. & Karpenko, V. Y. (2010): Londonite from the Urals, and new aspects of the crystal chemistry of the rhodizite-londonite series. Canadian Mineralogist. 48: 241-254

ЮЖНЫЙ УРАЛ (5600' ≈ 5100' с. ш.)

--Скиппенит из Кочкарского м-ния (Au) \\ Bindi L, Cipriani C (2004) The crystal structure of skippenite, Bi2Se2Te, from the Kochkar deposit, southern Urals, Russian Federation, The Canadian Mineralogist 42, 835-840

Колисниченко С.В.. Гиганты в мире минералов на Южном Урале (2009 г.):

Сайт "Минералы Челябинской области" - http://www.chelmineral.ru/ \\ местонахождения - http://www.chelmineral.ru/?page=deposits

Сибирь \ Сибирь в "Атласе мира для минералога". - Местонахождения минералов и примеры находок http://geo.web.ru/druza/L-AtE_Sib.htm \\

--Реутовский В.С. Полезные ископаемые Сибири. - СПб., 1905. - 874 с.: карта. Автор - инженер, редактор и издатель журнала "Вестник золотопромышленности и горного дела вообще" (Томск).

Дополнения к списку (Евсеев А.А. Минералогические находки. Краткий обзор. I. Сибирь. М., 2006. √ 157 с. )

Новые минералы*

Зап. Сибирь \\

Ср. Сибирь \\ Таймыр

Пейзаж. Плато Путорана. Фото: В. Мальцев. Источник: http://geo-art.ru/

Нижняя Тунгуска р.

Кристаллы гидроталькита на друзе кальцита. Рудногорское м-ние, Ангаро-Илимская группа, Ср. Сибирь. Поздняя послескарновая гидротермальная минерализация. Фото из статьи Спиридонов Э.М.,.Иванова П.В., Киров Г.И., Янакиева Д.Я. ПОСЛЕСКАРНОВЫЕ ГИДРОТЕРМАЛИТЫ РУДНОГОРСКОГО МЕСТОРОЖДЕНИЯ В ТРУБКЕ ВЗРЫВА БАЗАЛЬТОВ ТРАППОВОЙ ФОРМАЦИИ  (ЮГ СИБИРСКОЙ ПЛАТФОРМЫ)

Якутия 591 минералов; 459 минер. видов; 50 новых видов; фото минералов - 403 \ .591 entries listed. 459 valid minerals. 50 type localities (valid minerals). \\ http://www.mindat.org/loc-2644.html (на 2012.03.13)

Аугелит.Кестёр, Яно-Адычанский район, Якутия, Россия. "Друза кристаллов аугелита на висячем боку жеоды с осадком гидрослюды? и франколита" [на снимке образец повернут на 180╟--А.Е.]. Образец: Минер. музей им.А.Е. Ферсмана РАН. Коллекция В.И. Степанова ST 7442. Буц Б., 1967. Фото: ╘ А.А. Евсеев.

Бирюза в псевдоморфозе по амблигониту, арандизит по кестериту, кремовый крандаллит? Кестёр м-ние, Сев. Якутия, Россия. Образец: Минер. музей им.А.Е. Ферсмана РАН. Коллекция В.И. Степанова ST 7329. Иванов В.В., ЛАМГРЭ, 1956. Фото: ╘ А.А. Евсеев.\\ НМК-144

- Минералы Якутии - на сайте К.И. Клопотова

--Месторождения - http://www.atlas-yakutia.ru/depositmap.html

Алдан, Якутия \ Хабаровский край, Россия

СВ России

Магаданская обл.

--Хакимов АХ, Пацкевич Г.П. Особенности формирования Кедонского месторождения аметиста. // В кн. Драгоценные и цветные камни. М.: Наука. 1980. С. 247-253.

Чукотка, Россия (СВ)

--Андрианов А.В.═ Рудные месторождения Чаунского района. Сб. Геология и минералогия Чаунского района. Труды Горно-геол. упр. ГУСМП, т. 9, 1941.

Камчатка \ Корякия

--Озерновское м-ние, Камчатка \\ голдфилдит; петцит; хемусит! \\ V.A. Kovalenker, O.Yu. Plotinskaya (2005): Te and Se mineralogy of Ozernovskoe and Prasolovskoe epithermal gold deposits, Kuril √ Kamchatka volcanic belt. Geochemistry, Mineralogy and Petrology 43, 118-123. \\ http://www.geology.bas.bg/mineralogy/gmp_files/gmp43/Kovalenker.pdf

--Грановский═А.Г., Гуляева Г.Я. Хромшпинелиды,═Ветвейской═группы гипербазитовых массивов (Корякское нагорье) // Геология и═геофизика. 1981. - ╧ 6. - С.56-67.

--Геология═юга Корякского нагорья. М'.: Наука, 1987. - 168с

--Корякско-Камчатский регион новая-═платиноносная* провинция* России - С-Петербург, 2002. - 383с.

--Минералогия и генезис ╚шлиховой═платины╩ россыпных месторождений южной части Корякского нагорья (Россия) // Геология рудных месторождений. 2002. - ╧ 3. - С. 188-212
--Округин═A.B., Ким A.A. Топоминералогия платиноидов из россыпей восточной части Сибирской платформы // Редкие═самородные═металлы и интерметаллиды коренных и россыпных месторождений Якутии. ≈ Якутск, 1992.-С.77-102.

Курильские о-ва

Дальний Восток (Россия) литература по геологии и пол. ископ. (в алфавите авторов) - http://wiki.fegi.ru/index.php/Амур р.

--Новые и редкие минералы Дальнего Востока. - Владивосток: ДВО АН СССР, 1987. - 128 с.

Амурская обл., Россия \\

Приморье, Россия

Сахалин \\ фото - http://fotocult.ru/gallery/

Хабаровский край, и Еврейская АО, Россия \\

Юг Сибири

Алтай, Россия \ Казахстан

1. Стихтит. Казнахтинский хр., Горн. Алтай, Россия. "Гемма"(2011.09.10) 2. Диопсид ("виолан"). Балачихинское проявление, Кузн. Алатау, юг Сибири, Россия. Образец: ФМ (╧74048, Татаринов А.В., 1971). Фото 1-2: ╘ А.А. Евсеев \\ см. также - Кислов Е.В. Голубой диопсид Йоко-Довыренского массива // Минералогия месторож╜дений камнесамоцветного и поделочного сырья: Тез. докл. Годичного собр. Минерал, о-ва при РАН. - СПб., 1996. - С. 15-16

Бурятия

--Миронов А.Г.,Куликов А.А.,Золото Бурятии. Улан-Удэ, Изд. БНЦ СО РАН, 2000, 464 с. 

Горный Алтай

Восточная Сибирь

- --Аметист \\ Татаринов А.В. Минералы кремнезема и условия образования аметиста в скарново-магнетитовых полях юга Сибирской платформы. // В сб. Минералогия и генезис цветных камней Восточной Сибири. Новосибирск, Наука. 1983. С. 34-41.
--Сепиолит \\ Вахрушев В. А═Сепиолит из Рудногорского железорудного месторождения (Восточная Сибирь), √ Минералы и парагенезисы минералов горных пород и руд. Л.: Наука, 1979. С. 153-155.

--Малич═К.Н. Платиноиды клинопироксенит-дунитовых массивов Восточной Сибири. ≈ СПб.:═Пангея, 1999. ≈ 219с.

Горная Шория, географическая область, Сибирь (ЮЗ), Кемеровская обл., Россия

Енисейский кряж

 

1. Кукеит. Удерей м-ние, Енисейский кряж, Ср. Сибирь, Россия. (╧83145. Чвилева Г.Н., 1984).2. Лазулит. Кристалл [~3-4 см], вросший в пегматите. Тасеевское м-ние (участок IV, отвал старой шахты), [Енисейский кряж, Ср. Сибирь]. Коллекция В.И. Степанова ST 7437. Сбор 1956 г. Образец 1-2: Минер. музей им.А.Е. Ферсмана РАН. Фото 1-2: ╘ А.А. Евсеев.

Забайкалье, Россия \\ фото - http://www.crystallika.com.postman.ru/

Забайкалье_местонахождения

--ОПИСАНИЕ МЕСТОРОЖДЕНИЙ ЗАБАЙКАЛЬЯ [А.Е. Ферсман]

--Хапчеранга , Центр. Забайкалье \\ касситерит--М-2-2, 267рис, 270а; станнин--М-1, 361; флюори т--М-2-1, 24; энаргит--М-1, 411 \\ в ФМ (кол-во образцов в систем. колл.): антимонит--1; арсенопирит--5; вольфрамит-1; галенит--3; кальцит--3; касситерит!!--47 обр.; кварц--3; микроклин-1; пирит--2; пирротин-12; сфалерит--13; халькопирит--1; церуссит--2; \\ сокращения

--Хапчерангинский оловорудный р-н и м-ние \\ ═Геология оловорудных месторождений СССР. В двух томах. Гл. ред. С.Ф. Лугов. М.: Недра, 1986., т.2, в.1, с.407-409═

Цвизелит (красновато-коричневые зерна до 1,5 см) в кварцевом прожилке с альбитом, арсенопиритом? Этыка м-ние, Вост. Забайкалье, Россия. Образец: Минер. музей им.А.Е. Ферсмана РАН. Коллекция В.И. Степанова ST 7419. 1984 г. Фото: ╘ А.А. Евсеев.\\ НМК-144

 

--сайт "Цветные камни Трансбайкальского региона" - http://lavrovit.ru/?page_id=271

- Александровский Голец (U-Mo) рудопроявление,═верх. р. Читканда, Удоканский хр., Каларский район,═Забайкальский край,═СВ Забайкалье \\ браннерит; иригинит* ; молуранит \\ webmineral.ru

-- Эпштейн Г.Ю. О молибдатах урана-молураните и иригините // Записки ВМО, 1959, Ч. 88. Вып. 5, стр. 564-570

Иркутская обл. \\

--Ольхон о. - карта - http://www.olkhon.org/olkhon-map.htm

Кемеровская обл. и Горная Шория

Красноярский край \\ минеральные ресурсы - http://nature.krasn.ru/content.ph

Кузнецкий Алатау \\ ═

Прибайкалье \\

Саяны и Присаянье \\

Амблигонит. Малореченское пегматит. поле, Вост. Саян, Россия. Образец: Минер. музей им.А.Е. Ферсмана РАН. Коллекция В.И. Степанова ST 7283. ИМГРЭ. 1978 г. Фото: ╘ А.А. Евсеев.\\

Онотское месторождение талька, Вост. Саян \\ webmineral.ru

Сибирская платформа

--Ангаро-Илимские железорудные месторождения трапповой формации южной части Сибирской платформы. Москва: Госгеолтехиздат, 1960, 320 с.

--Вахрушев В. А, Воронцов А. Е. Минералогия и геохимия железорудных месторождений юга Сибирской платформы. Новосибирск: Наука, 1976, 189 с.

Тува.

--Бронзова Ю.М., Рождественская И.В., Франк-Каменецкая О.В., Кузнецова Л.Г., Золотарев А.А. Изоморфизм турмалинов из редкометальных пегматитов Сангиленского нагорья // Федоровская сессия 2006. Тезисы докладов международной научной конференции. СПб, 2006. 217 с.: ил.
--Кузнецова Л.Г., Сизых Ю.И. К вопросу о природе скаполита в редкометальных пегматитах Сангилена // Докл. Академии Наук. 2004. т. 395. ╧ 5. стр. 655-660.

--Кузнецова Л. Г., Золотарёв А. А., Франк-Каменецкая О. В., Рождественская И. В., Бронзова Ю. М., Спратт Дж., Эртль А. Химический состав и видовая принадлежность турмалинов из редкометальной пегматитовой жилы со скаполитом (Сангиленское нагорье,═Тува).√ ЗРМО, 2011. ч. 140, вып. 1, с. 102-116

Хакассия

Атлантика

Европа \\

--Зап. Европа_минералогические особенности (в фотографиях образцов от А до Я) -- Европа_крупные кристаллы \\ Европа _кристаллы_5 см \\ Европа_кристаллы _10 см \\

Средиземноморье_минералогические находки вдоль побережья

Европа (СЗ) \\

Исландия

Скандинавия \\

Норвегия

Альтхаузит (=алтхаузит). Сиренево-бурое зерно (4 см) со спайностью в стеатитовой породе с включениями ильменита. Overntjern Quarry, Overntjern, Modum, Buskerud, Norway. Образец: Минер. музей им.А.Е. Ферсмана РАН. Коллекция В.И. Степанова ST 7422. Обмен с Kristiansen R. (в этикетке "Cristensen R."), 1979. Фото: ╘ А.А. Евсеев.

--Альтаузит*- Tingelstadtjern Quarry*, Modum, Buskerud, Norway \ Raade, G. (1979) Althausite, a new mineral from Modum, Norway: Addendum. Lithos: 12: 288

--Новые минералы*, впервые описанные из Норвегии \\ Raade, G. (1996) Minerals originally described from Norway. Including notes on type material. Norsk Bergverksmuseum Skrift: 11: 104 pp. + plates 1-7.

Финляндия \\

--Laitakari, A. (1967): Suomen mineraalien hakemisto. Index of Finnish minerals with bibliography. Bulletin de la Commission ge?ologique de Finlande. No. 230. 842 p.

1. Сурьма. Роутакаллио к-р, Сейняйоки \ Routakallio Quarry, Seinajoki, Финляндия. Более 7 см. Образец: В.Г. Гришин. 2. Лабрадор. Иляма \ Ylamaa, 45км к ВСВ от г. Хамина \ Hamina, Финляндия. 6х9 см.. Образец: Мин. музей РГГРУ (Р-198, Казаков В.В. Дар: 2008). Фото 1-2: ╘ А.А. Евсеев.

1. Аллюодит (желтый до зелёного) в породе. Хунпалео, Финляндия. Образец: Минер. музей им.А.Е. Ферсмана РАН. Коллекция В.И. Степанова ST 7404. Поваренных А.С., 1971. Фото: ╘ А.А. Евсеев. 2. Вайриненит (вайрюненит). Viitaniemi pegmatite, Erajarvi area, Финляндия. Размер поля изображения 10 мм. Фото: Jyrki Autio. This image has been released to the public domain and may be used freely. Это изображение было передано в общественное достояние и может свободно использоваться. Источник: www.mindat.org \\ НМК-144

Тропа на карьер Хярксари \ Harksaari, Таммела, Финляндия. Фото: Jyrki Autio. This image has been released to the public domain and may be used freely. Это изображение было передано в общественное достояние и может свободно использоваться: Источник: http://www.mindat.org

Швеция

З а п. Е в р о п а

Британ. о-ва, Пиренейский п-в

Корнуолл, Англия

Испания

Австрия \\

Лазулит* с мусковитом. Криглах, Штирия, Австрия \ Krieglach*, Fischbacher Alpen, Styria.~6 см. Образец: Минер. музей им.А.Е. Ферсмана РАН. Коллекция В.И. Степанова ST 7439. Обмен с Минер. музеем ИГН Украинской ССР, 1976 г. Фото: ╘ А.А. Евсеев. \\ www.mindat.org \\ См. также лазулит из Hollgraben, Pfarrwerfen, Werfen, Salzburg, Austria - 7 фото на www.mindat.org/

Альпы \

Бавария , Германия \\ Баден-Вюртемберг, Германия

Балканский п-ов

Бельгия \\

Болгария \\ минералов - 428; мин. видов - 353; нов. видов - 8; фото минералов - 556 (на 2011.11.01) \\ Источник: http://www.mindat.org/loc-14255.html

Венгрия

Германия \\ фото минералов \\ http://www.mindat.org/rloc.php?loc=Germany \\ http://www.mindat.org/loc-14244.html)

Сев. Рейн-Вестфалия (Германия)

Италия \\ в миндат \\ \\ 2291 минералов \ entries listed. 1340 достоверных видов \valid minerals. 266 новых видов \ type localities (valid minerals). 5 type localities (others).(на 2011.07.30)

--Лацио \\ .Лигурия \\ Пьемонт, Сев. Италия \\

Тоскана

Карпаты

Македония \\

Польша \\

Румыния \\ Сербия \\

Словакия

Франция

--Mineralogie de la France by Eric Asselborn, 2013. 242 pages.

--Лодев \ Lodeve м-ние (U),═Herault,═Languedoc-Roussillon,═France \\ металодевит* ; новые виды--6; отенит* ; разнообразие - 118 мин. видов \\ www.mindat.orgr

--Deliens, M. et al. (1990). "Mineraux des gisements d'uranium du Lodevois." Ed. Association Francaise de Micromineralogie, 1-61.

Чехия \\

Швейцария \\

Вост. Европа \\

Белоруссия \\

Википедия

Прибалтика

Украина \

-- Местонахождения минералов Украины от А до Я

Украинский щит - геологические памятники - Google Maps

Волынь и СЗ Украина

Донбасс

Приазовье

Прикарпатье

Закарпатье

Молдавия

Евразия

Азия

Япония \\ http://www.petrovrareminerals.com/articles02.html \\ http://www.mindat.org/loc-14488.htm

Корейский п-ов

Казахстан и Средняя Азия Казахстан и Средняя Азия_А-Я_местонахождения минералов (на карте)

Казахстан

Восточный Казахстан

Средняя Азия \\

Киргизия \\

Беусит (красновато-коричневый) с синим вивианитом и мусковитом. Кыру-Булак, верх. р. Ляйляк, Туркестанский хр (С), Киргизия. Образец: Минер. музей им.А.Е. Ферсмана РАН. Коллекция В.И. Степанова ST 7412 ( Из первой коллекции В.И. Степанова, ╧112). Фото: ╘ А.А. Евсеев.\\ НМК-144

 

Таджикистан \\

--Шураб - http://www.turisten.ru/view/l-9626-шураб/

Памир \

Карамазар рудный район, Сев. Таджикистан: Адрасман (Adrasman) --Алтын-Топкан--Кансай --Кураминский хр --

----Чорух-Дайрон \\ Назаровская заявка, Могол-Тау--шеелит--ГГМ (быв. Мин. муз. МГРИ - ╧41962-41967; ;1971-41983╧)

Туркмения \\

Узбекистан \\

Бирюза в гипсе. Мелкие желвачки бирюзы и скопления до 8 мм в прозр. гипсе. Горизонт 675 м. Кальмакыр, Узбекистан. Образец: Минер. музей им.А.Е. Ферсмана РАН. Коллекция В.И. Степанова ST 7333. Кудаев Э.Ш., 1979.. Фото: ╘ А.А. Евсеев. \\ НМК-144

Кызылкум \\

Афганистан \ Afghanistan - http://www.mindat.org/

Пакистан

--Аквамарин - Пакистан--фото- www.mindat.org

Кавказ, ЮЗ Азия \

Азербайджан \\

Армения \\

Грузия \\

Израиль \\ Иордания \\ Палестина \\ Ирак \\

Иран \\

Лавендулан. Ярко-голубая корочка сферолитов лавендулана на карбонатной породе. Талмесси \ Talmessi, Иран. 9,5х6 см. Образец: Минер. музей им.А.Е. Ферсмана РАН. (Коллекция В.И. Степанова ST 7138. Обмен: Guillemin C., 1980. Музей Высшей горной школы, Париж) Фото: ╘ А.А. Евсеев \\ НМК-144

Йемен, Аравийский п-ов \\

Оман

--Gordon Stanger and Colin Neal (1984) A New Occurrence of Suolunite, from Oman. Mineralogical Magazine 48:143-146

Саудовская Аравия

Минералогические находки Аравийского п-ва и прилегающих территорий (примеры). Составил А. Евсеев, 2016. Подробнее: www.mindat.org

 

--Абхурит* - новый минерал \\ Matzko, J. J., Evans, H. T., Jr., Mrose, M. E. and Aruscavage, P. (1985) Abhurite, a new tin hydroxychloride mineral, and a comparative study with a synthetic basic tin chloride. Canadian Mineralogist. 23, 233-240

Сирия

Турция \\ минералы и местонахождения --см. http://www.mineralienatlas.de/ \\ Ryan C. W. Guide to the Known Minerals of Turkey. Ankara, 1960, 196 p.

Индия, Непал, Шри-Ланка

Индия - http://www.mindat.org/loc-16773.html

1. Монацит-(Ce). Кристалл неправильной формы. Pakkanadu, пров. Мадрас, Индия. 5 см. ST 7355 (Семёнов Е.И., 1970). 2. Тилазит (кристаллыдо 2,5 см в кварце). Jhabua Distr., Мадхья-Прадеш шт., Индия. (ST 7073, Семёнов Е.И., 1980). Образец 1-2: Минер. музей им.А.Е. Ферсмана РАН. Коллекция В.И. Степанова . Фото 1-2: ╘ А.А. Евсеев.

--Деллавентураит2004* - новый минерал из Каджлидонгри майн, Мадхъя-Прадеш, Индия \\ Tait, K.T., HAwthorne, F.C., Grice, J.D., Ottolini, L., Nayak, V.K. (2004) Dellaventuraite, NaNa2(MgMn 3+ 2 Ti 4+ Li)Si8O22O2, a new anhydrous amphibole from the Kajlidongri manganese mine, Jhabua District, Madhya Pradesh, India. American Mineralogist: 90: 304-309.

- Сподуменовые пегматиты--Хутти р-н, округ Райчур, Карнатака (1981л) \\ ЕК

--Югаваралит -- Малад, Мумбай (Бомбей), Индия--14фото-- www.mindat.org \\ Wise, W.S. (1978): Yugawaralite from Bombay, India. Mineralogical Record 9 (5): 296

--Каджлидонгри р-к - минералогия и генезис марганцевых руд \\ Nayak, V. K. (1966): Mineralogy and genesis of the manganese ores of Kajlidongri mine, district Jhabua, Madhya Pradesh, India. Economic Geology 61, 1280-1282; \\ голландит* - фото - www.mindat.org

Шри-Ланка

Минералогические находки Шри Ланки (примеры). Составил А. Евсеев, 2016.

Вост. Азия ( Китай и др.)

Китай \ China \\ www.mindat.org

- новые минералы, открытые в Китае - \\ de Fourestier, J. (2000): Mineral species first found in the People's Republic of China. Rocks & Minerals.
- Словарь географических названий Китая / [Сост. Я. А. Миропольский, Г. Е. Тихонова]. - М. : Наука, 1984-. - 22 см.
2. Т-Я. - М. : Наука, 1984. - [1], 471-848 с

--Хуньчуньит*(1992)--новый минерал золота--Хуньчунь р., Вост. Цзилинь [ = Гирин пров. \ Jilin [Kirin] \\ ЕК

--Ottens B. China: Mineralien, Fundstellen, Lagerstatten. Christian Weise Verlag. 2008, 552 pp.

Внутр. Монголия \\
Ганьсу пров. \\

Гуандун \\

Гуанси-Чжуанский автономный район \\ Гуйчжоу \\

Синьцзян-Уйгурский автономный район; Китай

Образец: Минер. музей им.А.Е. Ферсмана РАН. Коллекция В.И. Степанова ST 7284. Хвостова В.А., ЛАМГРЭ. Сбор 1954 г. Фото: ╘ А.А. Евсеев.\\ НМК-144

Сычуань, Китай \\

Тайвань

--Суолунит \\ Kung-Suan Ho et al (2009) The First occurrence of Suolonite in Taiwan. Coll and Res 22:1-13

Тибет \\

Фуцзянь, провинция

--Can Rao, Ru Cheng Wang, and Huan Hu (2011): Paragenetic assemblages of beryllium silicates and phosphates from the Nanping No. 31 granitic pegmatite dyke, Fujian province, southestern China. Canadian Mineralogist. 49, 1175-1187;

--Трифилин! \\ Rao, C., Wang, R. C., Hatert, F., & Baijot, M. (2014). Hydrothermal transformations of triphylite from the Nanping No. 31 pegmatite dyke, southeastern China. European Journal of Mineralogy, 26(1), 179-188.

Хайнань , Китай \\ Хубэй

Хунань, провинция, Китай - http://www.mindat.org/loc-705.html

Цзянси пров.

Цинхай \\ Цзянси пров. \\ Шаньси \\ Юньнань \ Yunnan \\ www.mindat.org

Юньнань

Флюорит_Китай и Монголия

Вьетнам \\

Индонезия - см. http://www.mineralienatlas.de/

- Cirotan mine (Au), Cikotok Gold Distr., Ява, Индонезия \\ инезит - Canadian Mineralogist 38: 1125-1136 (2000)

--Парсеттенсит; родонит; шеелит; ютенбогардтит др. \\ Marcoux, E., Milesi, J. P., Sohearto, S., & Rinawan, R. (1993). Noteworthy mineralogy of the Au-Ag-Sn-W (Bi) epithermal ore deposit of Cirotan, West Java, Indonesia. - The Canadian Mineralogist, 31(3), 727-744.

--Leroy, J. L., Hube, D., & Marcoux, E. (2000). Episodic deposition of Mn minerals in cockade breccia structures in three low-sulfidation epithermal deposits: A mineral stratigraphy and fluid-inclusion approach. - The Canadian Mineralogist, 38(5), 1125-1136.

Камбоджа \\ Лаос \\ Малайзия \\

Монголия

--Россовскиит* - новый минерал из Монголии - Bulgut pegmatite, Altai Mts, Hovd Aimag (Khovd Aimag), Mongolia \\ Konovalenko, S.I., Ananyev, S.A., Chukanov, N.V., Rastsvetaeva, R.K., Aksenov, S.M., Baeva, A.A., Gainov, R.R., Vagizov, F.G., Lopatin, O.N., Nebera, T.S. (2015): A new mineral species rossovskyite, (Fe3+,Ta)(Nb,Ti)O4: crystal chemistry and physical properties. Physics and Chemistry of Minerals, 42, 825-833

--Липовский Ю.О., Сережникова Э.Ф. Цветные камни (Монголия) // Геология Монгольской Народной Республики. ≈ М.: Недра, 1977. ≈ Т. 3. ≈ С. 599-621.

--Хух-Дель-Ула г.. к С от ж.-д. ст. Хара-Айрак\ [минералы пегматитов в собрании ФМ] : альбит; апатит; касситерит; лепидолит!!; топаз; турмалин! \\ ЕК

--Н. В. Владыкин, В. И. Коваленко, М. Д. Дорфман. Минералогические и геохимические особенности Хан-Богдинского массива щелочных гранитов : (МНР). - М.: Наука, 1981.- 136 с.

Мьянма (быв. Бирма) \\

Таиланд \\ Филиппины \\

ЮВ Азия

Африка

Алжир \\

Гвинея \\

--Одинит* \\ Bailey, S. W. (1988). Odinite, a new dioctahedral-trioctahedral Fe 3+-rich 1: 1 clay mineral. Clay Minerals, 23(3), 237-247.

--Румаит с острова Рума (о-ва Лос, Гвинея) - новый минеральный вид, связанный с довыренитом Biagioni, C., Bonaccorsi, E., Merlino, S., Parodi, G.C., Perchiazzi, N., Chevrier, V. & Bersani, D. (2010). Roumaite, (Ca,Na,)3(Ca,REE,Na)4(Nb,Ti)[Si2O7]2(OH)F3, from Rouma Island, Los Archipelago, Guinea: a new mineral species related to dovyrenite. Canadian Mineralogist, 48, 17-28. \\ www.mindat.org

На островах Лос (Гвинея).. Фото ╘ : М. Моисеев

Египет \\

--Целестин!! \\ Galmed, M. A. (2002). Origin and characteristics of Eocene celestite mineralization and associating diagenetic processes, Gabal Mokattam, East Cairo, Egypt. Egypt J Geol, 46(2), 703-722.

1. Ванадинит. Мибладен, Марокко. Кристаллы на мелкозернистом доломите.Образец: Минер. музей им.А.Е. Ферсмана РАН. Коллекция В.И. Степанова. ST 7230. Богуцкий И. 2. Целестин. Djebel Mokattam, Египет. Около 8 см. Образец: ФМ. Фото 1-2: ╘ А.А. Евсеев.\\ Другие фото целестина - www.mindat.org

Мали \\

--Currier, R. H., Pohl, D., (2011), Mineral Collecting in Mali, Mineralogical Record: 42(3): 231-250

Марокко

--Дельхайелит - Djebel Saghro (Jbel Saghro), Ouarzazate Province, Souss-Massa-Draa Region, Morocco \\ Berger, J., Ennih, N., Mercier, J. C., Liegeois, J. P., & Demaiffe, D. (2009). The role of fractional crystallization and late-stage peralkaline melt segregation in the mineralogical evolution of Cenozoic nephelinites/phonolites from Saghro (SE Morocco). Mineralogical magazine, 73(1), 59-82. \\ Источник: www.mindat.org

-- Steffen Jahn, Rainer Bode, Peter Lyckberg, Olaf Medenbach, Hans-Jurgen Lierl═u.a. Marokko (Morocco). 2003. - 536 pages ═

Нигерия \\

Сенегал

Тунис

Центрально-Африканская республика.(ЦАР)

Чад

--Rigobert, T., Claude, D. J., Marambaye, D., & Yannick, B. (2013). On the occurrence of gold mineralization in the Pala Neoproterozoic formations, South-Western Chad. Journal of African Earth Sciences. Volume 84, August 2013, Pages 36√46 \\ Goueigoudoum, Pala, Mayo-Kebbi Ouest Region, Chad (гессит, зигенит, золото, кавацулит и др) \\ Источник: www.mindat.org

Экв. и Южн. Африка

Ангола \\

Ботсвана

--Кудрявцеваит - новый минерал из кимберлитов Ботсваны \ AK-8 kimberlite pipe, Orapa, Central District, Botswana \\ Anashkin, S., Bovkun, A., Bindi, L., Garanin, V., & Litvin, Y. (2013). Kudryavtsevaite, Na3MgFe3+ Ti4O12, a new kimberlitic mineral. Mineralogical Magazine, 77(3), 327-334.

Габон

Замбия \ Zambia (ныне) = Сев. Родезия (быв.), Африка

Зимбабве

1. Вивианит. Фрагмент кристалла. Анлуа \ Anloua, близ Нгаундере, Камерун. Более 30 см. (╧64547, Guillemin C., 1962). 2.Херлбутит (= херлбатит = харлбутит). Гранд-Слэм \ Grand Slam, Зимбабве. ~3 см. (╧61521. Белов Н.В., 1960.). Вивианит. Фрагмент кристалла. Анлуа \ Anloua, близ Нгаундере, Камерун. Более 30 см. Образец 1-2: Мин. музей им.А.Е. Ферсмана РАН. Фото 1-2: ╘ А.А. Евсеев.

Камерун

Конго НР

Конго ДР (быв. Заир) \\ Buttgenbach H. Mineraux de Belgique et du Congo Belge. Liege, 1947, 590 p.

--Андремейерит - новый минерал \\ Sahama, T.G., Siivola, J. and P. Rehtijarvi, P. (1973): Andremeyerite, a new barium iron silicate from Nyiragongo, Zaire. Bull. Geol. Soc. Finland, 45, 1-8.;

--Andersen, T., Elburg, M. A., & Erambert, M. (2014). Extreme peralkalinity in delhayelite-and andremeyerite-bearing nephelinite from Nyiragongo volcano, East African Rift. Lithos, 206, 164-178.

--Lhoest, J.J., Gauthier, G.J. and King, V.T. (1991), Famous mineral localities: the Mashamba West Mine Shaba Zaire, Mineralogical Record: 22(1): 13-20, 28.

Корнетит. Темные зеленовато-синие корочки (до 1,5х1,5 см) блестящих кристаллов корнетита, обрастающие почковидным малахитом. Калаби р-к, Катанга (Шаба) \ Kalabi Mine, Katanga (Shaba), ДР Конго. Образец: Минер. музей им.А.Е. Ферсмана РАН. (Коллекция В.И. Степанова ST 7458. Guillemin C., 1980. Музей Высшей горной школы, Париж) Фото: ╘ А.А. Евсеев

 

Намибия \

Экв. Гвинея

ЮАР

--Диегогаттаит\ Diegogattaite* (2013) - новый минерал из р-ка Весселс \\ Rumsey, M. S., Welch, M. D., Kampf, A. R., & Spratt, J. (2013). Diegogattaite, Na2CaCu2Si8O20╥ H2O: a new nanoporous copper sheet silicate from Wessels Mine, Kalahari Manganese Fields, Republic of South Africa. Mineralogical Magazine, 77(8), 3155-3162.

--Лавинскиит* - новый минерал из р-ка Весселс -\\ Yang, H., Downs, R.T., Evans, S.H., Pinch, W.W. (2014): Lavinskyite, K(LiCu)Cu6(Si4O11)2(OH)4, isotypic with plancheite, a new mineral from the Wessels mine, Kalahari Manganese Fields, South Africa. American Mineralogist, 99, 525-530.

--Маршаллзусманит!! из р-ка Весселс - \\ Pohwat, P.W. (2014): Connoisseur's Choice: Marshallsussmanite, Wessels mine, Kalahari Manganese Field, Northern Cape Province, South Africa. Rocks & Minerals, 89(3), 258-260.

--Меренскиит -- Бушвельд к-с, ЮАР \ Cairncross, B. (2002). Merenskyite, type-mineral from the Bushveld Complex. Rocks & Minerals √ Special Issue on ⌠Minerals of Africa■, Vol. 77, 48-50.

--Сугилит - Весселс р-к [2-я находка в мире] \\ Dunn, P.J., Brummer, J.J. and Belsky, H. (1980). Sugilite, a second occurrence: Wessels Mine, Kalahari manganese field, Republic of South Africa. Canadian Mineralogist, 18, 37√39.

 

1. Сугилит.[Весселс р-к\ Wessels mine, Калахари, Сев. Капская пров.,] ЮАР. Образец: ФМ (╧87731. Обмен, 1990).2. Сурьма. Монарх р-к (Sb), Гравелотт, Лимпопо пров. \ Monarch Antimony mine, Gravelotte , Murchison Range , Limpopo Province , Ю. Африка. ~7 см. Образец: Мин. музей РГГРУ. 2012.01. Фото 1-2: ╘ А.А. Евсеев.

Минералы═ Южн. Африки в фотографиях на www.mindat.org. Выборка : более 100 фото на 2016.07. 08

373═ олмиит
361═ родохрозит
264═ флюорит═ (из них 220 - Riemvasmaak, Kakamas,  Northern Cape Province)
233═ эттрингит
204═ гематит
174═ стурманит
166 ═кальцит
152═ гаусманнит
146═ кварц
139═ аметист
132═ инезит
111 ═бултфонтейнит
103═ сугилит

1. Олмиит.═Н'Чванинг II р-к, Сев. Капская пров. ЮАР \ N'Chwaning II Mine, Cape Prov., S.Africa═. Образец: Геол. музей им. В.В. Ершова (МГГУ). 2. Родохрозит. Н'Чванинг I р-к, Сев. Капская пров. ЮАР \ N'Chwaning I Mine, Cape Prov., S.Africa. ~3 см. Образец: Мин. муз. им. А.Е. Ферсмана РАН. Фото 1-2: ╘ А.А. Евсеев.

Минералогические находки Южной Африки (примеры). Составил: А. Евсеев, 2016. Мессина--ахоит и папагоит в кварце!! \ Soutpansberg горы--корунд!!! \\ Палабора р-к, Phalaborwa-айоваит!; бадделеит!!!--xls<10 см--мд; магнетит!--xls; хондродит! \\ \\ Murchison Mine, Gravelotte--антимонит--ф--мд; сурьма!--2ф; пьемонтит; стихтит \\ Farm Tweefontein No. 1033--стибиопалладинит* \\ Potgietersrus (быв.)= Mokopane, Бушвельд -сперрилит!!--xl ~2 см--Брит.муз.--рис. \ mdt \\ Boekenhoutshoek area --аметист!!--123ф--мд--кактус.\\ Премьер р-к --алмаз "Куллинан" !!! \\ Бушвельд комплекс _запад. часть \\ Пиланесберг г.и щел. комплекс--эвдиалит-ф--мд; астрофиллит; лампрофиллит; ловенит; ильваит; кубанит; пентландит; содалит; торит--мд \\ Сокращения: ф - фото; мд - www.mindat.org; \\ Источник и подробнее: www.mindat.org

Вост. Африка \\

--Капустин═Ю.Л., Поляков А.И. Карбонатитовые═вулканы═Восточной Африки и генезис карбонатитов // Известия АН СССР, серия геологическая. 1985. ╧ 3. С. 30-43.

Бурунди \\

Кения

--Карбонатитовая дайка --Shombole, South Rift Valley, Rift Valley Province, Kenya--фото - www.mindat.org/photo

--Кремень, образовавшийся из гелей силиката натрия... \ "Laminated lakebed chert near the shore of Lake Magadi, Kenya. The chert originates as sodium silicate gels which crystallize to magadiite and similar minerals; these then dehydrate to chert. 1986 35mm transparency"--фото - www.mindat.org/photo

Минералогические находки Кении и прилегающих территорий (примеры). Составил: А. Евсеев, 2016. \\

Мадагаскар \\ 516 минералов и разновидностей, 323 достоверных видов, 12 новых видов \\ 516 entries listed. 323 valid minerals. 12 type localities (valid minerals) на 2012.10.13 .\\ http://www.mindat.org/loc-2247.html \\ лондонит!!; пеццоттаит* ; родицит!!; скиавинатоит \ schiavinatoite*

--Пеццоттаит - новый минерал из пегматитов Сакавалана \\ Hawthorne F. C., Cooper M. A., Simmons W. B., Falster S. U., Laurs B. M., Armbruster T., Rossman G. R., Peretti a., Gunter D., Cooper M. A., Grobety B. : (2004): Pezzottaite, Cs(Be2Li)Al2Si6O18, a spectacular new beryl-group mineral from the Sakavalana Pegmatite, Fianarantsoa Province, Madagascar. Mineralogical Record, 35: 369-378.═

--Титанит и другие минералы из жил альпийского типа на севере Мадагаскара \\ Pezzotta, F. (2005): Titanite e altri minerali in fessure di tipo "alpino" nel nord est del Madagascar. Rivista Mineralogical Italiana. 30 (2): 104-111

--Цаворит и другие гроссуляры из Итрафу \\ Adamo, I., Diella, V. & Pezzotta, F. (2012): Tsavorite and other Grossulars from Itrafo, Madagascar. Gems & Gemology. 48, 178-187

Малави \\

--Гарсон М.С. Карбонатиты Малави. Карбонатиты. М.: Мир, 1969. С. 50-86.

Мозамбик

Руанда \\ минералы - http://www.mindat.org/loc-21896.html \\ местонахождения - http://www.mindat.org/rloc.php?loc=Rwanda

--Ферророземариит* - новый минерал из пегматита Рубинди (Руанда) \\ Hatert, F., Lefevre, P., Fransolet, A.-M., Spirlet, M.-R., Rebbouh, L., Fontan, F., and Keller, P. (2005)Ferrorosemaryite, NaFe 2+ Fe 3+ Al(PO4)3, a new phosphate mineral from the Rubindi pegmatite, Rwanda. European Journal of Mineralogy: 17(5): 749-759

1. Гетерозит. Руанда [вероятно, Buranga pegmatite - А.Е.]. ~3х4 см. Образец: Минер. музей им.А.Е. Ферсмана РАН. Коллекция В.И. Степанова ST 7402. Обмен 1983 г. 2.Фосфосидерит. Светло-сиреневые мелкозернистые корочки на зернистом даллите?. Буранга м-ние, СЗ Руанда. Образец: Минер. музей им.А.Е. Ферсмана РАН. Коллекция В.И. Степанова ST 7304. Василевский И.А., 1974. Через Шмакина Б.М. Фото 1-2: ╘ А.А. Евсеев.

Минералогические находки Руанды (примеры). Составил : А. Евсеев, 2016. Источник и подробнее: www.mindat.org

Сомали

Судан

Лазулит. Вкрапления в гнейсовидном кварците с метаварисцитом?, аугелитом?, андалузит. Судан. Образец: Минер. музей им.А.Е. Ферсмана РАН. Коллекция В.И. Степанова ST 7436. Груздев В.С., 1974. Фото: ╘ А.А. Евсеев.\\ НМК-144

Танзания \\ http://www.mindat.org/loc-4384.html \\ м-н-ния - http://www.mindat.org/rloc

-- От Кольского до Танзании┘ и обратно

--═Зайцев═А.Н. Ньеререит из кальцитового═карбонатита═вулкана Керимаси, северная Танзания // Записки Всероссийского минералогического общества. 2009. Часть 138. ╧5. С. 63-77.

--Даусон Дж.Б. Олдоиньо-Ленгаи действующий═вулкан═с потоками лав натровых карбонатитов. Карбонатиты. М.: Мир, 1969. С. 169-181.

--Кианит оранжевый \\ Chadwick, K.M. & Rossman, G.R. (2009) Orange kyanite from Tanzania. Gems & Gemology 45, 146-147.

Mn-содержащий кианит.═Лолиондо, Танзания. Образцы: Тусон-шоу-2010. Фото: М.С. Алферова \\ Источник:═http://www.fmm.ru/novosti_tuson1.htm

Уганда

Эфиопия

--Кингстонит - новый минерал из Юбдо, Эфиопия \ Stanley, C.J., A.J. Criddle, J. Spratt, A.C. Roberts, J.T. Szymanski, M.D. Welch (2005): "Kingstonite, (Rh,Ir,Pt)3S4, a new mineral species from Yubdo, Ethiopia", Mineralogical Magazine: 69(4): 447-453. \\ www.mindat.org

--Минералы ЭПГ \\ Евстигнеева═Т.Л., Кудрявцев A.C., Рудашевский Н.С. Минералы элементов платиновой группы из═Юбдо═(Эфиопия): новые данные. // Минералогический журнал. 1998. - Т. 14. ≈ ╧1. - С.29-41
-- Благ. опал - добыча (видео) - Ethiopia opal miners...- www.youtube.com/ \\ Wegel Tena,Wollo-Ethiopia .Opal Rabbithole..Digging opals 2011--видео - www.youtube.com

Минералогические находки Эфиопии (примеры). Составил А. Евсеев, 2016. \\ Подробнее: www.mindat.org

Австралия \ Австралия и Новая Зеландия

Виктория \\

Западная Австралия \\

1. "Зебровый камень". Kununurra, Зап. Австралия. 2. Мукаит (яшма). Мука-[Стейшн] \ Mooka [Station], Kennedy Ranges near Gascoyne Junction, ~ 160 км к З от Карнарвон \ Carnarvon, Зап. Австралия. Образец 1-2: Музей Terra mineralia, Германия. Фото 1-2: ╘ Д. Тонкачеев


--Jacobson, M., Calderwood, M., Grguric, B.(2007): Pegmatites of Western Australia (2007)

Квинсленд \\

Новый Южный Уэльс \\

Северная территория \\

Апатит. Зеленоватые округлы кристаллы (до 1,5 мм) в кальцифире с форстеритом. Алис-Спрингс, Северная территория, Австралия. Образец: Минер. музей им.А.Е. Ферсмана РАН. (Коллекция В.И. Степанова ST 7476. Бородаев Ю., 1974. Сбор 1973 г.). Фото: ╘ А.А. Евсеев

 

--Тредголдит - Саут-Аллигатор-Вэлли - 2-ая находка в мире \\ Henry, D.A., Pogson, R.E. and Williams, P.A. (2005) Threadgoldite from the South Alligator Valley uranium field, Northern Territory, Australia: second world occurrence. - Australian Journal of Mineralogy, 11, 7-11

Тасмания

Южная Австралия \\

Новая Зеландия

Минералогические находки Новой Зеландии (примеры). Составил А. Евсеев. \\ сокращения: ф - фото; мд - www.mindat.org \\ Подробнее: www.mindat.org

Северный остров \\ Aranga Quarry (Stone's Quarry)--кавансит--6ф ; cowlesite-3ф-мд \\ Browns Island (Motukorea)--мотукореаит* \\ Маротото\ Marototo, к СВ от Paeroa--агвиларит--ФМ \\ Karangahake--диоптаз--mdt \\ Martha Mine (Waihi mine) --агвиларит; инезит-ф--мд \\ Mayor Island(Tuhua) -тухуалит* (Opo Bay +) \\ Уайт Айленд\ White Isl --сера!--Касаткин А., 2007 \\ Puhipuhi--ливингстонит \\ Lake Taupo, Wairakei --вайракит* \\ Sugar Loaves Islands, New Plymouth, Taranaki --таранакит*

Южный остров: Red Hill, Wairau Valley --аваруит; вайрауит*\ www.mindat.org/loc-61475.html \\ Dun Mountain, Nelson Cu-р-к -диоптаз--Railton, G.L.a.o., 1990; заратит; магнезиохромит--mindat \ дунит--впервые! отсюда \\ Marlborough---анальцим; баричит!; эрионит!--мд

Минералогические находки Южного острова Новой Зеландии (примеры). Составил А. Евсеев. \\ сокращения: ф - фото; мд - www.mindat.org \\ Подробнее: www.mindat.org

Red Hill, Wairau Valley --аваруит; вайрауит*\ www.mindat.org/loc-61475.html \\ East Nelson, Nelson--хромит!--4ф-мд \\Dun Mountain, Nelson Cu-р-к -диоптаз--Railton, G.L.a.o., 1990; заратит; магнезиохромит--мд \\ Marlborough--анальцим; баричит!; эрионит- mindat \\ Te Aroha Station, Hokitika-куммингтонит!-2ф--мд \\ Gillespie's Beach, Salt Water Creek-хаттонит* \\ Stew Point Station--ferroceladonite--3ф--мд \\ Kakanui North & South Heads-ввулкан. брекч. и пляжн. песке--ф--мд: пироп!; хром-диопсид!; шпинель \\ Моераки валуны The Moeraki Boulders - шаровид. конкреции! \\Watsons Beach, Otago--кумбсит*; кутногорит; парсеттенсит; родонит \\ Chrystalls Beach--таранакит*--2ф--мд \\ образовался по возд. гуано морских птиц на камни (вулк.? породы), леж. на берегу \\ Hokonui Hills- ферроалюминоселадонит*; ферроселадонит* \\ Dunite quarry, Greenhills--стихтит!--4ф--мд; титанит--ф \\ Orepuki--в аллюв.отл. платина--ф--мд

--Кумбсит*(1991) - новый минерал, ассоциирующий с парсеттенситом и кариопилитом из Отаго, Новая Зеландия \\ Sameshima T, Kawachi Y (1991) Coombsite, Mn analogue of zussmanite, and associated Mn-silicates, parsettensite and caryopilite, from southeast Otago, New Zealand, New Zealand Journal of Geology and Geophysics, 34, 329-335

Восточное полушарие

Ю ж н о е _ п о л у ш а р и е

З а п а д н о е _ п о л у ш а р и е

Северная Америка

Канада \\

--Ann P. Sabina. Rock and mineral collecting in Canada. Ottawa : Geological Survey of Canada, Dept. of Mines and Technical Surveys, 1964.\\ другие публикации -

-- Трейл Р. Дж. Каталог минералов Канады. \ Trail R. J. Catalogue of Canadian Minerals. Revised 1980. Geol. Surv. of Canada Paper 80-18, 1983, 483 p.

США \\ http://www.mineralienatlas.de/lexikon/index.php/USA

 

American Mineral Treasures [Сокровища минералов Америки]. 2008. - 368 p. \\ Подробнее: http://www.lithographie.org/bookshop/hc_american_mineral_treasures.htm \\ см. также http://geo.web.ru/druza/l-USA_AMT.htm

Топографическая минералогия ( литература о местонахождениях по штатам) \\ http://www.minsocam.org/

Сев. Америка (С)

Аляска

Гудньюс Бэй (Аляска) и соседние местонахождения минералов (примеры). Составил: А. Евсеев, 2016.

--Rosenblum, S., Carlson, R.R., Nishi, J.M., and Overstreet, W.C. (1986): Platinum-group elements in magnetic concentrates from the Goodnews Bay district, Alaska. US Geol. Surv. Bull. B1660, Reston, 38 pp.

\\ Нунавут

Северо-Западные территории \ North-West Territories, Канада

--Перовскит \\ Anton R. Chakhmouradian and Roger H. Mitchell (2001) Three compositional varieties of perovskite from kimberlites of the Lac de Gras Field (Northwest Territories, Canada). Mineralogical Magazine 65:133-148

Шпинель. Мак-Дональд о., Баффинова Земля, Нунавут, Канада \ MacDonald Island, Baffin Island, Nunavut, . 35х25х20 мм. Фото: Jyrki Autio. This image has been released to the public domain and may be used freely. Это изображение было передано в общественное достояние и может свободно использоваться.═ Источник: www.mindat.org \\

Юкон

Гренландия \\

- Petersen, O. V. & Johnsen, O. (2005): Mineral species first described from Greenland. Canadian Mineralogist, Special publication no. 8., 184p.

Сев. Америка (В)

Сев. Америка (В)_находки крупных кристаллов (10 см и более)

--WILSON, W.E. (1991) The Lake George antimony mine, New Brunswick. Mineralogical Record 22, 263-267.

Айова

Вермонт \\

Верхнее оз

Виргиния \\ Висконсин \\ Джорджия \\

Иллинойс

--Хардин округ, Иллинойс - главный район добычи флюорита в США (O`Donoghue, 1993)

--Goldstein, A. (1997): The Illinois-Kentucky Fluorite District. The Mineralogical Record: 28: 12.

1. Пирит (дисковидная конкреция). Спарта, округ Рандолф, Иллинойс, США 2. Флюорит. Annabel Lee mine, Hardin Co., Иллинойс, США. 8 см. ФМ (Обмен, 1991). Образцы 1-2: ФМ . Фото 1-2: ╘ А.А. Евсеев.

Витерит. Минерва ╧1 майн, близ Кейв-ин-Рок, округ Хардин, Иллинойс \ Minerva # I mine, near Cave in Rock, Hardin Co. , Illinois, USA Образец: Геолог. музей Колорадской горной школы \ Colorado School of Mines (Денвер, Колорадо). Фото: ╘ "Русские минералы"

Индиана, США \\ http://www.mindat.org/loc-16287.html \\ более 100 фото минералов из осадочных пород (доломит, миллерит!!; целестин!; флюорит! и др.) www.mindat.org/gallery

Квебек \\

Коннектикут

Лабрадор

Манитоба \

Амблигонит. Берник-Лейк, Манитоба, Канада. Образец: Минер. музей им.А.Е. Ферсмана РАН. Коллекция В.И. Степанова ST 7286. Семенов Е.И., 1968 . Фото: ╘ А.А. Евсеев.\\ НМК-144

Массачусетс \\

Миннесота \\

Миссури \\ Мичиган \\

Мэн \\

Новая Шотландия, Канада \\

Нью-Брансуик пров., Канада\ New Brunswick, Canada

Нью-Гэмпшир, США \\

Вольфеит (коричневое зерно со спайностью, 5х6 см) в серо-зеленом трифилине с включениями пирита, сфалерита, халькопирита. Палермо майн, Нью-Гэмпшир, США. Образец: Минер. музей им.А.Е. Ферсмана РАН. Коллекция В.И. Степанова ST 7423. Обмен с U.S. National museum (╧133069), 1977 г. Фото: ╘ А.А. Евсеев. \\ НМК-144

 

Нью-Джерси, США - http://www.mindat.org \\.

Нью-Йорк \\

--Местонахождения минералов указатель \\ George Robinson & Steven Chamberlain (2007) Gazetteer of major New York State mineral localities. Rocks & Minerals, 82, #6, 472-483.;

Онтарио\ Ontario, Канада \\

Пенсильвания, США - http://www.mindat.org/loc-14026.html \\

Сев. Каролина \\

--Corundum (Var: Ruby) : Al2O3, Actinolite (Var: Smaragdite) :

Теннесси \\ Флорида

Сев. Америка (З)

Айдахо, США \\

Альберта, Канада

Аризона, США \\ на странице http://www.mindat.org/loc-3293.html (на 2015.09.27) -- 1242 минерала (842 вида) из них - 82 новых мин. вида \\ для сравнения на 2008 г. - 887 минералов (690 видов). из них 46 новых видов \\ в сводке Anthony J.W. et al, 1995 --809 мнр. видов, из них 76 новых видов \\ Anthony, J.W., et al (1995), Mineralogy of Arizona, 3rd.ed.:

Вульфенит Аризоны

Арканзас, США

Вайоминг, США

Колорадо, \\ http://www.mindat.org/rloc

Монтана \\

- Gobla, M.J. (2012) Montana mineral locality index. Rocks & Minerals, 87, #3, 208-240.

Невада \\

Нью-Мексико, США \\

Оклахома \\ Саскачеван

Техас, США \\

Минералогические находки шт. Техас и соседних территорий (примеры). Составил А. Евсеев, 2016. Подробнее: www.mindat.org \\ Сокращения: ф - фото; мд - www.mindat.org \\ НМК-144

 

1. Артинит. Округ Сан-Бенито, Калифорния, США. Сферолиты до 3-4 см. (╧79076, Cisneros Sh., 1979). 2. Целестин. Пинакоидально-призматический толстостолбчатый кристалл. Бернет округ \ Burnet Co ., Техас, США. ~10 см. (К-4642. Дар: Smith A ., 1991). Образец 1-2: ФМ. Фото 1-2: ╘ А.А. Евсеев.

Южная Дакота, США \\ Юта, США \\

Сев. Америка (Кордильеры)

Британская Колумбия, Канада - http://www.mindat.org/loc-14311.html

--Нефрит!! \\ Dease Lake, Liard Mining Division, Брит. Колумбия, Канада --монолит весом 1300 кг (1,5х0,3 м)--фото - www.mindat.org

Вашингтон, США \\ Cannon, B. (1975): Minerals of Washington: 53.

Орегон

Калифорния, США \\ http://www.mindat.org/loc-3424.html \\ фото \\ Калифорния_минералы по контуру \\

- Долина Смерти, округ Иньо, Калифорния - рудники и месторождения \\ Evans, James R., G.C. Taylor, and J.S. Rapp (1976) Mines and mineral deposits in Death Valley National Monument. California Division Mines and Geology Special Report 125: 1-61: 28.

Гавайские о-ва \ Hawaii, Тихий океан; США \\

Мексика

Мексика - 9 минералов \\ Мексика_крупные кристаллы \\ Мексика_крупные кристаллы_5 с

Леграндит. Желтые прозрачные кристаллы леграндита (до 1 см) на смитсоните в пустотах лимонита. Охуэла р-к, Мапими, Дуранго, Мексика. Образец: Минер. музей им.А.Е. Ферсмана РАН. Коллекция В.И. Степанова ST 7161. Портилья Кеведо В., 1972. Фото: ╘ А.А. Евсеев.\\ НМК-144

Дворик. Гуанахуато, Мексика. Фото: В. Мальцев. Источник: http://geo-art.ru/

 

Центральная Америка

Куба

Минералогические находки о. Куба (примеры). Составил А. Евсеев, 2016 \\ Увеличить. \\ Подробнее: www.mindat.org

 

--Кубанит* - Barracanao (Baracoa), Moa-Baracoa District, Mayari-Baracoa Belt, Holguin Province, Cuba

--Pinar del Rio Province \\ аугелит!--ФМ (ST 7444); вавеллит!; (галлит!; германит - оба по Handbook of Mineralogy - www.mindat.org)

--Lazarenkov, V.G., Tikhomirov, I.N., Zhidkov, A.Y., and Talovina, I.V. (2005): Platinum Group Metals and Gold in Supergene Nickel Ores of the Moa and Nikaro Deposits (Cuba). Lithology and Mineral Resources 40(6), 521-527.

Аугелит (сферолиты) с зелеными сферолитами и бесцветными кристаллами вавеллита \ фторвавеллита. ~ 2-3 см. М-ние Иерро \ Hierro (Cu-колчеданное), Pinar del Rio, Куба. Образец: Минер. музей им.А.Е. Ферсмана РАН. Коллекция В.И. Степанова ST 7444. Фесенко Ю., [1971] г. Фото: ╘ А.А. Евсеев.

 

Южная Америка

Ю. Америка (СЗ)

Венесуэла \\

--Россиантонит* - новый минерал из пещер (Akopan-Dal Cin cave system, Chimanta Massif) \\ Galli, E., Brigatti, M.F., Malferrari, D., Sauro, F., De Waele, J. (2013): Rossiantonite, Al3(PO4)(SO4)2(OH)2(H2O)10∙4H2O, a new hydrated aluminum phosphate-sulfate mineral from Chimanta massif, Venezuela: Description and crystal structure. American Mineralogist, 98, 1906-1913.

-- Свеит - новый минерал из пещер \\ Cueva del Cerro Autana (Autana Cave),═Amazonas,═Venezuela \\ J.E.J. Martini, (1980) Sveite, a new mineral from Autana Cave, Territorio Federal Amazonas, Venezuela Trans. Geol. Soc. S. Africa, 83, 239-241.

Гайана \ Guyana (до 1966 г. - Британская Гвиана) \\

Колумбия \\

Эквадор

Минералогические находки Эквадора и Перу (примеры). Составил А. Евсеев, 2016. Подробнее: www.mindat.org

Аргентина. \\

Минералогия Аргентины - веб- публикация - http://ama.gl.fcen.uba.ar/index.php/publicaciones/

Умангит (лилово-черный) с халькоменитом (светло-голубой до синевато-зеленого) и церусситом (белый). Сьерра-де-Качеута, пров. Мендоса, Аргентина \.Sierra de Cacheuta, Province of Mendoza, Argentina. 5 x 3 x 2,5 см. Находка 1970-х гг. Образец и фото: Raul Jorge Tauber Larry. This image has been released to the public domain and may be used freely. Это изображение было передано в общественное достояние и может свободно использоваться. Источник: www.mindat.org

Боливия \\

--Petrov, A. & Sith B & C. (2001): A guide to Mineral Localities in Bolivia. Mineralogical Record. 32, 457-482

--Льяльягуа (Боливия) - знаменитое местонахождение минералов \\ Hyrsl, J. & A. Petrov (2006): Famous Mineral Localities: Llallagua, Bolivia. Mineralogical Record 37, 117-162.

Знаменитые минералогические находки Южной Америки. 1. Реальгар. Паломо р-к \ Palomo mine, Уанкавелика, Перу. Образец: Пеков И.В., 2008. Фото: ╘ А.А. Евсеев. 2. Паравоксит*, вавеллит. Сигло XX р-к, Льяльягуа, Потоси, Боливия \ Singlo XX Mine, Llallagua Distr., Potosi Dep., Bolivia. Образец: "Русские минералы". Фото и монтаж: А. Евсеев, 2016.

Перу \\

Сайт о минералах Перу на Facebook: https://www.facebook.com/MineralesPeruanos

Список минералов (A-Z)+ фото - http://www.mindat.org/locdetailed-5869.html

Чили \\

Бразилия \\ минералы -787 ; достоверные виды - 601 \ 620; новые виды - 51 \ 53; местонахождения \ localities - 843 \ 1008 ; фото минер. √ 5430 \ 6613; фото мест √ 74 \ 115 (на 2009.08.05 \ 2010.05.06) \\ Источник: http://www.mindat.org/loc-366.html \\ http://www.mindat.org/rloc.php?loc=Brazi

 

1. Горсейксит. Бразилия. Образец: ФМ (╧264. Дар: Г. Черник, 1916). Фото: ╘ А.А. Евсеев. 2. Гентгельвин (розовый) и криолит (коричневый). 31х30 мм. Мадейра плутон, Питинга р-к, Амазонас, Бразилия \ Madeira pluton, Pitinga mine, Presidente Figueiredo, Amazonas, Brazil. Photo and collection Fernando Brederodes. This image has been released to the public domain and may be used freely. Это изображение было передано в общественное достояние и может свободно использоваться.═ Источник: http://www.mindat.org/photo-649418.html \\ 33_30

Баия, Бразилия

Мату-Гросу шт.

Минас-Жерайс шт. \\ минералов - 713, из них твердых видов - 491, из них новых видов - 46 (на 2015.09. 30) \\ источник: http://www.mindat.org/

Бразилианит (кристалл 2,5х2,5 см), мусковит. Linopolis, Минас-Жерайс, Бразилия. ~3 см. Образец: Минер. музей им.А.Е. Ферсмана РАН. Коллекция В.И. Степанова ST 7425. Обмен с R.V. Gaines(США) Фото: ╘ А.А. Евсеев.

Лудламит (псевдоморфоза по трифилину), вивианит, сидерит. Fazenda Boa Vista, Galilea, Минас-Жерайс, Бразилия. ~5 см. Образец: Минер. музей им.А.Е. Ферсмана РАН. Коллекция В.И. Степанова ST 7397. Обмен с R.V. Gaines(США), 1978 г. . Фото: ╘ А.А. Евсеев. \\ Пометка В.И. Степанова на обороте этикетке: "Оч. хорошийобразец, оч. свежий, оч. ценный генетически" \\ см. минералы этого пегматита на www.mindat.org : Boa Vista pegmatite, Conselheiro Pena, Doce valley, Minas Gerais, Бразилия \ лудламит есть в списке, но нет фото.

Параиба

--Фторнатромикролит - новый минерал из Бразилии \\ Witzke, T., Steins, M., Doering, T., Schuckmann, W., Wegner, R., Pollmann, H. (2011): Fluornatromicrolite, (Na,Ca,Bi)2Ta2O6F, a new mineral from Quixaba, Paraiba, Brazil. Canadian Mineralogist, 49, 1105-1110.

Риу-Гранди-ду-Норти, Бразилия \\

--Robinson, G.W. & Wegner, R.R. (1998): Mineralogy of the Boqueiraozinho pegmatite, Parelhas, Rio Grande do Norte, Brazil. Mineralogical Record 29, 193-197.

Риу-Гранди-ду-Сул, Бразилия \\

Сан-Паулу

Парагвай \\ Уругвай

АНТАРКТИДА \\

Новые минералы:

Вокруг Антарктиды (прилегающие территории)_минералогические находки

Океаны

Тихий океан \\

Новая Гвинея о., Океания, Тихий океан; Индонезия \ Папуа - Новая Гвинея \\ второй по величине остров Земли (после Гренландии)

Новая Каледония -- геология и пол. ископаемые

Гавайские о-ва \ Hawaii, Тихий океан; США \\

--Обсидиан - "волосы Пеле" (нитевидные формы) --фото www.mindat.org
Фиджи, Тихий океан

Южное полушарие

Весь мир

Фото дня или "За месяц вокруг света" - 2014.11-12 - 2015. 01 - 2015. 02 - 2015. 03 - 2015. 04 - 2015. 05 - 2015.06 - 2015.07 - 2015.08 - 2015.09- 2015.10 - 2015.11 - - 2015.12 - 2016.01 - 2016.02 - 2016.03 - 2016.04 - 2016.05 - 2016.06

Фото дня. Июль 2016 г. Составил А Евсеев, 2016.

1. Боксит. М-ние "Красная шапочка", Сев. Урал, Россия. 2. Жадеит. Борус хр., Вост. Саян, Россия. 3. Гипс. Кугитангтау хр., Туркмения. 4. Альмандин. Вост. Индия. 5. Лабрадор и розовый кварц. Мадагаскар. 6. Стихтит (фиолетовый) в серпентините. Дундас, Тасмания, Австралия \\ Подробнее: см. Фото дня или "За месяц вокруг света". 2016.06.(фрагмент) Составил А. Евсеев.

Всемирная минералогия-32 - по одному минералу от региона

А.А. Евсеев. Минералогические находки вокруг света вдоль 40-ой параллели. - Минералогический альманах, т.13, 2008, с. 76-85.
\\ Краткий вариант статьи \\ Полный текст статьи \\ Фотогалерея \\

--Кристаллы пяти континентов_экспозиция в Минералогическом музее им. А.Е. Ферсмана РАН \\ текст

--Минералы- спутники на расстоянии (минералы-телеспутники)

--Журнал "Вокруг света" - http://www.vokrugsveta.ru/

--Институт географии РАН _Информационный портал

Путешествия за камнем

--Беус А. Путешествия в тропики за самоцветами. ≈ М.: Наука, 1992. ≈ 221 с

--Ферсман А.Е. "Путешествия за камнем" \\ читать

--В.А. Обручев. Мои путешествия по Сибири \\ читать

МИНЕРАЛЫ \

5 замечательных находок \ Европа - Азия - Африка - Австралия - Сев. Америка - Южн. Америка (выборка: по одному образцу из северной, южной, западной, восточной и центральной части каждого регион). Случайная выборка

Вторые находки минерала в мире, ставшие лучшими

"Сборные" минералов по странам и регионам (10-15 избранных находок) \\ 1-е -в 2007 г.

По 2 минерала от континента за 2 минуты (экспресс-опрос)

Ареалы находок минералов (основные находки ряда минералов, вынесенные на карту мира)

Кристаллы пяти континентов_выставка в Минералогическом музее им. А.Е. Ферсмана РАН

--Евсеев А.А. Географическая привязка первоначальных местонахождений минералов. \\ Новые данные о минералах. М.: ЭКОСТ, 2003. Вып. 38, с. 113-124.

--А.А. Евсеев. Минералогические находки вокруг света вдоль 40-ой параллели с. ш.

Океаны

Острова (от Гренландии до Мадагаскара) \ минералогические находки

Луна \\ минералогия - http://luna-mineralogiya.ru/index.html

АВТОРЫ \ \ А √ Л | М - Я | A - Z Анастасенко| | Г.П. Барсанов || И.В. Бельков || В.И. Вернадский || А.В. Волошин || В.И. Воробьев | Гиймен К. \ Guillemin C.| | А.А. Годовиков || Б.З. Кантор | К.И. Клопотов || Ю.С. Кобяшев || П.А. Кочубей | Крыжановский В.И. || А.Н. Лабунцов | М.Н. Малеев || В.А. Мальцев || Л.А.Паутов || И.В. Пеков || В.А. Пелепенко || В.В. Пономаренко | | В.А. Слётов | Э.М. Спиридонов | | В.И. Степанов | А.Е. Ферсман | А.П. Хомяков || Б.В. Чесноков || Н.В. Чуканов || Н.П. Юшкин и другие

Из публикаций: А - Б - В - Г - Д - ЕЁ - Ж - З - И - К - Л - М - Н - О - П - Р - С - Т - У - Ф - Х - Ц - Ч - ШЩ - ЭЮ - Я - AZ \\ A - B - C - D - E - F - G - H - I - J - K - L - M - N - O - P - Q - R - S - T - U - V - W - X - Y - Z

Бетехтин А.Г. Минералогия. ≈ М.: Государственное издательство геологической литературы, 1950. ≈ 956 c. \\ веб-публикация \\ Об авторе: Выдающийся российский геолог (к 100-летию со дня рождения А.Г. Бетехтина)═/ Н.═Лаверов, В.═Жариков, Н.═Ерёмин и═др.═// Вестник Московского университета. Серия 4. Геология. ≈ 1997. ≈ ╧═1. ≈ С.═69√71.

Смирнов В.И. Геология полезных ископаемых ≈ M.: ╚Недра╩, 1982. ≈ 669 c. \\ веб-публикация

Ферсман А.Е. Путешествия за камнем (веб-публикация) \\ http://lib.rus.ec/b/284737/read#r10 ; также http://prozaik.in/aleksandr-fersman-puteshestviya-za-kamnem.html?page=1

 

МИР КАМНЯ В ЛИЦАХ

Исследователи самоцветов Сибири - http://lavrovit.ru/?page_id=271

Фотографы минералов

Слева направо: Б. Кантор, О. Лопаткин, В. Мальцев, П. Мартынов, А. Свердлов, Дж. Сковил

Заблоцкий Е.М. Биографический словарь деятелей горной службы дореволюционной России --сетевая версия - http://russmin.narod.ru/dictionary.htm

lБиографии минералогов и коллекционеров -см. The Mineralogical Record Biographical Archive - http://www.minrec.org/labelarchive.asp

Биографии ученых Геовики

Коллекционеры и дилеры рассказывают ... \\ Хорди Фабре \ Jordi Fabre - www.youtube.com \\ Роб Лавински \ Rob Lavinsky (The Arkenstone)--Тусон-2014 - https://www.youtube.com/

 

Сотрудники Музея природы (Нижн. Тагил) и др. Слева направо: В.А. Попов, Л.А. Чешко, В.И. Попова, С.В. Бусыгин, А.Д. Радостев, М.Б. Лейбов, Н.Д. Чудинова, В.Ф. Старков, Н.И. Козин, Н.М. Федюнина.. Музей природы. Нижний Тагил, 2014.07.22 Фото: ╘ А.А. Евсеев

Николай Васильевич Владыкин (род. 1944 г.), геохимик и минералог. Научные интересы - геохимия и минералогия магматических пород. Исследователь Мурунского массива. Открыл новый минерал армстронгит в массиве Хан-Богдо (Монголия). Интервью с Н.В. Владыкиным - "Лунный камень Николая Владыкина" - читать

--"Я с детства геологией был увлечён. Зачитывался книгами Александра Ферсмана ╚Занимательная минералогия╩, ╚Занимательная геохимия╩, он много чего в Крыму описывал. Я сам из Крыма, в Симферополе жил до 18 лет. В седьмом классе сестра меня взяла с собой в поле на вулкан Кара-Даг. А в восьмом я уже сам выращивал кристаллы. Когда поступил в Ленинградский университет, там, в Питере, нас серьёзно ╚дрессировали╩. Нужно было на глаз определять 300√400 минералов. Первые 10 лет проработал по минералам редких металлов √ цирконий, ниобий, к примеру, искали. Это такое интересное дело.═"(из интервью Н.В. Владыкина)

Из публикаций

Владыкин Н.В. Минерально-геохимические особенности редкометальных гранитоидов Монголии / Отв. ред. В. И. Коваленко. Новосибирск: Наука Сиб. отд-ние, 1983. - 200 с.
Владыкин Н.В., Дорфман М.Д., Коваленко В.И. Минералогия, геохимия и генезис редкометальных топаз-лепидолит-альбитовых пегматитов Монгольской Народной Республики. // Тр. Минералогического музея им. А.Е. Ферсмана. М., 1974, Вып. 23. 6-49.
Минералогические и геохимические особенности Хан-Богдинского массива щелочных гранитов : (МНР) / Н. В. Владыкин, В. И. Коваленко, М. Д. Дорфман. М.: Наука, 1981.- 136 с.

Минералы Монголии. Коллективная монография. Издание Минералогического музея им. А.Е. Ферсмана РАН. М.: ЭКОСТ, 2006. - 352 с., 223 иллюстрации, 181 табл. \ Подробнее:═http://www.fmm.ru/reklama/mongolia.htm

Н. В. Владыкин перед докладом о Мурунском массиве в Минер. музее им. А.Е. Ферсмана. 2011.10. 27. Фото: А. Евсеев.

Антони Джозеф Мандарино \ Joseph Anthony Mandarino (1929-2007), американо-канадский минералог, бывший куратор отдела минералогии Королевского музея Онтарио (Торонто, Канада). В его честь назван минерал мандариноит \ mandarinoite.(www.mindat.org) \\ "American-Canadian mineralogist, former Curator of Mineralogy, Royal Ontario Museum, Toronto, Ontario. Источник: www.mindat.org

Алексей Владимирович Свердлов (1922.02.23 - 2010.07.26), профессиональный фотограф, работал в "Фотоиздате" ВДНХ, центральных газетах, а начиная с 1963 г. в течение 33 лет - фотокорреспондентом АПН, где особенно много приходилось снимать прикладное искусство, живопись (репродукционная съемка), позже - изделия из камня и минералы. С 1970 по 1990 гг у него вышло более 20 альбомов, в том числе в серии "Камни Урала" ("Агат", "Малахит", "Селенит"), альбомы по музеям - Уральскому геологическому, Нижнетагильскому краеведческому и др. Автор практически всех фотографий в четырех из 12 вышедших номеров журнала═"Мир камня"═(1993-1995 гг.). Подробнее: "Среди минералов"(альманах). М. , 1998, с.14-17 (интервью с А.В. Свердловым: "Сегодня я бы снял многое иначе")

А.В. Свердлов. На даче у М. Бахина. Раздоры, близ Москвы. 2006.07.02. Фото: ╘ А. Евсеев.═

ИЮЛЬ \ в тот день

Отряд В.И. Степанова на мысе Железный рог (Тамань, юг России). Слева направо: В. Степанов (в море), А. Ефимов, В. Москалев, Т. Матросова. 1977.07. Фото: А. Евсеев.

Анапаит на сидерите. Мыс Железный Рог, Таманский п-ов, юг России. Более 10 см. Образец: Минер. музей им.А.Е. Ферсмана РАН. Коллекция В.И. Степанова ST 7313. Сбор В.И. Степанова, 1977. Фото: ╘ А. Евсеев. Этикетка (полное описание)

 

О.К. Иванов (в центре) поздравляет Валентину Ивановну Попову с днем рождения. Институт минералогии. 2014.07.16. Фото: ╘ А.А. Евсеев.

21 июля 1935 г. родился Владимир Андреевич Пелепенко; его коллеция минералов √ одна из крупнейших собранных в России. В декабре 2000 г. в Екатеринбурге открылся Уральский минералогический музей В.А. Пелепенко. Особую ценность его собранию придают образцы сборов 1970-1990-х годов из знаменитых месторождений Казахстана (Акчетау, Кара-Оба, Джезказган), Средней Азии (Кадамджай, Хайдаркан), Урала (Изумрудные копи), Сибири (Норильский район) и Дальнего Востока (Дальнегорск).

Близ устья р. Шалашная, Пермский край. 2014.07.24. Фото: ╘ А.А. Евсеев.\\ Поездка по Уралу

 

29 июля 1993 г . - в Москве напечатан первый номер журнала "Мир камня", а чуть позже - журнал "К". Они стали первыми научно-популярными журналами в России, посвященными минералогии. На обложках первых номеров и в статьях - фотографии А.В. Свердлова. \\ Содержание журнала "Мир камня" ╧╧ 1-12 за 1993 √ 1997 гг.

 

 

В ТОТ ГОД...

17-18 век \\ Медвежий о. - самородное серебро \\ "История находок самородного серебра на о. Медвежьем описана в работах В. Рожкова, И. И. Гинсбурга, В. Новоченко, А. Токарева, Д. Белянкина и Б. Куплетского, Д. Белянкина, В. Влодавца и А. Шимпфа, Е. А. Салье, А. Е. Ферсмана, Э. П. Либмана, А. А. Кузина, А. Ф. Ушакова, Е. Эпштейна и дру╜гих, но наиболее интересные сведения опубликованы в статье М. М. Максимова. Основываясь на архивных материалах, М. М. Максимов ус╜тановил, что еще в 1669 г. добытое крестьянами-поморами серебро Медвежьего острова служило серебряникам Кирилло-Белозерского монастыря сырьем для изготовления крестов, чаш, подсвечников, голубей и другой утвари церковного культа. По-видимому, кустарная добыча и кустарное использование серебра в этом районе началось очень давно, а уже в 1671, 1673, 1676, 1680 гг. в район Белого моря из Москвы были направлены государственные экспедиции". (М.Г. Федотова) \\ Читать продолжение ...

1737 - "...крестьянин Антонов открыл на берегу Выгозера у истоков р. Выги жильное золото. Разработка этого меторождения велаь казной на Воицком руднике с 1742 г. до 1766 г. ... " (Бублейников, 1956, 66)

--азурит--ГМ; борнит!; золото--М-1-1, 39; молибденит--ГМ; халькопирит \\ ЕК

--Кулешевич Л.В., Лавров О.Б. История открытия и минералогия Воицкого рудника (Карелия) // Записки РМО. 2012. Часть 141, Вып. 5, стр. 59-67
--Кулешевич Л.В., Лавров О.Б. Рудник Воицкий √ Au-Cu-S-кварцевое месторождение в Северо-Выгозерской палеопротерозойской структуре Карелии // Геология и полезные ископаемые Карелии. Вып. 13. Петрозаводск: КарНЦ РАН, 2010. C. 116√130

--Майер Г. Воицкий рудник // Горный журнал. 1907. Т. 1, кн. 3. С. 277√281.═.

Самородное золото в кварц-карбонат-сульфидной жиле. Воицкий р-к, Карелия. Добыт не позднее 1783 г, Образец: Минер. музей им. А.Е. Ферсмана, ╧688. Фото: М. Моисеев \\ Источник и подробнее: http://webmineral.ru/

16 июля 1923 г. А. Н. Лабунцов и др. открывают на плато Расвумчорр (Хибины, Кольский п-ов) россыпи богатых апатитовых руд на площади 10 тыс. кв. метров. Это открытие во многом определило судьбу освоения будущего грандиозного месторождения в этом районе Кольского п-ова, ставшем рекордным в мире по числу новых видов.

1930-ые гг.

Группа сотрудников станции "Тиетта" на балконе. 1930-ые гг.Фотоархив Мин. музея им.А.Е. Ферсмана РАН.

1947

Триплит с гюбнеритом и тетраэдритом. Образец: Минер. музей им.А.Е. Ферсмана РАН. Коллекция В.И. Степанова ST 7418 (26.IV. 1948. От студента Л. Лебедева, сбор 1947 г. ). Фото: ╘ А.А. Евсеев

1976

Тиролит. Розетки чешуек тиролита (до 1 см) на породе. Запачица уч., гора Изремец, Врачанско, Болгария. Образец: Минер. музей им.А.Е. Ферсмана РАН. Коллекция В.И. Степанова ST 7155. Сбор: Степанов В.И., 1976 г. Фото: ╘ А.А. Евсеев \\ НМК-144

1990

Слева направо: Юрий Родионов, Владимир Пелепенко, Александр Немцов, Владимир Пивко, Юрий Кобяшев, 1990. Фото из книги Музей камня. Уральский минералогический музей В.А. Пелепенко. \ Автор-составитель Е.Ф. Тамплон. √ Екатеринбург: КВАДРАТ, 2010. √ 512 с.

1990.05

Группа минералогов (сотр. ГГМ им. В.И. Вернадского и др.) на м-нии ╧100, Индер, Сев. Прикаспий, Казахстан. 1990.05. Фото : А. Евсеев.

2012 г.

Клуб друзей минералогии (Москва) на выставке "Сокровища подземного царства" в Серпуховском историко-художественном музее (ул. Чехова, 87). 2012.04.08. Фото: ╘ А.А. Тирский

2016.05.19. В Музее изобразительных искусств Музейного комплекса им. И. Я. Словцова (Тюмень, ул. Орджоникидзе, 47) открылась выставка "Каменные сказы Дивногорья". На выставке представлены экспонаты из уникальной коллекции Уральского минералогического музея В. А. Пелепенко (Екатеринбург). \\ Источник: https://tumix.ru/news

2018 - "На Урале откроется первый в мире подземный музей минералов"

--"В 2018 году в Свердловской области откроется первый в мире подземный минералогический музей. Экспозиционный зал с естественным расположением уникальных минералов в горной породе будет находиться на территории Березовского рудника на 18-метровой глубине. Об этом рассказал руководитель Союза золотопромышленников региона Александр Ястребков.

Уникальный музей создается на базе крокоитового шурфа √ одного из пяти в мире месторождений редкого минерала крокоита. Помимо него, экспозицию музея составят еще несколько десятков уникальных минералов, обнаруженных уральскими геологами только в этом месте. Подземная экспозиция расположится на 100 квадратных метрах с гротами, ответвлениями и наглядными табличками". \\ Источник: http://nsn.fm/hots/

 

МИНЕРАЛОГИЧЕСКИЙ УНИВЕРСИТЕТ

 

КЛУБ ДРУЗЕЙ МИНЕРАЛОГИИ

⌠В ЗЕРКАЛЕ КАМНЯ■

Леонид Енгибаров

Сердце

(В Ереване)

К художнику пришла старость. Стало болеть сердце. И однажды он вышел из дома, поправил длинные пряди седых волос, и, прищурив на солнце глаза, пошел к своему другу-каменщику.

≈ Здравствуй, мастер, ≈ сказал художник, ≈ мы дружим с тобой много лет и мы многое знаем, ты ≈ о камне, я ≈ о человеческом сердце. Людские сердца ≈ разные. Бывают чистые, как горный хрусталь, бывают лучистые, как рубин, или твердые, как алмаз, или нежные, как малахит. Я знаю, есть и другие: пустые, как морская галька, или шершавые, как пемза. Скажи мне, мастер, из какого камня ≈ мое?..

Каменщик раскурил трубку и ответил:

≈ Твое сердце ≈ из туфа. Туф дает людям тепло, но он ранимый, мягкий, и все невзгоды жизни оставляют на нем свои следы. Туф ≈ это камень для тебя, для художника.

Они долго глядели на раскинувшийся перед ними прекрасный туфовый город, хранящий в себе сердца многих поколений его создателей ≈ каменщиков и художников.

ххх

Тихий пруд. Ивы опустили в воду уже желтые пряди, как на крышу черного рояля, и слушают тихие звуки осеннего парка.

Лодки, серые клавиши, выщерблены и погнуты┘

Сижу на берегу с пригоршней камней┘

За спиной раздается голос: ╚Никогда не понимал этого бесцельного занятия ≈ бросать камни пригоршнями. Если это так уж необходимо ≈ дождитесь зимы, притащите по льду мешок камней и высыпьте на середину. Весной все будет на дне╩.

Человек поднимает воротник и уходит. Он никогда не увидит ажурных кругов, идущих по воде от брошенного камня, нанизанных друг на друга, похожих на Эйфелеву башню с огнями по краям, которые зажигают на шальных волнах лучи уходящего солнца.

КЛОУН С ОСЕНЬЮ В СЕРДЦЕ \\ читать книгу

Юрий Панкратов

А свечка, свесившись с окна,
дрожит, как вспышка бриллианта,
и освещает край сукна
засаленного биллиарда...

НОЧНОЕ КАФЕ В АРЛЕ

ххх

Источник: http://www.voskres.ru/literature/critics/pankratova.htm

Виктор Соснора

После Петра мы видим результат:
все та же грязь, пожалуй, и похуже.
"Петр" переводим "камень", и как мне
на стул седла садиться плохо, Всадник,
на камне - Конь, и Камень - на коне,
и камня мне на камне не оставил...
ANNO IVA

"На что способен сей?" - все ж вопросил. "
Сей-час лежит",- ответил просто перс.
"Так запусти ему на драку барса,
пусть он - поступит!.." Дарий запустил.
Барс бросился; по правилам пирата;
ревел, как на раба; кусал клыком...
каменья кварца, восклицая воздух
в окружности на пятьдесят в шагах.
"Где бой? Где крови кружево? Где шкура
пятнистая?" - маячил Македонский.
"Пес, думается, спит. А барс боится",-
ответил Дарий... Барса увели.

БАЛЛАДА О ПСЕ АЛЕКСАНДРА МАКЕДОНСКОГО

Кристалл любви, кристалл надежды,
медаль ста солнц, метель ста вьюг!
Не удален и не удержан,
сам удалился и стою.

Стою над пропастью. Два грифа
летают. Море - в небесах.
О волны, кружевная гибель!-
вас не воспеть, не написать.

ххх

Кристалл любви, кристалл забвенья,
молитва колокольных лбов!
Над пропастью луна забрезжит,
клубится солнце, как любовь.

Стою с бокалом. И не брошусь.
Стою вне Вас, бокал - за Вас!
Я пью вино - златую бронзу,-
и счастлив мой глагол и глас!

Пой песню! В этом песнопенье
лишь голос горечи без нот.
Над нами тучи переспели,
дождь оживительный блеснет!

Стою. Блеснет да в пропасть канет
и сердца страх, и тишь в крови...
Кристалл времен, кристалл дыханья,
твердыня жизни и любви!

Источник: http://modernpoetry.ru/main/viktor-sosnora-izbrannoe

В. Соснора. Кристалл: Стихи. ≈ Л.: Советский писатель, 1977. ≈ 96 с.

В. Соснора. Камни NEGEREP. ≈ СПб.: Пушкинский фонд, 1999. ≈ 144 с.

В. Шекспир

 

КИНО_В зеркале камня

Людмила Чурсина

Знаете, бриллианты хороши не в куче, а когда они в единственном числе. Это в полной мере относится и к комплиментам. Кстати, я совершенно равнодушна к бриллиантам. Была в Якутии, на фабрике, где алмазы превращают в бриллианты. Завели меня в небольшую комнату, там стояли алюминиевые кастрюльки, в которых хранились бриллианты. Мне дали в руки полную кастрюлю с бриллиантами и разрешили в них запустить кисть руки. Верите, никаких эмоций. Ну, не прилипают ко мне бриллианты, меха и прочая роскошь. У меня в далекой молодости были единственные серьги с бриллиантами, но у меня такая подвижность рук, что я нечаянно вырвала серьги из ушей и больше никогда их туда не вдевала.

"Жизнь уже не течет, а убегает" \\ Источник: Российская газета - https://rg.ru/2016/07/20/ - читать

Людмила Чурсина≈единственная в мире актриса, в честь которой был назван новый минерал (чурсинит). Он был открыт на м-нии Хайдаркан(Васильев В.И. и др., 1984).

Василий Шукшин

-- Дедушка, как у вас называется вот такой камень? -- Девушка вынула из кармана жакета белый, с золотистым отливом камешек.
-- Какой? -- спросил старик, продолжая смотреть на горы.
Девушка протянула ему камень. Старик, не поворачиваясь, подставил ладонь.
-- Такой? -- спросил он, мельком глянув на камешек, и повертел его в сухих, скрюченных пальцах. -- Кремешок это. Это в войну, когда серянок не было, огонь из него добывали.
Девушку поразила странная догадка: ей показалось, что старик слепой. Она не нашлась сразу, о чем говорить, молчала, смотрела сбоку на старика. А он смотрел туда, где село солнце. Спокойно, задумчиво смотрел.
-- На... камешек-то, -сказал он и протянул девушке камень. -- Они еще не такие бывают. Бывают: весь белый, аж просвечивает, а снутри какие-то пятнушки. А бывают: яичко и яичко -- не отличишь. Бывают: на сорочье яичко похож -- с крапинками по бокам, а бывают, как у скворцов, -- синенькие, тоже с рябинкой с такой.

Солнце, старик и девушка

В купе, где студенты, слышно, запели под гитару нечто крикливое, бестолковое:

В трюмах кораллы и жемчуг;
Весел пиратский бриг.
Судно ведет с похмелья
Сам капитан-старик...

Печки-лавочки

В. Санаев, З. Гердт и С. Любшин в фильме "Печки-лавочки" \\ смотреть --www.youtube.com

\\ И. Анненский \\\ И. Бродский \\ И.А. Бунин \\ Ю.И. Визбор \\ М.А. Врубель \\ В.С. Высоцкий \\ П.А. Вяземский \\ И.-В. Гёте \\ И.А. Гончаров \\ \\ А.C. Пушкин \\ И. Северянин \\ Л. Толстой \\ А.П. Чехов \\ Агат \\ Алмаз \\ Апатит \\ Бирюза \\ Жемчуг \\ Опал \\ Топаз \\

СТРАНЫ от А до Я

находки минералов по листам карты мира: 1234567 891011121314151617181920212223242526272829303132 - 33

Минераландия

НЕ ТОЛЬКО МИНЕРАЛЫ: А - Б - В - Г - Д - Е - Ж - З - И - К - Л - М - Н - О - П - Р - С - Т - У - Ф - Х - Ц - Ч - ШЩ - Э - Ю - Я

местонахождения минералов - | - mineral localities : А Б В ГДЕ Ж З И Й К Л М Н О ПР С Т У Ф Х Ц ЧШ Щ Э Ю Я || A B C D E F G H I J K L M N O P R S T U V W X Y Z
Сев. Америка (С)

Гренландия

Атлантика - Скандинавия - Кольский п-в

Урал
Ср. Сибирь
Якутия
СВ России

Сев. Америка (З - Сев. Америка (Кордильеры)

Сев. Америка (В)

Британ. о-ва, Пиренейский п-в - Зап. Европа - Вост. Европа

Казахстан, Ср. Азия

Юг Сибири
Забайкалье, Вост . Сибирь
Камчатка - Дальний Восток (Россия, Япония
Мексика
Кавказ, ЮЗ Азия
Афганистан, Пакистан
Индия
Монголия. Китай
ЮВ Азия - Тихий океан
Ю. Америка (СЗ) - Кордильеры
Бразилия

Африка - Сев. и Зап.Экв. и ЮжнВост.

Антарктида
Австралия

Тихий океан - Весь мир

янв
фев
март
апр
май
июнь
июль
авг
сен
окт
нояб
дек
2004
2005
2006
2007
2008
2009
2010
2011
2012
2013
╧104 ╧112
2014 ╧114
2015
╧126 ╧131
2016
       
обновление: 2016. 07. 31

╘ Александр Евсеев, 2003 - 2016. ╘ Фото: принадлежит авторам, 2016