обновление: 2015. 02. 08

местонахождения А Б В ГДЕ Ж З И Й К Л М Н О ПР С Т У Ф Х Ц ЧШ Щ Э Ю Я || A B C D E F G H I J K L M N O P R S T U V W X Y Z \\ регионы мира: 1234567 891011121314151617181920212223242526272829303132 - 33 || Россия \ Европа \ Азия \ Африка \ Австралия \ Северная Америка \ Южная Америка \

ВСЕ КАМНИ МИРА125 - В ДВЕ СТРОКИ

или НОВЫЙ МИР КАМНЯ

ДЕКАБРЬ, 2014

 

Малахит (лучистый), азурит (кристаллы). . Каменушинское м-ние, Кемеровская обл., Россия. Более 20 см. Образец: К. Бердышева. "Гемма", 2014. 12. 06. Фото: ╘ А.А. Евсеев

 

МИНЕРАЛОГИЧЕСКИЙ УНИВЕРСИТЕТ

20 января 2015 г. Гаранин В.К. Алмазы и их месторождения в России

27 января. Сурков А.В. Просто песок

Занятия пройдут в Минер. музее им. А.Е. Ферсмана РАН (Ленинский пр., 18 кор.2. Тел. 8 (495) 954-39-00 . Начало 19 час.

Вход свободный

Внимание: Возможны некоторые измения тематики и места проведения занятий (смотрите здесь)

 

Страница находится в стадии заполнения

С 7 октября 2014 г. продолжил работу МИНЕРАЛОГИЧЕСКИЙ УНИВЕРСИТЕТ - цикл публичных лекций и практикум для всех, кого интересуют минералы и где их находят. Занятия будут проходить еженедельно по вторникам в течение года ви Минер. музее им. А.Е. Ферсмана РАН и Минер. музее МГРИ-РГГРУ . Начало 18.45. Вход свободный.

Подробнее о тематике и справки по тел.: 8 (495) 433-63-11 - Минер. музей МГРИ-РГГРУ (Должанская Татьяна Юрьевна) ; 8 (495) 954-18-59 - Минер. музей им. А.Е. Ферсмана РАН (Евсеев Александр Андреевич) . Внимание: Возможны некоторые измения тематики и места проведения занятий (смотрите здесь )

янв
фев
март
апр
май
июнь
июль
авг
сен
окт
нояб
дек
2004
2005
2006
2007
2008
2009
2010
2011
2012
2013
╧104 ╧112
2014 ╧114
2015
╧126                      

МИНЕРАЛЫ и не только на druza: А - Б - В - Г - Д - Е - Ж - З - И - К - Л - М - Н - О - П - Р - С - Т - У - Ф - Х - Ц - Ч - ШЩ - Э - Ю - Я \\ Алфавитный список минералов (на geo.web.ru/druza)

см.на www.mindat.org \ A-B-C-D-E-F-G-H-I-J-K-L-M-N-O-P-Q-R-S-T-U-V-W-X-Y-Z

Фото и монтаж: А. Евсеев.

 

Минералы от A до Z - список IMA (Международной минералогической ассоциации)- http://pubsites.uws.edu.au/ima-cnmnc/

Комиссия по новым минералам, номенклатуре и классификации - http://pubsites.uws.edu.au/ima-cnmnc/ \\ The Commission on New Minerals, Nomenclature and Classification (CNMNC) of the International Mineralogical Association (IMA) was formed in July 2006 by a merger between the Commission on New Minerals and Mineral Names (CNMMN) and the Commission on Classification of Minerals, at the request of both commissions

Алфавитный список_ минералы: от А до Я (на русском языке) - более 4000 минералов ( 4633 страницы категории "Минералы") на http://wiki.web.ru/wiki/ \\ http://webmineral.com/Alphabetical_Listing.shtml

Все минералы мира (от A до Z) \ All Minerals of the World / Tous les mineraux de la terre http://euromin.w3sites.net/mineraux/accueil.html

Алфавитный список_ минералы от A до Z (на английском языке) и фото минералов - http://www.mineralatlas.com/ \\ фото минералов - http://www.cs.cmu.edu/~adg/adg-home.html (на сайте Alan Guisewite ) Список минералов - http://en.wikipedia.org/wiki/List_of_minerals

А -

Авантюрин \\ Авгит

Агат

Агат. Сев. Тиман, Россия. Образец: В.В. Буканов. 7 см. 2014. 12. 11. Фото: ╘ А.А. Евсеев

Адамин \\ Азурит \\

 

Аквамарин \\

Слайд из лекции Э.М. Спиридонова "Группа берилла". Минералогический ун-т. Мин. музей им. А.Е. Ферсмана РАН.. 2014.11. 18. Фото: А. Евсеев.

Актинолит \\

Алмаз \\

--Урал. алмазы - библиография - http://uraloved.ru/geologiya/uralskie-almazi

 

Алтаит* ════ PbTe

Альбит \\ Альмандин

Амазонит \\ Вохменцев А. Я., Остроумов М. Н., ┘Попов В. А. и др. Амазонит. М.: Недра. 1989. √ 192 с.

Аметист \\ Анортоклаз \\ http://www.mindat.org/ \\ Аметрин \\ Андрадит \\ Анатаз

Ангидрит

Апатит-(CaF) \ Apatite-(CaF) - наиболее обычный (распространенный) минерал в группе апатита.

Апофиллит \\

Арагонит \\

Арагонит. Абаил м-ние, Ю. Казахстан. Образец: С. Голомолзов. Более 40 см. "Гемма", 2014. 12. 06 . Фото: ╘ А.А. Евсеев

Арсенопирит \\

--Hidalgo del Parral, Mun. de Hidalgo del Parral, Chihuahua, Mexico-- 20 фото --/www.mindat.org/

Арфведсонит \\\

Асбест \ асбестовидная форма выделения у различных минералов

 

Астрофиллит \\ Аурихальцит \\ Ахтарандит

Б -

Бабингтонит

Базы данных: http://www.mindat.org/ (на 2011.09.25)

Барит \\

--Фотогалерея образцов барита со всего мира (по странам и регионам) из частной коллекции Bill & Diana Dameron▓s barite suite. и др.-- http://www.baritespecimenlocalities.org/BariteHome.htm

Берилл \\

Бериллий_минералы \\ Библиография (популярные издания о камнях)- http://basik.ru/forum/index.php?showtopic=77

Биндгеймит = оксиплюмборомеит \ oxyplumboromeite (переименован в 2010 г.)

Биотит

Бирюза.

Бирюза. М-ние неизвестно. Фото: Д. Тонкачеев

 

Бор_минералогия и геохимия \\ Бразилианит

В -

Вавеллит

Ванадинит \\

Варисцит \\

Везувиан \\ Вивианит

Викимапия \ Wikimapia (карты мира и России)

Виллиомит \\ Висмут \\ Висмутин \\

Включения в минералах и драг. камнях \\

Вокеленит \\ Вольфрамит.

Вторая находка минерала в мире

ВУЛКАНЫ \ минералогические находки

Вульфенит \\


Вульфенит. Сортуз, Казахстан. Более 30 см. Образец: Минералогический музей МГРИ-РГГРУ. Фото: ╘ А.А. Евсеев.

Выставки минералов и поделочных камней

--└ЗАНИМАТЕЛЬНАЯ МИНЕРАЛОГИЯ■ В КАМНЕ ...Подробнее(pdf)

Г -

Галенит \\ Галит \\ Гарниерит \\ Гематит \\

Генезис минералов

--Попов В.А. Практическая генетическая минералогия. - Екатеринбург: УрО РАН, 2011.- 167 с.

Флюорит. Хурайское м-ние, Бурятия, юг Сибири, Россия. Образец справа более 8 см. Образцы: Д. Черепанов . "Гемма", 2014. 12. 06. Фото: ╘ А.А. Евсеев

Геовикипедия \ GeoWiki Всё о геологии - http://wiki.web.ru/

Гётит \\

Гигантские и крупные кристаллы (индивиды) \\ Ферсман А.Е. Кристаллы - гиганты. "Природа", ╧3-4, 1926 \\ Rickwood P. C. The largest crystals.

Карналлит. Верхнекамское м-ние, г. Березники, Пермский край, Россия. ~ 10 см. Образец: Мин. музей им.А.Е. Ферсмана РАН (╧94477. Дар: Чайковский И.И., 2014). Фото: ╘ А.А. Евсеев

Гипс \\

Горная энциклопедия - http://www.mining-enc.ru/ \\ http://dic.academic.ru/contents.nsf/enc_geolog/

Графит

Графит. Алиберовский р-к, Вост. Саян, Сред. Сибирь, Россия. Образец: Минер. муз. им. А.Е. Ферсмана РАН. Фото: ╘ А.А. Евсеев

Горный хрусталь \\

Гроссуляр

Д -

Данбурит \\ Датолит \\

Двойники \\ http://folk.ntnu.no/krill/mineralogee/8.htm \\

Кварц. Двойники по японскому закону. Слайд из лекции Э.М. Спиридонова "Кварц и иные минералы кремнезёма". Минералогический ун-т. Мин. музей им. А.Е. Ферсмана РАН.. 2014.10. 21. Фото: А. Евсеев.

Декоративный камень

Демантоид \\ Дендриты \\

Детский мир камня \\

Ира Гриценко достает кварц из "гнезда" - узкой щели, куда не смогли пролезть её родители. Заброшенное м-ние Перекатное (Алдан, Якутия). 2013 г. Фото: Ю. Гриценко

--Минералогический музей МГРИ-РГГРУ - день в гимназии ╧1306

--Геологическая школа МГУ -- О полевых практиках и экспедициях

--Школьный факультет РГГРУ - МГРИ

--Ферсман А. Е. Путешествия за камнем. М. 1960 (веб-публикация) :

--Ферсман А.Е. Занимательная минералогия (веб-публикация)

Диопсид

Доломит \\ Дравит \\

Драгоценные камни (д.к.)≈литература о них (по минералам): http://www.geol.msu.ru/departments/mineral/Rus/Edu/deposit_liter_r.htm \\ списки месторождений по минералам (сост. И.А. Бакшеев) - http://www.geol.msu.ru/departments/mineral/Rus/Edu/deposits_r.htm

--Горная энциклопедия - о д.к.

--Пыляев М. И. ╚Драгоценные камни, их свойства, местонахождения и употребление╩ \\ http://www.vadim-blin.narod.ru/book/titl.htm \\ указатель (быстрый поиск по ключевым словам) - http://www.vadim-blin.narod.ru/book/glossary.html

Драгоценные камни (самоцветы)_география находок

Дымчатый кварц

Дюмортьерит

Дюмортьерит (синий) в мелкозернистом топазе и др. Урей, Забайкалье, Россия. Около 5 см. Образец: Д. Черепанов . "Гемма", 2014. 12. 06. Фото: ╘ А.А. Евсеев

Е -Ж -

Жадеит

Живопись в камне

Журналы для минералогов и коллекционеров \\ The Mineralogical Record, \\ Rocks & Minerals \\ Le Regne Mineral \\ Mineraux et Fossiles \\ Lapis \\ Mineralien Welt \\ Rivista Mineralogica Italiana \\ Revista de Minerales \\ MineralUp\\ Bocamina \\ UK Journal of Mines and Minerals

З -

Закономерные срастания

Заратит--см. фото выше

Золото

Страницы из книги А.В. Суркова Сурков А.В. Атлас форм самородного золота [золотин]. Часть I. М., 2000. Минер. музей МГРИ-РГГРУ.

 

И -

Изумруд \\

Слайд из лекции Э.М. Спиридонова "Группа берилла". Минералогический ун-т. Мин. музей им. А.Е. Ферсмана РАН.. 2014.11. 18. Фото: А. Евсеев.

Ильваит \\ Ильменит \\

Индивиды и агрегаты \\ Годовиков А.А., Степанов В.И. Формы нахождения минералов. М. 2003. \\

Инструмент

Иранит \\ в фотографиях на сайте www.mindat.org/ \\ Иран (12), США (12--Аризона и Невада), Чили

Искусственные кристаллы \ минералы

Исландски шпат (

История минералогии ( находки, открытия и др..)

К -

Календари с минералами

Кальцит

Камень в городе

Атланты. Санкт-Петербург. 2014. 12.11. Фото: ╘ А.А. Евсеев

Камень в доме

Чашки "с минералами" Мин. муз. МГРИ-РГГРУ, 2014. 12. 26. Фото: ╘ А.А. Евсеев.

Камералка минералога

Карбонаты

Карта мира - http://maps-of-world.ru/inter.htm \\ http://geography_atlas.academic.ru/

Картирование, минералогическое

Карты \\ http://www.marshruty.ru/ \\ http://wikimapia.org/country/ \\ http://www.openstreetmap.org/ \\ http://ru.wikipedia.org/wiki/OpenStreetMap-- Карты мира, стран и городов - http://planetolog.ru/ \\ http://mapper.infomine.com/ \\ http://www.veslo.ru/maps.html

--http://wikimapia.org/

--карта мира и минералы (фото) - http://fotki.yandex.ru/users/ilm/map/view/recent

Касситерит \\

Каталоги минералогических коллекций

--Каталог минералогической коллекции Центрального Сибирского геологического музея. Составили: В.И. Синяков и М.М. Федосеева. - Новосибирск, 1978. - 218 с.

--Минералогическая коллекция Горного института императрицы Екатерины II. [Каталог]. Составил А.Э. Купффер. С.-Петербург, 1911. - 575 с.

Кварц \\ публикации - http://www.quartzpage.de/info_lit.html -- Экспресс-опрос -2011 (кварц) (на ответ давалось 2-3 мин. )

--Кварц по странам мира - http://www.mindat.org/mesg-95-139699.html

Кварц скрученный (начальная стадия). Актас м-ние, Центр. Казахстан. Более 15 см. Образец: Мин. музей им.А.Е. Ферсмана РАН (Коллекция В.И. Степанова, ST 6751. Банщикова И., 1968). Фото: ╘ А.А. Евсеев

Кварц с включениями

Кварц_ "хрустальные журавли" \\ Соболев М. Хрустальные журавли. - Журнал "К", 1993, ╧0, с..50.

Кварц_японские двойники_фотогалерея mindat.org

Кианит

--Хизоварское м-ние--http://www.granitoao.ru/

Киноварь \\

Клиноптилолит \\ Клинохлор \\

Книги для минералогов и коллекционеров

--http://www.crystalclassicsminerals.com/books.php

Книжная полка минералога и коллекционера

Коллекционирование минералов

Степанов В.И. Шкала качества образцов (разработана им в 1970-ые гг.)

Колумбит \\

Конкреции \\ Остров Чампа, Земля Франца-Иосифа и другие места - http://nnm.me/blogs/thread1/myachi-bogov/

Кораллы \\ Кордиерит \\

Корунд \\ сайт, посвященный корунду - http://www.corunduminium.com/index1.html

Кремень \\

Кристаллы и сростки

Кристобалит

Кристобалит. Кристобалит сайт, Томас Рейндж, Юта, США. Образец: Мин. музей им.А.Е. Ферсмана РАН (Дар: Белаковский Д.И.). Фото: ╘ А.А. Евсеев

Кунцит \\

Кунцит. Лавра-ду-Урукум, Галилея, Минас-Жерайс, Бразилия. Слайд из лекции Э.М. Спиридонова "Самоцветы гранитных пегматитов". Минералогический ун-т. Мин. музей им. А.Е. Ферсмана РАН.. 2014.12. 09.

Куприт

Л -

Лабрадор \\ Лазулит \\ Лазурит \\ Лампрофиллит \\ Леграндит \\

Лепидолит \\

1. Лепидолит. Калбинский хр., ЮЗ Алтай, Казахстан. 2. Поделочный лепидолит Бикиты (Зимбабве). Слайд из лекции Э.М. Спиридонова "Самоцветы гранитных пегматитов". Минералогический ун-т. Мин. музей им. А.Е. Ферсмана РАН.. 2014.12. 09.

Лёд \\ http://www.mindat.org/min-2001.html \\ фотогалерея

Лёллингит \\

Линарит \\ Линарес*, Испания (mindat.org )

--Еремеев П.В. Кристаллы линарита с Урала и Алтая // Зап. Минерал. общ-ва. 1884. Ч. 19. С. 15 (Березовское м-ние - первая находка на Урале).

Линарит (синие кристаллы до 1,5 см). Кень-Чоку, Казахстан. Образец: Минералогический музей МГРИ-РГГРУ, ╧1068. Фото: ╘ А.А. Евсеев.

Литература о минералах и драгоценных камнях \\ Из публикаций о минералах зарубежных стран \\ Из публикаций о минералах России, а также СССР

Литература по геологии в бибиотеке ДВГИ ДВО РАН. \\ http://wiki.fegi.ru/index.php/

Ломонтит \\ Лоренценит

Любители камня

Люминесцирующие (флюоресцирующие минералы) - тема выставки выставки Минер. музея им.А.Е. Ферсмана РАН

М -

Магнетит \\

Малахит

Малахит. Камбове р-к \ Kambove mine, Катанга, ДР Конго. Образец: Мин. музей им.А.Е. Ферсмана РАН (╧93181. Дар: Белаковский Д.И., 2010.). Фото: ╘ А.А. Евсеев

Марказит

Марки \\ минералы на марках - Minerals on Stamps

Медь и минералы меди

Месторождения

Метахьюэттит

Метахьюэттит из Сред. Азии. На этом материале Ф. Готорном (F. Hawthorne) расшифрована кристаллическая структура минерала. Обнаружен сотрудниками Минер. муз. им. А.Е. Ферсмана РАН. Слайд из доклада Л.А. Паутова и др. 2014.12. 18. \\ 33_14--метах

 

Метеориты \\ Кулик Л.А. О метеоритах, Вестник знания 1940, ╧7-8, с.39-42 \\

Микроклин

Миметезит

Миндат.орг\ www.mindat.org - - крупнейшая база данных о минералах и местонахождениях. Её основатель - Джолиан Ральф \ Jolian Ralf . Минералогический альманах \ Mineralogical Almanac (Россия \ Russia) \ http://www.minbook.com/mineralogical_almanac_ru.htmlМинералогия_для студентов (фото минералов и рисунки кристаллов)- http://geoserv.krc.karelia.ru/geo/rus/ht

Минералогический альманах -

Минералогия

--Бетехтин А.Г. 'Курс минералогии' - Москва: Государственное издательство геологической литературы, 1951 - с.543 --веб-публикация

Минералы (справочник) -------

--Силикаты√справочник ═краткий указатель - http://geo.web.ru/druza/m-miner_A-Ya_sil.htm

--Минералы. Справочник. Том 3. Выпуск 1. Силикаты с одиночными и сдвоенными кремнекислородными тетраэдрами. Содержание

Минералы - спутники на расстоянии \\ Евсеев А.А. Минералы - спутники на расстоянии (2): Отдельные статьи Горного информационно-аналитического бюллетеня. - ╧12. - М.: Издательство "Горная книга", 2009. - 35 с.

Митридатит \\

Мозаика \\

Морденит

Мрамор \\ Мраморный оникс

М у з е и

Россия

--Серпухов, Московская обл. - Серпуховский геолого-минералогический музей \\ в октябре 2014 г. впервые у музея появился свой сайт - http://www.минералмузей.рф/. \\ Адрес музея: 142200 г. Серпухов, Московской обл., ул. Чехова, д.8/7, а/я 13. \\ Телефоны: 8 (4967) 72-48-45, +7 (903) 259-02-43. Эл. почта kamnirus@ya.ru, kamninet@mail.ru

Украина

--Минералогические коллекции Украины [музеи] - http://d290351.u72.ukrhosting.com/subpage38.html

--"Первый частный минералогический музей в Киеве" (2004 г.). \\ Минерал. альманах, 2009, т.14, в.3, с.46-51. \\ В его экспозиции более 2000 образцов (около 500 минеральных видов) со всего мира. "...создан на средства члена-корреспондента Национальной академии наук профессора Станислава Алексеевича Довгого и торжественно открыт 23 июля 2004 года...". "Проблемы региональной минералогии освещены в витрине "Сто минералов Украины", на которой представлены минералы, играющие существенную роль в экономике Украины" (В.И. Павлишин).

Н -

Названия и привязка местонахождений минералов

--Географические названия России (в том числе, месторождений полезных ископаемых) - http://russia.yaxy.ru/subdmn/russia/geo-nm.html

Названия минералов ---Имена минералов. Как их называют Леенсон И.А. (╚Химия и Жизнь╩, 2012, ╧1) \\ веб-публикации: \\ Имена минералов. Как их называют январь╧1 \\ Кто открыл, кто синтезировал? - февраль╧2 \\ Петрологи, геологи, минералоги, кристаллографы - март╧3 \\ Химики, физхимики и один математик - апрель ╧4 \\ Еще немного химиков и физхимиков - ╧5 \\ Космонавты, коллекционеры, поэты - ╧6

Афмит \ Afmite \\ назван в честь Французской Ассоциации Микроминералогии \ Association Francaise de Micromineralogie (AFM)\\ http://www.mindat.org

Натролит

Натюрморт с камнем

Недра - http://www.rosnedra.com/

Нефрит

Новое на сайте (по декабрь 2012)

Новые книги и публикации

Евсеев А.А. Минералогические находки. Краткий обзор. III. Восточная Европа (республики быв. СССР). М.: 2014, 326 с.

В алфавитном порядке приводится краткий список минералов Восточной Европы (республик быв. СССР) - более 1500 названий, включая разновидности. Для каждого даны примеры наиболее интересных находок, сделанных за большой исторический период, что позволяет показать минералогическое своеобразие и разнообразие этой части континента. Большое внимание уделено географии проявлений минералов, авторам образцов. Даны многочисленные ссылки на источники более полной информации √ справочники, публикации, собрания музеев, веб-страницы с фотографиями минералов и др. (сайт автора - http://geo.web.ru/druza/ и др.).
Обзор рассчитан на минералогов и геологов, интересующихся региональной и всемирной минералогией, студентов, сотрудников музеев, минералогов-любителей и коллекционеров
.

Колисниченко С.В., Попов В.А., Епанчинцев С.Г., Кузнецов А.М. Все ═минералы Южного Урала. Минералы Челябинской области. ═Энциклопедия уральского камня. - Челябинск: Изд-во "Санарка"; 2014. - 624 с.: ═1600 ил..

Новинки!

Новые минералы--обзор за февраль-май 2012 г. - http://www.mindat.org/forum.php

Новые поступления в Мин.муз. им. А.Е. Ферсмана РАН

О -

Облицовочные камни \\ Обсидиан

Одноимённые местонахождения \ Одноименные географические названия

Окаменелое дерево \\ Окенит \\ Окно (камень у окна) \\ Опал

Определение (диагностика) минералов

Ортоклаз

Открытки с камнем

П -

Первая находка минерала в быв. СССР и России

Пегматиты

Переименования (географических названий)

Песок и минералы россыпей \\ Петалит

Пирит!! \\

Пирит. [Джеганас река, Усть-Джегутинский район, Карачаево-Черкесия], Сев. Кавказ, Россия. Образцы: В. Левицкий. Фото: ╘ А.А. Евсеев

 

Пироморфит \\

Пироп \\ http://www.mindat.org/min-3321.html \\ фото (27) - http://www.mindat.org/gallery.php?min=3321 \\

Поделочные камни

Полевые шпаты \\ Поллуцит

Породообразующие минералы

Пренит - http://www.mindat.org/min-3277.html \\ фото (1002) - http://www.mindat.org/gallery.php?min=3277 - на 2009.05.27

Псевдомалахит

Псевдоморфозы \\ фотогалерея - http://www.mineralatlas.com/specials/pseudo.htm

Публикации

--The Mineral News, 2004-2007 \\ Указатель публикаций по авторам \ местонахождениям \ минералам

Р -

Разнообразие минералов Софийский симпозиум

Региональная минералогия (заметки)

Р-коллекция \\ В феврале 2008 г. в Минералогическом музее РГГРУ (Москва) были записаны первые образцы в новую тематическую коллекцию "Региональная и всемирная минералогия" (сокращенно - Р-коллекция).

Реальгар

Резной камень \\

 

Рисунок и живопись в камне \\ http://www.minrec.org/artmuseum.asp

1. Живопись в камне. Авторская работа А.Н. Коробкова. 2. Близ вершины г. Пайкс-Пик (Колорадо, США). . Фото и монтаж: А. Евсеев.

Родонит \\

Родохрозит \\

Розелит

Ртуть \\

Рубин

Слайд из лекции Э.М. Спиридонова "Корунд". Минералогический ун-т. Мин. музей им. А.Е. Ферсмана РАН.. 2014.12. 02.

Рутил

С -

Сапфир

Корунд - сапфир из щелочных базальтов. Беллерберг, Эйфель, Германия. Слайд из лекции Э.М. Спиридонова "Корунд". Минералогический ун-т. Мин. музей им. А.Е. Ферсмана РАН.. 2014.12. 02.

Звёздчатый сапфир с тончайшими иглами распада рутила. Шри-Ланка и Мадагаскар. Слайд из лекции Э.М. Спиридонова "Корунд". Минералогический ун-т. Мин. музей им. А.Е. Ферсмана РАН.. 2014.12. 02. \\ НМК-125

 

Сапфирин \\"Сборные" минералов по странам и регионам (10-15 избранных находок) \\ 1-е -в 2007 г .

Селадонит

Селенит (разн. гипса) \\ Сера \\ Серандит \\ Серебро \\ silver - mindat --фото (1189), местонахождения (3716) -- на 2009.11.15

Серпентин \\

Сидерит

Силикаты от А-Я_краткий указатель к справочнику "Минералы"(том.III-V)

Силлиманит \\

Симметрия в геологии, минералогии и не только

Синтетические кристаллы

Скаполит

Скипетровидные кристаллы (в том числе обратные скипетры аметиста \ reverse sceptre из Боливии ( Esperanza Mine, near Bombori, Nor Potosi Province, Potosi Department))--фотогалерея--http://www.mineralatlas.com/specials/sceptres.htm \\ http://www.mindat.org/ \\ http://www.mindat.org/photo-284819.html

Сколецит

Словари

--Кривовичев В.Г. Минералогический словарь.- СПб.: Изд-во С.-Петерб. ун-та, 2008. - 556 с. --СЛОВАРЬ МИНЕР. ВИДОВ - веб (В.Г. Кривовичев. Словарь минеральных видов. СПб, 2006)

--ГЕОЛОГИЧЕСКИЙ СЛОВАРЬ (включает раздел "МИНЕРАЛОГИЯ")

Содалит \\

Спессартин

 

Сперрилит.

Список минералов - http://en.wikipedia.org/wiki/List_of_minerals

Сподумен

Справочник "Минералы"_краткий указатель к томам IV-V

Справочники

Ссылки: http://www.insminerals2005.narod.ru/

Ставролит

Сталактиты и псевдосталактиты

Станнин

Стеллерит. Стибиотанталит

Суйсеки (камни для созерцания) √ это камни причудливой формы, которую им придала вода в естественных условиях \\ Подробнее: http://a-stones.net/mMain.aspx?ChapterID=37 \\

Сульфиды

Сфалерит \\

Сферокристаллы --см. http://geo.web.ru/db/msg.html?mid=1179562. \\ Сферокристаллические сферолиты - http://geo.web.ru/db/msg.html?mid=1175869

Сферолиты

Кварц (агрегат свободных сферолитов). 6,5х 6 см. Близ устья р.Тембенчи, прит. р. Ниж. Тунгуска, Ср.Сибирь. (коллекция В.И. Степанова. ST6726). Фото: ╘ А.А. Евсеев

 

Т -

Танзанит

Танзанит. Трихроичный кристалл. Слайд из лекции Э.М. Спиридонова "Кордиерит, эпидот, танзанит и др.". Минералогический ун-т. 2014.12.16. Фото: А. Евсеев

 

Танталит

Теллуриды и другие минералы теллура \\

Типоморфизм

Титанит \\

Титанит (двойник) Водораздельное м-ние, Прип. Урал, Россия. Образец: В. Буканов. 2014. Фото: ╘ А.А. Евсеев

 

Тодорокит \\ Томсонит \\ Топаз \\

Топонимика (интересная для минералога) \\ Мурзаев Э.М. Словарь народных географических терминов. М.: Мысль, 1984. - 654 с. - электронная версия

Торбернит \\ Торий_минералы_ география находок \\

Тремолит \\ Турмалин (группа) \\

У -

Улексит \\ Уранинит

Ф -

Фаялит \\ Фенакит \\ Флогопит \\

Флюорит

1. Флюорит на кварце. Хуанганг р-к \ Huanggang Mine (Huanggangliang Mine), Внутр. Монголия, Китай. Высота более 15 см. "Гемма", 2014. 12. 06 Фото: ╘ А.А. Евсеев 2. Флюорит. Огранка (195 карат). Бербес, Испания. Образец: Don B. Veigel, 2010. Фото: Д. Тонкачеев.

Формы выделения минералов

Геликтит кальцита (Хайдаркан, Киргизия) и проволочное серебро (Конгсберг, Норвегия). Фото и монтаж: А. Евсеев

Фото дня или на geo.web.ru/druza/ - "Вокруг света за 30 дней"

Фото дня на миндат.орг_ретроспектива - http://www.mindat.org/gallery.php?potd=1

Фото мест по всему миру - http://www.panoramio.com/map/

Фотоатлас минералов -- http://tw.strahlen.org/fotoatlas.html (834 minerals, 1148 photos)

Фотогалереи минералов - минералы от A до Z и число их фотографий - указатель для миндат.орг - http://www.mindat.org/photoindex.php--http://www.mineralatlas.com/ \\ http://kristallov.net/index.html \

Фотосъёмка минералов \\ \\ http://klopotow.narod.ru/soveti/foto.html

Фторапатит

Х -

Халцедон \\ http://www.mindat.org/min-960.html ; фото (541) - http://www.mindat.org/gallery.php?min=960 \\

Халькопирит \\

Хризолит \\ Хромит

Хромфиллит

Ц -

Цвета минералов

Цветные камни \\

--Буканов В.В. Энциклопедия "Цветные камни" - официальный сайт

Цветные камни

Целестин

Цеолиты \\ Циркон

Цитрин

Ч -

Чароит \\ Чароит. Сиреневое чудо Сибири. Иллюстрированное научно-популярное издание. - Иркутск6 изд-во "Петрографика", 2011. - 192 с. (авторы текстов: Рогова В.П., Воробьев Е.И. и др.)

ШЩ -

Шеелит

Шерл. \\ Шорломит \\

Шпинель

Щелочные массивы \\ XXV Всероссийский семинар с участием стран СНГ. Геохимия магматических пород. 23-26 мая 2008 г. Школа Щелочной магматизм Земли   \\ http://alkaline2008.narod.ru/ \\ Тезисы - http://alkaline2008.narod.ru/Abstract.htm

Э -

Эвдиалит \\

Эгирин \\ местонахождения (595) - http://www.mindat.org/min-31.html \\ фото (169) - http://www.mindat.org/gallery.php?min=31 (на 2009.03.22) \\

Экскурсии_ минералогические экскурсии. \\ В Гос. геол. музей им. ВИ. Вернадского

Эльбаит \\

Эльбаит (полихромные кристаллы), лепидолит (розовый). Педернейра р-к \ Pederneira mine, Минас-Жерайс, Бразилия. Образец: Геологический музей, Лозанна, Швейцария. Фото: Д. Тонкачеев.

Эпидот \\

Ю -

Я

Янтарь \\ Ярмарки минералов и драгоценных камней \\ Ярозит \\ Яшма

ЯШМА В РОССИИ [по А.Е. Ферсману] - http://pictoris.ru/5/27/index.html

ОПИСАНИЕ РУССКИХ ЯШМ [по А.Е. Ферсману] - http://pictoris.ru/5/29/index.html

 

Фото и монтаж: А. Евсеев.

МЕСТОНАХОЖДЕНИЯ МИНЕРАЛОВ

Местонахождения минералов \ mineral localities на сайте и на страницах справочника Евсеев А.А. Географические названия в минералогии. Краткий указатель. Ч. I, М. , 2000. - 269 с.; Ч. II, М. , 2000. - 282 с.
Часть I и II (выборочно)
:

м-н-ния
А
Б
В
Г
Д
Е
Ж
:З
И
Й
К
Л
М
Н
О
П
Р
С
Т
У
Ф
Х
Ц
Ч
Ш
Щ
Э
Ю
Я
стр.
10-
26-
45-
54
-
63-
73-
75-
77-
81-
87-
88-
122-
132-
151-
160-
166-
180-
188-
213-
226-
234-
239-
247-
249-
255-
260
260-
265-
267-
Locality
A
B
C
D
E
F
G
H
I
J
K
L
M
N
O
P
Q
R
S
T
U
V
W
X
Y
Z
cтр.
9-
24-
44-
63-
71-
78-
86-
97-
108-
113-
118-
135-
148-
173-
181-
188-
203
204-
214-
243-
257-
260-
268-
275-
276-
278-

См. также http://www.mining-enc.ru

А

Адун-Чолон (= Адун-Чилон), Вост. Забайкалье , Россия

Айфель = Эйфель \ Eifel горы (палеовулкан), Рейнланд-Пфальц, Германия \ Eifel, Rheinland-Pfalz, Deutschland

Акчатау \ Akchatau, Ц. Казахстан \\

Аллуайв, Ловозеро, Кольский п-ов, Россия. \\ 67╟51?48.62? с. ш. 34╟30?16.25? в. д.

Альмаден, Испания

Арендаль, Ю. Норвегия.

Астафьевское м-ние, Ю. Урал, Россия\\ http://www.mindat.org/loc-192610.html

Ахалцихе (р-н), Грузия

Ахматовская копь, Ю. Урал, Россия

Б - местонахождения минералов

Баженовское м-ние , г. Асбест, 60 км к СВВ от Екатеринбурга, Ср. Урал, РФ

Белореченское м-ние, 70 км к Ю от Майкопа, Сев. Кавказ, Россия \\ Levitskii V.V. Journey to the Belorechenskoye Deposit. Mineralogical Almanac, vol. 13c, 2008 , p. 62-71

Березовское золоторудное месторождение, Средний Урал, Россия

--ЕРЕМЕЕВ, П. В. Кристаллы блеклой медной руды из Березовского рудника на Урале / П. В. Еремеев. - СПб., 1885. - 6 с.

Борон, округ Керн, Калифорния, США

Брокен-Хилл (быв.) = Кабве (ныне) р-к, Центральная пров., Замбия \ Kabwe Mine (Broken Hill Mine), Kabwe (Broken Hill), Central Province, Zambia; 14╟29'S , 28╟25'E - http://www.mindat.org/loc-4341.html \\

Брокен Хилл (Broken Hill), Н. Ю. Уэльс, Австралия, 31-57` ю. ш. , 141-26` в. д. \\ http://www.mindat.org/loc-72.html \\

Брумаду \

--Брумадуит \ Brumadoite - новый минерал \\ D. Atencio, A. C. Roberts, P. A. Matioli, J. A. R. Stirling, K. E. Venance, W. Doherty, C. J. Stanley, R. Rowe, G. J. C. Carpenter and J. M. V. Coutinho (2008): Brumadoite, a new copper tellurate hydrate, from Brumado, Bahia, Brazil. Mineralogical Magazine 72, 1201-1205.

Бу-Аззер, Марокко \\

Бурпала , Прибайкалье (С), Россия

В

Ватиха, Мурзинка, Ср. Урал, Россия.

Везувий и Монте-Сомма, Италия \\

Величка, Польша

Верхнекамское м-ние, Пермский край, Россия

Вишневые горы, Ю. Урал, Россия \\ фотогалерея и др. - http://webmineral.ru/

Водинское м-ние, к ССВ от Самары, Ср. Поволжье, Россия

--Сидоров А.А. Минералогия Водинского месторождения самородной сера Самарской области и история его окрытия. Учебное пособие. Самара: Самар. гос. техн. ун-т, 2011. - 189 с.

Володарск-Волынское пегм. поле, пос. Володарск-Волынский, к З от Житомира, Волынь , Украина \\ берилл!!!--ф; гетит!!!; кварц!!; керит!!; микроклин!; опал!; топаз!!!--xls>100 кг; фенакит!!

Гётит. Володарск-Волынское пегматит. поле, Украина. "Гемма", 2014. 12. 06 . Фото: ╘ А.А. Евсеев

Вороньи тундры, Кольский п-ов, Россия

Г

Гаурдак, Туркмения

Голд-Куорри Майн , быв. р-к (Au-Ag-As-Sb-Hg-Tl-Ba-Pb-Zn-Cu-Mn-Ni), ~10 км к СЗ от Карлин, округ Юрика, Невада, США \ Gold Quarry Mine, Maggie Creek Subdistrict, Carlin Trend, Eureka Co., Nevada, USA; 40╟47'29"N; 116╟12'33"W \\ , Невада, США \\ бурангаит; везиньеит; *голдкуоррриит--ф; казахстанит!; карбонат-цианотрихит; кингит; кордероит; мандариноит; метатюямунит; *невадаит--ф; разнообр. мин.-112 (2006.07.12); ришеллит; селен; синкозит; туранит!; тюямунит!-ф; ферванит!!; хьюэттит!!; шубнелит; haggite; hummerite; *...1996-meurigite;. \\ MR, 1995, 449-469 \\ В 1990-ые гг. м-ние считаталось главным источником вторичных минералов Zn, Cu, Bi, Pb, Fe (Kokinos M. et al., 1993); ФМ; 150 фото (многие - микро).

--Jensen, M. C., Rota, J. C. and Foord, E. E. (1995): The Gold Quarry Mine, Carlin-trend, Eureka County , Nevada . - Mineralogical Record: 26: 449-469; --Cooper, M.A., Hawthorne, F.C., Roberts, A.C., Foord, E.E., Erd, R.C., Evans, H.T., Jr., and Jensen, M.C. (2004) Nevadaite, (Cu 2+,[],Al,V 3+)6[Al8(PO4)8F8](OH)2(H2O) 22, a new phosphate mineral species from the Gold Quarry mine, Carlin, Eureka County, Nevada: Description and crystal structure. - Canadian Mineralogist: 42(3): 741-752. \\ Источник и подробнее: http://www.mindat.org/loc-29501.html

Голд-Куорри Майн \ Gold Quarry Mine и соседние местонахождения минералов запада США (с примерами находок). Составил: А. Евсеев, 2014.

Горихо (Gorikho), м-ние, в ср. и ниж. теч. р. Горихо (приток р. Тола, басс. р. Селенга), 45 км к В от Урги [Улан-Батора], Монголия \\ берилл!; горный хрусталь!; топаз!!; флюорит!; Ф, 491; Ш, 28, 197

Горни-Славков ( (ныне) = Шлаггенвальд (быв.) (Horni Slavkov (now) = Schlaggenwald (form.)), 12 км к ЮЮЗ от гор. Карловы Вары , Богемия, Чехия

Гумешевский р-к, Ср. Урал, Россия

Д

Дальнегорск (и район), Приморье, Россия - рекордные кристаллы на сайте - http://giantcrystals.strahlen.org/asia/dalnegorsk.htm \\

-- Боросиликатное м-ние \\ Верхний р-к \\

-- Николаевский р-к

.Дара-Пиоз (= Дараи-Пиез = Дара-и-Пиоз = Дарапиоз) (Dara-Pioz) , 45 км к СВ от пос. Гарм и 35 км к ССВ от Таджикабада, Алайский хр. , Таджикистан \\ http://www.mindat.org/loc.php?loc=3241

Дараи-Пиёзский массив, Алайский хр., Таджикистан. Слайд из доклада Л.А. Паутова и др. 2014.12. 18.

 

--Паутов Л. А., Игнатенко К.И. Цектцерит - находка в Таджикистане. - Минерал.ж. , 1992, 14, ╧3, с.75-78.

Дашкесан, Азербайджан

Джезказган, Казахстан

"Натюрморт". 1. Медь. 2. Азурит с малахитом (сростки ло 3-4 см). Джезказган, Казахстан. "Гемма", 2014. 12. 06. Фото: ╘ А.А. Евсеев

Додо м-ние, Прип. Урал, Россия - http://www.polarquartz.ru/dep-dodo.html

Е

Ж

З

Завитинское (Завитая), м-ние, Вост. Забайкалье , Россия \\ адуляр!; воробьевит!; касситерит!; кукеит!; петалит!!; ростерит!; сподумен!!; турмалин!!; Смо, 351

Заги \ Zagi Mountain, 30 km NW of Peshawar, 4 km S of Warsak (34╟09`N, 71╟24`E), близ Kafoor Dheri, р-н Пешавара, Северо-Западная Пограничная провинция, Пакистан;

Змеиногорский р-к (Zmeinogorsk) = Змеиногорское м-ние, Алтай, Сибирь (ЮЗ), РФ \

И

Изумрудные копи, Ср. Урал, Россия

Илимауссак, Ю. Гренландия

Ильмены. Ю. Урал, Россия \\ карта и др. http://reserves-park.ru/index/0-204 \\ http://nashural.ru/Mesta/ilmeni.htm

Индер (Inder) (= Индерское м-ние), 15 км к В от пос. Индерборский, 150 км к С от Атырау (= Гурьев (быв.)), Сев. Прикаспий, Казахстан \\ витчит; * (1966) волковскит; галит!!; гергейит!!--xls<25 см; [* 1834] гидроборацит!!!; * (1940) индерборит!!; * (1937) индерит; иниоит!!; калиборит!!; колеманит!; кургантаит!; * (1940) курнаковит; * новые мин.≈5 видов (Pk); пинноит!; * (1956) преображенскит; сульфоборит!; улексит!!; Пеков И. В. , 1993 (МК, ╧1, 8-12); Pk (ф)

Итинокава, о. Сикоку, Япония.

Иультин, Чукотка, Россия

Й - К

Кап-Гарон \ Cap Garonne, близ Le Pradet, 12 км к В от Тулона, Вар, Франция \\ Знаменитый находками вторичных минералов старинный рудник, где сегодня располагается музей \\ адамин!; бариофармакоалюмит*; делориит\ deloryite* (Sarp H. et al., 1992); зденекит*(1995) ; илтисит \ iltisite*; камеролаит \ camerolaite* (1991) ; капгароннит* (Mason S. et al., 1992); манертит \ mahnertite *(1996) ; новые мин.*≈12 видов; оливенит!; перрудит* \ perroudite; пущаровскит \ pushcharovskite *(1997) ; разн.--148 мин. (137 вид.); форетит*; фотогалерея mindat--122 фото мин.; цианотрихит!!--ф; geminite (Sarp H. et al., 1990); guarinoite* (Sarp H. et al., 1993); theresemagnanite* (Sarp H. et al., 1993) \\ http://www.mindat.org/loc-1747.html

Кап-Гарон (Вар, Франция) и соседние местонахождения минералов с примерами находок. Составил: ╘ А.А. Евсеев
Подробнее: Евсеев А.А. Атлас мира для минералога. М., 2004. - 284 с. Внимание: названия и привязка (положение на карте) некоторых местонахождений требует уточнения (показаны на карте красными и коричневыми значками)

 

Кара-Оба = Караоба \ Kara-Oba, м-ние (Mo-W), пос. Джамбул (47-11`N, 71-23`E), Ц. Казахстан

Карнасурт, Ловозеро, Кольский п-ов

Кацна яма (копь) , 15 км к СВ от Первоуральска, Ср. Урал, Россия \\ эпидот!! (⌠пушкинит■!!

Керченское м-ние, Крым, Россия \\ анапаит!!!; барит!! вивианит!!; * митридатит; родохрозит, Ca-вый!!--пс-зы по раковинам (ф); смайтит!; Смо, 352; Pk \\

Кировский р-к, Кировский р-к, Кукисвумчорр, Хибины, Кольский п-ов, Россия

Кличка

Кнаппенванд \ Knappenwand , Унтерзульцбахталь, Зальцбург, Австрия \\ актинолит!! (биссолит); апатит!!; эпидот!!! --xls< 1м \\ BG, 395; ВВМ, 80, 197; \\ Seemann, R. (1986): Famous mineral localities: Knappenwand, Untersulzbachtal (Austria). Mineralogical Record 17(3), 167-181.

Слайд из лекции Э.М. Спиридонова "Кордиерит, эпидот, танзанит и др.". Минералогический ун-т. 2014.12.16. Фото: А. Евсеев

 

Коашва, Хибины, Кольский п-ов, РФ \\ Пеков И.В., Николаев А.П. Минералы щелочных пегматитов и гидротермалитов месторождения Коашва (Хибины, Кольский полуостров) // Минералогический альманах, 2013, т. 18, в. 2, 6-65

Кобальт, Онтарио, Канада \ Cobalt (Кобальт), Coleman Township, Ontario, Canada

Кобокобо = Кобо-Кобо (Kobokobo), пегм. м-ние (Be) к З от Камитунга, Киву, ДР Конго \\ * алтупит; берилл!!; * новые мин.≈14 видов; *упалит; фронделит!!; *фуралюмит; ММ; Ш, 34, 123

Ковдор \\

Конгсберг (Kongsberg), Норвегия \\ * конгсбергит; пренит!; серебро!!!; флюорит!≈розовый; ВВМ, 68, 174, 176, 178, 179 \\ O. Johnsen, Mineralogical Record, 1986, 17, 19-36

Кондёр г. , м-в ул.-осн. и щел. пород (Kondoer = Konder), Алданский щит, 75 км к З от пос. Джигда и 100 км к ЗЮЗ от пос. Нелькан, ниж. теч. р. Маймакан, Хабаровский край, РФ \ фото 3D - http://www.mindat.org/photo-619937.html

Консельейру-Пена \ Conselheiro Pena District (пегматитовый район) 21 км к С от Дивину-да-Ларанжейрас, (р-н), Минас-Жерайс, Бразилия

Коршуновское м-ние, Иркутская обл., Вост. Сибирь, Росссия

Кремиковцы = Кремиковци (Kremikovtsi), ~ 15 км к СВ от Софии, Болгария \\ азурит!; барит!; витерит!!; гематит!!; гетит!!; кальцит!; лепидокрокит!; норсетит!! (ММ); родохрозит!!; романешит!!

Кугитанг-тау, Туркмения

Кукисвумчорр, Хибины, Кольский п-ов, Россия \\ Петараситовая жила, Тульйок река (верховья), Кукисвумчорр гора, Хибины, Кольский п-ов, Мурманская область, Россия

Кухилал (Kukhilal) = Кухи-Лал = Кугиляль = Кох-и-Лал, Памир (ЮЗ), Таджикистан

Кырк-Булак, Туркестанский хр. (С) \\ андалузит!!-паралл. сростки xls до 18 см; арроядит!; берилл!!; беусит! - выдел. до неск. см; грифит!!--1-я нах. в СССР; кордиерит!; крыжановскит!!; *магниотриплит!; манганоконинкит!; поллуцит!; саркопсид!; синканкасит! (ФМ); спессартин!!; трифилин!; цвизелит

Л

Лаврион = Лавриум, Греция \ Laurium (= Laurion = Lavrion (нем.)), Greece \\ фотогалерея--http://www.mineral-forum.com/

--Камарицаит* - новый минерал \\ N. V. Chukanov, I. V. Pekov, S. Mockel, A. A. Mukhanova, D. I. Belakovsky, L. A. Levitskaya & G. K. Bekenova (2010): Kamarizaite, Fe33+(AsO4)2(OH)3∙3H2O, a new mineral species, arsenate analogue of tinticite. Geology of Ore Deposits 52, 599-605.
--Капелласит* - новый минерал \\ W. Krause, H.-J. Bernhardt, R. S. W. Braithwaite, U. Kolitsch and R. Pritchard (2006): Kapellasite, Cu3Zn(OH)6Cl2, a new mineral from Lavrion, Greece. Mineral. Mag. 70, 329-340.

--Паралаурионит* -- рис. кр-лов--Дэна Дж.Д. и др., 1953, II-2, 86

Лакарги гора, Верхнечегемская вулканическая структура, Кабардино-Балкария, Сев. Кавказ, Россия \ Lakargi Mt., Verkhnechegemskaya caldera (Upper Chegem caldera) ; ксенолиты скарнов в игнимбритах; 43╟17'N ; 43╟6'E \

Лангезундфьорд = Лангесунн-фьорд (Langesund(s)fjord), Ю. Норвегия Ленгенбах, Швейцария \\ http://en.wikipedia.org/wiki/Lengenbach_Quarry

Ленгенбах (у входа в карьер), Валлис, Швецария. 2014 г. Фото: Д. Тонкачеев.

Ловозеро, Кольский п-ов, Россия

Лонгбан, Вермланд, Швеция \\ 59╟51'13"N , 14╟15'34"E

М

Мави р-к, Лагман пров., Афганистан

Маданский рудный район, ( = Маданское рудное поле (Pb-Zn)(Madan ore field), р-н пос. Мадан, 200 км к ЮВ от Софии, Болгария \\ галенит!!--xls< 20 см; манганильваит* (= ильваит-Mn); родохрозит!; пирротин!; сфалерит!; ферройохансенит!; халькопирит!; церуссит!! \\ http://www.mindat.org/loc-459.html

Маджуба-Хилл Майн. округ Першинг, Невада, США \\ * (1978) гоудейит \ goudeyite; клиноклаз!; * (1978) парноит; страшимирит!! \\ http://www.mindat.org/loc-3924.html

Маунт-Кобальт, 120 км к Ю от Клонкерри, Квинсленд, Австралия \ Mount Cobalt ( Mt Cobalt Mine), Selwyn District , Mt Isa - Cloncurry area , Queensland , Australia -- http://www.mindat.org/loc-138.html \\ фото: гетерогенит!-ф; кобальтин!--ф; мансфельдит (6); смольяниновит≈пс-зы по эритрину (кр-лы до 2 мм (3); сферокобальтин!--ф; эритрин!!!≈(10 фото);

 

Эритрин. [Маунт-Кобальт Майн \ Mount Cobalt Mine, Cloncurry, Клонкарри]. Квинсленд, Австралия. Образец: ФМ (╧86120). Фото: ╘ А.А. Евсеев

Маунт Кобальт и соседние местонахождения минералов Австралии. Составил: ╘ А.А. Евсеев.

 

Маунт-Малоса \ Mt. Malosa, близ Зомба, Малави, Вост. Африка \\ барилит!; микроклин!; миларит!; ниобофиллит!!--фото-- www.mindat.org/gallery1; ортоклаз!; паризит!!; разн. 48 мин. (44 достоверных вида); эгирин!!!≈xls> 20 см; эпидидимит!!≈xl 5, 4 см; D; L, 1999, ╧4, 22-32; 48 entries listed. 44 valid minerals-- www.mindat.org (2008.02.24)

Малханское м-ние , Забайкалье, Россия

Меднорудянский р-к, Ниж. Тагил, Ср. Урал, Россия

Могок = Могоу (новое название, по Е.Я. Киевленко, 2001) (Mogok District), Мьянма (= Бирма (быв.)

Мурзинка, Ср. Урал, Россия

Эгирин. Маунт-Малоса, Зомба Дистрикт, Малави. ~9 см. Образец: "Русские минералы". "Гемма", 2014. 12. 06. 2. Топаз (╧ 31290) . Мурзинка, Ср. Урал, Россия. Высота ~ 5 см. Образец : ФМ (Из коллеции П.А. Кочубея). Фото 1-2: ╘ А.А. Евсеев

Мурунский массив = Мурун (Murun), близ г. Мурун (1452 м), междуречье рр. Чара и Токко, ~50 км к ЗЮЗ от пос. Торго, Алдан (СЗ), Якутия (ЮЗ), РФ \\\\ Сиреневый Камень месторождение чароита --http://petrographica.ru/

--Нунканбахит* - новый минерал --фото-- Bernard J. H. and Hyrsl J. Minerals and Their Localities. - Supplement, Praha, 2013. - 100 p (фото--с. 63)

Мусонои р-к \ Musonoi mine, ~25-30 км к З (по другим данным -10 км к СЗ ) от Колвези (10╟41`S, 25╟39`E), Катанга (быв. Шаба, ДР Конго (быв. Заир); 10╟42`S, 25╟23`E \\

Н

Найка, Чиуауа, Мексика

Нойдорф, Гарц, Германия

Пфаффенберг, Нойдорф и соседние местонахождения минералов Германии. Составил: ╘ А.А. Евсеев

Неройка г., Прип. Урал, Россия \\ Додо м-ние \\ Шафрановский И. И. Кварц горы Неройки //Тр. ЦНИЛ камней-самоцветов. 1937. С. 1≈40.

Норильский р-н, Ср. Сибирь, Россия

Валлериит и гидрогранат по ангидриту. Норильский рудный р-н, Сред. Сибирь, Россия. Фото: ╘ Е.В. Середа.

Н`Чванинг (N`Chwaning), р-ки (без уточнения) , к СЗ от Куруман, Калахари (Mn)-рудное поле, ЮАР \\ афвиллит!!!--xls< 1 см; браунит!!--xl 1, 6 см (ф); журавскит!--xls; кариопилит!!; лейкофеницит!--xls< 3 мм; портландит!!!--xls< 3 см; MR, 1992, v. 23, 436; MRI

Ньоркпахк, Хибины, Кольский п-ов, Россия

О

Одихинча \ Odikhincha, м-в, р. Котуй, 110 км к ЮЮВ от Хатанги, Ср. Сибирь, Россия \\ акерманит (=окерманит)!; андрадит, Ti-сод. (меланит!!); магнетит!; нефелин!!--xls; мелилит!; тасекит!; шорломит!!; МЩ, 133 \\ Зайцев В.А. Редкометальная минерализация нефелин-сиенитового пегматита из массива Одихинча --стенд доклад - http://alkaline2008.narod.ru/ \\ Зайцев В.А., Чуканов Н.В. ТАСЕКИТ ИЗ НЕФЕЛИН-СИЕНИТОВОГО ПЕГМАТИТА МАССИВА ОДИХИНЧА. \\ http://alkaline2008.narod.ru/Abstract.htm

Одихинча м-в \\ Минералогия щелочных массивов и их месторождений. М.: Наука, 1974.- 248 с. (с.133-134)

Отоме,, р-к (Otomezaka = Otome mine), Makioka-cho , Yamanashi City , Kinpuzan district, преф. Яманаси (Yamanashi Pref.), Япония \\ : http://www.mindat.org/loc-220223.html

Охуэла р-к \ Ojuela mine, Мапими, Дуранго, Мексика

П

Палитра пегматит, Кедыкверпахк г., Ловозеро

Панашкейра \ Panasqueira; Португалия; 40╟10`N , 7╟46`W;

Перекатное м-ние, Алдан, Якутия, Россия.

Питкяранта, Сев. Приладожье, Ю. Карелия, РФ \\ См. http://karelnedra.karelia.ru/mnia/sn_karelia.htm

Плоская г. , Кейвы, Кольский п-ов, Россия; амазонитовые пегматиты с редкими минералами Y и Yb

Полковник г.., Орск, Ю. Урал, Россия

Пршибрам, рудное поле, Чехия \ \ Pribram ore field, Czech Republic

Пуйва, Прип. Урал, Россия.

Пуна\ Poona = Pune (район Пуны), Индия \\

Р

Рай-Из гипербазитовый массив (район), хр. Марун-Кеу, ж.-д.. ст. Харп, ЯНАО, Тюменская обл., Пол. Урал, Россия \\

Расвумчорр, Хибины, Кольский п-ов, Россия

Ратнапура, Шри-Ланка

Рубцовское м-ние, Алтай, Россия \\ коннеллит!--фото

Рудные горы, Гемания \ Чехия

С

Сарановское м-ние, Ср. Урал, Россия

Сарбайский р-к (Sarbayskii mine) = Сарбайское м-ние, гор. Рудный, 45 км к ЮЗ от Кустаная, Казахстан

Сар-э-Санг = Сари-Санг = Сары-Санг \ Sar-e-Sang = Sar-Sang (Encarta-2001), Бадахшан, Афганистан \\ * (1968) афганит!!; лазурит!!!--xls<5 см ; сапфирин; К-83; BG, 281; D

Сент-Илер массив, Квебек, Канада \\ http://www.mindat.org/loc-123123.html

Сикуаньшань, Хунань, Китай

Слюдянка (и район) Словарь топонимов Слюдянского района - http://www.maxknow.ru/images/upload/articles7/468.htm

Солонго (= Магнетитовое) м-ние, Забайкалье, Бурятия, Россия

Суит-Хоум Майн, Алма, \ Sweet Home Mine, Alma, Колорадо, США \\

Сюебаодин \ Xuebaoding, горы, район Пинъу \ Pingwu, Сычуань, Китай

Т

Талнах м-ние, Ср. Сибирь (С)

Тигриное м-ние, Приморье, Россия

Титовское м-ние, р. Догдо, хр. Тас-Хаяхтах, Пол. Якутия, Россия

Толбачик (= Толбачинский) (Tolbachinskii) вулкан, к ЮЗ от Ключевской Сопки, Камчатка, Россия --Кальциолангбейнит* - новый минерал с вулкана Толбачик

--Большое трещинное извержение (БТТИ), Толбачик вулкан, Камчатский край, Северо-Восточный регион, Россия

Траверселла (Traversella), близ Ивреа, Пьемонт, Сев. Италия \\ аметист!!; доломит!; магнетит!!≈xls< 3 см; пирит!; шеелит!!; эпидот!; ВВМ, 160, 234

Турьинские р-ки, Сев. Урал, Россия \\ Фёдоров Е. С., Никитин В. В. Богословский горный округ. Описание в отношении его топографии, минералогии, геологии и рудных месторождений. - СПб., 1901. - С. 92.

Тюямуюн, Киргизия

У

Уа-Уа Маунтинз, близ Delta, округа Бивер, Миллард и Айрон, Юта, США \ Wah Wah Mts, Millard Co. \ Beaver Co. \ Iron Co., Utah, USA \\ берилл!!!--xls, малиново-красный; гейкилит

-- Харрис Майн, Уа-Уа Маунтинз, округ Бивер, Юта, США\ Harris Mine, Wah Wah Mountains, Beaver County \\ берилл!!!--xls, малиново-красный

Берилл красный в риолите. Уа-Уа Маунтинс\ Wah Wah Mts, Юта, США. Кристалл ~3 см. (╧╧81692, 84849. Barlow F.J., 1982. Обмен, 1986). Образец : Мин. музей им. А.Е. Ферсмана РАН. Фото: ╘ А.А. Евсеев.

Умбозерский р-к, г. Аллуайв, Ловозеро, Кольский п-ов, РФ

Ушкатын-III, м-ние (Fe-Mn), близ пос. Жайрем, Атасуйский р-н (З), Ц. Казахстан \\ бементит!; брандтит!; браунит!; вульфенит; гаусманнит; кентролит!; пеннантит!; родохрозит!!; тодорокит!!; церуссит!!; якобсит

Ф

Фенцзяшань \ Fengjiashan, к ЮЗ от Daye, Хубэй, Китай \\ ═Фото: аметист!; ═апофиллит!; волластонит!!(добывается); инезит!!!≈ф; кварц (и аметист)--япон. дв-ки!!; ═пирит!; стильбит!; флюорит!!; хубеит!!*)≈Ottens B., 178 - 188

--Ottens B. (2007): The Fengjiashan mine, Daye District, Ezhou Prefecture, Hubei Province, China. The Mineralogical Record, 38, 33-42.

Фрайберг (=Фрейберг), район.

Франклин, Нью-Джерси \ (Franklin), 80 км к СЗ от Нью-Йорка, округ Сассекс, Нью-Джерси, США \\ аллеганит! (М 3-1); виллемит!! (М 3-1)≈xls<20 см; ганит! (М 2-3); гетеролит! (М 2-3); глаукохроит! (М 3-1); годжкинсонит! (М 3-1); ларсенит! (М 3-1); лейкофеницит! (М 3-1); *ленниленапеит (ММ); лёллингит! (М 1-1); * новые мин.≈67 видов (вместе с м-нием Стерлинг-Хилл); норбергит! (М 3-1); пирохроит! (М 2-3); родонит!! (М 3-2); тефроит! (М 3-1); * франклинит!! (М 2-3)≈xls< 15 см; хендриксит!; цинкит!!! (М 2-2); BG, 19, 21; MR, 1996, 226 (лит.)

Х

Хайдаркан, м-ние, Киргизия

Кальцит. Хайдаркан, Ю. Киргизия. Более 18 см. Образец: Мин. музей им.А.Е. Ферсмана РАН (Коллекция В.И. Степанова). Фото: ╘ А.А. Евсеев

 

Хибины, Кольский п-ов, Россия \\ карта Хиб ин \\ турист. схема

Хуанганг р-к \ Huanggang Mine (Huanggangliang Mine), Внутр. Монголия, Китай

Ильваит. Huanggang Mine (Huanggangliang Mine), Внутр. Монголия, Китай. Образец: Минер. музей им. А.Е. Ферсмана РАН (╧93759. Дар: Д.И. Белаковский. Из поступлений 2012 г.). Фото: ╘ А. Евсеев.

Ц

Цумеб \ Tsumeb и район, Намибия \\ (ГРЭ- III , 587-593); геол. карта р-на; геол. разрез); ╚скопления германита достигали веса в несколько сотен тонн╩ (с.589)

Ч

Чаньярсильо м-ние (Ag) , ~75 км от Копьяпо; Атакама, Чили \\ Хуан Годой открыл месторождение 16 мая 1832 г., после чего в Чили началась "серебряная лихорадка" \\ виртуальное путешествие на заброшенные рудники Чаньярсилльо - http://www.geovirtual2.cl/minas/Chanarcillo/chan00entrada.htm

Чаувай, м-ние (Hg), 65 км к ЮЗ от гор. Ош, Ю. Киргизия \\ акташит!--ф; аурипигмент; валентинит; галхаит!!--кр-лы до 1-2 см (Пеков И.В., 2005, устно); * (1981) груздевит--ф; киноварь!!--xls; лаффитит!; кермезит ; метациннабарит--в кр-ле кальцита (Степанов В.И.(колл.), до 1982); реальгар!--Поярков В.Э., 1932(л); твалчрелидзеит!; флюорит!!; Pk (ф) \\ м-ние открыто в 1914 г.

--Груздевит \\ Спиридонов Э.М., Крапива Л.Я., Гапеев А.К., Степанов В.И., Чвилёва Т.Н. Груздевит Cu6Hg3Sb4S12 - новый минерал из сурьмяно-ртутного месторождения Чаувай (Средняя Азия) // Доклады АН СССР, 1981. Том 261, с. 971-976.

Чаувай (Киргизия) и две другие находки груздевита в мире. Составил: А. Евсеев.

Ш Щ

Шерловая Гора (= Шерлова гора = Ширлова гора) (Scherlovaya Gora), Вост. Забайкалье, РФ

Агардит-(Y). Шерловая Гора., Забайкалье, Россия. Более 8х8 см. Образец: Мин. музей им.А.Е. Ферсмана РАН (╧93857. Дар: Клопотов К.И., 2012). Фото: ╘ А.А. Евсеев

 

Шимен, Хунань, Китай

Шкатулка, пегм. залежь, Умбозерский р-к, Аллуайв, Ловозеро, Кольский п-ов, РФ \\

Шнееберг, Рудные горы, Саксония, Германия

Шор-Су = Шорсу, м-ние, 30-35 км к ЮЮЗ от Коканда, Фергана (Ю), Узбекистан \\ озокерит!; сера!!!; целестин; МС-1, 278-279; Смо, 356

Э

Эльба о., Италия

Эронго, Намибия.

Ю

Юбилейная залежь \ Jubilee( = Yubileinaya) pegmatite ), Карнасурт, Ловозеро, Кольский п-ов, Россия

Юкспор, Хибины, Кольский п-ов, Россия

Я

Яогансян р-к (W) \ Yaogangxian = Yao Guang Xiang, 40 км к ЮВ от Ченжоу, Хунань (Ю), Китай \ Yaogangxian = Yao Guang Xiang, Yizhang Co., Chenzhou Prefecture, Hunan; 25╟35'N , 113╟15'E \\ : http://www.mindat.org/loc-4549.html

Яхимов (Jachymov) (= быв. Иоахимсталь\ Joachimsthal), Западно-Чешский край, Богемия, Чехия \\ http://www.mindat.org/loc-158151.html \\

--Высокиит* - новый минерал из Яхимова \\ Plasil, J., Hlousek, J., Skoda, R., Novak, M., Sejkora, J., Cejka, J., Veselovsky, F., Majzlan, J. (2013): Vysokyite, U4+[AsO2(OH)2]4.4H2O, a new mineral from Jachymov, Czech Republic. Mineralogical Magazine, 77, 3055-3066.

--Уранопилит* - (mindat)

см. также--СПРАВОЧНИК МЕСТОНАХОЖДЕНИЙ МИНЕРАЛОВ И РУД - http://mineral.nsu.ru/educat/article/7/

 

СТРАНЫ и РЕГИОНЫ

Находки минералов по всему миру. Подробнее: Евсеев А.А. Атлас мира для минералога. М., 2004. - 284 с. \\ Евсеев А.А. Атлас для минералога. Россия и бывший СССР . М., 2011. √ 248 с

СТРАНЫ от А до Я

находки минералов по листам карты мира: 1234567 891011121314151617181920212223242526272829303132 - 33

Викимапия \ Wikimapia (карты мира и России)

Сев. Америка (С)

Гренландия

Атлантика - Скандинавия - Кольский п-в

Урал
Ср. Сибирь
Якутия
СВ России

Сев. Америка (З - Сев. Америка (Кордильеры)

Сев. Америка (В)

Британ. о-ва, Пиренейский п-в - Зап. Европа - Вост. Европа

Казахстан, Ср. Азия

Юг Сибири
Забайкалье, Вост . Сибирь
Камчатка - Дальний Восток (Россия, Япония
Мексика
Кавказ, ЮЗ Азия
Афганистан, Пакистан
Индия
Монголия. Китай
ЮВ Азия - Тихий океан
Ю. Америка (СЗ) - Кордильеры
Бразилия

Африка - Сев. и Зап.Экв. и ЮжнВост.

Антарктида
Австралия

Тихий океан - Весь мир

Интересная подборка из 9 минералов региона получается если взять по одному из 9 его частей (центр, север, юг, запад, восток, СВ, ЮВ, ЮВ, СЗ)

Арктика

Северный Ледовитый океан - карта

Новая Земля

--Павловское м-ние (Pb-Zn)(Безымянский рудный узел (Южный остров архипелага Новая Земля, Архангельская область) - Википедия

Шпицберген \\Гёлит* \ hoelite --Пирамида гора и пос. (быв. угольный р-к), Шпицберген. Новый минерал был обнаружен в горящем угольном пласте. Назван в честь А. Гёла (1879√1964), норвежского геолога и полярного исследователя. Он возглавлял экспедицию, во время которой был найден минерал.(/www.mindat.org)\\ Oftedahl, I (1929): Minerals from the burning coal seam at Mt.Pyramide, Spitsbergen. (part II of Werenskiold, W.and Oftedal, I: A burning coal seam at Mt.Pyramide, Spitsbergen.] in Hoel, A, Editor): Det norske Videnskaps-Akademi i Oslo, Resultater av de norske statsunderstottede Spitsbergenekspeditioner (Skrifter om Svalbard og Ishavet), Vol I, No 3, 9-14 + Plate 1

Восточное полушарие

Евразия

Россия и СССР

--Ферсман А. Е. Геохимия России. Петроград, 1922. Вып. 1. 214 с.

--Минералы СССР, т.1 "Самородные элементы"/ под ред. А.Е.Ферсмана (редактор тома Н.А.Смольянинов), Изд.АН СССР Москва-Ленинград. 1940 г. - 328 с., тир. 3000 экз.

--Геологические памятники природы России "Природное наследие России" . Авторы: Карпунин А.М. , Мамонов С.В. , Мироненко О.А. , Соколов А.Р. Главный редактор - Орлов В.П. \\ веб-публикация

Карта России на сайте К.И. Клопотова

Кристаллы России в экспозиции Минералогического музея им. А.Е. Ферсмана РАН (кристаллы 5 см и более на выставке "Кристаллы")

10 замечательных минералов России (экспресс-опрос провел А. Евсеев, на ответ давалось несколько минут. 1 октября- 9 ноября 2010 \\ 44 участника на 2010.11.09. \\ 111 чел. на 2011.03. 23. Самыми популярными минералами по числу голосов оказались кварц и малахит. Всего было названо более 200 минералов и цветных камней (2011.03.23)

Минералы России по числу ссылок (20 и более) в ╚Атласе мира для минералога╩

Новые минералы ( СССР и Россия) \\ Список всех новых минералов, открытых на территории быв. СССР с 1766 до первой половины 2006 г. содержит 714 достоверных ( valid ) минеральных видов √ см. Pekov I.V. New Minerals from Former Soviet Union Countries, 1998-2006 // Mineralogical Almanac, Vol. 11. Moscow, Mineralogical Almanac, 2007, 112 pp. (список - стр. 85-88)

Полезные ископаемые - Википедия

Разнообразие минералов - 2889 ; из них достоверные виды - 1796; новые виды - 614; местонахождения - \ localities - ; фото минер. - 5724; фото мест - 85 (на 2011.05.03) \\ Источник: http://www.mindat.org/loc-14409.html

Разнообразие минералов - 2067 ; из них достоверные виды - 1652; новые виды - 576; местонахождения - \ localities - ; фото минер. - 3322; фото мест - 67 (на 2009.01.28) \\ Источник: http://www.mindat.org/loc-14409.html

Основные структурно-минерагенические провинции цветных камней России - http://www.lavrovit.narod.ru/kamni/provincia.htm

Карта "Самые замечательные месторождения минералов в Союзе" (фрагмент). Источник: Ферсман А.Е. Занимательная минералогия. М. -Л.: "Детская литература", 1937. - 240 с. Объяснения к карте - см. стр. 235-238. Подробнее Коллекционные минералы из России - http://www.kristallemineralsrussia.com/

 

Кольский п-в и Карелия \\

Хибины и Ловозеро --карта (спутник)

Кольский п-в_фото минералов_Bernard - новая страница

-- В.В. Борисова, А.В. Волошин. Перечень минеральных видов Кольского полуострова. Изд. 4-е, испр. и доп. / √ Апатиты: К&М, 2010. √ 64 с

Минералы Кольского п-ва от A до Z \\ 1168 минералов; 835 минер. видов; 255 новых видов; фото минералов - 22181.(1-е - адамсит-(Y), 101- бахчисарайцевит и т.д.) \\ Источник: http://www.mindat.org/loc-2666.html (на 2014.06.19)

Минералы Кольского п-ва от А до Я (по Борисовой В.В. и др., 2002 с доп.)

Полезные ископаемые --читать

--Новые минералы---264 вида \\ Волошин А.В. , Пеков И.В., Борисова В.В. Минералы, впервые открытые в Кольском регионе: исторический обзор и статистические данные. - Минер. альманах. Т. 18, вып.2, 2013, с.107-123

Карелия \\ http://mindat.ru/locathn/r_karel.htm \

- Атлас структур и текстур докембрийских вулканогенных пород Карелии \\ литература

Вост. Европа

Россия \\ 3086 минералов; 1959 минер. видов; 255 новых видов; фото минералов - 8561.(1-е - абрамовит, 101- Allochalcoselite и т.д.) \\ Источник: http://www.mindat.org/loc-14409.html (на 2014.06.19)

Местонахождения минералов России на сайте К.И. Клопотова

Европейская часть России

1. Изумруд (Урал) и виллиомит (Хибины). Фото и монтаж: А. Евсеев.

Архангельская обл.

--Вишневский С.А., Маслов М.А., Пальник Н.А., Пономарев Г.Я. Коэсит в породах Карской структуры // ДАН СССР. 1977. Том 232. ╧2, стр. 446-448

КМА \\ Европ. часть России (север) \\

Тиман \\ Сев. Тиман--путешествия \\ путешествия-2009 \\ схема

Поволжье \\

Подмосковье, Россия и Москва

Центр Европ. части России

Крым . Сев. Кавказ, Россия

 

Урал

- пока не найдены (не описаны для Урала на 2014 г.) : сподумен, эвдиалит...:

Из публикаций по минералогии Урала - http://w.ilmeny.ac.ru/biblio/ \\ минералы Урала - http://ural-ozersk.ucoz.ru/

--Знаменитые месторождения Урала. Ч.II Д.А. Клейменов, В.Г. Альбрехт, А.Г. Талалай, В.А. Коротеев и др. Издательство: "Уральский рабочий", 2007 г., С. 240 \\ Во второй книги из серии "Знаменитые месторождения Урала" приведены сведения об истории открытия, геологии и минералогии Высокогорского, Гороблагодатского, Медноруднянского, Саткинского, Соль-Илецкого, Учалинского, Узельгинского, Молодёжного, Таш-Тау, Яр-Бишкадакского месторождений

ПРИРОДНЫЕ ДОСТОПРИМЕЧАТЕЛЬНОСТИ УРАЛА - http://nashural.ru/mesta.htm

Рудники (и не только) Урала - фотогалереи \ видео "Планета Карабаш"

Пермский край, Россия \\ Геологические памятники - http://www.perm-kray.ru/index.htm

--Чайковский И. И. МОРФОЛОГИЯ КАМЕННОЙ СОЛИ ИЗ СОВРЕМЕННЫХ РАССОЛОВ ВЕРХНЕКАМСКОГО МЕСТОРОЖДЕНИЯ (ОТВАЛЫ ПЕРВОГО БЕРЕЗНИКОВСКОГО РУДОУПРАВЛЕНИЯ)

Полярный Урал, Россия \\ фото - http://polyarny.net/foto/

ПРИПОЛЯРНЫЙ УРАЛ \\ КЕММЕРИХ А. О. ═ПРИПОЛЯРНЫЙ ═УРАЛ. ПУТЕВОДИТЕЛЬ. ИЗДАТЕЛЬСТВО ╚ФИЗКУЛЬТУРА И СПОРТ╩. МОСКВА 1970 \ веб-публикация

1. Кварц (японский двойник). Центральны Паток м-ние, Прип. Урал, Россия. 6х4,5 см. Образец: Минер. музей МГРИ-РГГРУ (Р-:2750. Дар: В.В. Буканов (2014. 12. 11). 2. Алмаз. "Шпинелевый" двойник с иглами травления. 1,20 кар. Урал, Россия. Образец: Мин. музей им.А.Е. Ферсмана РАН [╧64752]. Фото: ╘ А.А. Евсеев

 

--Пеленгичей (=Пелингичей), м-ние, к С от г. Народная, р. Пелингичей, прит. р. Балбанью, Прип. Урал \\ горный хрусталь!!; доломит!; кварц!!≈xls с вкл. и др.; скорцалит!; шеелит!; штольцит!!--xls< 1, 5см!--ф \\ WS, ╧7, 15 \\ \\ Буканов В.В. и др. (Приполярный Урал: минералы хрусталеносных жил. Минералогический Альманах, том 17, выпуск 2, 2012 )\\ о м-нии Пелингичей-3 - стр. 22-26 \\ См. также : http://webmineral.ru/deposits/

СЕВЕРНЫЙ УРАЛ (6400'≈5845' с. ш.)

Средний Урал, Россия

СРЕДНИЙ УРАЛ (5845' ≈ 5600' с.ш.

----Высокогорское медно-железорудное месторождение находится на окраине города Нижнего Тагила. Добыча руды на горе Высокая была начата еще Демидовыми в 1721 году. Сейчас на месте горы находится главный карьер месторождения, добыча руды в котором была остановлена в 1990 году (карьер в настоящее время затоплен). После 1990 года отработка месторождения велась подземным способом (шахта "Магнетитовая"). Помимо руды на месторождении было добыто достаточно много поделочного малахита высокого качества. Описание месторождения имеется в книге Киевленко Е.Я., Сенкевич Н.Н. "Геология месторождений поделочных камней" (Недра, 1983 г.), стр. 98. \\ Источник и подробнее: http://www.insminerals.ru/Vysokogor.htm

--Самоцветная полоса Урала ≈ это условное название территории, узкой лентой протянувшейся с юга на север более чем на сто километров вдоль восточного склона Среднего Урала в верховьях рек Нейва , Реж и Адуй . (Википедия)

Знаменитые месторождения Свердловской области: путеводитель геолого-минералогических маршрутов.
Составители: Д.А. Клейменов, Ю.А. Поленов, В.Н. Огородников и др. Издательство: "Уральский рабочий", 2011 г., С. 44 В путеводителе приводится подробное описание месторождения расположенных в окрестностях городов Екатеринбурга, Каменск-Уральского и Полевского. История открытия и освоения, интересные факты, минералы и горные породы, встречающиеся на данных месторождениях

ЮЖНЫЙ УРАЛ (5600' ≈ 5100' с. ш.)

Южный Урал, Россия \\ По страницам книги Колисниченко С.В., Попов В.А., Епанчинцев С.Г., Кузнецов А.М. Все ═минералы Южного Урала. Минералы Челябинской области. ═Энциклопедия уральского камня. - Челябинск: Изд-во "Санарка"; 2014. - 624 с.: ═1600 ил..

Слайд из лекции Э.М. Спиридонова "Кордиерит, эпидот, танзанит и др.". Минералогический ун-т. 2014.12.16. Фото: А. Евсеев

Сибирь \ Сибирь в "Атласе мира для минералога". - Местонахождения минералов и примеры находок http://geo.web.ru/druza/L-AtE_Sib.htm \\

Дополнения к списку (Евсеев А.А. Минералогические находки. Краткий обзор. I. Сибирь. М., 2006. √ 157 с. )

Новые минералы*

Зап. Сибирь \\

Ср. Сибирь \\

Медно-никелевая руда (сульфидная). Норильский рудный р-н, Сред. Сибирь, Россия. Фото: ╘ А.А. Евсеев. \\ НМК-125

Таймыр

Нижняя Тунгуска р.

Якутия 591 минералов; 459 минер. видов; 50 новых видов; фото минералов - 403 \ .591 entries listed. 459 valid minerals. 50 type localities (valid minerals). \\ http://www.mindat.org/loc-2644.html (на 2012.03.13)

--Улусы Якутии. Административное деление республики Якутия на улусы \ схем. карты улусов - http://yakutia-map.ru/

--Томпонский улус схем. карта - http://yakutia-map.ru/map1265916_0_0.htm

АМАКИНИТ═══════ Fe(OH)2
Установлен на глубине 300 м в алмазном месторождении кимберлитовой трубки Удачная-Восточная, З.Якутия. Образует светло-зеленые груборомбоэдрические кристаллы до 2 см и зерна, слагает прожилки мощностью до 2 см и гнезда совместно с серпентином и карбонатом [Козлов И.Т., Левшов П.П. Амакинит - новый минерал из группы брусита-пирохроита. // ЗВМО, 1962, 91, 1, 72-77.].
Название: в честь Амакинской геологической экспедиции, участвовавшей в открытии алмазов в Якутии. ⌠Амака■- медведь (якутск.).
TS: FM 69547 ? \\ Источник: Pekov I.V. Minerals First Discovered on the Territory of the Former Soviet Union. Moscow, Ocean Pictures, 1998.- 369 pp.

1. Акташит. Гал-Хая м-ние, СВ Якутия, Россия. (╧73900. Груздев В.С.). 2. Лампрофиллит (кр-л 4,5 см) с магнезиоарфведсонитом (кр-л 9 см) в керолите с реликтами натролита и эдингтонита. Около м-ния хром-диопсида Инагли (карьерчик в борту ручья), Алдан, Якутия, Россия. (╧4961. Из колл. В.И. Степанова. Дар: Черкасов А., 1983). Образец 1-2: Мин. музей им.А.Е. Ферсмана РАН. Фото 1-2: ╘ А.А. Евсеев

Алдан, Якутия \ Хабаровский край, Россия

 

 

 

СВ России

Магаданская обл.

(Невада, США)

Корякия и Камчатка, Россия \\

Чукотка, Россия (СВ)

Камчатка \

--Тазиевит* - новый минерал из вулкана Мутновский \\ Michael Zelenski, Anna Garavelli, Daniela Pinto, Filippo Vurro, Yves Moelo, Luca Bindi, Emil Makovicky, and Elena Bonaccorsi (2009) Tazieffite, Pb20Cd2(As,Bi)22S50Cl10, a new chloro-sulfosalt from Mutnovsky volcano, Kamchatka Peninsula, Russian Federation. American Mineralogist, 94, 1312√1324.

Курильские о-ва

Дальний Восток (Россия) литература по геологии и пол. ископ. (в алфавите авторов) - http://wiki.fegi.ru/index.php/Амур р.

Амурская обл., Россия \\

--Мельников А.В. Топонимический словарь Амурской области. - Благовещенск, 2009. - 232 стр. \\ веб-публикация - http://www.chitalnya.ru/work/121676/

Приморье, Россия

Сахалин

Хабаровский край, Россия \\

"Ирнимит" ("синяя яшма "). Ир-Нимийское м-ние, Приохотье, Хабаровский край, Россия. Минералогический музей МГРИ-РГГРУ, ╧802. Фото: ╘ А.А. Евсеев.

Юг Сибири

Алтай, Россия \ Казахстан

--Геологическая экскурсия Геологическое строение и распределение минерализации. Колывань и др - http://shakhov.igm.nsc.ru/excursion--geological.html

Минералы меди из Сибири (ЮЗ)

Малахит (лучистый), азурит (кристаллы). Каменушинское м-ние, Кемеровская обл., Россия. Более 20 см. Образец: К. Бердышева. "Гемма", 2014. 12. 06. Фото: ╘ А.А. Евсеев

Горный Алтай

Восточная Сибирь

Горная Шория, географическая область, Сибирь (ЮЗ), Кемеровская обл., Россия

Енисейский кряж

Забайкалье, Россия \\ фото - http://www.crystallika.com.postman.ru/

Забайкалье_местонахождения

--ОПИСАНИЕ МЕСТОРОЖДЕНИЙ ЗАБАЙКАЛЬЯ [А.Е. Ферсман]

--Жипкошинское м-ние (Sb) разрабатывает Харашибирский сурьмяной комбинат \\ подробнее - http://www.chita.ru/wikismi/p16663/

Стибиконит по антимониту. Жипкошинское м-ние (Sb), Могойтуйский р-н, Забайкалье, Россия. Более 8 см. Образец: Д. Черепанов . "Гемма", 2014. 12. 06. Фото: ╘ А.А. Евсеев

 

Иркутская обл. \\

Кемеровская обл. и Горная Шория

Красноярский край \\ минеральные ресурсы - http://nature.krasn.ru/content.ph

Прибайкалье \\

Саяны и Присаянье \\

Тува

Хакассия

Атлантика

Европа \\

--Зап. Европа_минералогические особенности (в фотографиях образцов от А до Я) -- Европа_крупные кристаллы \\ Европа _кристаллы_5 см \\ Европа_кристаллы _10 см \\

Средиземноморье_минералогические находки вдоль побережья

Европа (СЗ) \\

Исландия

Скандинавия \\

Норвегия \\

Финляндия \\

--Кеми, м-ние (Cr) расположенном на сев. берегу Ботнического залива (Финляндия). Месторожд. связано с массивом анортозит-серпентинитового состава, залегающим на контакте кварцитов и сланцев с гнейсами архея.

Швеция

--Ruoutevare, Kvikkjokk, Лапландия, Швеция--магнезиохёгбомитe-2N2S (TL); бравоит

Ruoutevare (Лапландия, Швеция) и соседние местонахождения минералов (с примерами находок) в р-не Ботнического залива. Составил: А. Евсеев.

Британ. о-ва, Пиренейский п-в

Испания

Пирит (кр-лы до 6 см). Испания. Штуф более 30 см. Образец: "Русские минералы". "Гемма", 2014. 12. 06 . Фото: ╘ А.А. Евсеев

--- Sierra Albarrana, Hornachuelos, Cordoba \ Кордова, Андалузия; 38╟6'0"N;5╟27'39"W \\ Браннерит!! -кр-л 6х4х4 см-,\\ http://www.mindat.org/loc-125864.html \\ Anthony, J. W. et al. (1997): Handbook of Mineralogy, Vol. 3, 76 \\ уранинит ! - Calvo B., Gonzalez del Tanago Chanrai J., Gonzalez del Tanago y del Rio J., (1991), "Los minerales y la mineria de la Sierra Albarrana y su entorno", ENRESA. Madrid, 203 pp \\ www.mindat.org/

Слайд из лекции Э.М. Спиридонова "Кордиерит, эпидот, танзанит и др.". Минералогический ун-т. 2014.12.16. Фото: А. Евсеев

Португалия

З а п. Е в р о п а

Австрия \\

Альпы \\

Минералы Альп в фотографиях. По страницам книги Gramaccioli C. M. Minerali Alpini e Prealpini. Vol.1-2. Bergamo, 1975. - 473 p. \\ выборка: стр. (11) - 71-...

Кварц_япон. двойник (Monti Aju, Траверселла) - стрюверит-тапиолит - клиноцоизит -ксантоконт (Ленгенбах) - сарторит? - флюорит (Бавено) - кварц (Швейцария,с.141 [реверс?] ) - платтнерит - магнетит (2-Траверселла) - биндгеймит по бурнониту - доломит - вульфенит - апатит (розовый) - циркон (3, микро) - геленит! - уралит (пс-за)- рихтерит - циннвальдит - ксенотим - браннерит - клиноцоизит - гессонит

Идрия и другие местонахождения минералов Вост. Альп и прилегающих территорий (с примерами находок) . Составил: А. Евсеев. 2014.12.22

Альмандин. Этцталь\ Oetzthal, Тироль, Австрия. Образец: ФМ (╧49799. Передано государством, 1950). Фото: ╘ А.А. Евсеев

-- Горб, Лершелтини, Биннталь, Валлис \ Gorb, Lercheltini (Larcheltini), Binntal, Wallis (Valais), Швейцария \\ граезерит*

Гора Горб (в центре кадра). Бинн дол., Валлис, Швейцария. Фото: Д.Тонкочеев, 2014.

 

Бавария , Германия \\ Баден-Вюртемберг, Германия

Балканский п-ов

Бельгия \\

Болгария \\ минералов - 428; мин. видов - 353; нов. видов - 8; фото минералов - 556 (на 2011.11.01) \\ Источник: http://www.mindat.org/loc-14255.html

Венгрия

--Парадшашварит* - новый минерал - Nagy-Lapafo hill, Paradsasvar (Uveghuta), Matra Mtns, Heves Co., Hungary \\ http://www.mindat.org/loc-69177.html \\

--Надьбёржёни, Венгрия \ Nagyborzsony, Hungary \\ джонассонит*(Paar W.H. et al., 2006); пильзенит* (1853); sztrokaite *(1983)

Германия \\ фото минералов \\ http://www.mindat.org/rloc.php?loc=Germany \\ http://www.mindat.org/loc-14244.html)

Минералы Германии (примеры) - фото на страницах книги Bode R. , Wittern A. Mineralien und Fundstellen Bundesrepublik Deutschland. 1989. - 303 p. \\ стр.7, 107, 157- 287 \\ агат; арагонит; браунит; гаусманнит; гипс; корунд; лангит; левин; леонит; линарит; майенит; медь (2); меланит; миметезит; мусковит; мюккеит; родохрозит (4)(Herdorf и др.) ; рутил; серебро; стильбит; циркон (2); шабазит (Niederofleiden); штрунцит;

--Паттерсонит* - новый минерал \\ U. Kolitsch, H.-J. Bernhardt, W. Krause et al. (2008): Pattersonite, PbFe3(PO4)2(OH)4[(H2O)0.5(OH)0.5]2, a new supergene phosphate mineral: description and crystal structure. European J. Mineralogy 20, 281-288; Jahn, S. (2008): Pattersonit - ein neues Mineral von der Grube Vereinigung bei Eisenbach. Mineralien-Welt 19 (4), 26-29 (in German).

Стронциоджинорит. Kohnstein Quarry, Niedersachswerfen, Nordhausen, Гарц, Тюрингия, Германия. 12х8 см. Образец: Мин. музей им.А.Е. Ферсмана РАН. Фото: ╘ Д. Тонкачеев. \\ 33_5--Ге--Га

Италия \\ в миндат \\ \\ 2291 минералов \ entries listed. 1340 достоверных видов \valid minerals. 266 новых видов \ type localities (valid minerals). 5 type localities (others).(на 2011.07.30)

--Кварц "оконный" \ "fenster" \\ Porretta Terme, Болонья--фото

Сера. Ракальмуто, пров. Агридженто, Сицилия, Италия. Образец: А. Захаров. "Гемма", 2014. 12. 06 . Фото: ╘ А.А. Евсеев

--Фассинаит* - новый минерал из р-ка Трентини \ Trentini, пров. Виченца, Италия \\ Bindi, L., Nestola, F., Kolitsch, U., Guastoni, A. & Zorzi, F. (2011): Fassinaite, Pb2+2(S2O3)(CO3), the first mineral with coexisting thiosulphate and carbonate groups: description and crystal structure. Mineralogical Magazine, 75, 2721-2732. \\ Fassina, B., Rocchetti, I. & Boscardin, M. (2012): Fassinaite, una nuova specie minerale dal Vicentino. Rivista Mineralogica Italiana, 2/2012, 92-98.

--Лацио \\ Лигурия \\

Пьемонт, Сев. Италия \\

Валь д`Ала и другие местонахождения минералов Пьемонта и прилегающих территорий с примерами находок. Составил: ╘ А.А. Евсеев
Подробнее: Евсеев А.А. Атлас мира для минералога. М., 2004. - 284 с. Внимание: название и привязка (положение на карте) некоторых местонахождений требует уточнения (показаны на карте красными и коричневыми значками). Карты предназначены только для образовательных целей.

Тоскана

Карпаты

Македония

Польша \\

Румыния

Франция

Чехия \\

Швейцария \\

--Замечательные минералы (выбор Д. Тонкачеева): КВАРЦ (скрученный и "оконный"); ФЛЮОРИТ (розовый), АДУЛЯР; САРТОРИТ; АНАТАЗ; БРУКИТ; САРТОРИТ; КАФАРСИТ

--Фианель р-к, Граубюнден, Швейцария\ Fianel, Ausserferrera, Val Ferrera, Hinterrheintal, Graubunden \\ Brugger, J., Krivovichev, S., Meisser, N., Ansermet, S. & Armbruster, T. (2006): Scheuchzerite, Na(Mn,Mg)9[VSi9O28(OH)](OH)3 , a new single-chain silicate. American Mineralogist 91, 937-943.

Одна из закопушек [на кварц] в Швейцарских Альпах на высоте 2400 м. Фото: Д.Тонкочеев, 2014.

На работу - по реке. Берн, Швейцария. Одежда упакована в водонепроницаемые пакеты. Фото: Д. Тонкачеев, 2014..

Типичный швейцарский пейзаж в районе долины Бинн.Фото: Д. Тонкачеев, 2014..

Вост. Европа \\

Белоруссия \\

Украина \

-- Местонахождения минералов Украины от А до Я

Полезные ископаемые (2011)-- http://uazakon.ru/ \\ http://uazakon.ru-2 и т.д.

Украинский щит - геологические памятники - Google Maps

Волынь и СЗ Украина

Донбасс

Приазовье \\ Прикарпатье \\ Закарпатье

Молдавия

Евразия

Азия

Казахстан и Средняя Азия Казахстан и Средняя Азия_А-Я_местонахождения минералов (на карте)

Казахстан

--Жиланды м-ние "(оно известно также еще под названием Майкаин) расположено в Экибастузском районе Павлодарской области Казахстана западнее поселка Майкаи - http://www.insminerals.ru/Galer_Mayk.htm \\ Подробнее "Самоцветы Казахстана. Том I. Месторождения и проявления драгоценных и полудрагоценных самоцветов", Алмааты, 1999 г., стр. 60.

Бирюза. Майкаинское м-ние, Сев. Казахстан. Выставка-ярмарка "Мир камня" Санкт-Петербург. 2014. 12. 11. Фото: ╘ А.А. Евсеев.

--Синхизит \\ Cтепанов═В., Шульга═Г., Спиридонов═Э. Акцессорный синхизит из щелочных гранитов Шаншальского интрузива (Центральный Казахстан═// Тр. Минерал. музея АН СССР им. А.Е. Ферсмана. ≈ 1982. ≈ ╧═30. ≈ С.═147√154.

Средняя Азия \\

Киргизия \\

1. Груздевит. Чаувай, Киргизия. Образец: Мин. музей им.А.Е. Ферсмана РАН (╧80668. Спиридонов Э.М.). 2. Гетчеллит с вакабаяшилитом, кальцитом и флюоритом. Хайдаркан, Ю. Киргизия. Более 15х10 см. Образец: Минералогический музей МГРИ-РГГРУ, ╧543. Фото: ╘ А.А. Евсеев.

Таджикистан \\

Целестин. Сросток голубых призматических конвертообразных расщепленных кристаллов. Гулисай м-ние, 25 км к С от г. Куляб, Таджикистан. Более 15 см. Дар: Михейкин В.И,, 2014.05. Фото: А. Евсеев.

Памир

Карамазар рудный район, Сев. Таджикистан: Адрасман (Adrasman) --Алтын-Топкан--Кансай --Кураминский хр -- Чорух-Дайрон--

Туркмения \\

Узбекистан \\ Кызылкум \\

Работы сотрудников Минер. муз. им. А.Е. Ферсмана РАН в Сред. Азии в период 1998 - 2014 гг. Слайд из доклада Л.А. Паутова и др. 2014.12. 18.

Афганистан - http://www.mindat.org/

Пакистан

Кавказ, ЮЗ Азия \

Азербайджан \\ Армения \\ Грузия \\

Израиль \\ Ирак \\

Иран \\

--Зарех-Шуран (= Зерешуран = Заршуран) \ Zareh Shuran м-ние (As), ~35 км к С от г. Такаб, Иран; 36╟43`N, 47╟8`E \\ акташит; аурипигмент!!--xls<3 см; далиранит*; иорданит; галхаит; гетчеллит!--Bariand P. et al., 1968л; реальгар \\ РЖ "Геология" 9В338-1973 \\ ЕК

. Аурипигмент (почковидный!). Зарех-Шуран (=Заршуран) рудн. р-н, бл. г. Такаб, Вост. Азербайджан, Иран. ~5 см. Образец: Минер. музей РГГРУ(Р-516. Евсеев А., 2009)

Зарех-Шуран (Иран) и местонахождения минералов Закавказья (примеры).

ОАЭ \\ Йемен, Аравийский п-ов

Турция \\ минералы и местонахождения --см. http://www.mineralienatlas.de/

Индия, Непал, Шри-Ланка

Рубин с каймой кианита. Майсур (Майсор), Индия. Слайд из лекции Э.М. Спиридонова "Кордиерит, эпидот, танзанит и др.". Минералогический ун-т. 2014.12.16. Фото: А. Евсеев

Индия - http://www.mindat.org/loc-16773.html

Графит. Шри-Ланка. Образец: А. Захаров. "Гемма", 2014. 12. 06. Фото: ╘ А.А. Евсеев

Непал

Вост. Азия ( Китай и др.)

Китай \ China \\ www.mindat.org

--Ottens B. China: Mineralien, Fundstellen, Lagerstatten. Christian Weise Verlag. 2008, 552 pp.

Внутр. Монголия \\

--Суолун массив \ Suolun massif, Horqin Right Front Banner (Ke'erqin Youyi Qianqi), Hinggan League \\ суолунит!*

Ганьсу пров. \\

Гуандун \\

Гуанси-Чжуанский автономный район

Гуйчжоу \\

Синьцзян-Уйгурский автономный район; Китай

Вульфенит. Куруктаг \ Kuruktag, Синьцзян-Уйгурский автономный район; Китай. Кристаллы до 3 см. Образец: П. Давыдов. "Гемма", 2014. 12. 06 Фото: ╘ А.А. Евсеев

--Натровистантит* - Коктогай

Сычуань, Китай \\

Тибет \\ Фуцзянь, провинция \\ Хайнань , Китай \\ Хубэй

Хунань, провинция, Китай - http://www.mindat.org/loc-705.html

Цзянси пров.

Шаньси \\

Юньнань \ Yunnan \\ www.mindat.org

--Dayakou изумрудный р-к, Malipo Co., Wenshan, Yunnan \\ изумруд!-- фото--кр-лы в породе и голтовка - Ottens B., 2008, 51 \\ фото www.mindat.org

Флюорит_Китай и Монголия

Монголия

Вьетнам \\

Индонезия - см. http://www.mineralienatlas.de/

Камбоджа \\ Лаос \\

Мьянма (быв. Бирма) \\

Таиланд \\ Филиппины \\

Корунд. Щелочные базальты. Сапфир (Таиланд, Ю. Китай, Австралия). Слайд из лекции Э.М. Спиридонова "Корунд". Минералогический ун-т. Мин. музей им. А.Е. Ферсмана РАН.. 2014.12. 02.

ЮВ Азия

Япония \\ http://www.petrovrareminerals.com/articles02.html \\ http://www.mindat.org/loc-14488.htm

--Адачиит ( = адатиит) \ Adachiite*--новый минерал из группы турмалина - Киура р-к, Кюсю о., Япония \\ Nishio-Hamane, D., Minakawa, T., Yamaura, J., Oyama, T., Ohnishi, M., Shimobayashi, N. (2014): Adachiite, a Si-poor member of the tourmaline supergroup from the Kiura mine, Oita Prefecture, Japan. Journal of Mineralogical and Petrological Sciences, 109, 74-78.\\ http://www.mindat.org/min-43780.html

Корейский п-ов

Африка

Алжир \\ Гвинея \\ Египет \\ Мали \\

Марокко

Пренит. [Бендуку (близ)], Каес р-н, Мали \ [Bendoukou (Benduko)], Kayes Region. Более 30 см. Образец: "Русские минералы". "Гемма", 2014. 12. 07. Фото: ╘ А.А. Евсеев

Нигерия \\ Сенегал

Мавритания

--барит--сферическая конкреция (шар диаметром 5 см)--Tagant, Erg Aouker (Aoukar)--фото - http://www.baritespecimenlocalities.org/Africa.htm

Экв. и Южн. Африка

Ангола \\

-- South Cassinga, Lubango City Council, Huila Province, Angola \\ Гематит--фото--mdt; диадохит!!--фото--mdt

Габон

Замбия \ Zambia (ныне) = Сев. Родезия (быв.), Африка \--давидит!!!--фото

Изумруд. Кагем р-к. \ Kagem mine, Kafubu, Замбия. Слайд из лекции Э.М. Спиридонова "Группа берилла". Минералогический ун-т. Мин. музей им. А.Е. Ферсмана РАН.. 2014.11. 18. Фото: А. Евсеев.

Зимбабве \\

Бикита, Пенчелонга и соседние местонахождения минералов (Зимбабве и др.). Составил: А. Евсеев. 2014.12.30

Конго НР

Конго ДР (быв. Заир) \\ Buttgenbach H. Mineraux de Belgique et du Congo Belge. Liege, 1947, 590 p.

Намибия \\

═ Namibia I ═ by Ludi von Bezing, Rainer Bode, Steffen Jahn═(2014)

ЮАР

--Скоттиит* - новый минерал \\ Yang, H., Downs, R.T., Evans, S., Pinch, W. (2013): Scottyite, the natural analogue of synthetic BaCu2Si2O7, a new mineral from the Wessels mine, Kalahari Manganese Fields, South Africa. American Mineralogist, 98, 478√484.

--Cairncross, B. (2004) Field Guide To Rocks & Minerals Of Southern Africa:

Палабора и соседние местонахождения минералов Южной Африки. Составил: А. Евсеев. 2014.12.30

Вост. Африка \\ Бурунди \\ Кения

Мадагаскар \\ 516 минералов и разновидностей, 323 достоверных видов, 12 новых видов \\ 516 entries listed. 323 valid minerals. 12 type localities (valid minerals) на 2012.10.13 .\\ http://www.mindat.org/loc-2247.html \\ лондонит!!; родицит!!; скиавинатоит \ schiavinatoite*

Хибонит (= гибонит = ибонит) и сапфир в магнезиальных скарнах. Мадагаскар. Слайд из лекции Э.М. Спиридонова "Корунд". Минералогический ун-т. Мин. музей им. А.Е. Ферсмана РАН.. 2014.12. 02.

Малави \\

Руанда \\ минералы - http://www.mindat.org/loc-21896.html \\ местонахождения - http://www.mindat.org/rloc.php?loc=Rwanda

Сомали

Танзания \\ http://www.mindat.org/loc-4384.html \\ м-н-ния - http://www.mindat.org/rloc

--Маутиа-Хилл, Конгва, Додома регион, Танзания \ Mautia Hill, Kongwa, Kongwa District, Dodoma Region, Tanzania \\ иодерит*!--ф; магнезиохёгбомит*; пьемонтит--ф; \\ http://www.mindat.org/loc-3247.html

1. Алабандин. Мерелани-Хиллс, Аруша регион, Танзания. Образцы: Д. Лисицин. "Гемма", 2014. 12. 06 . Фото: ╘ А.А. Евсеев. 2. Рубин в метабазитах. Р-н г. Килиманджаро, Танзания. Слайд из лекции Э.М. Спиридонова "Корунд". Минералогический ун-т. Мин. музей им. А.Е. Ферсмана РАН.. 2014.12. 02.

Уганда

Эфиопия

Австралия \ Австралия и Новая Зеландия

Виктория \\ Западная Австралия \\

Квинсленд \\

--Day, B. and Beyer, B., 1995, Some mines of the Mt Isa district, Queensland; the Mt Cobalt mine. Australian Journal of Mineralogy 1(2): 17-23

Новый Южный Уэльс \\

Северная территория \\ Тасмания

Южная Австралия \\

Бурра-Бурра (Burra Burra), Капунда и соседние местонахождения минералов на ЮВ Австралии с примерами находок. Составил: А. Евсеев \\ ЮАв

 

--ангастонит* - новый минерал--Angaston, South Australia \\ Mills, S. J., Groat, L. A., Wilson, S. A., Birch, W. D., Whitfield, P. S. & Raudsepp, M. (2008): Angastonite, CaMgAl2(PO4)2(OH) 4╥7H2O, a new phosphate mineral from Angaston, South Australia, Mineralogical Magazine. 72 (5): 1011√1020

Новая Зеландия

Ю ж н о е п о л у ш а р и е

З а п а д н о е п о л у ш а р и е

Северная Америка

Канада \\ Trail R. J. Catalogue of Canadian Minerals. Revised 1980. Geol. Surv. of Canada Paper 80-18, 1983, 483 p.

США \\ http://www.mineralienatlas.de/lexikon/index.php/USA

American Mineral Treasures [Сокровища минералов Америки]. 2008. - 380 p. \\ Подробнее: http://www.lithographie.org/bookshop/hc_american_mineral_treasures.htm

Топографическая минералогия ( литература о местонахождениях по штатам) \\ http://www.minsocam.org/

Сев. Америка (С)

Аляска \\ Нунавут

Северо-Западные территории \ North-West Territories, Канада

Юкон

Биг-Фиш-Ривер и Рапид Крик, Юкон

Гренландия \\

Местонахождения минералов о. Диско и прилегающих территорий (Гренландия и Баффинова Земля). Составил: А. Евсеев, 2014.12.30

 

Сев. Америка (В)

Сев. Америка (В)_находки крупных кристаллов (10 см и более)

Айова

Барит. Линвуд, округ Скотт, Айова, США \ Linwood Mine, Buffalo, Scott Co., Iowa. Образец: А. Захаров. "Гемма", 2014. 12. 06. Фото: ╘ А.А. Евсеев \\ Ай--НМК-125

Вермонт \\ Виргиния \\ Висконсин \\ Джорджия \\ Иллинойс

Индиана, США \\ http://www.mindat.org/loc-16287.html \\ более 100 фото минералов из осадочных пород (доломит, миллерит!!; целестин!; флюорит! и др.) www.mindat.org/gallery

Квебек \\ Манитоба

Массачусетс \\

Гроссуляр. South street, Carlisle, Middlesex, Массачусетс, США. Образец: Мин. музей им.А.Е. Ферсмана РАН (╧93571. Дар: Wall Suzan, 2011). Фото: ╘ А.А. Евсеев \\ НМК-125

Миннесота \\ Миссури \\ Мичиган \\ Мэн \\

Маунт-Майка \ Mount Mica, ~2 км к СВ от Парис \ Paris, округ Оксфорд, Мэн, США \\ *коснарит\ kosnarite (1993)--xls<0,9 мм; *макриллисит \ mccrillisite (Foord E.E. et al., 1994); эльбаит!!≈зеленый; BG, 10

Ньюри (Newry), округ Оксфорд, Мэн, США \\ Ньюри округ Оксфорд, Мэн, США \\ амблигонит!!; бериллонит!!; петалит!; эльбаит!!

Новая Шотландия, Канада \\ Нью-Гэмпшир, США \\

Нью-Джерси, США - http://www.mindat.org \\

Нью-Йорк \\

Онтарио\ Ontario, Канада \\

--Лангис майн (р-к), Онтарио, Канада--бравоит; зигенит; кобальтпентландит; лангисит*; паркерит; \\ Petruk, W., Harris, D.C., and Stewart, J.M. (1969) Langisite, a new mineral, and the rare minerals cobalt pentlandite, siegenite, parkerite, and bravoite from the Langis mine, Cobalt-Gowganda area, Ontario, Canada. Canadian Mineralogist: 9: 597-605.

Пенсильвания, США - http://www.mindat.org/loc-14026.html \\

Сев. Каролина \\

Теннесси \\ Флорида

Сев. Америка (З)

Айдахо, США \\

Альберта, Канада \\

Аризона, США \\ Вульфенит Аризоны

Арканзас, США \\ Вайоминг, США

Колорадо, \\ http://www.mindat.org/rloc

--Gypsum Valley District, San Miguel Co., Колорадо \\ корвусит*; паскоит!(ф); ферванит*; штейгерит*! \\ Источник: http://www.mindat.org/

Монтана \\ поиски сапфиров--видео \\ Gobla, M.J. (2012) Montana mineral locality index. Rocks & Minerals, 87, #3, 208-240.

Невада \\ Нью-Мексико, США \\

Blanchard Mine, Bingham, Hansonburg District, Socorro Co., New Mexico, USA ; 33╟48'42"N; 106╟22'30"W \\ линарит!!!

Техас, США \\

Южная Дакота, США \\

--Никель-Плейт майн (Sn) - в пегматитах \ Nickel Plate mine, Keystone, Блэк-Хиллс, округ Пеннингтон, Ю. Дакота; 43╟53'1"N;103╟24'45"W ; ~3-4 км от горы Рашмор, где в граните высечен гигантский барельеф - скульптурные портреты четырех президентов США \\ арроядит-(KFe)* - новый минерал; касситерит! --РГ (о) \\ http://www.mindat.org/loc-4118.html

Никель-Плейт майн (Sn) и соседние местонахождения минералов в Блэк-Хиллс (Ю. Дакота, США). Составил: А. Евсеев.

Юта, США \\

Долина Монументов, Repete Mine и соседние местонахождения минералов запада США (с примерами находок) - . Составил: А. Евсеев.

 

--Ларисаит - новый минерал из Юты (США) \\ Chukanov, N.V., Pushcharovsky, D.Yu., Pasero, M., Merlino, S., Barinova, A.V., Mockel, S., Pekov, I.V., Zadov, A.E., Dubinchuk, V.T. (2004): Larisaite, Na(H3O)(UO2)3(SeO3)2O2.4H2O, a new uranyl selenite mineral from Repete mine, San Juan County, Utah, U.S.A. European Journal of Mineralogy, 16, 367-374.

--Невадаит* - новый минерал \\ Cooper, M.A., Hawthorne, F.C., Roberts, A.C., Foord, E.E., Erd, R.C., Evans, H.T., Jr., and Jensen, M.C. (2004) Nevadaite, (Cu 2+,?,Al,V 3+)6[Al8(PO4)8F8](OH)2(H2O)22, a new phosphate mineral species from the Gold Quarry mine, Carlin, Eureka County, Nevada: Description and crystal structure. Canadian Mineralogist: 42(3): 741-752.

--Нестолаит* - новый минерал \\ Kasatkin, A.V., Plasil, J., Marty, J., Belakovskiy, D.I., Lykova, I.S. (2014): Nestolaite, CaSeO3╥H2O, a new mineral from the Little Eva mine, Grand County, Utah, USA. Mineralogical Magazine, 78, 497-505.

-- Blue Cap mine \\ магнезиопаскоит*; мартиит*; постит*

--Kampf, A.R. & I.M. Steele (2008): Martyite, a new mineral sppecies related to volborthite: description and crystal structure. Canadian Mineralogist 46, 687-692.

--Kampf, A. R., Mills, S. J., Merlino, S., Pasero, M., McDonald, A. M., Wray, W. B., & Hindman, J. R. (2012). Whelanite, Cu2Ca6 [Si6O17 (OH)](CO3)(OH) 3 (H2O)

--Kampf, A. R., Hughes, J. M., Marty, J. and Nash, B. (2012), Postite, IMA 2011-060, Canadian Mineralogist: 50(1): 45-53.

Bawana Mine (Old Hickory mine), Rocky Distr., Юта, США \\ брошантит--ф; Stringhamite (TL); Whelanite (TL)

Бавана майн и соседние местонахождения минералов запада США (с примерами находок). Составил: А. Евсеев.

Сев. Америка (Кордильеры)

Британская Колумбия, Канада - http://www.mindat.org/loc-14311.html

Вашингтон, США \\

Орегон

Яшма "Биггс". Орегон, США . Выставка-ярмарка "Мир камня" Санкт-Петербург. 2014. 12. 07. Фото: ╘ А.А. Евсеев

 

Калифорния, США \\ http://www.mindat.org/loc-3424.html \\ фото \\ Калифорния_минералы по контуру \\

--Индерит--xl 25х3 см--округ Керн, Калифорния--Gui-72, 110

--Отто Маунтин \ Otto Mountain--13 нов. минералов (agaite*; bairdite*; ottoite; thorneite*; timroseite* и др)

Отто Маунтин и соседние местонахождения минералов Калифорнии (США). Составил: А. Евсеев.

Гавайские о-ва \ Hawaii, Тихий океан; США \\

Мексика

Мексика - 9 минералов \\ Мексика_крупные кристаллы \\ Мексика_крупные кристаллы_5 с

--обсидиан радужный - шт. Сан-Луис-Потоси--Буканов, 2008, 285

--Целестин!! -1) La Paz, Sierra del Fraile, San Luis Potosi, Mexico--фото - www.mindat.org/ 2) Luz Mine, La Paz, Mun. de Villa de La Paz, San Luis Potosi, Mexico--группа крупных (до 10 см) кристаллов - фото - www.mindat.org/

Розазит. Охуэла р-к, Дуранго, Мексика. "Гемма", 2014. 12. 06. Фото: ╘ А.А. Евсеев

Центральная Америка

Куба

Южная Америка

Ю. Америка (СЗ)

Венесуэла \\ Гайана \ Guyana \\ Колумбия \\

Аргентина. \\

Боливия \\

Перу \\

Ангидрит (торговое название "ангелит"). Арекипа \ Arequipa, Перу. Более 8 см.. Выставка-ярмарка "Мир камня" Санкт-Петербург. 2014. 12. 07. Фото: ╘ А.А. Евсеев. \\ 33_29

Анаурипигмент с реальгаром на аурипигменте. Паломо р-к, Кастровиррейна, Уанкавелика, Перу. ~10 см. Образец: ФМ (╧93546. Левицкий В.В., Аносов М.Ю., Никифоров А.Б., Белаковский Д.И., 2011). Фото: ╘ А.А. Евсеев.

--Кварц--японские двойники - -Flor de Peru I claim (Tentadora Mine), Mt Ullpac (Mt Ollupac), Pampa Blanca, Castrovirreyna District, Castrovirreyna Province, Huancavelica Department, Peru

--Паломо р-к, Кастровиррейна пров., Уанкавелика деп., Перу--анаурипигмент*; антимонит!!; аурипигмент!!; зелигманнит!--ф; реальгар!!--xls<3,5 см-ф \\ http://www.mindat.org/loc

Чили \\

--Bojar, H.-P., Walter, F. (2013): Joanneumite, Cu(C3N3O3H2)2(NH3)2, a new mineral species with ammine and isocyanurate group. Poster, MinPet 2013, September 19-23; abstract in Mitt. Osterr. Mineral. Ges. 159 (in press) [http://erdwissenschaften.uni-graz.at/aktuelles/veranstaltungen/minpet2013/downloads/ThirdCircular2013_Final.pdf]

 

Бразилия \\ минералы -787 ; достоверные виды - 601 \ 620; новые виды - 51 \ 53; местонахождения \ localities - 843 \ 1008 ; фото минер. √ 5430 \ 6613; фото мест √ 74 \ 115 (на 2009.08.05 \ 2010.05.06) \\ Источник: http://www.mindat.org/loc-366.html \\ http://www.mindat.org/rloc.php?loc=Brazi

Минералы Бразилии в фотогорафиях (по страницам книги Cornejo C., Bartorelli. A. Minerals & Precious Stones of Brazil. - Sao Paulo, 2010. - 704 p.\\ выборка--с. 15-25-35. \\ (2) -кол-во фотографий..

--АГАТ (3); АКВАМАРИН (2); АЛМАЗ (727 кар.), АМЕТИСТ (2); апатит; БЕРИЛЛ; БРАЗИЛИАНИТ*; висмут; гётит; гидраргиллит; ГОРНЫЙ ХРУСТАЛЬ; гранат;

--дымчат. кварц; золото (5) - xls; изумруд ; индиголит; карбонадо; КВАРЦ --"фантомы"; корунд; крокоит; КУНЦИТ; купроэльбаит (="параибаит = ""heitorite") ; лепидолит (2)

--медь; метеориты(2); МИКРОКЛИН; минасжерайсит-(Y)*; монацит; натролит; нефрит (изделие); ортоклаз; опал благородный (Piaui); пироморфит; платина; рубеллит (2); рутил; селлаит!!--xls<3 см; силлиманит (издел.);

--танталит(Mn\ Fe); титанит; ТОПАЗ (3); фенакит; халькопирит ; шабазит; шеелит; ЭВКЛАЗ; ЭЛЬБАИТ (5)--Вв т.ч. полихромный на обл.

Слайд из лекции Э.М. Спиридонова "Группа берилла". Минералогический ун-т. Мин. музей им. А.Е. Ферсмана РАН.. 2014.11. 18. Фото: А. Евсеев.

Баия, Бразилия

Альмейдаит\ Almeidaite--новый минерал---кр-лы до 3 см--м-ние не указано, Novo Horizonte \\ Luiz A.D. Menezes Filho, L.A.D., Chukanov, N.V., Rastsvetaeva, R.K., Aksenov, S.M., Pekov, I.V., Chaves, M.L.S.C., Scholz, R., Atencio, D., Branda?o, P.R.G., Romano, A.W., de Oliveira, L.C.A., Ardisson, J.D., Krambrock, K., Moreira, R.L., Guimara?es, F.S., Persiano, A.C. and Richards, R.P. (2013) Almeidaite, IMA 2013-020. CNMNC Newsletter No. 16, 2013, page 2705; Mineralogical Magazine, 77, 2695-2709.

--Карнаиба м-ние , Баия, Бразилия \\ ЕК \\ Sinkankas, 384-385 \\ (1989л)

Минас-Жерайс

--Morteani, G., Preinfalk, C., and Horn, A.H. (2000): Classification and mineralization potential of the pegmatites of the Eastern Brazilian Pegmatite Province. Mineralium Deposita 35, 638-655.

--Коррейяневишит \ Correianevesite\ Chukanov, N.V., Scholz, R., Zubkova, N.V., Pekov, I.V., Belakovskiy, D.I., Van, K.V., Lagoeiro, L., Graca, L.M., Krambrock, K., de Oliveira, L.C.A., Menezes Filho, L.A.D., Sa Carneiro Chaves, M.L., Pushcharovsky, D.Y. (2014): Correianevesite, Fe2+Mn2+2(PO4)2╥3H2O, a new reddingite-group mineral from the Cigana mine, Conselheiro Pena, Minas Gerais, Brazil. American Mineralogist, 99, 811-816

--Руифранкоит - новый минерал \\ D. Atencio, et al (2007): Ruifrancoite, a new Fe3+-dominant monoclinic member of the roscherite group from Galileia, Minas Gerais, Brazil. Canadian Mineralogist, 45, 1263-1273.

--Линдбергит* - новый минерал \\ Atencio, D., Coutinho, J. M.V., Graeser, S., Matioli, P. A., Menezes Filho, L. A. D. (2004): Lindbergite, a new manganese oxalate dihydrate from Boca Rica mine, Galileia, Minas Gerais, Brazil, and Parsettens, Oberhalbstein, Switzerland. Am. Mineral., 89, 1087-1091.

--THE PEDERNEIRA TOURMALINE MINE IN BRASIL JUNE 2010 - видеосюжет

Лепидолит. Крузейру р-к \ Cruzeiro Mine, Минас-Жерайс, Бразилия. Слайд из лекции Э.М. Спиридонова "Самоцветы гранитных пегматитов". Минералогический ун-т. Мин. музей им. А.Е. Ферсмана РАН.. 2014.12. 09.

--Сигана р-к \ Cigana mine-коррейяневесит = коррейяневишит \ Correianevesite* - новый минерал--Чуканов Н., 2014

Сигана р-к \ Cigana mine, Линополис и соседние местонахождения минералов (Минас-Жерайс, Бразилия). Составил: А. Евсеев

Параиба \\ Пиауи (Piaui), шт., Бразилия (СВ) \\ благородный опал (D)

Риу-Гранди-ду-Норти, Бразилия \\

Риу-Гранди-ду-Сул, Бразилия \\

Аметистовая жеода с перегородками - псевдоморфозами халцедонаа по кальциту. Риу-Гранди-ду-Сул, Бразилия. Слайд из лекции Э.М. Спиридонова "Кварц и иные минералы кремнезёма". Минералогический ун-т. Мин. музей им. А.Е. Ферсмана РАН. 2014.10. 21. Фото: А. Евсеев.

-- Ираи

Сан-Паулу

Парагвай \\ Уругвай

Антарктида \\

Карта полезных. ископаемых и др.\\ Горная энциклопедия (статья)

Вокруг Антарктиды (прилегающие территории)_минералогические находки

Тихий океан \\

Новая Гвинея о., Океания, Тихий океан; Индонезия \ Папуа - Новая Гвинея \\ второй по величине остров Земли (после Гренландии)

Новая Каледония -- геология и пол. ископаемые

Гавайские о-ва \ Hawaii, Тихий океан; США \\

Фиджи, Тихий океан

Южное полушарие

 

Весь мир

Минералогические находки вокруг света - "Фото дня \ За месяц вокруг света". 2014.11.25 - 2014.12.31. Выбор сюжетов производится мной по порядку листов на карте мира (см.): 1-ого числа каждого месяца - с листа ╧1 ("Исландия"), 2-ого - с листа ╧2 и так до 31-ого числа - с листа ╧31 ("Антарктида") \\ А. Евсеев

Минералогические находки вокруг света ("Фото дня". Ноябрь-декабрь 2014 г.) . Составил: А. Евсеев.

Находки минералов по листам карты мира: 1234567 891011121314151617181920212223242526272829303132 - 33

Всемирная минералогия-32 - по одному минералу от региона

А.А. Евсеев. Минералогические находки вокруг света вдоль 40-ой параллели. - Минералогический альманах, т.13, 2008, с. 76-85.
\\ Краткий вариант статьи \\ Полный текст статьи \\ Фотогалерея \\

--Кристаллы пяти континентов_экспозиция в Минералогическом музее им. А.Е. Ферсмана РАН \\ текст

--Минералы- спутники на расстоянии (минералы-телеспутники)

--Журнал "Вокруг света" - http://www.vokrugsveta.ru/

--Институт географии РАН _Информационный портал

МИНЕРАЛЫ \

5 замечательных находок \ Европа - Азия - Африка - Австралия - Сев. Америка - Южн. Америка (выборка: по одному образцу из северной, южной, западной, восточной и центральной части каждого региона). Случайная выборка

Вторые находки минерала в мире, ставшие лучшими

"Сборные" минералов по странам и регионам (10-15 избранных находок) \\ 1-е -в 2007 г.

По 2 минерала от континента за 2 минуты (экспресс-опрос)

Ареалы находок минералов (основные находки ряда минералов, вынесенные на карту мира)

Кристаллы пяти континентов_выставка в Минералогическом музее им. А.Е. Ферсмана РАН

--Евсеев А.А. Географическая привязка первоначальных местонахождений минералов. \\ Новые данные о минералах. М.: ЭКОСТ, 2003. Вып. 38, с. 113-124.

--А.А. Евсеев. Минералогические находки вокруг света вдоль 40-ой параллели с. ш.

Океаны

Острова (от Гренландии до Мадагаскара) \ минералогические находки

Луна \\ минералогия - http://luna-mineralogiya.ru/index.html

АВТОРЫ \ \ А √ Л | М - Я | A - Z Анастасенко| | Г.П. Барсанов || И.В. Бельков || В.И. Вернадский || А.В. Волошин || В.И. Воробьев | Гиймен К. \ Guillemin C.| | А.А. Годовиков || Б.З. Кантор | К.И. Клопотов || Ю.С. Кобяшев || П.А. Кочубей | Крыжановский В.И. || А.Н. Лабунцов | М.Н. Малеев || В.А. Мальцев || Л.А.Паутов || И.В. Пеков || В.А. Пелепенко || В.В. Пономаренко | | В.А. Слётов | Э.М. Спиридонов | | В.И. Степанов | А.Е. Ферсман | А.П. Хомяков || Б.В. Чесноков || Н.В. Чуканов || Н.П. Юшкин и другие

Из публикаций: А - Б - В - Г - Д - ЕЁ - Ж - З - И - К - Л - М - Н - О - П - Р - С - Т - У - Ф - Х - Ц - Ч - ШЩ - ЭЮ - Я - AZ \\ A - B - C - D - E - F - G - H - I - J - K - L - M - N - O - P - Q - R - S - T - U - V - W - X - Y - Z

Бетехтин А.Г. Минералогия. ≈ М.: Государственное издательство геологической литературы, 1950. ≈ 956 c. \\ веб-публикация

Смирнов В.И. Геология полезных ископаемых ≈ M.: ╚Недра╩, 1982. ≈ 669 c. \\ веб-публикация

Ферсман А.Е. . Путешествия за камнем \\ http://lib.rus.ec/b/284737/read#r10 (веб-публикация)

Фото и монтаж: А. Евсеев.

МИР КАМНЯ В ЛИЦАХ

Исследователи самоцветов Сибири - http://lavrovit.ru/?page_id=271

Заблоцкий Е.М. Биографический словарь деятелей горной службы дореволюционной России --сетевая версия - http://russmin.narod.ru/dictionary.htm

lБиографии минералогов и коллекционеров -см. The Mineralogical Record Biographical Archive - http://www.minrec.org/labelarchive.asp

Биографии ученых Геовики

1. В.Н. Яковенчук. Апатиты. Кольский п-ов (2012). 2. Антон Чирков. Санарка, Южн. Урал (2013). Фото 1-2: А. Евсеев

1. Г.П. Барсанов. 2. М.Б. Чистякова и М.Д. Дорфман. Слайд из доклада Л.А. Паутова и др. 2014.12. 18.

Георгий Павлович Барсанов (1907.12.23 (29?) - 1991), замечательный минералог и педагог, специалист в области истории минералогии, зав. каф. минералогии МГУ, директор Минералогического музея им. А.Е. Ферсмана АН СССР. В его честь назван минерал георгбарсановит (сначала был назван барсановитом).

Г.П. Барсанов - выпускник ЛГУ (1930), с 1931 - сотрудник ЛИГЕМ. В1937-1941 преподавал в Московском институте цветных металлов и золота (МИЦМиЗ). Участник Великой Отечественной войны, после тяжелого ранения демобилизован, в 1943 защитил кандидатскую диссертацию по минералогии Ильменских гор. Доктор наук (1947), в 1952-1976 - директор Минералогического музея АН СССР, в 1953-1986 - зав. кафедрой минералогии МГУ, в 1960-1964 - вице-президент Международной минералогической ассоциации. Труды по минералогии редких элементов. Источник: http://srcc.msu.su/uni-persona/vernadsky/1936.htm

 

Слайд из доклада Л.А. Паутова и др. 2014.12. 18. (Фото: А. Евсеев)

Совместный полевой отряд Минер. муз. им. А.Е. Ферсмана РАН и Института геологии АН РТ на морене ледника Дараи-Пиёз. Слайд из доклада Л.А. Паутова и др. 2014.12. 18.

Дмитрий Тонкачеев в районе м-ние Фалотта. Швейцария, 2014.\\ То--Шв --Ал

Минералоги-любители и Филипп Рот (слева), бывший директор карьера Ленгенбах. Валлис, Швецария.. Фото: Д. Тонкачеев, 2014.

ДЕКАБРЬ \ в тот день

В. А. Пелепенко - создатель Уральского минералогического музея (Екатеринбург). Мин. музей МГРИ-РГГРУ. 2014.12. 05. Фото: А. Евсеев. Мин. музей МГРИ-РГГРУ. 2014.12. 05. Фото: А. Евсеев.

Новогодние поздравления от коллег из музея "Земля и люди" (София)

На Чистых прудах. 2014. 12. 31. Фото: ╘ А.А. Евсеев.

В ТОТ ГОД...

1914 г. - открыто м-ние Чаувай, (Ю. Киргизия)

1977 г.

1. В.И. Степанов и Т.И. Матросова документируют образцы. 2. В.И. Степанов в поисках анапаита. Железный Рог, Тамань, юг России. 1977. Фото 1-2: А. Евсеев

В.И. Степанов - фото 1980-х и 1944 г. Анапаит. Железный Рог, Тамань, юг России. Образец: Мин. музей им.А.Е. Ферсмана РАН (Сбор В.И. Степанова 1977 г.. ST6726). Выставка к 90- летию со дня рождения В.И. Степанова. Фото: ╘ А.А. Евсеев.

 

2013 г . - находка на Южном Урале замечательных кристаллов вивианита.

Вивианит с сидеритом на кварце. Светлинское м-ние (Au), к ЮЗ от г. Пласт, Ю. Урал, Россия. Кристалл более 6 см. Образец: Мин. музей им.А.Е. Ферсмана РАН (╧94327. Дар: С.В. Колисниченко, 2014). Фото: ╘ А.А. Евсеев

 

"Гемма" - 2014.12.06-07

Родохрозит (Китай), кавансит (Индия), сера (Италия) и др. Образцы: А. Захаров. "Гемма", 2014. 12. 06. Фото: ╘ А.А. Евсеев

С. Голомолзов и образец арагонита (Абаил м-ние, Ю. Казахстан). "Гемма", 2014. 12. 06. Фото: ╘ А.А. Евсеев

Декоративные и поделочные камни. Образцы: Ю. Цыганков. "Гемма", 2014. 12. 06 Фото: ╘ А.А. Евсеев

Рисунчатый камень и флорентийская мозаика. "Гемма", 2014. 12. 06 Фото: ╘ А.А. Евсеев

Студентки-геологи Заира Абазова (слева), Маша Зайцева и Вероника Санфирова. "Гемма", 2014. 12. 07. Фото: ╘ А.А. Евсеев

Организаторы выставки. "Гемма", 2014. 12. 07. Фото: ╘ А.А. Евсеев

Михаил Аносов, Людмила Чешко и Михаил Бахин. "Гемма", 2014. 12. 07. Фото: ╘ А.А. Евсеев

Михаил Моисеев, Татьяна Павлова и Андрей Захаров. "Гемма", 2014. 12. 07. Фото: ╘ А.А. Евсеев

2014.12. 09.

Ракин В.И. делает доклад "Морфология алмазов уральского типа (анализ полярного комплекса)" Минер. муз. им. А.Е. Ферсмана РАН. 2014.12. 09. Фото: А. Евсеев . \\ НМК-125

2014. 12. 11-14.

Выставка-ярмарка "Мир камня" 11-14 декабря 2014 г. , Ленэкспо (павильон ╧8), Санкт-Петербург. Фото: ╘ А.А. Евсеев

В.В. Буканов (справа) представил свою новую энциклопедию "Цветные камни и коллекционные минералы", а также получил "Гран-при" за переданные им образцы в Минералогический музей МГРИ-РГГРУ. Выставка-ярмарка "Мир камня" Санкт-Петербург. 2014. 12. 07. Фото: ╘ А.А. Евсеев.

Михаил Мурашко знакомится с новой энциклопедией В.В. Буканова "Цветные камни и коллекционные минералы. Выставка-ярмарка "Мир камня" Санкт-Петербург. 2014. 12. 07. Фото: ╘ А.А. Евсеев.

М. Мурашко (слева), В. Буканов и В. Левицкий. У входа на выставку-ярмарку "Мир камня" Санкт-Петербург. 2014. 12. 07. Фото: ╘ А.А. Евсеев

2014.12.18 -

18 декабря в Минералогическом музее им. А.Е.Ферсмана РАН состоялся день Благодарения - собрание, посвященное дарителям музейных экспонатов - Минер. музей им.А.Е. Ферсмана РАН_2014.12.18_День благодарения

В программе

1. Л.А. Паутов рассказывает о работе музея в Средней Азии. 2. Невадаит. Ходжа-Рушнай-Мазар. 2-я находка в мире. Обнаружен сотрудниками Минер. муз. им. А.Е. Ферсмана РАН. Слайд из доклада Л.А. Паутова и др. 2014.12. 18.

Слайд из доклада Д. И. Белаковского. 2014.12. 18

Поступления в коллекции Минер. муз. им. А.Е. Ферсмана РАН за 2014 г. Слайд из доклада Д. И. Белаковского. 2014.12. 18

 

Минер. муз. им. А.Е. Ферсмана РАН. 2014.12. 18. Фото: А. Евсеев

М.А. Юдовская, Д. Белаковский и В. Гаранин (за кадром). Минер. муз. им. А.Е. Ферсмана РАН. 2014.12. 18. Фото: А. Тирский

В. Гаранин (слева) и М. Аносов. Минер. муз. им. А.Е. Ферсмана РАН. 2014.12. 18. Фото: А. Тирский

А. Касаткин (справа) и В.К. Гаранин. Минер. муз. им. А.Е. Ферсмана РАН. 2014.12. 18. Фото: А. Евсеев .

 

Ира Гриценко получила диплом за образец кварца с Алдана (фото ниже). Минер. муз. им. А.Е. Ферсмана РАН. 2014.12. 18. Фото: А. Тирский

Кирилл Власов. Минер. муз. им. А.Е. Ферсмана РАН. 2014.12. 18. Фото: А. Тирский

И. Чаплыгин (слева). Минер. муз. им. А.Е. Ферсмана РАН. 2014.12. 18. Фото: А. Тирский

Тост от Дмитрия Дубкова. Минер. муз. им. А.Е. Ферсмана РАН. 2014.12. 18. Фото: А. Тирский

А. Фриденберг (слева) и А. Жаров. Минер. муз. им. А.Е. Ферсмана РАН. 2014.12. 18. Фото: А. Тирский

МИНЕРАЛОГИЧЕСКИЙ УНИВЕРСИТЕТ

2 декабря . Э.М. Спиридонов. Корунд (рубин, сапфир и др.) \\ 2014.12.02. Минералогический университет \\ пробная веб-трансляция

На лекции Э.М. Спиридонова "Корунд". Минералогический ун-т. Мин. музей им. А.Е. Ферсмана РАН.. 2014.12. 02. Фото: А. Евсеев.

Э.М. Спиридонова после лекции "Корунд". Минералогический ун-т. Мин. музей им. А.Е. Ферсмана РАН.. 2014.12. 02. Фото: А. Евсеев.

 

Минералогический университет. 2014.12.16

2014.12.16 Минералогический университет

16 декабря

Э.М. Спиридонов .

Кордиерит, эпидот, танзанит и др.

2014.12.16. Минерал. ун-т

2014.12.02. Минерал. ун-т \\ пробная веб-трансляция

2014.10.28. Минерал. ун-т

2014.10.21. Минерал. ун-т

Танзанит. Трихроичный кристалл. Слайд из лекции Э.М. Спиридонова "Кордиерит, эпидот, танзанит и др.". Минерал. ун-т. 2014.12.16. Фото: А. Евсеев

23 декабря 2014 г. - Борисов А.А. Что такое геохимия?

 

КЛУБ ДРУЗЕЙ МИНЕРАЛОГИИ

4 декабря, четверг, 17 ч. Григорий Иванов (Апатиты) представил фильм "Они шли на Север" (об истории освоения Хибин) . Встреча в Мин. музее им. А.Е. Ферсмана РАН (Ленинский пр., 18 кор.2. Тел. 8 (495) 954-39-00

4 декабря 2014 г. в клубе друзей минералогии состоялся просмотр фрагментов нового документального фильма "Они шли на Север" (об истории освоения Хибин). Идея фильма: Григорий Иванов и Татьяна Никуличева.

Григорий Иванов представляет фильм "Они шли на Север". Клуб друзей минералогии. Мин. муз. им. А.Е. Ферсмана РАН. 2014.12. 04.

Григорий Иванов представляет фильм "Они шли на Север". Клуб друзей минералогии. Мин. муз. им. А.Е. Ферсмана РАН. 2014.12. 04.

1. Первый автомобиль в Хибинах. 1920-ые гг. 2. Е.Б. Халезова рассказывает о жизни в Хибинах в 1930-е гг. Кадры из фильма "Они шли на Север". \\ XX-в.

Кадры из фильма "Они шли на Север"

1. Журналистка Татьяна Никуличева. 2. В заброшенной штольне Ловчорритового рудника (2014 г.). Кадры из фильма "Они шли на Север"

Григорий Иванов (в центре) и др. Минер. муз. им. А.Е. Ферсмана РАН. 2014.12. 04. Фото: Л.А. Чешко.

⌠В ЗЕРКАЛЕ КАМНЯ■

\\ И. Анненский \\\ И. Бродский \\ И.А. Бунин \\ Ю.И. Визбор \\ М.А. Врубель \\ В.С. Высоцкий \\ П.А. Вяземский \\ И.-В. Гёте \\ И.А. Гончаров \\ \\ А.C. Пушкин \\ И. Северянин \\ Л. Толстой \\ А.П. Чехов \\ Агат \\ Алмаз \\ Апатит \\ Бирюза \\ Жемчуг \\ Опал \\ Топаз \\

Антуан де Сент-Экзюпери

Я занимаюсь будущим, как ваятель: он ударяет резцом по глыбе мрамора, высвобождая свое творение. Отлетает осколок за осколком, за которыми пряталось лицо бога. Кто-то скажет: "В мраморе уже был этот бог. Ваятель нашел его. Нашел, умея работать резцом". А я говорю вам: ваятель не рассчитывал и не находил. Он работал с камнем. Не капли пота, не блеск мелькающего резца заставили улыбнуться мрамор. Улыбаться умел ваятель. Освободи человека, и ему захочется творить.

ххх

-- Дело не в чьей-то глупости, -- говорил отец. -- Дело в словах, которые передают пустяки, не достойные внимания. Приучи себя не вслушиваться в ветер слов и не вникай в рассуждения, которыми обманывают себя люди. Будь проницателен. Ненависть совсем не бессмысленна. Пока каждый камень не встал на место, храма нет. Но когда все камни на месте и служат храму, значимы только тишина и молитва. И к чему тогда вспоминать о камнях?

ххх
Но кто в силах показать людям новое царство? Кто из дробности мира может мощью своего гения создать новую картину и заставить людей всмотреться в нее? Всмотреться и полюбить? Нет, не логик, а художник, ваятель. Ваятелю не нужны словесные ухищрения, он наделяет камень силой будить любовь.

ххх

Я ничего не скажу тебе словом "гора", если ты путешествовал только в паланкине, если не обдирал руки о шипы на склоне, если из-под ног у тебя не катились камни, если ветер на вершине не дул тебе в лицо.

Цитадель \\ http://www.lib.ru/EKZUPERY/citadel.txt

Кино

Золотые призы Московского международного кинофестиваля 1975 г. ( шары из сиреневого камня, названного позже чароитом). получили фильмы ╚Земля обетованная╩ (Польша, режиссёр Вайда), ╚Дерсу Узала╩ (СССР, режиссёр А. Куросава), ╚Мы так любили друг друга╩ (Италия, режиссёр Э. Скола).. На верхнем фото Э. Скола, А. Куросава, А. Вайда с оригинальными призами. \\ XX в -ча

28 декабря - Международный день кино. В этот день в 1895 г. в Париже состоялся первый публичный киносеанс.

"Какой художественный фильм вы можете смотреть с любого места?" . Блиц-опрос среди геологов, минералогов и др. Отвечали: Г.Ю. Абрамов, И.А. Абрамова, Д.И. Белаковский, А.Ю. Беляков, М.А. Богомолов, Е.А. Борисова, Б.Е. Боруцкий, В.К. Гаранин, М.Е. Генералов, В.Ю. Герасимов, А.П. Горбатова, Т.Ю. Должанская, А.А. Евсеев, А. Жаринов, В. Зервандова, В.Ю. Карпенко, А.Е. Корольков, В.Е. Лашнева, Л.А. Матвеева, Е.Н. Матвиенко, А.В. Мелешин, М.М. Моисеев, И.В. Пеков, С. Петракова, М.Ю. Поваренных, А. Парфёнов, О.Л. Свешникова, Э.М. Спиридонов, А.Н. Тимофеев, В. Трусов, А.Г. Турчкова, Е.Б. Халезова, В. Химчук и др.

Зарубежные фильмы

СТРАНЫ от А до Я

находки минералов по листам карты мира: 1234567 891011121314151617181920212223242526272829303132 - 33

 

НЕ ТОЛЬКО МИНЕРАЛЫ: А - Б - В - Г - Д - Е - Ж - З - И - К - Л - М - Н - О - П - Р - С - Т - У - Ф - Х - Ц - Ч - ШЩ - Э - Ю - Я

местонахождения минералов - | - mineral localities : А Б В ГДЕ Ж З И Й К Л М Н О ПР С Т У Ф Х Ц ЧШ Щ Э Ю Я || A B C D E F G H I J K L M N O P R S T U V W X Y Z
Сев. Америка (С)

Гренландия

Атлантика - Скандинавия - Кольский п-в

Урал
Ср. Сибирь
Якутия
СВ России

Сев. Америка (З - Сев. Америка (Кордильеры)

Сев. Америка (В)

Британ. о-ва, Пиренейский п-в - Зап. Европа - Вост. Европа

Казахстан, Ср. Азия

Юг Сибири
Забайкалье, Вост . Сибирь
Камчатка - Дальний Восток (Россия, Япония
Мексика
Кавказ, ЮЗ Азия
Афганистан, Пакистан
Индия
Монголия. Китай
ЮВ Азия - Тихий океан
Ю. Америка (СЗ) - Кордильеры
Бразилия

Африка - Сев. и Зап.Экв. и ЮжнВост.

Антарктида
Австралия

Тихий океан - Весь мир

янв
фев
март
апр
май
июнь
июль
авг
сен
окт
нояб
дек
2004
2005
2006
2007
2008
2009
2010
2011
2012
2013
╧104 ╧112
2014 ╧114
2015
╧126                    
обновление: 2015. 02. 08

╘ Александр Евсеев, 2003 - 2015. ╘ Фото: принадлежит авторам, 2015