старт
где? - АЯ - где?-1 - что?- АЯ-
кто?
когда?
литература---W
Новый мир камня
ФМ = МФ- В зеркале камня
клуб

геовики - Р-коллекция

фототека
новое фото
новое на сайте- 2016
музеи | сокращения
обновление: 2016. 07. 02

местонахождения А Б В ГДЕ Ж З И Й К Л М Н О ПР С Т У Ф Х Ц ЧШ Щ Э Ю Я || A B C D E F G H I J K L M N O P R S T U V W X Y Z \\ регионы мира: 1234567 891011121314151617181920212223242526272829303132 - 33 || Россия \ Европа \ Азия \ Африка \ Австралия \ Северная Америка \ Южная Америка \

ВСЕ КАМНИ МИРА143 - В ДВЕ СТРОКИ

или НОВЫЙ МИР КАМНЯ \ ИЮНЬ, 2016

Кальцит (3 генерации), пирит (по крупным кристаллам кальцита). Пршибрам, Чехия. Более 25 см. Образец: Мин. музей им.А.Е. Ферсмана РАН (дар: А. Маресьев). Фото: ╘ А.А. Евсеев.\\ НМК-143

янв
фев
март
апр
май
июнь
июль
авг
сен
окт
нояб
дек
2004
2005
2006
2007
2008
2009
2010
2011
2012
2013
╧104 ╧112
2014 ╧114
2015
╧126 ╧131
2016
           

МИНЕРАЛЫ и не только на druza: А - Б - В - Г - Д - Е - Ж - З - И - К - Л - М - Н - О - П - Р - С - Т - У - Ф - Х - Ц - Ч - ШЩ - Э - Ю - Я \\ Алфавитный список минералов (на geo.web.ru/druza)

см.на www.mindat.org \ A-B-C-D-E-F-G-H-I-J-K-L-M-N-O-P-Q-R-S-T-U-V-W-X-Y-Z

Минералы от A до Z - список IMA (Международной минералогической ассоциации)- http://pubsites.uws.edu.au/ima-cnmnc/

Комиссия по новым минералам, номенклатуре и классификации - http://pubsites.uws.edu.au/ima-cnmnc/ \\ The Commission on New Minerals, Nomenclature and Classification (CNMNC) of the International Mineralogical Association (IMA) was formed in July 2006 by a merger between the Commission on New Minerals and Mineral Names (CNMMN) and the Commission on Classification of Minerals, at the request of both commissions

Алфавитный список_ минералы: от А до Я (на русском языке) - более 4000 минералов ( 4976 страниц категории "Минералы") на http://wiki.web.ru/wiki/ \\ http://webmineral.com/Alphabetical_Listing.shtml

Все минералы мира (от A до Z) \ All Minerals of the World / Tous les mineraux de la terre http://euromin.w3sites.net/mineraux/accueil.html

Алфавитный список_ минералы от A до Z (на английском языке) и фото минералов - http://www.mineralatlas.com/ \\ фото минералов - http://www.cs.cmu.edu/~adg/adg-home.html (на сайте Alan Guisewite ) Список минералов - http://en.wikipedia.org/wiki/List_of_minerals

Фото: А. Евсеев

А -

Авантюрин \\

Авгит

1. Авгит. Акбайтал р. (Южный), Музкольский хр., Вост. Памир, Таджикистан (1994). 2х1,5х2,5 см. Образец: Минер. музей МГРИ-РГГРУ(Р-2516. Из колл. А.Е. Задлва, 1994, ╧0563). 2. Авгит (кристаллы до 2-3 см) из туфов Восточно-Африканского рифта. Образец: Мин. музей им.А.Е. Ферсмана РАН (╧91248. От Петрогрографического музея ИГЕМ РАН. Дар, 2002). Фото 1-2: ╘ А.А. Евсеев. 3. Авгит. Sierra Cuadrada deposit, El Sombrero, Paso de Indios Department, Chubut, Argentina. 10х7мм. Образец и фото: Raul Jorge Tauber Larry. This image has been released to the public domain and may be used freely. Это изображение было передано в общественное достояние и может свободно использоваться.═Источник: www.mindat.org

Агат

Адамин \\ Адуляр \\

Азурит \\

Аквамарин \\ Алмаз \\

Алтаит* ════ PbTe

Альбит \\ Альмандин

Амазонит \\ Вохменцев А. Я., Остроумов М. Н., Попов В. А. и др. Амазонит. М.: Недра. 1989. √ 192 с.

Аметист

Анатаз \\ Андалузит \\

Андрадит

Андрадит. Синереченское м-ние, Приморье, Россия. Более 5 см. Образец: Минер. музей МГРИ-РГГРУ (Евсеев А., 2016. Сбор: "Кристалл-Декор", 1980-е гг.) \\ НМК-143

Апатит-(CaF) \ Apatite-(CaF) - наиболее обычный (распространенный) минерал в группе апатита.

Апофиллит \\

Арагонит \\

Арагонит. Абаил м-ние, Ю. Казахстан. Более 40 см. Образец: ФМ (╧46672). Фото: ╘ А.А. Евсеев.

 

Арсенопирит \\ Астрофиллит \\

Ахтарандит

Б -

Бабингтонит

Базы данных: http://www.mindat.org/ (на 2011.09.25) \\ http://webmineral.com

Барит \\

Берилл \\

Бериллий_минералы \\ Библиография (популярные издания о камнях)- http://basik.ru/forum/index.php?showtopic=77

Библиотеки --РОССИЙСКАЯ ГОСУДАРСТВЕННАЯ БИБЛИОТЕКА--http://search.rsl.ru/ru

Бирюза

Боксит

Боксит. М-ние "Красная шапочка", Сев. Урал, Россия. Более 50 см. Образец: Минер. музей им. А.Е. Ферсмана РАН (╧38914. 17 МГК, 1938). Фото: ╘ А.А. Евсеев. "Фото дня" на сайте. 2016.06.07.

Бор_минералогия и геохимия

Борнит

В -

Вад - смесь порошковатых, рыхлых оксидов и гадроксидов марганца (КМС)

Вазы из поделочного камня \\ Ванадинит \\

Веб-сайт

-- http://petrographica.ru

Везувиан \\

--AMABILI, M. (2013) The best vesuvianite specimens from the Jeffrey mine. Mineralogical Record, 44, 423-431.

Вивианит

Викимапия \ Wikimapia (карты мира и России)

Виллиомит \\

Включения в минералах и драг. камнях \

Волконскоит* \\ Вольфрамит.

Воробьевит

Вторая находка минерала в мире

ВУЛКАНЫ \ минералогические находки

Вульфенит \\

Выставки минералов и поделочных камней

--ЗАНИМАТЕЛЬНАЯ МИНЕРАЛОГИЯ■ В КАМНЕ ...Подробнее (pdf)

Г -

Галенит \\

Галит \\

Гельвин

Гематит \\

Генезис минералов

--Попов В.А. Практическая генетическая минералогия. - Екатеринбург: УрО РАН, 2011.- 167 с.

Геовикипедия \ GeoWiki Всё о геологии - http://wiki.web.ru/

Гётит \\

Гигантские и крупные кристаллы (индивиды) \\ См.: А.Е. Ферсман. Величина природных кристаллов // Природа, 1925, ╧ 10/12, стлб. 103; его же. Кристаллы-гиганты и монолиты-гиганты // Природа, 1926, ╧ 3/4, стлб. 86≈88; его же. Пегматиты. Т. I. Гранитные пегматиты. M.≈Д., 1940.

1. Касситерит (кристалл ~15х12х8 см). Кара-Су, Туркестанский хр. (С), Киргизия. (╧50580, Гинзбург А.И., 1950). 2. Натролит. Путеличорр, Хибины, Кольский п-ов, Россия. Кристалл 30х11х12 см. (╧56544, Бородин Л.С., 1954). Образец 1-2: Мин. музей им. А.Е. Ферсмана РАН Фото 1-2: ╘ А.А. Евсеев.

 

Кварц скрученный. Пуйва г., Припол. Урал, Россия. Образец: Мин. музей им. А.Е. Ферсмана РАН (╧ 40913, Леммлейн Г.Г., 1939). Фото: ╘ А.А. Евсеев..

Шеелит. Mina Turmalina, Piura, Перу (Turmalina mine, Canchaque, Huancabamba Province, Piura Department, Peru -www mindat.org). 15х10 см. Подпись: "Самый крупный кристалл в мире". Образец: Museo Andres del Castillo (Лима, Перу). Источник: видеофильм V Aniversario del Museo de Minerales "Andres Del Castillo" (смотреть - www.youtube.com) \\ См. также фото - www.mindat.org \\ о шеелите - Hyrsl, J. and G. del Castillo (2013) Scheelite from the Turmalina mine, Peru. Mineralogical Record 44:437-440

Гигантские кристаллы гипса. Найка, Чиуауа, Мексика \ Cave of Crystals, Naica Mine, Naica. This image has been released to the public domain and may be used freely. Это изображение было передано в общественное достояние и может свободно использоваться.Фото: Alexander Van Driessche. Источник: https://en.wikipedia.org/wiki/Cave_of_the_Crystals \\ Fisher, R.D. (2006): Die grossten Gipskristalle der Welt: "Crystal Cave of the Giants" in Naica, Mexiko. LAPIS 31 (11), 33-36 (нем.)

Гипс \\

Горная энциклопедия - http://www.mining-enc.ru/ \\ http://dic.academic.ru/contents.nsf/enc_geolog/

Горный хрусталь \\

Гроссуляр

Д -

Данбурит \\ Датолит \\

Двойники \\ http://folk.ntnu.no/krill/mineralogee/8.htm \\

Декоративный камень

Демантоид \\

--Мексика \\ Cerro De La Concordia, Piedra Parada, Mun. de Tatatila, Veracruz, Mexico--кристаллы (до 6 мм) на породе -- фото - www.mindat.org

Дендриты

Детский мир камня \\

Г.В. Сонин проводит экскурсию школьников. Геолог. музей им. А.А. Штукенберга, Казанский ун-т. 2015.05.23. Фото: ╘ А. Евсеев

 

--Геологическая школа МГУ -- О полевых практиках и экспедициях

--Школьный факультет РГГРУ - МГРИ

--Клуб юных геологов им. академика В.А. Обручева (Санкт-Петербург) - http://www.anichkov.ru/departments/lyceum/geology

--Ферсман А. Е. Путешествия за камнем. М. 1960 (веб-публикация) :

--Ферсман А.Е. Занимательная минералогия (веб-публикация) \\ читать

Доломит \\

1. Доломит. Сросток полупрозрачных ромбоэдров. Памплона, Наварра, Испания. ~10 см. (╧72240, Montal J., 1969). 2. Дравит. Доброва \ Dobrowa, Каринтия, Австрия. 5 см. (К-2558. Передано государством, 1949). Образец 1-2: ФМ. Фото 1-2: ╘ А.А. Евсеев.

Дравит \\

Драгоценные камни (д.к.)≈литература о них (по минералам): http://www.geol.msu.ru/departments/mineral/Rus/Edu/deposit_liter_r.htm \\ списки месторождений по минералам (сост. И.А. Бакшеев) - http://www.geol.msu.ru/departments/mineral/Rus/Edu/deposits_r.htm

--Горная энциклопедия - о д.к.

--Пыляев М. И. ╚Драгоценные камни, их свойства, местонахождения и употребление╩ \\ http://www.vadim-blin.narod.ru/book/titl.htm \\ указатель (быстрый поиск по ключевым словам) - http://www.vadim-blin.narod.ru/book/glossary.html

Драгоценные камни (самоцветы)_география находок

--Генетическая минералогия драгоценных камней (лекции Э.М. Спиридонова) - http://spiridonov.mineralog.com/

--Самые дорогие драгоценные камни \ top 10 most expensive Gemstones in the world - https://www.youtube.com/watch?v=UV-jYew4Ous

Дымчатый кварц

Е -

Еремеевит

Ж -

Живопись в камне

Журналы для минералогов и коллекционеров \\ The Mineralogical Record, \\ Rocks & Minerals \\ Le Regne Mineral \\ Mineraux et Fossiles \\ Lapis \\ Mineralien Welt \\ Rivista Mineralogica Italiana \\ Revista de Minerales \\ MineralUp\\ Bocamina \\ UK Journal of Mines and Minerals

З -

Закономерные срастания

Заратит--см. фото выше

Золото

Самородное золото. Два первых снимка. Вверху. Окатанный сросток кристаллов. Александровский прииск, окрестности Южно-Енисейска, Ср. Сибирь Внизу. Сросток кристаллов. Россыпи Невьянской дачи, Средний Урал, Россия. Образцы: Минер. музей им. А.Е. Ферсмана РАН. Источник и подробнее: https://www.fmm.ru/gallery.htm

 

И -

Изумруд \\ Ильваит \\

Ильменит \\

Индивиды и агрегаты \\ Годовиков А.А., Степанов В.И. Формы нахождения минералов. М. 2003. \\ Макагонов Е.П.Симметрия сростков минеральных индивидов. Наука 1991

Инструмент

Искусственные кристаллы \ минералы

Исландский шпат

История минералогии ( находки, открытия и др.)

К -

Календари с минералами

Кальцит

Кальцит (3 генерации), пирит(по крупным кристаллам кальцита). Пршибрам, Чехия. Более 25 см. Образец: Мин. музей им.А.Е. Ферсмана РАН (дар: А. Маресьев). Фото: ╘ А.А. Евсеев.\\ НМК-143

 

Камень в городе \\

Садовое кольцо, Москва. Фото: А.А. Евсеев, 2016.

Камень\ минерал в доме

Камералка минералога \\

Карбонаты

Карта мира - http://maps-of-world.ru/inter.htm \\ http://geography_atlas.academic.ru/

Картирование, минералогическое

Карты \\ http://www.marshruty.ru/ \\ http://wikimapia.org/country/ \\ http://www.openstreetmap.org/ \\ http://ru.wikipedia.org/wiki/OpenStreetMap-- Карты мира, стран и городов - http://planetolog.ru/ \\ http://mapper.infomine.com/ \\ http://www.veslo.ru/maps.html

--http://wikimapia.org/

--карта мира и минералы (фото) - http://fotki.yandex.ru/users/ilm/map/view/recent

Касситерит \\

--Разновидность касситерита - "Деревянистое олово"

Каталоги минералогических коллекций

Кварц \\ публикации - http://www.quartzpage.de/info_lit.html -- Экспресс-опрос -2011 (кварц) (на ответ давалось 2-3 мин. )

--Кварц по странам мира - http://www.mindat.org/mesg-95-139699.html

--Кварц псевдокубический --фото - www.mindat.org \\ Artesia, Eddy Co., New Mexico, USA--ф-мд \\ Tarr, W.A. y Lonsdale, J.T. (1929). Pseudo-cubic quartz crystals from Artesia, New Mexico. American Mineralogist, 14, 50-53.

--Кварц--скипетровидный и обратные скипетры \\ Liliana Mine, Mun. de Chihuahua, Chihuahua, Mexico

Кварц с включениями

Клинохлор \\

Книги для минералогов и коллекционеров

--http://www.crystalclassicsminerals.com/books.php

Книжная полка минералога и коллекционера

Barlow F.J., Jones R.W. and LaBerge G.L. (editors) The F. John Barlow Mineral Collection. Sanco Publishing, Appleton, WI, 1996, 408pp. \\ http://www.amazon.com/F-John-Barlow-Mineral-Collection/

 

Коллекционирование минералов

Степанов В.И. Шкала качества образцов (разработана им в 1970-ые гг.)

-- http://www.strahlen.org/

Колумбит \\

Конкреции \\ Остров Чампа, Земля Франца-Иосифа и другие места - http://nnm.me/blogs/thread1/myachi-bogov/

--Сребродольский Б.И. Конкреционные образования в серных месторождениях. - Конкреции и конкреционный анализ. -Л., 1970, 118-121.

Кораллы \\

Кордиерит \\

Кордиерит и гранат в сланце. ═San Fenancio Mine, Estancia Anchilla, Tafi del Valle Department, Province of Tucuman, Argentina. 80х80 см. Фото: Raul Jorge Tauber Larry.This image has been released to the public domain and may be used freely. Это изображение было передано в общественное достояние и может свободно использоваться.═Источник: www.mindat.org

 

Корунд \\ сайт, посвященный корунду - http://www.corunduminium.com/index1.html.

Кремень \\

Кристаллы и сростки

Кристобалит \\ Куприт

Л -

Лабрадор \\

Лабунцовит

Лазулит \\

Лазурит \\

Лампрофиллит \\ Ловозеро, Кольский п-ов, Россия--индивиды до 20 см (Pekov, 1998) \\ Сент-Илер массив, Квебек, Канада - всего 2 фото для знаменитого местонахождения (и для всей Канады)--кр-лы до 2 мм-- в www.mindat.org

Лепидолит \\

Лёд \\ http://www.mindat.org/min-2001.html \\ фотогалерея

Лёллингит \\ Линарит \\ Линарес*, Испания (mindat.org )

Литература о минералах и драгоценных камнях \\ Из публикаций о минералах зарубежных стран \\ Из публикаций о минералах России, а также СССР

Наша библиотека - Геологический музей им. В.В.Ершова - http://ershov-geomuz.narod.ru/libr.htm

Литература по геологии в бибиотеке ДВГИ ДВО РАН. \\ http://wiki.fegi.ru/index.php/

Ломонтит \\

Лопарит

 

Лоренценит

Любители камня

Люминесцирующие (флюоресцирующие минералы) - тема выставки выставки Минер. музея им.А.Е. Ферсмана РАН

М -

Магнетит \\

Малахит

Малахит. Катанга пров., ДР Конго (быв. Заир). Более 70 см. Образец: Музей естеств. истории Татарстана. Фото: ╘ А. Евсеев.

Марки \\ минералы на марках - Minerals on Stamps

Медь и минералы меди

Месторождения

Метахьюэттит

Метеориты \\

--"Палласово железо" - видео - https://www.youtube.com/

Микроклин

Миндат.орг\ www.mindat.org - - крупнейшая база данных о минералах и местонахождениях. Её основатель - Джолиан Ральф \ Jolian Ralf . Минералогический альманах \ Mineralogical Almanac (Россия \ Russia) \ http://www.minbook.com/mineralogical_almanac_ru.html Минералогия_для студентов (фото минералов и рисунки кристаллов)- http://geoserv.krc.karelia.ru/geo/rus/ht

Минералогический альманах -

--Новые выпуски

--В мире минералов. Минералогический Альманах, том 21, выпуск 1, 2016. Подробнее..

Минералогические словари

-- Кривовичев В.Г. Минералогический словарь - http://bibl.gorobr.ru/book/248/book.html (веб-публикация)

Минералогия

--Бетехтин А.Г. 'Курс минералогии' - Москва: Государственное издательство геологической литературы, 1951 - с.543 --веб-публикация

--Корбел П. и Новак М. . МИНЕРАЛЫ. Иллюстрированная энциклопедия. М.: "Лабиринт Пресс", 2004. - 296 с.

МИНЕРАЛЫ (справочник) ------- http://www.geokniga.org/collections/3607 \\ т.2, вып.2

--Силикаты√справочник ═краткий указатель - http://geo.web.ru/druza/m-miner_A-Ya_sil.htm

--Минералы. Справочник. Том 3. Выпуск 1. Силикаты с одиночными и сдвоенными кремнекислородными тетраэдрами. Содержание

Минералы - спутники на расстоянии \\ Евсеев А.А. Минералы - спутники на расстоянии (2): Отдельные статьи Горного информационно-аналитического бюллетеня. - ╧12. - М.: Издательство "Горная книга", 2009. - 35 с.

Митридатит \\

Мозаика \\

Мрамор \\

Мраморный оникс

М у з е и

--

О.Л. Свешникова (слева) рассказывает о работе над экспозицией, посвященной минералам альпийских жил. Минер. музей им. А.Е. Ферсмана РАН. 2016.06.02. Фото: А. Евсеев.

На открытии обновленной экспозиции, посвященной минералам альпийских жил. Минер. музей им. А.Е. Ферсмана РАН. 2016.06.02. Фото: А. Евсеев.

Минералогический музей имени Александра Ферсмана РАН - видео https://www.youtube.com/watch?v=BGdq13i4T9w

--Masterpieces of the Mineral World: Treasures from the Houston Museum of Natural Science Hardcover √ November 1, 2004
by Wendell E. Wilson (Author), Joel A. Bartsch (Author), Mark Mauthner (Author)

World Directory of Mineral Collections (Second Edition) Pieter C. Zwaan; Ole V. Petersen . Published by═Commission on Museums of the International Mineralogical Association,, Copenhagen, 1977

Россия

-- Минер. музей им. А.Е. Ферсмана РАН, Москва

-- Музей ╚Самоцветы╩ (Москва) - http://gemmuseum.ru

--Миасс \\ Рассомахин М.А. НОВЫЕ ПОСТУПЛЕНИЯ В ЕСТЕСТВЕННО-НАУЧНЫЙ МУЗЕЙ ИЛЬМЕНСКОГО ЗАПОВЕДНИКА

- читать - baseserv.ilmeny.ac.ru/(pdf)

--Нижний Тагил \\ Нижнетагильский музей-заповедник "Горнозаводской Урал". Адрес:═622000,═Свердловская область, г.═Нижний Тагил, пр. Ленина, 1 ═\\ Телефон:═(3435) 41-6401 \\ Нижнетагильский музей-заповедник был основан в 1841 г. П.Н. Демидовым. Это один из старейших музеев страны, хранитель прошлого "Железной столицы России". Источник и подробнее: http://www.museum.ru/m972

Перу

--Музей Андрес дель Кастильо \ Museo Andres del Castillo (Лима, Перу) \\ Jr. De La Union 1030. Lima 1. Peru T .511.433.2831
museo@mdh.com.pe \\ museo@madc.com.pe \\ сайт музея - http://www.madc.com.pe/esp/index.html \\ видео (на испанском языке) - www.youtube.com

--Экспозиция "Минералы Перу" - http://www.madc.com.pe/esp/exposicion_minerales_peru.html

Museo ANDRES DEL CASTILLO - Lima Peru \\ Источник: видео https://www.youtube.com/watch?v=azuBQ5N2cQM

1. Ферберит, кварц. Мундо Нуэво, Ла Либертад, Перу. 2. Барит, родохрозит. Huarihuayin, Huanuco, Перу. Образец 1-2: Museo Andres del Castillo (Лима, Перу). Фото 1-2: ╘ М. Алексеев.

США

Минералогический музей. Гарвардский университет. Источник: видеосюжет - https://www.youtube.com/watch?v=Rfm1QLe8rlk \\

Экспозиция минералов из музея Гарвардского университета на Westward Look Show (Тусон-шоу-2015) \ Harvard Museum of Natural History Exhibit at 2015 Westward Look Show - https://www.youtube.com/watch?v=p7a9SkVDfJ8 -

1. Боб Джонс рассказывает о минералах из коллекции Гарвардского университета. 2. Эльбаит ("арбузный"). Dunton mine, Ньюри, Мэн, США. Образец: Минер. музей Гарвардского у-та═ \ Источник: www.youtube.com/

Н -

Названия и привязка местонахождений минералов

--Географические названия России (в том числе, месторождений полезных ископаемых) - http://russia.yaxy.ru/subdmn/russia/geo-nm.html

Названия минералов

- Беусит, открытый в пегматитах Аргентины, назван в честь советского минералога и геохимика Алексея Александровича Беуса (1923 - 1994), ученого секретаря ИМГРЭ и зав. отделом геохими на первом этапе развития института (1956-1966 гг.).

1. Беусит (массивный коричневый), литиофилит (темный). La Empleada Pegmatite, Coronel Pringles Department, San Luis, Argentina. 5 x 4,5 x 1,6 см. Образец и фото: Fernando Brederodes. This image has been released to the public domain and may be used freely. Это изображение было передано в общественное достояние и может свободно использоваться.═ Источник: www.mindat.org 2. Беусит. Кырк-Булак, Туркестанский хр., Киргизия. Образец: Мин. музей им.А.Е. Ферсмана РАН (╧57458. Гинзбург А.И., 1955). Фото: ╘ А.А. Евсеев.3. А.А. Беус (фото из статьи М.Д. Дорфмана, 1994).

Биотит назван в 1847 г. в честь французского физика, математика, метеоролога, астронома и минералога Жана-Батиста-Био, который изучал оптические свойства слюд. \ Named in 1847 by Johann Friedrich Ludwig Hausmann in honour of the French physicist, mathematician, meteoriticist, astronomer, and mineralogist, Jean Baptiste Biot [April 21, 1774 Paris, France - February 3, 1862 Paris, France], who studied the optical properties of the micas. Biot and his associate, Felix Savart, discovered that an electric current in a wire produced a magnetic field. Biot received many awards in his lifetime in recognition of the value of his scientific researches. \\ Источник: www.mindat.org

1. Биотит. Риколатва, Кольский п-ов, Россия. Более 20 см. Образец: Минер. музей РГГРУ (Р-300. Дар: И.В. Пеков, 2008). Фото: ╘ А.А. Евсеев. 2. Жан-Батист Био \ Jean Baptiste Biot [April 21, 1774 Paris, France - February 3, 1862 Paris, France]. Фото: www.mindat.org \\ Подробнее о Ж.-Б. Био - на ru.wikipedia.org

Ненашева С.Н. МИНЕРАЛЫ, НАЗВАННЫЕ В ЧЕСТЬ СОТРУДНИКОВ МИНЕРАЛОГИЧЕСКОГО МУЗЕЯ ИМ. А.Е. ФЕРСМАНА РОССИЙСКОЙ АКАДЕМИИ НАУК - http://geo.web.ru/druza/m-Mus-FM_pers_m.htm

---Имена минералов. Как их называют Леенсон И.А. (╚Химия и Жизнь╩, 2012, ╧1) \\ веб-публикации: \\ Имена минералов. Как их называют январь╧1 \\ Кто открыл, кто синтезировал? - февраль╧2 \\ Петрологи, геологи, минералоги, кристаллографы - март╧3 \\ Химики, физхимики и один математик - апрель ╧4 \\ Еще немного химиков и физхимиков - ╧5 \\ Космонавты, коллекционеры, поэты - ╧6

Митчелл Р.С. Названия минералов. Что они означают? - М.: "Мир", 1982. - 248 с.

Натролит

Натюрморт с камнем

Недра - http://www.rosnedra.com/

Нефелин

Новое на сайте (по декабрь 2012)

Новые книги и публикации \\ см. также www.minbook.com/02.12.2016.(авторы со своими новыми книгами)

--Каталог экспозиции Геологическогого музея им. В.В. Ершова. - М., НИТУ "МИСиС", Горный институт, 2016.- 140 с. Составлен Т.В. Дубровской, А. Е. Корольковым.

--100 новых минералов, открытых А.П. Хомяковым. М., ИМГРЭ, 2016.

--Cурков А.В. Шальное золото тайги. - М.: Волшебный фонарь. 2016. - 322 с.

--Minerals and Their Localities -- THIRD EDITION by Jan H. Bernard and Jaroslav Hyrsl \\ Hardcover, 912 pages 3 edition, 2015. Published by Granit
ISBN 978-80-7296-098-9 \\ Источник и подробнее: www.mineralogicalrecord.com

--Moore's Compendium of Mineral Discoveries 1960-2015 by Thomas P. Moore. \\ 1644 pages ═1 edition, 2016. Published by Mineralogical Record, Inc.\\ Источник и подробнее: www.mineralogicalrecord.com/

 

Новые минералы--обзор за февраль-май 2012 г. - http://www.mindat.org/forum.php

Новые минералы - примеры находок по регионам мира: 1234567 891011121314151617181920212223242526272829303132 - 33 . Составил: А. Евсеев \\ 33_33

--Дорфман М.Д. Итоги открытия и изучения новых минералов в СССР. - Тр. Минералогического музея им. А.Е. Ферсмана.АН СССР, 1971, вып. 20, с.9-13.

Новые поступления в Мин.муз. им. А.Е. Ферсмана РАН

О -

Облицовочные камни \\

Обсидиан

Одноимённые местонахождения \ Одноименные географические названия

Окенит \\ Окно (камень у окна) \\

Онтогения минералов

--Жабин А.Г. Онтогения минералов: Агрегаты. М.: Наука, 1979. С. 276.

--Краснова Н.И., Петров Т.Г. Генезис минеральных индивидов и агрегатов. Санкт-Петербург: Невский курьер, 1997. С. 228.

Опал

Определение (диагностика) минералов

Ортоклаз

Открытки с камнем

П -

Первая находка минерала в быв. СССР и России

Пегматиты

- Ферсман А.Е. Пегматиты. М.: Изд-во АН СССР, 1940. Т.1.

Переименования (географических названий)

Перидот \ хризолит

Песок и минералы россыпей \\ Петалит

Пирит!! \\

1. Пирит. Березовское м-ние, Ср. Урал, Россия. 2. Пироморфит. Близ города Яншо (Yangshuo), 60 км к Ю от города Гуйлинь (Guilin),═Guangxi, Китай. Размер образца 7 см. Образец 1-2: Мин. музей им.А.Е. Ферсмана РАН . Фото 1-2: ╘ А.А. Евсеев

 

Пироморфит \\

Пироп \\ http://www.mindat.org/min-3321.html \\ фото (27) - http://www.mindat.org/gallery.php?min=3321

Пирротин

Пирротин, кальцит. Дальнегорск, Приморье, Россия. Более 8 см. 2. Пирротин. Дальнегорск, Приморье, Россия (╧87738). Образец 1-2: Минер. музей им. А.Е. Ферсмана РАН. Фото 1-2: А. Евсеев

Плагиоклазы\\ \\ альбит \\ анортит \\ беломорит \\ клевеландит \\ лабрадор \\

Поделочные камни \\ Полевые шпаты \\

Породообразующие минералы

Пренит - http://www.mindat.org/min-3277.html \\ фото (1002) - http://www.mindat.org/gallery.php?min=3277 - на 2009.05.27

Псевдоморфозы \\ фотогалерея - http://www.mineralatlas.com/specials/pseudo.htm

Псевдоморфозы. 1. Халцедон по морским лилиям. Более 8 см. Карьер "Северный", Комсомольского РУ, Приазовье \ Донбасс, Донецкая обл.. Образец: П. Мартынов (╧315). Фото: А. Евсеев. \\ Замещенный халцедоном известняк. Остатки морских лилий выглядят как шурупы за счет растворения члеников лилий. Остается халцедоновый слепок пространства между этими члениками. (по описанию сходного образца в ФМ). 2. Пирит по раковинам брахиопод девонского периода (псевдоморфозы). Округ Льюкас \ Lucas Co ., Огайо, США. Образец: Минер. музей им. А.Е. Ферсмана РАН (ОП-1875 и др. Приобретение 1991 г .). Фото: ╘ А.А. Евсеев.

Публикации

--The Mineral News, 2004-2007 \\ Указатель публикаций по авторам \ местонахождениям \ минералам

Р -

Разнообразие минералов Софийский симпозиум

Региональная минералогия (заметки)

Р-коллекция \\ В феврале 2008 г. в Минералогическом музее РГГРУ (Москва) были записаны первые образцы в новую тематическую коллекцию "Региональная и всемирная минералогия" (сокращенно - Р-коллекция).

Резной камень \\

Рисунок и живопись в камне \\ http://www.minrec.org/artmuseum.asp

Роговая обманка \\

Родонит \\

Родохрозит \\

Ртуть \\ Рутил

С -

Самарскит

 

Сапфир \\ Сапфирин \\

"Сборные" минералов по странам и регионам (10-15 избранных находок) \\ 1-е -в 2007 г .

Селенит (разн. гипса) \\ Сера \\ Серандит \\

Серебро \\ silver - mindat --фото (1189), местонахождения (3716) -- на 2009.11.15

Силикаты от А-Я_краткий указатель к справочнику "Минералы"(том.III-V)

Симметрия в геологии, минералогии и не только

Скаполит \\ Скелетные кристаллы

Скипетровидные кристаллы (в том числе обратные скипетры аметиста \ reverse sceptre из Боливии ( Esperanza Mine, near Bombori, Nor Potosi Province, Potosi Department) \\ http://www.mindat.org/ \\ http://www.mindat.org/photo-284819.html

Сколецит

Словари

--Кривовичев В.Г. Минералогический словарь.- СПб.: Изд-во С.-Петерб. ун-та, 2008. - 556 с. --СЛОВАРЬ МИНЕР. ВИДОВ - веб (В.Г. Кривовичев. Словарь минеральных видов. СПб, 2006)

--ГЕОЛОГИЧЕСКИЙ СЛОВАРЬ (включает раздел "МИНЕРАЛОГИЯ")

Слюды

Смитсонит \\ Содалит \\

Спессартин

--Chadwick, K.M. & Rossman, G.R. (2009) Orange kyanite from Tanzania. Gems & Gemology 45, 146-147.

Сперрилит.

Список минералов - http://en.wikipedia.org/wiki/List_of_minerals

Сподумен

Справочник "Минералы"_краткий указатель к томам IV-V

Справочники

Ссылки: http://www.insminerals2005.narod.ru/

Ставролит

Сталактиты и псевдосталактиты

Стеллерит. Стибиотанталит

Стильбит

Суйсеки (камни для созерцания) √ это камни причудливой формы, которую им придала вода в естественных условиях \\ Подробнее: http://a-stones.net/mMain.aspx?ChapterID=37 \\

Сульфиды

Сфалерит \\

Сферокристаллы --см. http://geo.web.ru/db/msg.html?mid=1179562. \\ Сферокристаллические сферолиты - http://geo.web.ru/db/msg.html?mid=1175869

Сферолиты

Т -

Тальк

Теллуриды и другие минералы теллура

Типоморфизм

Титанит \\ Тодорокит \\

Топаз \\

Топонимика (интересная для минералога) \\ Мурзаев Э.М. Словарь народных географических терминов. М.: Мысль, 1984. - 654 с. - электронная версия

Торбернит \\ Торий_минералы_ география находок \\

Тремолит \\

Турмалин (группа) \\

У -

Увит \\ Улексит \\ Уранинит

Ф -

Фаялит \\ Флогопит \\

Флюорит

Формы выделения минералов

Фото дня или на geo.web.ru/druza/ - "Вокруг света за 30 дней"

Фото дня на миндат.орг_ретроспектива - http://www.mindat.org/gallery.php?potd=1

Фото мест по всему миру - http://www.panoramio.com/map/

Фотоатлас минералов -- http://tw.strahlen.org/fotoatlas.html (834 minerals, 1148 photos)

Фотогалереи минералов - минералы от A до Z и число их фотографий - указатель для миндат.орг - http://www.mindat.org/photoindex.php--http://www.mineralatlas.com/ \\ http://kristallov.net/index.html \

Фотографии минералов - страница Б.З. Кантора на http://www.mindat.org/user-17280.html

Фотосъёмка минералов \\ \\ http://klopotow.narod.ru/soveti/foto.html

Фторапатит

Х -

Халцедон \\ http://www.mindat.org/min-960.html ; фото (541) - http://www.mindat.org/gallery.php?min=960 \\

Халькопирит \\

Хризотил-асбест

Хромит

Ц -

Цвета минералов

Цветные камни \\

--Буканов В.В. Энциклопедия "Цветные камни" - официальный сайт

Целестин

Цеолиты \\

Циркон

Ч -

Чароит \\ Чароит. Сиреневое чудо Сибири. Иллюстрированное научно-популярное издание. - Иркутск6 изд-во "Петрографика", 2011. - 192 с. (авторы текстов: Рогова В.П., Воробьев Е.И. и др.)

ШЩ -

Шары и яйца из камня

Шахтёрская энциклопедия - MiningWiki═≈ энциклопедия о шахтах и шахтёрах, создаваемая совместными усилиями горняцкого сообщества.═

Шеелит \\

Шерл \\

Шорломит \\ Шпинель

Щелочные массивы \\ XXV Всероссийский семинар с участием стран СНГ. Геохимия магматических пород. 23-26 мая 2008 г. Школа Щелочной магматизм Земли   \\ http://alkaline2008.narod.ru/ \\ Тезисы - http://alkaline2008.narod.ru/Abstract.htm

Э -

Эвдиалит \\

Эгирин \\ местонахождения (595) - http://www.mindat.org/min-31.html \\ фото (169) - http://www.mindat.org/gallery.php?min=31 (на 2009.03.22) \\

Экскурсии_ минералогические экскурсии. \\ В Гос. геол. музей им. ВИ. Вернадского

Эльбаит \\

1. Эльбаит (полихромные кристаллы до 15-20 см) в кварце. Зап. Пуштиру, [ущ. Тро], Туркестанский хр.(Ю), Таджикистан. (╧46790, Беус А.А., 1949). Образец: Мин. музей им. А.Е. Ферсмана РАН. Фото: ╘ А.А. Евсеев. 2. Эпидот. Хашупа \ Hashupa , Шигар дол., Скарду, Балтистан, Пакистан.═Образец:═Музей Terra mineralia, Германия. Фото: ╘ Д. Тонкачеев

 

Эпидот \\

Ю -

--Wise, W.S. (1978): Yugawaralite from Bombay, India. Mineralogical Record 9 (5): 296

Я

Янтарь \\

Ярмарки минералов и драгоценных камней \\

The 2016 Tucson Gem and Mineral Show╝ Part 7: Shades of Blue Individual Minerals Continued - фотогалерея http://news.minerals.net/post/the-2016-tucson \\ фото - гранат синего(!) цвета с Мадагаскара (Blue Color-Changing Garnet from Bekily [Androy Region]) \\ Прим. : указатель Encarta-1997 содержит 8 названий нас. пунктов на Мадагаскаре

--Тусон-шоу-2016 - Tucson Gem and Mineral Show Feb 11 2016 Part 1--видео - www.youtube.com

Минералы синего цвета - тема Тусон-шоу-2016. Азурит, бенитоит, гемиморфит на одной из витрин Главного шоу. Источник: www.youtube.com

На Тусон-шоу-2016. Источник: www.youtube.com

Ярозит \\ Яшма

ЯШМА В РОССИИ [по А.Е. Ферсману] - http://pictoris.ru/5/27/index.html

ОПИСАНИЕ РУССКИХ ЯШМ [по А.Е. Ферсману] - http://pictoris.ru/5/29/index.html

МЕСТОНАХОЖДЕНИЯ МИНЕРАЛОВ

Местонахождения минералов \ mineral localities на сайте и на страницах справочника Евсеев А.А. Географические названия в минералогии. Краткий указатель. Ч. I, М. , 2000. - 269 с.; Ч. II, М. , 2000. - 282 с.
Часть I и II (выборочно)
:

м-н-ния
А
Б
В
Г
Д
Е
Ж
:З
И
Й
К
Л
М
Н
О
П
Р
С
Т
У
Ф
Х
Ц
Ч
Ш
Щ
Э
Ю
Я
стр.
10-
26-
45-
54
-
63-
73-
75-
77-
81-
87-
88-
122-
132-
151-
160-
166-
180-
188-
213-
226-
234-
239-
247-
249-
255-
260
260-
265-
267-
Locality
A
B
C
D
E
F
G
H
I
J
K
L
M
N
O
P
Q
R
S
T
U
V
W
X
Y
Z
cтр.
9-
24-
44-
63-
71-
78-
86-
97-
108-
113-
118-
135-
148-
173-
181-
188-
203
204-
214-
243-
257-
260-
268-
275-
276-
278-

См. также http://www.mining-enc.ru

А

Адун-Чолон (= Адун-Чилон), Вост. Забайкалье , Россия

Айфель = Эйфель \ Eifel горы (палеовулкан), Рейнланд-Пфальц, Германия \ Eifel, Rheinland-Pfalz, Deutschland

Акжайляу, к В от г. Аягуз, Вост. Казахстан.апатит!!!--с александрит. эффектом; КВАРЦ!!!--xl 10 м; кристалл дымч. кварца 5,8 м в длину и 1, 5 м в поперечнике, весил около 90 т-находка в южной части массива (Ерджанов К.Н., 1963);

1. Апатит (с "александритовым эффектом"). Акжайляу, Вост. Казахстан. ~4 см. Образец: В. Пономаренко.═ 2. Кридит. Акчатау, Казахстан. Более 4 см. Образец: ФМ (╧86499, Степанов В.И., Булгак Л.В., 1989). Фото 1-2: ╘ А.А. Евсеев.

Акчатау \ Akchatau, Ц. Казахстан \\

Аллуайв, Ловозеро, Кольский п-ов, Россия. \\ 67╟51` с. ш. 34╟32` в. д.

Альмаден, Испания

Арендаль, Ю. Норвегия.

Арис, Намибия

--Арисит-(Ce)(2010)* - новый минерал \\ Piilonen, P.C., McDonald, A.M., Grice, J.D., Rowe, R., Gault, R.A., Poirier, G., Cooper, M.A., Kolitsch, U., Roberts, A.C., Lechner, W. and Palfi, A.G. (2010): Arisite-(Ce), a new rare-earth fluorcarbonate from the Aris phonolite (Namibia), Mont Saint-Hilaire and the Saint-Amable sill (Quebec). Canadian Mineralogist 48, 661-671.

--Виндхукит*(2012) - новый минерал группы палыгорскита \\ Chukanov, N. V.; Britvin, S. N.; Blass, G.; Belakovskiy, D. I.; Van, K. V. (2012): Windhoekite, Ca2Fe3+3-x(Si8O20)(OH)4∙10H2O, a new palygorskite-group mineral from the Aris phonolite, Namibia. European Journal of Mineralogy 24, 171-179

--Эллингсенит*(2011) - новый минерал из фонолитов щелочного комплекса Арис (Намибия) \\ Yakovenchuk, V.N., Ivanyuk, G.Yu., Pakhomovsky, Y.A., Selivanova, E.A., Mikhailova, J.A., Krivovichev, S.V., Zolotarev, A.A. and Zalkind, O.A. (2011): Ellingsenite, Na5Ca6Si18O38(OH)13╥6H2O, a new martinite-related mineral from phonolite of the Aris alkaline complex (Namibia). Canadian Mineralogist, 49, 1165-1173

Астафьевское м-ние, Ю. Урал, Россия\\ http://www.mindat.org/loc-192610.html

Ахалцихе (р-н), Грузия.

Ахматовская копь, Ю. Урал, Россия

Б - местонахождения минералов

Баженовское м-ние , г. Асбест, 60 км к СВВ от Екатеринбурга, Ср. Урал, РФ

Баласаускандык, СЗ Каратау, Казахстан \\ * (1959) альванит; * (1963) бокит; * казахстанит; * карбонат-цианотрихит; * новые мин.-->10 видов; роскоэлит; * русаковит;* (1959) сатпаевит; * (1972) черныхит--ф; Pk (ф)

Банкрофт, Онтарио, Канада \\ Rocks and minerals for the collector: Bancroft - Parry Sound area and southern Ontario; Sabina, A P. Geological Survey of Canada, Miscellaneous Report 39, 1986, ; 182 pages

Белореченское м-ние, 70 км к Ю от Майкопа, Сев. Кавказ, Россия \\ Levitskii V.V. Journey to the Belorechenskoye Deposit. Mineralogical Almanac, vol. 13c, 2008 , p. 62-71 \\ Подробнее: /webmineral.ru/

Березовское золоторудное месторождение, Средний Урал, Россия

Биг-Фиш-Ривер \ Big Fish River, 70 км к СЗ от Аклавик, хр. Ричардсон, Юкон, Канада \\ *баричит; *виксит; *горманит!!; лазулит!!; *маричит; *нахпоит; * новые мин.≈6 видов; *саттерлиит; MR, 1999, 50 \\ http://www.mindat.org/loc-628.html

--Бобдаунсит* - новый минерал \\ Tait, K.T., Barkley, M.C., Thompson, R.M., Origlieri, M.J., Evans, S.H., Prewitt, C.T. & Yang, H. (2011): Bobdownsite, a new mineral species from Big Fish River, Yukon, Canada, and its structural relationship with whitlockite-type compounds. Canadian Mineralogist, 49, 1065-1078.

Борон, округ Керн, Калифорния, США \\ в этом же районе находится заброшенный ныне подземный р-к Бейкер майн \ Baker mine, U.S. Borax Mine (Pacific West Coast Borax; Pacific Coast Borax Co.; Boron Mine; U.S. Borax and Chemical Corp.; Kramer Mine; Baker Mine), Kramer Borate deposit, Boron, Kramer District \ подробнее - mindat

Брокен-Хилл (быв.) = Кабве (ныне) р-к, Центральная пров., Замбия \ Kabwe Mine (Broken Hill Mine), Kabwe (Broken Hill), Central Province, Zambia; 14╟29'S , 28╟25'E - http://www.mindat.org/loc-4341.html \\

Брокен Хилл (Broken Hill), Н. Ю. Уэльс, Австралия, 31-57` ю. ш. , 141-26` в. д. \\ http://www.mindat.org/loc-72.html \\

Брумаду \ Бу-Аззер, Марокко \\

Бурпала , Прибайкалье (С), Россия

В

Ватиха, Мурзинка, Ср. Урал, Россия.

Везувий и Монте-Сомма, Италия \\

Величка, Польша

Верхнекамское м-ние, Пермский край, Россия

Вишневые горы, Ю. Урал, Россия \\ фотогалерея и др. - http://webmineral.ru/

Водинское м-ние, к ССВ от Самары, Ср. Поволжье, Россия

--Сидоров А.А. Минералогия Водинского месторождения самородной сера Самарской области и история его окрытия. Учебное пособие. Самара: Самар. гос. техн. ун-т, 2011. - 189 с.

Володарск-Волынское пегм. поле, пос. Володарск-Волынский, к З от Житомира, Волынь , Украина \\ берилл!!!--ф; гетит!!!; кварц!!; керит!!; микроклин!; опал!; топаз!!!--xls>100 кг; фенакит!!

--Lyckberg, P., Chornousenko, V. & Wilson, W. E. (2009): Volodarsk-Volynski, Zhitomir Oblast, Ukraine. Mineralogical Record: 40: 473-506.

Вороньи тундры, Кольский п-ов, Россия

Вулькано о. \ Vulcano Isl., Липарские о-ва, 50 км к З от Мессины, у сев.-вост. побережья Сицилии, Италия \

Г

Гаурдак, Туркмения

Горихо (Gorikho), м-ние, в ср. и ниж. теч. р. Горихо (приток р. Тола, басс. р. Селенга), 45 км к В от Урги [Улан-Батора], Монголия \\ берилл!; горный хрусталь!; топаз!!; флюорит!; Ф, 491; Ш, 28, 197

Горни-Славков ( (ныне) = Шлаггенвальд (быв.) (Horni Slavkov (now) = Schlaggenwald (form.)), 12 км к ЮЮЗ от гор. Карловы Вары , Богемия, Чехия

Гумешевский р-к, Ср. Урал, Россия

Д

Дальнегорск (и район), Приморье, Россия - рекордные кристаллы на сайте - http://giantcrystals.strahlen.org/asia/dalnegorsk.htm \\

-- Боросиликатное м-ние \ Верхний р-к \\ Николаевский р-к

Дараи-Пиоз (= Дараи-Пиез = Дара-и-Пиоз = Дарапиоз) (Dara-Pioz) , 45 км к СВ от пос. Гарм и 35 км к ССВ от Таджикабада, Алайский хр. , Таджикистан \\ http://www.mindat.org/loc.php?loc=3241

Дашкесан, Азербайджан

Джезказган, Казахстан

 

Додо м-ние, Прип. Урал, Россия - http://www.polarquartz.ru/dep-dodo.html

Е

Ермаковское м-ние, Забайкалье, Россия.

 

Ж

З

Завитинское (Завитая), м-ние, Вост. Забайкалье , Россия \\ адуляр!; воробьевит!; касситерит!; кукеит!; петалит!!; ростерит!; сподумен!!; турмалин!!; Смо, 351

Заги \ Zagi Mountain, 30 km NW of Peshawar, 4 km S of Warsak (34╟09`N, 71╟24`E), близ Kafoor Dheri, р-н Пешавара, Северо-Западная Пограничная провинция, Пакистан;

Змеиногорский р-к (Zmeinogorsk) = Змеиногорское м-ние, Алтай, Сибирь (ЮЗ), РФ \

И

Идар-Оберштайн \ Idar-Oberstein Германия (ЮЗ) \\ агат!! \\ 500 лет (с 1375 г. по 1875 г) в этом районе разрабатывались месторождения агата, велась его обработка. Сегодня небольшой городок - крупнейший центр торговли минералами, драгоценными и поделочными камнями, его называют "самоцветнной столицей мира." .

Изумрудные копи, Ср. Урал, Россия

1. Бромеллит. Изумрудные копи, Ср. Урал, Россия. ~ 10 см. 2. Изумруд. Изумрудные копи, Ср. Урал, Россия. Более 7 см. Образец 1-2: Минер. музей им. А.Е. Ферсмана РАН. Фото 1-2: А. Евсеев.

Илимауссак, Ю. Гренландия

--Гмелинит и гершелит \\ Karup-Moeller, S. (1976): Gmelinite and Herschelite from the Ilimaussaq Intrusion in South Greenland, Mineralogical Magazine, Vol. 40, 867-873

--Карлгизекит-(Nd) \ Carlgieseckeite-(Nd)* - новый минерал из массива Илимауссак \\ Pekov, I.V., Zubkova, N.V.,Husdal, T.A., Kononkova, N.N., Agakhanov, A.A., Zadov, A.E. and Pushcharovsky, D.Y. (2012): Carlgieseckeite-(Nd), NaNdCa3(PO4)3F, a new belovite-group mineral species from the Ilimaussaq alkaline complex, South Greenland. Canadian Mineralogist. 50, 571-580

- Туперссуатсиаит \ Tuperssuatsiaite* - новый минерал \\ Karup-Moller, S. & Petersen. O. V. (1984): Tuperssuatsiaite, a new mineral species from the Ilimaussaq intrusion in South Greenland, Neues Jahrbuch fur Mineralogie, Monatshefte. 1984. 501-512

Ильмены. Ю. Урал, Россия \\ карта и др. http://reserves-park.ru/index/0-204 \\ http://nashural.ru/Mesta/ilmeni.htm

Индер (Inder) (= Индерское м-ние), 15 км к В от пос. Индерборский, 150 км к С от Атырау (= Гурьев (быв.)), Сев. Прикаспий, Казахстан \\

Итинокава, о. Сикоку, Япония.

Иультин, Чукотка, Россия

Й - К

Кап-Гарон \ Cap Garonne, близ Le Pradet, 12 км к В от Тулона, Вар, Франция

Капильитас, Катамарка, Аргентина

Карадаг, Крым, Россия \ Карадагский вулканический массив═(= гора Карадаг = горная группа Карадаг) √ Восточный Крым, между пос. Курортное и Коктебель (бывш. Планерское)\\ http://www.sevstone.ru/collection/all/all/crimea-karadag/

Карамазар (Karamazar) рудный район, Сев. Таджикистан

Кара-Оба = Караоба \ Kara-Oba, м-ние (Mo-W), пос. Джамбул (47-11`N, 71-23`E), Ц. Казахстан

Карнасурт, Ловозеро, Кольский п-ов

Кацна яма (копь) , 15 км к СВ от Первоуральска, Ср. Урал, Россия \\ эпидот!! (⌠пушкинит■!!

Кент, м-ние, гранитный м-в и грейзенизированные гранитные пегматиты, 30 км к ЮВ от пос. Карагайлы и 50 км к ЮВ от Каркаралинска, Ц. Казахстан \\

Керченское м-ние, Крым, Россия \\ анапаит!!!; барит!! вивианит!!; * митридатит; родохрозит, Ca-вый!!--пс-зы по раковинам (ф); смайтит!; Смо, 352; Pk \\

Кипуши, ДР Конго \\

Кировский р-к, Кировский р-к, Кукисвумчорр, Хибины, Кольский п-ов, Россия

Ковдор \\

--новый тип скандиевой минерализации в фоскоритах и карбонатитах Ковдорского массива \\ Subbotin, R. P. L. V. V., & Pakhomovsky, Y. A. (1998). A new type of scandium mineralization in phoscorites and carbonatites of the Kovdor massif, Russia.- Canadian Mineralogist 36:971-980.

Конгсберг (Kongsberg), Норвегия \\ * конгсбергит; пренит!; серебро!!!; флюорит!≈розовый; ВВМ, 68, 174, 176, 178, 179 \\ O. Johnsen, Mineralogical Record, 1986, 17, 19-36

Кондёр г. , м-в ул.-осн. и щел. пород (Kondoer = Konder), Алданский щит, 75 км к З от пос. Джигда и 100 км к ЗЮЗ от пос. Нелькан, ниж. теч. р. Маймакан, Хабаровский край, РФ \ фото 3D - http://www.mindat.org/photo-619937.html

Консельейру-Пена \ Conselheiro Pena District (пегматитовый район) 21 км к С от Дивину-да-Ларанжейрас, (р-н), Минас-Жерайс, Бразилия

Коршуновское м-ние, Иркутская обл., Вост. Сибирь, Росссия

1. Шабынит. Коршуновское м-ние, Иркутская обл. Образец: ФМ (╧84068. Малинко С.В., 1986). 2. Благородный опал по белемниту (псевдоморфоза). [Кубер-Педи \ Coober Pedy, м-ние], Южн. Австралия. Образец: А. Захаров ("Гемма-2009"). 2009.12.06. Фото 1-2: ╘ А.А. Евсеев.

Кремиковцы = Кремиковци (Kremikovtsi), ~ 15 км к СВ от Софии, Болгария \\ азурит!; барит!; витерит!!; гематит!!; гетит!!; кальцит!; лепидокрокит!; норсетит!! (ММ); родохрозит!!; романешит!!

Кубер-Педи , м-ние (Coober Pedy field), 180 км к С от гор. Туркула и 750 км СЗ от Аделаиды, Ю. Австралия \\ благородный опал!!!--пс-зы!! по раковинам, белемнитам и др

Кукисвумчорр, Хибины, Кольский п-ов, Россия \\ Петараситовая жила, Тульйок река (верховья), Кукисвумчорр гора, Хибины, Кольский п-ов, Мурманская область, Россия

Кухилал (Kukhilal) = Кухи-Лал = Кугиляль = Кох-и-Лал, Памир (ЮЗ), Таджикистан

Кырк-Булак, Туркестанский хр. (С) \\ андалузит!!-паралл. сростки xls до 18 см; арроядит!; берилл!!; беусит! - выдел. до неск. см; грифит!!--1-я нах. в СССР; кордиерит!; крыжановскит!!; *магниотриплит!; манганоконинкит!; поллуцит!; саркопсид!; синканкасит! (ФМ); спессартин!!; трифилин!; цвизелит

Л

Лаврион = Лавриум, Греция \ Laurium (= Laurion = Lavrion (нем.)), Greece \\ фотогалерея--http://www.mineral-forum.com/ \\ фотогалерея минералов - http://www.mindat.org/g/554

Лакарги гора, Верхнечегемская вулканическая структура, Кабардино-Балкария, Сев. Кавказ, Россия \ Lakargi Mt., Verkhnechegemskaya caldera (Upper Chegem caldera) ; ксенолиты скарнов в игнимбритах; 43╟17'N ; 43╟6'E \

Лангезундфьорд = Лангесунн-фьорд (Langesund(s)fjord), Ю. Норвегия Ленгенбах, Швейцария \\ http://en.wikipedia.org/wiki/Lengenbach_Quarry

Ловозеро, Кольский п-ов, Россия

Липовка, Ср. Урал, Россия

Лонгбан, Вермланд, Швеция \\ 59╟51'13"N , 14╟15'34"E

М

Мави р-к, Лагман пров., Афганистан

Маданский рудный район, ( = Маданское рудное поле (Pb-Zn)(Madan ore field), р-н пос. Мадан, 200 км к ЮВ от Софии, Болгария \\ галенит!!--xls< 20 см; манганильваит* (= ильваит-Mn); родохрозит!; пирротин!; сфалерит!; ферройохансенит!; халькопирит!; церуссит!! \\ http://www.mindat.org/loc-459.html

Маджуба-Хилл Майн. округ Першинг, Невада, США \\ * (1978) гоудейит \ goudeyite; клиноклаз!; * (1978) парноит; страшимирит!! \\ http://www.mindat.org/loc-3924.html

Мало-Быстринское м-ние (= Малобыстринское), м-ние, 18 км к З от Слюдянки, Прибайкалье (ЮЗ), РФ \\ афганит!; * (1991) быстрит--ф; лазурит!!!; сера!; * тункит; Pk (ф)

Малханское м-ние , Забайкалье, Россия

Малый Пункаруайв г., Ловозеро, Кольский п-ов, Россия

Маунт-Кобальт, 120 км к Ю от Клонкерри, Квинсленд, Австралия \ Mount Cobalt ( Mt Cobalt Mine), Selwyn District , Mt Isa - Cloncurry area , Queensland , Australia -- http://www.mindat.org/ \\ фото: гетерогенит!-ф; кобальтин!--ф; мансфельдит (6); смольяниновит≈пс-зы по эритрину (кр-лы до 2 мм (3); сферокобальтин!--ф; эритрин!!!≈(10 фото);

Маунт-Малоса \ Mt. Malosa, близ Зомба, Малави, Вост. Африка \\ барилит!; микроклин!; миларит!; ниобофиллит!!--фото-- www.mindat.org/gallery1; ортоклаз!; паризит!!; разн. 48 мин. (44 достоверных вида); эгирин!!!≈xls> 20 см; эпидидимит!!≈xl 5, 4 см; D; L, 1999, ╧4, 22-32; 48 entries listed. 44 valid minerals-- www.mindat.org (2008.02.24)

Машамба-Уэст р-к, Катанга, ДР Конго. \\ Везиньеит--ф; карнотит!--ф; кобальтодоломит!!--ф; кобальтокальцит!!-ф; колвезит!--ф; куприт!!-ф; малахит!!--ф; метатюямунит!--ф; планшеит!--ф \\ рудник начал работу в 1978 г. \\ Источник: http://www.mindat.org/loc-4334.htm

Меднорудянский р-к, Ниж. Тагил, Ср. Урал, Россия

Мерек (= Мерекское), м-ние, ~40 км выше устья р. Мерек (приток р. Амгунь), близ ж.-д. ст. Эанга, к ЮВ от Чегдомына, 270 км к С от Хабаровска, Буреинский хр. , Хабаровский край, РФ \\ касситерит!!≈xls \\ Мерек рудопр-ние, в верх. р. Мерек (левобережье р. Амгу)-касситерит!!-фото; рядом-пром. россыпи касситерита-- Расческин Е.В., 2004, 206-207 \\ Д..А. Петроченков. Касситерит [Мерек] и аммониты [Европ. Россия] в ювелирных изделиях--сообщ. в клубе друзей минералогии (2008.06.06)

Мерелани-Хиллс \ Merelani Hills, Танзания \\ алабандин!!!--xl 9x6x4 см; добыт в 2013 г.--фото www.mindat.org

Мибладен, Марокко \\ в поисках ванадинита - видеосюжет www.youtube.com/

Могок = Могоу (новое название, по Е.Я. Киевленко, 2001) (Mogok District), Мьянма (= Бирма (быв.)

Мурзинка, Ср. Урал, Россия

Мурунский массив = Мурун (Murun), близ г. Мурун (1452 м), междуречье рр. Чара и Токко, ~50 км к ЗЮЗ от пос. Торго, Алдан (СЗ), Якутия (ЮЗ), РФ \\\\ Сиреневый Камень месторождение чароита --http://petrographica.ru/

Мусонои р-к \ Musonoi mine, ~25-30 км к З (по другим данным -10 км к СЗ ) от Колвези (10╟41`S, 25╟39`E), Катанга (быв. Шаба, ДР Конго (быв. Заир); 10╟42`S, 25╟23`E \\

Н

Найка, Чиуауа, Мексика

Неройка г., Прип. Урал, Россия \\ Додо м-ние \\

Норильский р-н, Ср. Сибирь, Россия

Н`Чванинг (N`Chwaning), р-ки (без уточнения) , к СЗ от Куруман, Калахари (Mn)-рудное поле, ЮАР \\ афвиллит!!!--xls< 1 см; браунит!!--xl 1, 6 см (ф); журавскит!--xls; кариопилит!!; лейкофеницит!--xls< 3 мм; портландит!!!--xls< 3 см; MR, 1992, v. 23, 436; MRI

Ньоркпахк, Хибины, Кольский п-ов, Россия

О

Одихинча \ Odikhincha, м-в, р. Котуй, 110 км к ЮЮВ от Хатанги, Ср. Сибирь, Россия \\

Ору-Прету, Минас-Жерайс, Бразилия

Отоме,, р-к (Otomezaka = Otome mine), Makioka-cho , Yamanashi City , Kinpuzan district, преф. Яманаси (Yamanashi Pref.), Япония \\ : http://www.mindat.org/loc-220223.html

Охуэла р-к \ Ojuela mine, Мапими, Дуранго, Мексика \\ кобяшевит!!--новинка Тусон-шоу 2016 г.--фото- http://webmineral.ru/

П

Пала, округ Сан-Диего, Калифорния, США \\ берилл розовый!; кунцит!!; лепидолит!; эльбаит!!!

Палитра пегматит, Кедыкверпахк г., Ловозеро

Панашкейра \ Panasqueira; Португалия; 40╟10`N , 7╟46`W;

--Gaines, R.W. & Thadeu, D. (1971). The minerals of Panasqueira, Portugal. Mineralical Record, 2(2), 73-78.

Педернейра, р-к (Pederneira mine), Минас-Жерайс, Бразилия \\ эльбаит!!!--xl 20 см (ф), MR, 2000, #1, 56

Перекатное м-ние, Алдан, Якутия, Россия.

1. Кварц (сросток "журавлик"). Перекатное м-ние, Алдан, Ю. Якутия, Россия. Образец: В.А. Пелепенко. 2012.08. 2. Флюорит в серпентине. Люпикко, Питкяранта, Карелия, Россия. 4х5 см. Образец: Минер. музей МГРИ-РГГРУ (Сбор и дар: Моисеев М.М., 2016). Фото 1-2: ╘ А.А. Евсеев.

Питкяранта, Сев. Приладожье, Ю. Карелия, РФ \\ См. http://karelnedra.karelia.ru/mnia/sn_karelia.htm

Плоская г. , Кейвы, Кольский п-ов, Россия; амазонитовые пегматиты с редкими минералами Y и Yb

Полковник г.., Орск, Ю. Урал, Россия

Пршибрам, рудное поле, Чехия \ \ Pribram ore field, Czech Republic

Пуйва, Прип. Урал, Россия.

Пуна\ Poona = Pune (район Пуны), Индия \\

Р

Рай-Из гипербазитовый массив (район), хр. Марун-Кеу, ж.-д.. ст. Харп, ЯНАО, Тюменская обл., Пол. Урал, Россия \\

Расвумчорр, Хибины, Кольский п-ов, Россия

Ратнапура, Шри-Ланка

Рубцовское м-ние, 20 км к ЮВ от г. Рубцовск близ северной окраины дер. Потеряевка, Алтай, Россия; 51╟28'14'' с.ш., 81╟29'34'' в.д. \\ азурит!!; коннеллит!--фото ; йодаргирит!; куприт!!!; майерсит!!; маршит!!; медь!!; серебро!

1. Куприт (сросток кристаллов). Более 4 см . Рубцовское м-ние, Алтай, Россия. Образец: Минер. музей им. А.Е. Ферсмана РАН. 2. Ураноцирцит. [Рудные горы, Саксония], Германия. Образец: Геолог. музей им. В.И. Вернадского. Фото 1-2: ╘ А.А. Евсеев.

Рудные горы, Гемания \ Чехия

С

Санкт-Андреасберг, Гарц, Ниж. Саксония, Германия (33_5) \ St Andreasberg District, Harz Mts, Lower Saxony, Germany \\ апофиллит!!; *арсенолит; *брейтгауптит; *гармотом!!!; дискразит!!; кальцит!!!; миаргирит!; мышьяк!!; нов. мин.--4 вида; пираргирит!!!; прустит!; разн.-220 мин.(198 мин. вид.)--http://www.mindat.org/loc-22230.html (на 2008.09.04) ; * самсонит!!; стефанит!!; ВВМ, 46, 56, 240 \\

Сарановское м-ние, Ср. Урал, Россия

Сарбайский р-к \ Sarbayskii mine (= Сарбайское м-ние) и Соколовский р-к, гор. Рудный, 45 км к ЮЗ от Кустаная, Казахстан

Сент-Илер массив, Квебек, Канада \\ http://www.mindat.org/loc-123123.html

- Карлетонит* - новый минерал из Сент-Илера \\ Chao G.Y. (1971), Carletonite, KNa4Ca4Si8O18(CO3)4(F,OH) 7 H2O a new mineral from Mount St. Hilaire, Quebec. American Mineralogist: 56: 1855-1866;

--Коробицынит и цепинит-Na \\ HORVATH, L. (2001) Korobitsynite and tsepinite-Na from Mont Saint-Hilaire. MICRONEWS, 35, No.5, 5-6.

- Феррокентбруксит* - новый член группы эвдиалита из Сент-Илера \\ Johnson, O., Grice, J.D. & Gault, R.A. (2003): Ferrokentbrooksite, a new member of the eudialyte group from Mont Saint-Hilaire, Quebec, Canada. Canadian Mineralogist. 41: 55-60

Тундрит

Тундрит. Пудретт к-р, Сент-Илер, Квебек, Канада. Поле изображения 1, 4 x 1,8 мм. Образец и фото: Modris Baum. This image has been released to the public domain and may be used freely. Это изображение было передано в общественное достояние и может свободно использоваться. ИИсточник: /www.mindat.org/

Сикуаньшань, Хунань, Китай

Слюдянка (и район) Словарь топонимов Слюдянского района - http://www.maxknow.ru/images/upload/articles7/468.htm

Солонго (= Магнетитовое) м-ние, Забайкалье, Бурятия, Россия

Суит-Хоум Майн, Алма, \ Sweet Home Mine, Alma, Колорадо, США \\

Сюебаодин \ Xuebaoding, горы, район Пинъу \ Pingwu, Сычуань, Китай

Т

Талнах м-ние, Ср. Сибирь (С)

--Маяк р-к, Талнахское м-ние, Талнах, Норильский р-н, Ср. Сибирь (С), Россия. \\ новые минералы - годлевскит*; манганшадлунит:; маякит*(1976); плюмбопалладинит*; полярит*; таймырит*; талкусит*; урванцевит*; шадлунит* (Pekov, 1998) \\ ЕК

Тигриное м-ние, Приморье, Россия \\ Попова В. И., Попов В. А., Коростелёв П. Г., Орловский В. В. Минералогия руд W-Sn-месторождения Тигриное и перспективы его освоения. Екатеринбург: УрО РАН, 2013 г. √ 133 с. \\ П

Титовское м-ние, р. Догдо, хр. Тас-Хаяхтах, Пол. Якутия, Россия

Толбачик (= Толбачинский) (Tolbachinskii) вулкан, к ЮЗ от Ключевской Сопки, Камчатка, Россия\\ разнообразие - более 240 видов; новые минералы - более 75 видов; по числу новых минералов, открытых здесь, вулкан Толбачик занимает теперь 3-ье место в мире среди всех местонахождений минералов (данные И.В. Пекова, 2015.10) \\ См. также http://www.mindat.org/loc-5602.html

--Большое трещинное извержение (БТТИ), Толбачик вулкан, Камчатский край, Северо-Восточный регион, Россия

-- Второй шлаковый конус, Северный прорыв, Большое трещинное извержение, Толбачик, Камчатка \ Second scoria cone, Northern Breakthrough, Great Fissure eruption, Tolbachik volcano \ www.mindat.org

Траверселла (Traversella), близ Ивреа, Пьемонт, Сев. Италия \\ аметист!!; доломит!; магнетит!!≈xls< 3 см; пирит!; шеелит!!; эпидот!; ВВМ, 160, 234

Турьинские р-ки, Сев. Урал, Россия \\ Фёдоров Е. С., Никитин В. В. Богословский горный округ. Описание в отношении его топографии, минералогии, геологии и рудных месторождений. - СПб., 1901. - С. 92.

Тюямуюн, Киргизия

У

Уа-Уа Маунтинз, близ Delta, округа Бивер, Миллард и Айрон, Юта, США \ Wah Wah Mts, Millard Co. \ Beaver Co. \ Iron Co., Utah, USA \\ берилл!!!--xls, малиново-красный; гейкилит

Удачная трубка, Якутия, Россия

Умбозерский р-к, г. Аллуайв, Ловозеро, Кольский п-ов, РФ

Ушкатын-III, м-ние (Fe-Mn), близ пос. Жайрем, Атасуйский р-н (З), Ц. Казахстан \\ бементит!; брандтит!; браунит!; вульфенит; гаусманнит; кентролит!; пеннантит!; родохрозит!!; тодорокит!!; церуссит!!; якобсит

Ф

Фенцзяшань \ Fengjiashan, к ЮЗ от Daye, Хубэй, Китай \\ ═Фото: аметист!; ═апофиллит!; волластонит!!(добывается); инезит!!!≈ф; кварц (и аметист)--япон. дв-ки!!; ═пирит!; стильбит!; флюорит!!; хубеит!!*)≈Ottens B., 178 - 188

Фрайберг (=Фрейберг), район.

Франклин, Нью-Джерси \ (Franklin), 80 км к СЗ от Нью-Йорка, округ Сассекс, Нью-Джерси, США \\ аллеганит! (М 3-1); виллемит!! (М 3-1)≈xls<20 см; ганит! (М 2-3); гетеролит! (М 2-3); глаукохроит! (М 3-1); годжкинсонит! (М 3-1); ларсенит! (М 3-1); лейкофеницит! (М 3-1); *ленниленапеит (ММ); лёллингит! (М 1-1); * новые мин.≈67 видов (вместе с м-нием Стерлинг-Хилл); норбергит! (М 3-1); пирохроит! (М 2-3); родонит!! (М 3-2); тефроит! (М 3-1); * франклинит!! (М 2-3)≈xls< 15 см; хендриксит!; цинкит!!! (М 2-2); BG, 19, 21; MR, 1996, 226 (лит.)

Фука р-к \ Fuka mine, Окаяма преф., Япония \ Fuka mine, Bitchu (Битю), [Kawakami Isl.], Okayama Pref. , Japan; 43 o 46`N, 133 o 26`E \\ * (1973) бичулит; бултфонтейнит; * (1978) волластонит-7Т; геленит!; * (1992) клинотоберморит; куспидин!; нифонтовит!--xls< 4-5 мм; новые минералы--12 видов (на 2013 г.); .*оелит; *окаямалит (1998); ольшанскит!--xls; *1998-парасибирскит; пентагидроборит; ранкинит!; силленит!; спёррит; тоберморит (мон.); * фукалит; * (1986) хенмилит!!≈xls< 3 мм; MR, 1995, #5, 495 \\ http://www.mindat.org/loc-2202.html

Х - местонахождения

 

Хагендорф, Бавария, Германия

Хайдаркан, м-ние, Киргизия

Хибины, Кольский п-ов, Россия \\ карта Хибин \\ турист. схема

--Килманит-(Ce) \ Kihlmanite-(Ce) --новый минерал из Хибин(2014) \\ Yakovenchuk, V. N., Krivovichev, S. V., Ivanyuk, G. Y., Pakhomovsky, Ya. A., Selivanova, E. A.,Zhitova, E. A., Kalashnikova,G. O., Zolotarev, A. A., Mikhailova, J. A., Kadyrova, G. I. (2014): Kihlmanite-(Ce), Ce2TiO2[SiO4](HCO3)2(H2O), a new rare-earth mineral from the pegmatites of the Khibiny alkaline massif, Kola Peninsula, Russia. Mineralogical Magazine, 78, 483-496. \\ подробнее \\ www.mindat.org

1. Дельхайелит. Хибины, Кольский п-ов, Россия. 20 мм. 2. Дельхайелит. Юкспор, Хибины, Кольский п-ов, Россия. 30 мм. Фото 1-2: А. Колтовой

Хуанганг р-к \ Huanggang Mine (Huanggangliang Mine), Внутр. Монголия, Китай

Ц

Цумеб \ Tsumeb и район, Намибия \\ (ГРЭ- III , 587-593); геол. карта р-на; геол. разрез); ╚скопления германита достигали веса в несколько сотен тонн╩ (с.589) ; новые минералы- 71 мин. вид - см. www.mindat.org

Ч

Челекен (Cheleken) , 70 км к Ю гор. Туркменбаши (= Красноводск (быв.)), Туркмения \\ Современное гидротермальное образование--образцы сборов Л.М. Лебедева (поступили в ФМ в 1969 г. )\\ алуноген!; арагонит!; барит!!; болеит!; галенит!!--ф; галотрихит!; гипс!; кокимбит! (Будько В.Н., 1962л); копиапит!; куменгит; метавольтин!; озокерит!!; паракокимбит!; псевдоболеит; ремерит!; свинец!!; сфалерит!!; тамаругит!; ярозит!;

Чукикамата, Chuquicamata (22╟18`S, 68╟55`W), 15 км к N от Каламы, Антофагаста, Чили \\ атакамит! (М 2-1); *(2011) бетпакдалит-NaNa; * (1811) блёдит; мендосавиллит*; маршит! (М 2-1); *1908-натрохальцит;(Gui-72); * новые мин.≈12 видов; *1986-обрадовичит; * самплеит

Ш Щ

Шерловая Гора (= Шерлова гора = Ширлова гора) (Scherlovaya Gora), Вост. Забайкалье, РФ \\ Шерловая Гора \\ Г.А. Юргенсон, О.В. Кононов═.Шерловая Гора: месторождение самоцветов и редких металлов \\
Минералогический Альманах, том 19, выпуск 2, 2014 \\

Шимен, Хунань, Китай

Шкатулка, пегм. залежь, Умбозерский р-к, Аллуайв, Ловозеро, Кольский п-ов, РФ. Рудник в настоящее время затоплен. Уссингитовое ядро пегматита "...имеет форму извилистой линзы, протяженностью более 12 м при мощности до 2,5-3 м. Теперь уже не возникает сомнения, что именно "Шкатулка" и есть крупнейшее в мире уссингитовое тело"(Пеков И.В. 2001, с. 359)

Шнееберг, Рудные горы, Саксония, Германия \\ 365 минералов, из них 299 достоверных видов, из них 43═ новых вида ( type locality) на 2016.03.04\\ Источник: http://www.mindat.org/loc-1848.html

Шор-Су = Шорсу, м-ние, 30-35 км к ЮЮЗ от Коканда, Фергана (Ю), Узбекистан \\ озокерит!; сера!!!; целестин; МС-1, 278-279; Смо, 356

Э

Эвеслогчорр, Хибины, Кольский п-ов, Россия

Эпидидимит. Эвеслогчорр гора, Хибины, Кольский п-ов, Россия. Кристалл ~ 3 см. Образец: Мин. музей им. А.Е. Ферсмана РАН (╧94187. Сбор музея. Моисеев М.М., 2013). Фото: ╘ А. Евсеев.

Эльба о., Италия

Эронго, Намибия.

Эрцберг \ Erzberg близ Eisenerz, 11 км к ЮВ от Hieflau, Штирия \\ анкерит*; АРАГОНИТ!!!

Юбилейная залежь \ Jubilee( = Yubileinaya) pegmatite ), Карнасурт, Ловозеро, Кольский п-ов, Россия

Юкспор, Хибины, Кольский п-ов, Россия

Я

Яогансян р-к (W) \ Yaogangxian = Yao Guang Xiang, 40 км к ЮВ от Ченжоу, Хунань (Ю), Китай \ Yaogangxian = Yao Guang Xiang, Yizhang Co., Chenzhou Prefecture, Hunan; 25╟35'N , 113╟15'E \\ : http://www.mindat.org/loc-4549.html \\ Ottens, B. and Cook, R.B. (2005): The Yaogangxian tungsten mine, Yizhang County, Chenzhou, Hunan Province, China. Rocks & Minerals 80(1), 46-57.

Яхимов (Jachymov) (= быв. Иоахимсталь\ Joachimsthal), Западно-Чешский край, Богемия, Чехия \\ http://www.mindat.org/loc-158151.html \\

см. также--СПРАВОЧНИК МЕСТОНАХОЖДЕНИЙ МИНЕРАЛОВ И РУД - http://mineral.nsu.ru/educat/article/7/

 

СТРАНЫ и РЕГИОНЫ

Находки минералов по всему миру. Подробнее: Евсеев А.А. Атлас мира для минералога. М., 2004. - 284 с. \\ Евсеев А.А. Атлас для минералога. Россия и бывший СССР . М., 2011. √ 248 с

СТРАНЫ от А до Я

находки минералов по листам карты мира: 1234567 891011121314151617181920212223242526272829303132 - 33

Викимапия \ Wikimapia (карты мира и России)

Сев. Америка (С)

Гренландия

Атлантика - Скандинавия - Кольский п-в

Урал
Ср. Сибирь
Якутия
СВ России

Сев. Америка (З - Сев. Америка (Кордильеры)

Сев. Америка (В)

Британ. о-ва, Пиренейский п-в - Зап. Европа - Вост. Европа

Казахстан, Ср. Азия

Юг Сибири
Забайкалье, Вост . Сибирь
Камчатка - Дальний Восток (Россия, Япония
Мексика
Кавказ, ЮЗ Азия
Афганистан, Пакистан
Индия
Монголия. Китай
ЮВ Азия - Тихий океан
Ю. Америка (СЗ) - Кордильеры
Бразилия

Африка - Сев. и Зап.Экв. и ЮжнВост.

Антарктида
Австралия

Тихий океан - Весь мир

Интересная подборка из 9 минералов региона получается если взять по одному из 9 его частей (центр, север, юг, запад, восток, СВ, ЮВ, ЮВ, СЗ)

Mineralienatlas - указатеь по странам - https://www.mineralienatlas.de/

Арктика

Земля Франца-Иосифа, Северный Ледовитый океан, Арктика; Архангельская обл., Россия \\ Карбонатные (?) конкреции!!--о. Чамп; кварц (халедон) по дереву! - о. Мак-Клинтока о.; сера!

Северный Ледовитый океан - карта

Новая Земля

Восточное полушарие

Евразия

Минералогические находки Евразии (примеры). 1.2. Поллуцит (полир. шар). Кольский п-ов. 3. Боксит. Красная шапочка м-ние, Сев. Урал. 4. Алабандин. Якутия. 5. Целестин, сера. Сицилия, Италия. 6. Лепидолит. 7. Кальцит (геликтиты) и целестин. 8. Кальцит (геликтиты)

Россия и СССР

фотоконкурс 2015 г. - http://www.ntv.ru/novosti/1558667/

--Ферсман А. Е. Геохимия России. Петроград, 1922. Вып. 1. 214 с.

--Минералы СССР, т.1 "Самородные элементы"/ под ред. А.Е.Ферсмана (редактор тома Н.А.Смольянинов), Изд.АН СССР Москва-Ленинград. 1940 г. - 328 с., тир. 3000 экз.

--Геологические памятники природы России "Природное наследие России" . Авторы: Карпунин А.М. , Мамонов С.В. , Мироненко О.А. , Соколов А.Р. Главный редактор - Орлов В.П. \\ веб-публикация

Города России - на карте - http://town-map.ru/index.html

Реки России - сайт - http://vsereki.ru

Физическая карта России - http://town-map.ru/346093.html

Карта России на сайте К.И. Клопотова

Кристаллы России в экспозиции Минералогического музея им. А.Е. Ферсмана РАН (кристаллы 5 см и более на выставке "Кристаллы")

10 замечательных минералов России (экспресс-опрос провел А. Евсеев, на ответ давалось несколько минут. 1 октября- 9 ноября 2010 \\ 44 участника на 2010.11.09. \\ 111 чел. на 2011.03. 23. Самыми популярными минералами по числу голосов оказались кварц и малахит. Всего было названо более 200 минералов и цветных камней (2011.03.23)

Минералы России по числу ссылок (20 и более) в ╚Атласе мира для минералога╩

Новые минералы ( СССР и Россия) \\ Список всех новых минералов, открытых на территории быв. СССР с 1766 до первой половины 2006 г. содержит 714 достоверных ( valid ) минеральных видов √ см. Pekov I.V. New Minerals from Former Soviet Union Countries, 1998-2006 // Mineralogical Almanac, Vol. 11. Moscow, Mineralogical Almanac, 2007, 112 pp. (список - стр. 85-88)

Полезные ископаемые - Википедия

Разнообразие минералов - 2889 ; из них достоверные виды - 1796; новые виды - 614; местонахождения - \ localities - ; фото минер. - 5724; фото мест - 85 (на 2011.05.03) \\ Источник: http://www.mindat.org/loc-14409.html

Разнообразие минералов - 2067 ; из них достоверные виды - 1652; новые виды - 576; местонахождения - \ localities - ; фото минер. - 3322; фото мест - 67 (на 2009.01.28) \\ Источник: http://www.mindat.org/loc-14409.html

Основные структурно-минерагенические провинции цветных камней России - http://www.lavrovit.narod.ru/kamni/provincia.htm

Карта "Самые замечательные месторождения минералов в Союзе" (фрагмент). Источник: Ферсман А.Е. Занимательная минералогия. М. -Л.: "Детская литература", 1937. - 240 с. Объяснения к карте - см. стр. 235-238. Подробнее Коллекционные минералы из России - http://www.kristallemineralsrussia.com/

Кольский п-в и Карелия \\

Хибины и Ловозеро --карта (спутник)

Кольский п-в_фото минералов_Bernard - новая страница

-- В.В. Борисова, А.В. Волошин. Перечень минеральных видов Кольского полуострова. Изд. 4-е, испр. и доп. / √ Апатиты: К&М, 2010. √ 64 с

Минералы Кольского п-ва от A до Z \\ 1168 минералов; 835 минер. видов; 255 новых видов; фото минералов - 22181.(1-е - адамсит-(Y), 101- бахчисарайцевит и т.д.) \\ Источник: http://www.mindat.org/loc-2666.html (на 2014.06.19)

-- Симпсонит@ \\ первая находка в СССР-- Кольский п-ов--Соседко А.Ф., 1958л

От Белого до Баренцева моря через Кольский полуостров.

Минералы Кольского п-ва от А до Я (по Борисовой В.В. и др., 2002 с доп.)

--Новые минералы---264 вида \\ Волошин А.В. , Пеков И.В., Борисова В.В. Минералы, впервые открытые в Кольском регионе: исторический обзор и статистические данные. - Минер. альманах. Т. 18, вып.2, 2013, с.107-123

Карелия \\ http://mindat.ru/locathn/r_karel.htm \

- Атлас структур и текстур докембрийских вулканогенных пород Карелии \\ литература

Вост. Европа

Россия \\ 3086 минералов; 1959 минер. видов; 255 новых видов; фото минералов - 8561.(1-е - абрамовит, 101- Allochalcoselite и т.д.) \\ Источник: http://www.mindat.org/loc-14409.html (на 2014.06.19)

Местонахождения минералов России на сайте К.И. Клопотова

Европейская часть России

Архангельская обл.

КМА \\ Европ. часть России (север) \\

Тиман \\ Сев. Тиман--путешествия \\ путешествия-2009 \\ схема

Поволжье \\

--Царев метеорит,═Ленинский район,═Волгоградская область - webmineral.ru

Подмосковье, Россия и Москва

Центр Европ. части России

Юг России

Крым

Люнебургит. Грязевые сопки, Керченский п-ов, Крым, Россия. ~4 см. Образец: Мин. музей им.А.Е. Ферсмана РАН (Коллекция В.И. Степанова). Фото: ╘ А.А. Евсеев

--Тищенко А.И. Минералы Крыма. - Симферополь: Бизнес-Информ, 2015. 304 с., 72 с. цв. вкл.

Сев. Кавказ, Россия

--Садон м-ние, Сев. Осетия, Сев. Кавказ, Россия \\ арсенопирит--М-1-1, 312а; вольтцит--М-1-1, 207; гемиморфит--М-3-1, 623; гринокит!--ФМ; кнебелит!--М-3-1, 205, Вост. уч., шт ╧42--Радкевич, 1966л; мышьяк--М-1-1, 182, почковидный

Урал на сайте /www.mindat.org (на 2016.01.25) : минералов - 1057, твердых видов - 727 ; новых минер. видов (type locality) - 81

Сайт "Рудники Урала" - http://uralmines.ru

- пока не найдены (не описаны для Урала на 2014 г.) : сподумен, эвдиалит...:

--Знаменитые месторождения Урала. Ч.II Д.А. Клейменов, В.Г. Альбрехт, А.Г. Талалай, В.А. Коротеев и др. Издательство: "Уральский рабочий", 2007 г., С. 240 \\ Во второй книги из серии "Знаменитые месторождения Урала" приведены сведения об истории открытия, геологии и минералогии Высокогорского, Гороблагодатского, Медноруднянского, Саткинского, Соль-Илецкого, Учалинского, Узельгинского, Молодёжного, Таш-Тау, Яр-Бишкадакского месторождений

ПРИРОДНЫЕ ДОСТОПРИМЕЧАТЕЛЬНОСТИ УРАЛА - http://nashural.ru/mesta.htm

Рудники (и не только) Урала - фотогалереи \ видео "Планета Карабаш"

Пай-Хой

Пермский край, Россия \\ Геологические памятники - http://www.perm-kray.ru/index.htm

Проявление Вейнберг, Красновишерский р-н (проявление золото-редкометальной минерализации)--http://geo.perm-dom.ru \\ Алексеев В.Я., 1990 \\ ЕК

Полярный Урал, Россия \\ фото - http://polyarny.net/foto/

ПРИПОЛЯРНЫЙ УРАЛ \\ КЕММЕРИХ А. О. ═ПРИПОЛЯРНЫЙ ═УРАЛ. ПУТЕВОДИТЕЛЬ. ИЗДАТЕЛЬСТВО ╚ФИЗКУЛЬТУРА И СПОРТ╩. МОСКВА 1970 \ веб-публикация

СЕВЕРНЫЙ УРАЛ (6400'≈5845' с. ш.)

Блог Михаила Цыганко - http://zolotoy-kamen.ru

Пещера Старателей на реке Сосьва - читать

СРЕДНИЙ УРАЛ (5845' ≈ 5600' с.ш.

--Pekov, I. V., Yakubovich, O.V., Massa, W., Chukanov, N. V., Kononkova, N.N., Agakhanov, A. A. & Karpenko, V. Y. (2010): Londonite from the Urals, and new aspects of the crystal chemistry of the rhodizite-londonite series. Canadian Mineralogist. 48: 241-254

ЮЖНЫЙ УРАЛ (5600' ≈ 5100' с. ш.)

--Скиппенит из Кочкарского м-ния (Au) \\ Bindi L, Cipriani C (2004) The crystal structure of skippenite, Bi2Se2Te, from the Kochkar deposit, southern Urals, Russian Federation, The Canadian Mineralogist 42, 835-840

Колисниченко С.В.. Гиганты в мире минералов на Южном Урале (2009 г.):

Книги С.В. Колисниченко о минералах Южного Урала. Из библиотеки Минер. музея МГРИ-РГГРУ.

Яшма. Ю. Урал. Фото: С. Колисниченко. Из книги "Яшмовый пояс Южного Урала"

Сайт "Минералы Челябинской области" - http://www.chelmineral.ru/ \\ местонахождения - http://www.chelmineral.ru/?page=deposits

Сибирь \ Сибирь в "Атласе мира для минералога". - Местонахождения минералов и примеры находок http://geo.web.ru/druza/L-AtE_Sib.htm \\

--Реутовский В.С. Полезные ископаемые Сибири. - СПб., 1905. - 874 с.: карта. Автор - инженер, редактор и издатель журнала "Вестник золотопромышленности и горного дела вообще" (Томск).

Дополнения к списку (Евсеев А.А. Минералогические находки. Краткий обзор. I. Сибирь. М., 2006. √ 157 с. )

Новые минералы*

Зап. Сибирь \\

Ср. Сибирь \\ Таймыр

Нижняя Тунгуска р.

Якутия 591 минералов; 459 минер. видов; 50 новых видов; фото минералов - 403 \ .591 entries listed. 459 valid minerals. 50 type localities (valid minerals). \\ http://www.mindat.org/loc-2644.html (на 2012.03.13)

Значки, посвященные трубке Мир. Фото: Н.А. Колтовой

 

- Минералы Якутии - на сайте К.И. Клопотова

--Месторождения - http://www.atlas-yakutia.ru/depositmap.html

Алдан, Якутия \ Хабаровский край, Россия

СВ России

Магаданская обл.

--Хакимов АХ, Пацкевич Г.П. Особенности формирования Кедонского месторождения аметиста. // В кн. Драгоценные и цветные камни. М.: Наука. 1980. С. 247-253.

Чукотка, Россия (СВ)

--Андрианов А.В.═ Рудные месторождения Чаунского района. Сб. Геология и минералогия Чаунского района. Труды Горно-геол. упр. ГУСМП, т. 9, 1941.

Камчатка \ Корякия

--Озерновское м-ние, Камчатка \\ голдфилдит; петцит; хемусит! \\ V.A. Kovalenker, O.Yu. Plotinskaya (2005): Te and Se mineralogy of Ozernovskoe and Prasolovskoe epithermal gold deposits, Kuril √ Kamchatka volcanic belt. Geochemistry, Mineralogy and Petrology 43, 118-123. \\ http://www.geology.bas.bg/mineralogy/gmp_files/gmp43/Kovalenker.pdf

Курильские о-ва

Дальний Восток (Россия) литература по геологии и пол. ископ. (в алфавите авторов) - http://wiki.fegi.ru/index.php/Амур р.

--Новые и редкие минералы Дальнего Востока. - Владивосток: ДВО АН СССР, 1987. - 128 с.

Амурская обл., Россия \\

Приморье, Россия

Флюорит на кварце. Силинское м-ние, Приморье, Россия. 6х7 см. Образец: Минер. музей МГРИ-РГГРУ (Р-3134. Евсеев А., 2016)

 

Сахалин \\ фото - http://fotocult.ru/gallery/

Хабаровский край, и Еврейская АО, Россия \\

Юг Сибири

Алтай, Россия \ Казахстан

Бурятия

--Миронов А.Г.,Куликов А.А.,Золото Бурятии. Улан-Удэ, Изд. БНЦ СО РАН, 2000, 464 с. 

Горный Алтай

Восточная Сибирь

- --Аметист \\ Татаринов А.В. Минералы кремнезема и условия образования аметиста в скарново-магнетитовых полях юга Сибирской платформы. // В сб. Минералогия и генезис цветных камней Восточной Сибири. Новосибирск, Наука. 1983. С. 34-41.

Горная Шория, географическая область, Сибирь (ЮЗ), Кемеровская обл., Россия

Енисейский кряж

Забайкалье, Россия \\ фото - http://www.crystallika.com.postman.ru/

Флюорит (кристаллы до 4 см) на халцедоне. Степное м-ние, Вост. Забайкалье, Россия. Образец: Минер. музей МГРИ-РГГРУ (Р-3138. Евсеев А., 2016)

--Гусиное оз. , Зап. Забайкалье, Бурятия, РФ \\ агат!; халцедон!!--синий

Забайкалье_местонахождения

Минералы Забайкалья (монетками отмечены местонахождения), Россия. Из поступлений в Р-коллекцию Минер. музея МГРИ-РГГРУ за 2015 г. (колл. А.Е. Задова)

Гора Мурун \\ Катугин и др.

--ОПИСАНИЕ МЕСТОРОЖДЕНИЙ ЗАБАЙКАЛЬЯ [А.Е. Ферсман]

--сайт "Цветные камни Трансбайкальского региона" - http://lavrovit.ru/?page_id=271

- Александровский Голец (U-Mo) рудопроявление,═верх. р. Читканда, Удоканский хр., Каларский район,═Забайкальский край,═СВ Забайкалье \\ браннерит; иригинит* ; молуранит \\ webmineral.ru

-- Эпштейн Г.Ю. О молибдатах урана-молураните и иригините // Записки ВМО, 1959, Ч. 88. Вып. 5, стр. 564-570

Иркутская обл. \\

--Ольхон о. - карта - http://www.olkhon.org/olkhon-map.htm

Кемеровская обл. и Горная Шория

Красноярский край \\ минеральные ресурсы - http://nature.krasn.ru/content.ph

Кузнецкий Алатау \\ ═

Прибайкалье \\

--Кислов Е.В. Голубой диопсид Йоко-Довыренского массива // Минералогия месторож╜дений камнесамоцветного и поделочного сырья: Тез. докл. Годичного собр. Минерал, о-ва при РАН. - СПб., 1996. - С. 15-16

Саяны и Присаянье \\

Сибирская платформа

Тува.

Хакассия

Атлантика

Европа \\

--Зап. Европа_минералогические особенности (в фотографиях образцов от А до Я) -- Европа_крупные кристаллы \\ Европа _кристаллы_5 см \\ Европа_кристаллы _10 см \\

Средиземноморье_минералогические находки вдоль побережья

Европа (СЗ) \\

Исландия

Скандинавия \\

Норвегия

--Волконскоит--в виде тонкой корочки (crust) вокруг измененных кристаллов корунда. Kleggasen Ruby Quarry, Froland, Aust-Agder, Norway \\ Nilssen, B. & Raade, G. (1973): Contribution to the mineralogy of Norway, No 54. On Chromian Montmorillonite (Volkonskoite) in Norway. Norsk Geologisk Tidsskrift 54: 329-331 \\ фото - www.mindat.org

--Штромейерит и маккинстиит \\ Bergstol, S. & Vokes, F.M. (1974): Stromeyerite and mackinstryite from the Godejord polymetallic sulfide deposit, central Norwegian Caledonides. Mineralium Deposita 9, 325-337.

Финляндия \\

--Vuorelainen Y, Huhma A, Hakli A (1964): Sederholmite, wilkmanite, kullerudite, makinenite, and trustedtite, five new nickel selenide minerals. Comptes Rendus de la Societe Geologique de Finlande. 36, 113-125

Швеция

З а п. Е в р о п а

Британ. о-ва, Пиренейский п-в

Хилгардит-1 Tc . Булби м-ние ( Boulby ), Кливленд, Великобритания. Более 10 см. Образец: ФМ (╧91148. Приобретение, 2002). Фото: ╘ А.А. Евсеев

 

Корнуолл, Англия

Лироконит. Корнуолл, Англия, Великобритания. Образец: ФМ (╧4111). Фото: ╘ А.А. Евсеев. 2. Корнуолл, Англия. 2012.06. Фото: ╘ Г.Ю. Абрамов.

Для съёмок исторического фильма декорации не нужны. Корнуолл, Англия. 2012.06. Фото: ╘ Г.Ю. Абрамов.

Испания

Австрия \\

Альпы \

Бавария , Германия \\ Баден-Вюртемберг, Германия

Балканский п-ов

Бельгия \\

Болгария \\ минералов - 428; мин. видов - 353; нов. видов - 8; фото минералов - 556 (на 2011.11.01) \\ Источник: http://www.mindat.org/loc-14255.html

Венгрия

Германия \\ фото минералов \\ http://www.mindat.org/rloc.php?loc=Germany \\ http://www.mindat.org/loc-14244.html)

--Хентшелит*, новый минерал группы лазулита и рейхенбахит*, полиморф псевдомалахита - два новых фосфата меди из Рейхенбаха, Германия \\ Sieber, N.H.W., Tillmanns, E. and Medenbach, O. (1987) Hentschelite, CuFe2(PO4)2(OH)2, a new member of the lazulite group, and reichenbachite, Cu5(PO4)2(OH)4, a polymorph of pseudomalachite, two new copper phosphate minerals from Reichenbach, Germany. American Mineralogist 72, 404-408.

Сев. Рейн-Вестфалия (Германия)

Италия \\ в миндат \\ \\ 2291 минералов \ entries listed. 1340 достоверных видов \valid minerals. 266 новых видов \ type localities (valid minerals). 5 type localities (others).(на 2011.07.30)

--Лацио \\ .Лигурия \\ Пьемонт, Сев. Италия \\

Тоскана

Карпаты

Македония \\

Польша \\

Румыния \\ Сербия \\

Словакия

Франция

--Mineralogie de la France by Eric Asselborn, 2013. ═242 pages.

Чехия \\

Швейцария \\

Вост. Европа \\

Белоруссия \\

Википедия

Прибалтика

Украина \

-- Местонахождения минералов Украины от А до Я

Украинский щит - геологические памятники - Google Maps

Волынь и СЗ Украина

Донбасс

Приазовье

Прикарпатье

Закарпатье

Молдавия

Евразия

Азия

Япония \\ http://www.petrovrareminerals.com/articles02.html \\ http://www.mindat.org/loc-14488.htm

--Юконит и уоллкилделлит--р-к Киура, Ойта преф., Кюсю о. \\ Enju, S., & Uehara, S. (2015). Yukonite and wallkilldellite√(Fe) from the Kiura mine, Oita Prefecture, Japan. Journal of Mineralogical and Petrological Sciences, 110(3), 150-155

--

--Kinzandani (Kanayamadani), Hashidate, Ohmi, Itoigawa City, Niigata Prefecture, Chubu Region, Honshu Island, Japan \\ Ohmi=Omi--бенитоит \ benitoite--xls<3 mm \\ Strontio-orthojoaquinite!

Корейский п-ов

Казахстан и Средняя Азия Казахстан и Средняя Азия_А-Я_местонахождения минералов (на карте)

Казахстан

Восточный Казахстан

Средняя Азия \\

Киргизия \\

Таджикистан \\

Памир \

Карамазар рудный район, Сев. Таджикистан: Адрасман (Adrasman) --Алтын-Топкан--Кансай --Кураминский хр --

----Чорух-Дайрон \\ Назаровская заявка, Могол-Тау--шеелит--ГГМ (быв. Мин. муз. МГРИ - ╧41962-41967; ;1971-41983╧)

Туркмения \\

Узбекистан \\

Кызылкум \\

Афганистан \ Afghanistan - http://www.mindat.org/

Пакистан

--Аквамарин - Пакистан--фото- www.mindat.org

Кавказ, ЮЗ Азия \

Азербайджан \\

Армения \\

Грузия \\

Израиль \\ Иордания \\ Палестина \\ Ирак \\

Иран \\

 

1.═В.С. Чернавцев: " 2003 г. Сенсация "Главного шоу" \ Main Show (Тусон - 2003) - гигантский кристалл демантоида из Ирана".═Фото любезно предоставил В.С. Чернавцев.═2. Иранит. Шах-Кхуни \ Chah Khuni , Иран. Образец: ФМ (╧79159, Гарске Д.). Фото: ╘ А.А. Евсеев.

 

--═Adib, D. and Ottemann, J. (1970): Some new lead oxide minerals and murdochite from T. Khuni mine, Anarak, Iran. Mineralium Deposita, 5, 86-93.

Йемен, Аравийский п-ов \\

Оман

--Gordon Stanger and Colin Neal (1984) A New Occurrence of Suolunite, from Oman. Mineralogical Magazine 48:143-146

Сирия

Турция \\ минералы и местонахождения --см. http://www.mineralienatlas.de/ \\ Ryan C. W. Guide to the Known Minerals of Turkey. Ankara, 1960, 196 p.

Индия, Непал, Шри-Ланка

Индия - http://www.mindat.org/loc-16773.html

1. Бенстонит. Джоджипатти \ Jogipatti, Мадрас, Индия. Образец: ФМ (╧72323. Семёнов Е.И., 1969). Фото: ╘ А.А. Евсеев.2. Югаваралит, апофиллит. Малад, Мумбай (Бомбей), Индия. Образец:═Музей Terra mineralia, Германия. Фото: ╘ Д. Тонкачеев

Шри-Ланка

Вост. Азия ( Китай и др.)

Китай \ China \\ www.mindat.org

- новые минералы, открытые в Китае - \\ de Fourestier, J. (2000): Mineral species first found in the People's Republic of China. Rocks & Minerals.
- Словарь географических названий Китая / [Сост. Я. А. Миропольский, Г. Е. Тихонова]. - М. : Наука, 1984-. - 22 см.
2. Т-Я. - М. : Наука, 1984. - [1], 471-848 с

--Ottens B. China: Mineralien, Fundstellen, Lagerstatten. Christian Weise Verlag. 2008, 552 pp.

Внутр. Монголия \\
Ганьсу пров. \\

Гуандун \\

Гуанси-Чжуанский автономный район \\ Гуйчжоу \\

Синьцзян-Уйгурский автономный район; Китай

Берилл (разн. аквамарин), Чонкур-Джайляу, Синьцзян-Уйгурский автономный район; Китай. Образец: Минер. музей им. А.Е. Ферсмана РАН (╧74634, Беус А.А.. 1972 г.). Более 40х15 см. Фото: ╘ А.А. Евсеев.

Сычуань, Китай \\

Тайвань

--Суолунит \\ Kung-Suan Ho et al (2009) The First occurrence of Suolonite in Taiwan. Coll and Res 22:1-13

Тибет \\

Фуцзянь, провинция \\ Хайнань , Китай \\ Хубэй

Хунань, провинция, Китай - http://www.mindat.org/loc-705.html

Цзянси пров.

Цинхай \\ Цзянси пров. \\ Шаньси \\ Юньнань \ Yunnan \\ www.mindat.org

Юньнань

Флюорит_Китай и Монголия

Вьетнам \\

Индонезия - см. http://www.mineralienatlas.de/

[Аурипигмент, реальгар, кальцит]. Зап. Ява, Индонезия. "Гемма". 2013.04.06. Фото: ╘ А.А. Евсеев. \\ (так называемая "шмелиная" яшма \ "so-called "bumblebee jasper", which is no jasper at all, but calcite, mostly fibrous, that is beautifully colored and banded by co-precipitated fine-grained yellow, orange-red and black minerals. Judged from the volcanic origin, the yellow and orange colors are probably caused by orpiment and realgar, but so far no analysis has been done". Источник:═www.mindat.org

Камбоджа \\ Лаос \\ Малайзия \\

Монголия

--Липовский Ю.О., Сережникова Э.Ф. Цветные камни (Монголия) // Геология Мон╜гольской Народной Республики. ≈ М.: Недра, 1977. ≈ Т. 3. ≈ С. 599-621.

 

Мьянма (быв. Бирма) \\

--Тринефелин* и фабриесит* - новые минеральные виды из жадеитового месторождения Тавмав (Мьянма) \\ Ferraris, C., Parodi, G.C., Pont, S., Rondeau, B., Lorand, J.-P. (2014): Trinepheline and fabriesite: two new mineral species from the jadeite deposit of Tawmaw (Myanmar). European Journal of Mineralogy, 26, (in press).

--Эльбаит "грибовидный" \\ Lussier, A.J.; Aguiar, P.M.; Michaelis, V.K.; Kroeker, S.; Herwig, S.; Abdu, Y.; Hawthorne, F.C. (2008): Mushroom elbaite from the Kat Chay mine, Momeik, near Mogok, Myanmar: I. Crystal chemistry by SREF, EMPA, MAS NMR and Mossbauer spectroscopy. Mineralogical Magazine, 72, 747-761.

Таиланд \\ Филиппины \\

ЮВ Азия

Африка

Алжир \\

Замечательные минералогические находки Алжира и прилегающих территорий (примеры). Составил А. Евсеев 2016.06.20

 

Гвинея \\ Египет \\ Мали \\

Марокко

-- Steffen Jahn, Rainer Bode, Peter Lyckberg, Olaf Medenbach, Hans-Jurgen Lierl═u.a. Marokko (Morocco). 2003. - 536 pages ═

Нигерия \\

Сенегал

Тунис

Центрально-Африканская республика.(ЦАР)

Экв. и Южн. Африка

Ангола \\

Габон

Замбия \ Zambia (ныне) = Сев. Родезия (быв.), Африка

--Дациншанит-(Ce) \\ Appleton J.D., Bland D.J., Nancarrow P.H., Styles M.Z., Mambwe S.H., Zambezi P. (1992) The occurrence of daqinshanite-(Ce) in the Nkombwa Hill carbonatite, Zambia. - Mineralogical Magazine, 56, p. 419-422.

Зимбабве

Камерун

Конго НР

Конго ДР (быв. Заир) \\ Buttgenbach H. Mineraux de Belgique et du Congo Belge. Liege, 1947, 590 p.

Намибия \

--Владкривовичевит и херероит - новые минералы из р-ка Комбат (Комбат) \\ Turner, R., Siidra, O.I., Rumsey, M.S., Krivovichev, S.V., Stanley, C.J., and Spratt, J. (2012): Hereroite and Vladkrivovichevite: two novel lead oxychlorides from the Kombat mine, Namibia. Mineralogical Magazine vol 76(4), pp 883-890.

1. Еремеевит. 72 миля, Кейп Кросс (район), Намибия \ Mile 72, Cape Cross area, Swakopmund District, Erongo Region, Namibia. Фото: ╘ Rob Lavinsky. Источник: www.mindat.org 2. . Еремеевит. Эронго, Намибия. ~6 см. Образец: Д. Лисицин. "Гемма". 2014. 10. 05 . Фото: ╘ А.А. Евсеев

- Еремеевит

---Herting, S., and Strunz, H., (1978) Jeremejewit von Mile 72 in SW-Afrika. Aufschluss: 29 45-53 (in German).

---Wilson, W.E. et al. (2002) Jeremejevite from Namibia. Mineralogical Record: 33 289-301

--Шаттукит !! Niedermayr, G., Schnaitmann, E. A., Brandstatter, F. (2008): Das Dioptas-Shattuckit-Vorkommen Kandesei im Kakokoland [sic]. Mineralien-Welt 19, 76-93 (in German)

Замечательные минералогические находки в сев.-зап. части Намибии (примеры) \\ ~400х600 км

Экв. Гвинея

ЮАР

Замечательные минералогические находки Южн. Африки (примеры). Составил: А. Евсеев.

Вост. Африка \\

Бурунди \\

Кения

Мадагаскар \\ 516 минералов и разновидностей, 323 достоверных видов, 12 новых видов \\ 516 entries listed. 323 valid minerals. 12 type localities (valid minerals) на 2012.10.13 .\\ http://www.mindat.org/loc-2247.html \\ лондонит!!; родицит!!; скиавинатоит \ schiavinatoite*

--Пеццоттаит - новый минерал

--Laurs, Brendan M., William B. (Skip) Simmons, George R. Rossman, Elizabeth P. Quinn, Shane F. McClure, Adolf Peretti, Thomas Armbruster, Frank C. Hawthorne, Alexander U. Falster, Detlef Gunther, Mark A. Cooper, and Bernard Grobety (2003): Pezzottaite from Ambatovita, Madagascar: A New Gem Mineral. Gems & Gemology: 39(4): 284-301.
--Hawthorne, F.C., Cooper, M.A., Simmons, W.B., Falster, A.U., Laurs, B.M., Armbruster, T., Rossman, G.R., Peretti, A., Gunter, D., and Grobety, B. (2004) Pezzottaite Cs(Be2Li)Al2Si6O18 A spectacular new beryl-group mineral from the Sakavalana pegmatite, Fianarantsoa province, Madagascar. Mineralogical Record: 35(5): 369-378.

Тортвейтит. Бефанаму \ Befanamo, к З от Анказубе, Мадагаскар. Образец: ФМ (╧14287, Лакруа А. \ Lacroix A. через В.И. Вернадского, 1924). Фото: ╘ А.А. Евсеев.

Малави \\

Мозамбик

Руанда \\ минералы - http://www.mindat.org/loc-21896.html \\ местонахождения - http://www.mindat.org/rloc.php?loc=Rwanda

Сомали

Танзания \\ http://www.mindat.org/loc-4384.html \\ м-н-ния - http://www.mindat.org/rloc

Уганда

Эфиопия

Австралия \ Австралия и Новая Зеландия

Виктория \\

Западная Австралия \\

ЗАП. АВСТРАЛИЯ (Ю). Местонахождения минералов и примеры находок. Замечание: в списки минералов включены редкие находки, сделанные в разное время (иногда 100-200 лет назад), многие из них больше не повторялись.Название и привязка (положение на карте) некоторых местонахождений требует уточнения (показаны на карте красными и коричневыми значками). Карты предназначены только для образовательных целей. Источник: Евсеев А.А. Атлас мира для минералога. М., 2004. - 284 с.

1 √ Mount Keith Ni-deposit \ Маунт-Кейт м-ние (Ni)--*mountkeithite; *2001-woodalite

2 - Poona Hill \ Пуна-Хилл [=? Poona mine--изумруд!]
3 - Perseverence Mine, Agnew--виоларит; таковит (D)
4 - Northampton--галенит!!--xls на кварце (AJM,ф)
5 - Ninghanboun Hills--*лейкофосфит
6 √ Leonora \ Леонора (MR, 1988, 355)
7 - Mount Malcolm--золото!!--выд. 45х10 мм (AJM,ф); золото в яшме
8 √ Laverton--MR, 1988, 355
9 - Toppin Hill \ Топпин-Хилл (р-н)--*мочевина; *фосфаммит-- Earles Find; AJM, 2000, с.121, с.126
10 √ Menzies--изумруд!
11 - Carr Boyd Rocks Ni-mine \ Карр-Бойд-Рокс р-к--*каррбойдит; *никельблёдит; *1979-georgeite
12 - Siberia complex--*1994-эрникелит
13 - Kalgoorlie \ Калгурли≈алтаит!; калаверит; колорадоит!; креннерит; петцит!; разн.--BRE (19); роскоэлит; сильванит; теллуриды Au; *тиванит
13 -═ ? Perseverance mine--*томичит; уточн. коорд. (AJM, 2000, 125)
14 √ Coolgardie \ Кулгарди--золото!; кёхлинит!; опал благ.!! (AJM, ф)
15 √ Londonderry \ Лондондерри≈берилл!; "*боулиит"(= битиит); воробьевит!; петалит!!≈д.к. (Sink., 1981, 370); танталит
16 √ Spargoville≈ферроколумбит!!--xls<7 см (AJM, 2000, 90)
17 - Durkin mine--*никельблёдит
17 - Durkin shaft, Hampton East location--*1974-глаукосферит
17 √ Kambalda \ Камбалда--гаспеит; мелонит; *нов. м.
17 - Otter Shoot Ni-mine \ Оттер-Шут р-к--*гидрохонессит; * камбалдаит
18 - 132 North Ni mine, Widgiemooltha-- гаспеит!!--обр. 30 см (AJM, 2000, 98); *widgiemoolthalite
19 - Minyulo Well--*1932-миниюлит
20 - Marda--*натрий-фармакосидерит; коорд. √см. AJM, 2000, 124
A √ Fraser`s mine, Southern Cross--гипс!!≈щётка; AJM, 2000, 98ф
B √ Youndegin--метеорит железный!!!--2, 5 т, нах. 1903 г.; AJM, 2000, 100фC √ Youndegin Meteorite (по AJM)--*криновит; *роалдит; уточнить привязку! D √ Mt. Holland (пегматит)--*1985-кимробинсонит
E √ Jimberlana intrusion--*ловерингит F √ Boddington \ Боддингтон, м-ние(Au)--*saddlebackite (AJM)G √ Bunbury Gully, Greenbushes--*холтит
G √ Greenbushes tin placers \ Гринбушес, россыпи (Sn)--пол. шпат!!; *стибиотанталит; танталит!; холмквистит!!--xls<15 см (D); *холтит! (лок.--AJM) H √ Ravensthorpe--атакамит!! (Sink, 1966)

Квинсленд \\

Новый Южный Уэльс \\

Северная территория \\

--Корнерупин!! \\ G.G.Warren & D.H.McColl 1983. Occurrences of boron-bearing kornerupine in the western Harts Range and near Mount Baldwin, Arunta Block, Central Australia. BMR Journal of Australian Geology and Geophysics, 8 pp. 93-96 1983

Тасмания

Южная Австралия \\

Новая Зеландия

Восточное полушарие

Ю ж н о е _ п о л у ш а р и е

З а п а д н о е _ п о л у ш а р и е

Минералогические находки Сев. и Южн. Америки (примеры). 1.Медь. Кивино п-в, оз. Верхнее, США. 2. Ставролит. Пилар, Нью-Мексико, США. 3. Пирит. Спарта, Иллинойс, США. 4. Касситерит. Дуранго, Мексика. 5. Ангидрит. Арекипа \ Arequipa, Перу. 6. Родохрозит. Капильитас, Аргентина. Составил: А. Евсеев.

Северная Америка

Замечательные минералогические находки Сев. Америки (по размеру кристаллов и др.). 1. Эпидот. Аляска. 2. Родохрозит. Суит Хоум майн, Колорадо, США. 3. Нефелин. Онтарио, Канада. 4. Серандит. Сент-Илер, Квебек, Канада 5. Лабрадор. Канада. 6. Ганксит. Калифорния. 7. Кернит (слева) и индерит. Борон, Калифорния. 8. Вульфенит. Ред-Клауд майн, Аризона. 9. Альбит. Амилия-Курт-хаус \ Amelia Court House, Виргиния. 10. Гипс. Найка, Чиуауа, Мексика 11. 12. Леграндит. Охуэла р-к, Дуранго, Мексика. 13. Гроссуляр. Мексика. 14. Рутил . Грейвс-Маунтин, Джорджия, США. Составил: А. Евсеев, 2016.

Канада \\

--Ann P. Sabina. Rock and mineral collecting in Canada. Ottawa : Geological Survey of Canada, Dept. of Mines and Technical Surveys, 1964.\\ другие публикации -

-- Трейл Р. Дж. Каталог минералов Канады. \ Trail R. J. Catalogue of Canadian Minerals. Revised 1980. Geol. Surv. of Canada Paper 80-18, 1983, 483 p.

США \\ http://www.mineralienatlas.de/lexikon/index.php/USA

Рекордные по весу (более 200 карат) ограненные камни из месторождений США. Составил: А. Евсеев. Данные из книги Дж. Синканкаса - Sinkankas J. Gemstones of North America, Volume III. Geoscience Press, Inc. Tucson, 1997.-527 p.

--Шмакин Б.М., Топунова Г.А. Гранитные пегматиты США. М., 1981,116 с

American Mineral Treasures [Сокровища минералов Америки]. 2008. - 368 p. \\ Подробнее: http://www.lithographie.org/bookshop/hc_american_mineral_treasures.htm \\ см. также http://geo.web.ru/druza/l-USA_AMT.htm

Топографическая минералогия ( литература о местонахождениях по штатам) \\ http://www.minsocam.org/

Сев. Америка (С)

Аляска

Замечательные минералогические находки Аляски и прилегающих территорий (примеры). Составил А. Евсеев 2016.06.20\\ k-24

1. Натролит. Миндалины из разрушенной вулканической породы. Уналашка о., Алеутские о-ва, Аляска, США. Образец: ФМ (╧27258, Вознесенский, 1925). 2. Кварц (японский двойник) с включениями актинолита.. Грин-Монстер Маунтин, о. Принца Уэльского, Аляска, США. ~3 см. (Р-609. Дар: Д. Толанд, 2010). Образец: Минер. музей РГГРУ. Фото 1-2: ╘ А.А. Евсеев.

\\ Нунавут

Северо-Западные территории \ North-West Territories, Канада

--Перовскит \\ Anton R. Chakhmouradian and Roger H. Mitchell (2001) Three compositional varieties of perovskite from kimberlites of the Lac de Gras Field (Northwest Territories, Canada). Mineralogical Magazine 65:133-148

Юкон

Гренландия \\

- Petersen, O. V. & Johnsen, O. (2005): Mineral species first described from Greenland. Canadian Mineralogist, Special publication no. 8.

Сев. Америка (В)

Сев. Америка (В)_находки крупных кристаллов (10 см и более)

--WILSON, W.E. (1991) The Lake George antimony mine, New Brunswick. Mineralogical Record 22, 263-267.

Айова

Вермонт \\

Верхнее оз

Виргиния \\ Висконсин \\ Джорджия \\ Иллинойс

Индиана, США \\ http://www.mindat.org/loc-16287.html \\ более 100 фото минералов из осадочных пород (доломит, миллерит!!; целестин!; флюорит! и др.) www.mindat.org/gallery

Квебек \\

--Тетфорд Майнс \\ Amabili, M., Spertini, F., Auguste, M. B., and Bonin, G., (2009) Famous Mineral Localities: The Lac D'Amiante Mine, Back Lake, Thetford Mines, Quebec. Mineralogical Record 40(4) 297-304; Laszlo Horvath (p.c., 2003)

--Ниобоэшинит-(Y)* --новый минерал \\ Bermanec, V., Tomasic, N., Kniewald, G., Back, M.E., Zagler, G. (2008) Nioboaeschynite-(Y), a new member of the aeschynite group from the Bear Lake diggings, Haliburton County, Ontario, Canada. The Canadian Mineralogist 46, 395-402.

Коннектикут

Лабрадор

Манитоба \

Массачусетс \\

Миннесота \\

Миссури \\ Мичиган \\

Мэн \\

Новая Шотландия, Канада \\

Минералогические находки ЮВ Канады \\ Poudrette quarry, Сент-Илер--анальцим!!; карлетонит!!; серандит!!!; новые мин.-65 нов. видов \\ Jeffrey Mine, Asbestos--везувиан!!!--487ф-мд \\ Lake George Antimony mine--сурьма!!--10ф-мд; стибиванит*; \\ Potash Corporation of Saskatchewan Mine, Penobsquis \\ волковскит!; конголит;кургантаит; Brianroulstonite* \\ Wasson Bluff, Parrsboro--шабазит!!--54ф-мд \\ Wentworth Quarry (Fundy Gypsum; Canadian Gypsum Company)--говлит! \\ Brazil Lake pegmatite, Yarmouth Co.-берилл!; сподумен!!--кр-лы до 2 м--ф \\ Mount Apatite District, Auburn--фторапатит!!-сиреневый! Составил: А. Евсеев, 2016 \\ k-24

Нью-Брансуик пров., Канада\ New Brunswick, Canada

--Potash Corporation of Saskatchewan Mine (PCS Mine; Potash Corporation of America Mine), Penobsquis, Cardwell Parish, Kings Co., New Brunswick, Canada \\ витчит!--ф; волковскит!-ф; конголит; кургантаит; Brianroulstonite* \\ www.mindat.org

Нью-Гэмпшир, США \\

Нью-Джерси, США - http://www.mindat.org \\

Кутногорит. Стерлинг-Хилл, Нью-Джерси, США. Более 5 см. Образец: ФМ (╧66285, Mason B., 1964). Фото: А.Евсеев.

Нью-Йорк \\

--Местонахождения минералов указатель \\ George Robinson & Steven Chamberlain (2007) Gazetteer of major New York State mineral localities. Rocks & Minerals, 82, #6, 472-483.;

Онтарио\ Ontario, Канада \\

Минералогические находки ЮВ Канады и прилегающих территорий. Составил: А. Евсеев, 2016 \\ k-24

Пенсильвания, США - http://www.mindat.org/loc-14026.html \\

Сев. Каролина \\

--Corundum (Var: Ruby) : Al2O3, Actinolite (Var: Smaragdite) :

Теннесси \\ Флорида

Сев. Америка (З)

Айдахо, США \\

Альберта, Канада

Аризона, США \\ на странице http://www.mindat.org/loc-3293.html (на 2015.09.27) -- 1242 минерала (842 вида) из них - 82 новых мин. вида \\ для сравнения на 2008 г. - 887 минералов (690 видов). из них 46 новых видов \\ в сводке Anthony J.W. et al, 1995 --809 мнр. видов, из них 76 новых видов \\ Anthony, J.W., et al (1995), Mineralogy of Arizona, 3rd.ed.:

Вульфенит Аризоны

Арканзас, США

Вайоминг, США

Колорадо, \\ http://www.mindat.org/rloc

Монтана \\

- Gobla, M.J. (2012) Montana mineral locality index. Rocks & Minerals, 87, #3, 208-240.

Невада \\

Нью-Мексико, США \\

--Джорджчаоит*(1985) - новый минерал из Уинд-Маунтин, Нью-Мексико BOGGS, R.L. & GHOSE, S. (1985): Georgechaoite NaKZrSi3O9?2H2O, a new mineral species from Wind Mountain, New Mexico. - Canadian Mineralogist, 23, 1 4.═

--Уинд-Маунтин, Нью-Мексико \\ Джорджчаоит*; йофортьерит!; ловозерит; ридмержнерит; розенбушит--3ф-мд; туперссуатсиаит--ф \\ Подробнее: www.mindat.org

Йортфортьерит. Уинд-Маунтин \ Wind Mountain, Нью-Мексико, США. Фото: Jerry Cone. This image has been released to the public domain and may be used freely. Это изображение было передано в общественное достояние и может свободно использоваться.═\\ Источник: www.mindat.org

Оклахома \\ Саскачеван

Техас, США \\

Южная Дакота, США \\

Юта, США \\

Сев. Америка (Кордильеры)

Британская Колумбия, Канада - http://www.mindat.org/loc-14311.html

--Нефрит!! \\ Dease Lake, Liard Mining Division, Брит. Колумбия, Канада --монолит весом 1300 кг (1,5х0,3 м)--фото - www.mindat.org

Вашингтон, США \\ Cannon, B. (1975): Minerals of Washington: 53.

Орегон

Калифорния, США \\ http://www.mindat.org/loc-3424.html \\ фото \\ Калифорния_минералы по контуру \\

- Долина Смерти, округ Иньо, Калифорния - рудники и месторождения \\ Evans, James R., G.C. Taylor, and J.S. Rapp (1976) Mines and mineral deposits in Death Valley National Monument. California Division Mines and Geology Special Report 125: 1-61: 28.

Гавайские о-ва \ Hawaii, Тихий океан; США \\

Мексика

Замечательные минералогические находки Мексики (примеры).\\ Bolanos--серебро!--ФМ \\ Хальпа \ Jalpa --ялпаит* \\ Сан-Карлос р-к, Гуанахуато--агвиларит*---xls!!--!B-04 \\ Валенсиана\ Valenciana--аметист; аргентит; миларит; ортоклаз; полибазит; прустит; пираргирит; серебро; стефанит--Bancroft \\ Симапан \ Zimapan--ванадинит*;огнен. опал!!-ф \\ Trapichillos--андрадит!!!--xls<20 см--B-04 \\ Inguaran \ Ингуаран--япон. дв-ки кварца--ф\\ Amatitlan--аметист!!--87ф--мд \ Margareta mine \\ Huitzuco de los Figueroa (Huitzuco)--ливингстонит*--12ф-мд \\ Tetela de Xonotla, Puebla--ксонотлит* \\ Las Vigas de Ramirez (муниц.)--аметист!!--137ф \\ Cerro Platano, Xaltianguis-спесартин на п.ш.-похож на китайские ?-ф-мд \\ Составил А. Евсеев. 2016.06.16 \\ НМК--143 \\k-27

--Наследовит \\ San Miguel Mine, Moctezuma, Mun. de Moctezuma, Sonora (ср. Алтын-Топкан*)

--Натанит \\ Potosi Mine, Francisco Portillo, West Camp, Santa Eulalia District, Mun. de Aquiles Serdan, Chihuahua, Mexico --9ф--мд (ср. Мушистон*)

Кридит. West Camp, Santa Eulalia , Чиуауа, Мексика. \\ Источник: www.google.ru

--Moore, T., and Origlieri, M. (2008): Famous Mineral Localities: The Milpillas Mine, Cananea District, Sonora, Mexico. Mineralogical Record 39(6), 25-34.

Куранахит. Бамбольита р-к\ Bambollita mine, Моктесума, Сонора, Мексика. Образец: ФМ (╧82437. Eadis A . F ., 1983). Фото: ╘ А.А. Евсеев. \\ Bambollita mine - www.mindat.org \\ Куранахит--www.mindat.org/

Местонахождения (минералогические находки) куранахита в Сев. Америке. Источник: www.mindat.org

Радужный обсидиан. [Мексика] Более 10х15 см. Образец: Мин. музей им.А.Е. Ферсмана РАН. Фото: ╘ А.А. Евсеев.

- Радужный обсидиан - La Revoltosa Mine,═San Andreas, Mun. de Magdalena,═Jalisco,═Mexico \\ Подробнее - www.mindat.org

Мексика - 9 минералов \\ Мексика_крупные кристаллы \\ Мексика_крупные кристаллы_5 с

Центральная Америка

Куба

Южная Америка

Ю. Америка (СЗ)

Венесуэла \\

Гайана \ Guyana (до 1966 г. - Британская Гвиана) \\

Колумбия \\

Эквадор

Аргентина. \\

--Victorio Angelelli, M. K de Brodtkorb, C. E. Gordillo y H. D. Gay (1983). Las Especies Minerales de la Republica Argentina. Subsecretaria de Mineria. Publicacion Especial. 528 pp. Buenos Aires. Argentina.

Подробнее: http://ama.gl.fcen.uba.ar/index.php/publicaciones/

Минералогия Аргентины - веб- публикация - http://ama.gl.fcen.uba.ar/index.php/publicaciones/

de Brodtkorb, M.K. (Ed.) (2002): Las Especies Minerales de la Republica Argentina. Tomo I, xx pp.

de Brodtkorb, M.K. (Ed.) (2006): Las Especies Minerales de la Republica Argentina. Tomo II, 428 pp.

de Brodtkorb, M.K. (Ed.) (2007): Las Especies Minerales de la Republica Argentina. Tomo III, xx pp. [Volumes 1-3 are online: http://ama.gl.fcen.uba.ar/index.php/publicaciones/]

Paar, W.H., de Brodtkorb, M.K., Putz, H. and Martin, R.F. (2016): Atlas of Ore Minerals: Focus on Epithermal Deposits of Argentina. The Canadian Mineralogist Special Publication 11, 402 pp.

Минералогические находки на севере Аргентины. Составил А. Евсеев, 2016. \\ k-29

Боливия \\

Перу \\

Гюбнерит с кварцем. Пасто-Буэно, Анкаш, Перу.═Образец: ╘═Музей Terra mineralia, Германия. Фото: ╘ Д. Тонкачеев

Сайт о минералах Перу на Facebook: https://www.facebook.com/MineralesPeruanos

Список минералов (A-Z)+ фото - http://www.mindat.org/locdetailed-5869.html

Чили \\

--Антипинит - новый минерал. Pabellon de Pica*, Chanabaya, Iquique Province, Tarapaca Region, Chile \\ Chukanov, N.V., Aksenov, S.M., Rastsvetaeva, R.K., Lyssenko, K.A., Belakovskiy, D.I., Farber, G., Mohn, G., Van, K.V. (2015): Antipinite, KNa3Cu2(C2O4)4, a new mineral species from a guano deposit at Pabellon de Pica, Chile. Mineralogical Magazine, 79, 1111-1121.

--Чанабаяит- новый минерал. Pabellon de Pica*, Chanabaya, Iquique Province, Tarapaca Region, Chile \\ Чуканов Н.В., Зубкова Н.В., Мён Г., Пеков И.В., Пущаровский Д.Ю., Задов А.Е. Чанабаяит Cu2(N3C2H2)2Cl(NH3Cl,H2О,?)4 - новый минерал, содержащий триазолятный анион // Записки РМО, 2015. Часть 144, вып. 2, с. 36-47 \\ Подробнее - http://wiki.web.ru/wiki/Чанабаяит

--Шиловит - новый минерал. Pabellon de Pica*, Chanabaya, Iquique Province, Tarapaca Region, Chile \\ Chukanov, N.V., Britvin, S.N., Mohn, G., Pekov, I.V., Zubkova, N.V., Nestola, F., Kasatkin, A.V., Dini, M. (2015): Shilovite, natural copper(II) tetrammine nitrate, a new mineral species. Mineralogical Magazine, 79, 613-623.

Бразилия \\ минералы -787 ; достоверные виды - 601 \ 620; новые виды - 51 \ 53; местонахождения \ localities - 843 \ 1008 ; фото минер. √ 5430 \ 6613; фото мест √ 74 \ 115 (на 2009.08.05 \ 2010.05.06) \\ Источник: http://www.mindat.org/loc-366.html \\ http://www.mindat.org/rloc.php?loc=Brazi

--Воджинит на касситерите (эпитаксия)! \\ Dunn, P.J.; Gaines, R. W.; Wolfe, C.Wroe & Barbosa, C.do P. (1978): Epitaxial Wodginite and Cassiterite from Lavra Jabuti, Baixio, Galileia, Minas Gerais, Brazil. Mineralogical Record 9 (1), 14-19. \\ фото - www.mindat.org

--Туркестанит \\ Vilalva, F.C.J., and Vlach, S.R.F. (2010): Major- and trace-element composition of REE-rich turkestanite from peralkaline granites of the Morro Redondo Complex, Graciosa Province, south Brazil. Mineralogical Magazine 74(4), 645-658.\\ www.mindat.org/

Амазония

Гентгельвин (розовый) и криолит (коричневый). 31х30 мм. Мадейра плутон, Питинга р-к, Амазонас, Бразилия \ Madeira pluton, Pitinga mine, Presidente Figueiredo, Amazonas, Brazil. Photo and collection Fernando Brederodes. This image has been released to the public domain and may be used freely. Это изображение было передано в общественное достояние и может свободно использоваться.═ Источник: http://www.mindat.org/photo-649418.html

Источник: http://www.mindat.org/loc-215301.html

Мадейра м-ние (и плутон), Питинга, Амазония, Бразилия \ Madeira Nb-Ta-Sn deposit, Pitinga, Amazonas State, Brazil \\ криолит!!; рибекит!

-Bastos Neto, A. C., Pereira, V. P., Ronchi, L. H., de Lima, E. F. and Frantz, J. C.(2009): The world-class Sn, Nb, Ta, F (Y, REE, Li) deposit and the massive cryolite associated with the albite-enriched facies of the Madeira A-type granite, Pitinga mining district, Amazonas State, Brazil. Canadian Mineralogist 47, 1329-1357.

- Bastos Neto, A. C., Pereira, V. P., Pires, A. C., Barbanson, L. & Chauvet, A. (2012): Fluorine-rich xenotime from the world-class Madeira Nb-Ta-Sn deposit associated with the albite-enchriched granite at Pitinga, Amazonia, Brazil. Canadian Mineralogist 50, 1453-1466.

Баия, Бразилия

Мату-Гросу шт.

Минас-Жерайс шт. \\ минералов - 713, из них твердых видов - 491, из них новых видов - 46 (на 2015.09. 30) \\ источник: http://www.mindat.org/

--Кунцит!!!

--Матиолиит * - новый минерал, Mg-аналог бурангаита \\ Atencio, D., J.M.V. Coutinho, Y.P. Mascarenhas, and J.A. Ellena (2006): "Matioliite, the Mg-analog of burangaite, from Gentil mine, Mendes Pimentel, Minas Gerais, Brazil, and other occurrences". Am. Mineral. 91:1932-1936.

--Менезесит* - новый минерал \\ Daniel Atencio, Jose M.V. Coutinho, Antonio C. Doriguetto, Yvonne P. Mascarenhas, Javier Ellena, and Viviane Ferrari1 (2008): Menezesite, the first natural heteropolyniobate, from Cajati, Sao Paulo, Brazil: Description and crystal structure. American Mineralogist, 93, 81√87.

--Платина, палладий и потарит \\ Fleet, M.E., De Almeida, C.M., and Angeli, N. (2002) Botryoidal platinum, palladium and potarite from the Bom Sucesso stream, Minas Gerais, Brazil: compositional zoning and origin. Canadian Mineralogist: 40: 341-355.

Параиба

Риу-Гранди-ду-Норти, Бразилия \\

--Robinson, G.W. & Wegner, R.R. (1998): Mineralogy of the Boqueiraozinho pegmatite, Parelhas, Rio Grande do Norte, Brazil. Mineralogical Record 29, 193-197.

Риу-Гранди-ду-Сул, Бразилия \\

Сан-Паулу

Парагвай \\ Уругвай

АНТАРКТИДА \\

Опал. Пролив Дрейка, Антарктида. Образец С.В. Бусыгина. Фото: ╘ Б.З. Кантор (Мир минералов, 2013)

Новые минералы:

Вокруг Антарктиды (прилегающие территории)_минералогические находки

Океаны

Тихий океан \\

Новая Гвинея о., Океания, Тихий океан; Индонезия \ Папуа - Новая Гвинея \\ второй по величине остров Земли (после Гренландии)

Новая Каледония -- геология и пол. ископаемые

Гавайские о-ва \ Hawaii, Тихий океан; США \\

--Обсидиан - "волосы Пеле" (нитевидные формы) --фото www.mindat.org
Фиджи, Тихий океан

Южное полушарие

Весь мир

Замечательные находки кристаллов России и Казахстана (примеры). Составил А. Евсеев, 2016.

Замечательные находки кристаллов по всему миру. Составил А. Евсеев, 2016. \\ 1. Кварц (япон. двойник). Аляска, США 2. Диопсид. Квебек, Канада . 3. Флюорит. США. 4. Гипс (кристалл, покрытый корочкой бирюзы). США. 5. Доломит. Испания. 6. Авгит. Чехия. 7. Вольфрамит. Португалия. 8. Диаспор. Турция. 9. Корунд. Шри-Ланка. 10. Андалузит. Китай. 11. Арсенопирит. Китай. 12. Эритрин. Бу-Аззер, Марокко. 13. Амазонит. Консо, Эфиопия. 14. Кварц с включениями рутила. 15. Топаз. Минас-Жерайс, Бразилия

Фото дня или "За месяц вокруг света" - 2014.11-12 - 2015. 01 - 2015. 02 - 2015. 03 - 2015. 04 - 2015. 05 - 2015.06 - 2015.07 - 2015.08 - 2015.09- 2015.10 - 2015.11 - - 2015.12 - 2016.01 - 2016.02 - 2016.03 - 2016.04 - 2016.05 - 2016.06

Фото дня или "За месяц вокруг света". 2016.06. Составил А. Евсеев.

Всемирная минералогия-32 - по одному минералу от региона

А.А. Евсеев. Минералогические находки вокруг света вдоль 40-ой параллели. - Минералогический альманах, т.13, 2008, с. 76-85.
\\ Краткий вариант статьи \\ Полный текст статьи \\ Фотогалерея \\

--Кристаллы пяти континентов_экспозиция в Минералогическом музее им. А.Е. Ферсмана РАН \\ текст

--Минералы- спутники на расстоянии (минералы-телеспутники)

--Журнал "Вокруг света" - http://www.vokrugsveta.ru/

--Институт географии РАН _Информационный портал

Путешествия за камнем

--Беус А. Путешествия в тропики за самоцветами. ≈ М.: Наука, 1992. ≈ 221 с

--Ферсман А.Е. "Путешествия за камнем" \\ читать

--В.А. Обручев. Мои путешествия по Сибири \\ читать

МИНЕРАЛЫ \

5 замечательных находок \ Европа - Азия - Африка - Австралия - Сев. Америка - Южн. Америка (выборка: по одному образцу из северной, южной, западной, восточной и центральной части каждого регион). Случайная выборка

Вторые находки минерала в мире, ставшие лучшими

"Сборные" минералов по странам и регионам (10-15 избранных находок) \\ 1-е -в 2007 г.

По 2 минерала от континента за 2 минуты (экспресс-опрос)

Ареалы находок минералов (основные находки ряда минералов, вынесенные на карту мира)

Кристаллы пяти континентов_выставка в Минералогическом музее им. А.Е. Ферсмана РАН

--Евсеев А.А. Географическая привязка первоначальных местонахождений минералов. \\ Новые данные о минералах. М.: ЭКОСТ, 2003. Вып. 38, с. 113-124.

--А.А. Евсеев. Минералогические находки вокруг света вдоль 40-ой параллели с. ш.

Океаны

Острова (от Гренландии до Мадагаскара) \ минералогические находки

Луна \\ минералогия - http://luna-mineralogiya.ru/index.html

АВТОРЫ \ \ А √ Л | М - Я | A - Z Анастасенко| | Г.П. Барсанов || И.В. Бельков || В.И. Вернадский || А.В. Волошин || В.И. Воробьев | Гиймен К. \ Guillemin C.| | А.А. Годовиков || Б.З. Кантор | К.И. Клопотов || Ю.С. Кобяшев || П.А. Кочубей | Крыжановский В.И. || А.Н. Лабунцов | М.Н. Малеев || В.А. Мальцев || Л.А.Паутов || И.В. Пеков || В.А. Пелепенко || В.В. Пономаренко | | В.А. Слётов | Э.М. Спиридонов | | В.И. Степанов | А.Е. Ферсман | А.П. Хомяков || Б.В. Чесноков || Н.В. Чуканов || Н.П. Юшкин и другие

Из публикаций: А - Б - В - Г - Д - ЕЁ - Ж - З - И - К - Л - М - Н - О - П - Р - С - Т - У - Ф - Х - Ц - Ч - ШЩ - ЭЮ - Я - AZ \\ A - B - C - D - E - F - G - H - I - J - K - L - M - N - O - P - Q - R - S - T - U - V - W - X - Y - Z

Юдович Я. Э., Кетрис М. ПРоссийские геологи рассказывают о себе. Тексты с комментариями. Книга Первая. Открытия и находки, прозрения и разочарования. Сыктывкар: Геопринт, 2015. 480 с.

Юдович Я. Э., Кетрис М. П. Российские геологи рассказывают о себе. Тексты с комментариями. Книга Вторая. Геологическое поле. Сыктывкар: Геопринт, 2015. 376 с.

Юдович Я. Э., Кетрис М. П. Российские геологи рассказывают о себе. Тексты с комментариями. Книга Третья. Советская геология. Сыктывкар: Геопринт, 2015. 336 с.

Бетехтин А.Г. Минералогия. ≈ М.: Государственное издательство геологической литературы, 1950. ≈ 956 c. \\ веб-публикация \\ Об авторе: Выдающийся российский геолог (к 100-летию со дня рождения А.Г. Бетехтина)═/ Н.═Лаверов, В.═Жариков, Н.═Ерёмин и═др.═// Вестник Московского университета. Серия 4. Геология. ≈ 1997. ≈ ╧═1. ≈ С.═69√71.

Смирнов В.И. Геология полезных ископаемых ≈ M.: ╚Недра╩, 1982. ≈ 669 c. \\ веб-публикация

Ферсман А.Е. Путешествия за камнем (веб-публикация) \\ http://lib.rus.ec/b/284737/read#r10 ; также http://prozaik.in/aleksandr-fersman-puteshestviya-za-kamnem.html?page=1

МИР КАМНЯ В ЛИЦАХ

Вячеслав Юрьевич Волгин (р. 1929), минералог, сотрудник ИМГРЭ, исследователь минералогии и геохимии сурьмяно-ртутных месторождений

-- Волгин В.Ю.═и др. Распределение минеральных ассоциаций в пределах Чаувайского рудного поля. - Минералого-геохимические особенности ртутных и сурьмяных месторождений. - М., 1985, 8-12

1. Вячеслав Юрьевич Волгин. Фото: ИМГРЭ. 2. В.И.Степанов на обнажении с базалюминитом. Новоподольский карьер, Подольск, к Ю от Москвы.[Июнь 1975 г.]. Фото: А.Евсеев. 3. В.Я. Герасименко (слева) и А.В. Сурков. Геолог. музей им. В.В. Ершова. 2000.01.10. Видео: А.Евсеев.

В.Я. Герасименко. Воспоминания о В.И. Степанове \\ Среди минералов. М., 1998, с. 57-59

═════════════"Виктор Иванович обычно был в подвале на Садовнической набережной, рядом с ИМГРЭ (в кабинете на 4-ом этаже института - реже). Он перетаскивал лотки - спасал после очередного затопления. Или, надев очки-бинокуляр, готовил коллекцию для школьников, ⌠освежая■ старые образцы зубильцем. Но чаще он препарировал образец своей коллекции. Это было его любимым делом. При этом он расспрашивал: с каким вопросом явился, что принес. Также демонстрировал способ препарирования. Иногда, выхватив из рук принесенный камень, сразу брался за него...". (продолжение)

Здание ИМГРЭ на Садовнической набережной в Москве, где работал В.И. Степанов. Фото: А.Евсеев

Исследователи самоцветов Сибири - http://lavrovit.ru/?page_id=271

Фотографы минералов

Заблоцкий Е.М. Биографический словарь деятелей горной службы дореволюционной России --сетевая версия - http://russmin.narod.ru/dictionary.htm

lБиографии минералогов и коллекционеров -см. The Mineralogical Record Biographical Archive - http://www.minrec.org/labelarchive.asp

Биографии ученых Геовики

Коллекционеры и дилеры рассказывают ... \\ Хорди Фабре \ Jordi Fabre - www.youtube.com \\ Роб Лавински \ Rob Lavinsky (The Arkenstone)--Тусон-2014 - https://www.youtube.com/

ИЮНЬ \ в тот день

2016.06. 24

За несколько часов до открытия Московского кинофестиваля. 2016.06.24. Фото: А. Евсеев.

В ТОТ ГОД...

XVIII век \\ ═╚Горняк из Фалуна╩ - публикация И.П. Хебеля═ в 1811 г. -═ о событии, произошедшем более 50 лет назад (тело было обнаружено в 1809 г.)═ \\═ Бакс Карл. Богатства земных недр. М.: Прогресс , 1986. √ 384 с. ( см. стр. с. 77) \ Иоганн Петер Гебель (Хебель) (1760≈1826) ≈ немецкий поэт и прозаик, важную роль в его творчестве играла немецкая народная культура

1926.04.20 - родился Хеннинг Соренсен, датский минералог и петрограф, профессор геологии (Университет Копенгагена). В его честь назван минерал соренсенит (www. mindat.org), открытый в массиве Илимауссак (Гренландия) .

1948 - 1955 \\ История поисков и открытия коренных месторождений алмазов в Якутии :1948-1955 гг.тема диссертации и автореферата по , кандидат исторических наук Юзмухаметов, Ришат Нургалиевич \\ Источник и подробнее:
http://www.dissercat.com/content/istoriya-poiskov-i-otkrytiya-korennykh-mestorozhdenii-almazov-v-yakutii-1948-1955-gg#ixzz4CzP360bu

1947 -2007 - Легенды и мифы Школьного факультета. М., 2007. - http://www.geoland.ru/sites/default/files/legendy_i_mify_shkolnogo_faklteta.pdf

Вступительное слово (П.А.Игнатов)......................................................... 3
От составителей (И.Д.Васильев)............................................................... 5
От редакции (О.Шереметьев)................................................................... 7
Вехи истории Школьного Факультета МГРИ√РГГРУ........................... 9
Научные руководители и деканы Школьного Факультета........................ 11
Учащиеся и выпускники ШФ МГРИ√РГГРУ, ставшие сотрудниками и преподавателями, кандидатами и докторами наук (1947√2007)......... 16
╚Школьный факультет╩ (из книги ╚История МГРИ╩).......................... 21
Статьи из газет о Школьном Факультете................................................ 27
География поездок Школьного Факультета (М.Данукалова).................. 47
╚Древо╩ ШФ........................................................................................... 55
Статьи, воспоминания, байки П.А.Игнатов ╚Основы оптимального функционирования ДЮГД╩..... 79
С.Л.Афанасьев ╚Первые шаги╩........................................................... 87 А.А.Ануфриев...................................................................................... 99
А.Ф.Карпузов ╚Мой Школьный Факультет╩.................................... 103
Г.Д.Павлович ╚Кружковод ШФ ≈ не всегда бывший ШФ-шник╩.. 115
Юрий Привезенцев ╚Школьный факультет в 1973√1977 г.г.╩........... 119
Константин Ходорович ╚К чему замок?╩............................................ 127
Алёна Соколова................................................................................... 130
Борис Шкурский................................................................................. 131
Олег Шереметьев................................................................................ 138
Галина Созанчук (Зверева) ╚Школьный факультет╩.......................... 155
Анна Уштей (Сухих)........................................................................... 164
Николай Серебряков ╚Зимний лагерь╩............................................... 165
Владимир Ериклинцев......................................................................... 176
Алексей Георгиевский.......................................................................... 181
Елена Амаханова ╚Орден Великого Тормоза╩.................................... 186
Вс.В.Аристов, В.В.Аристов, Е.Данильченко ╚Школьный факультет 1990√1997 г.г.╩......................................... 188
С.И.Голиков ╚Вклад ШФ МГРИ в развитие ДЮГД России╩......... 197
Айсылу Хисамутдинова ╚Обрывки воспоминаний┘╩....................... 203
Иван Васильев ╚ШФ-112Б ≈ победит полюбэ!╩............................. 209
Детский геологический юмор (Вс.Аристов)........................................... 233
Песни Школьного Факультета.............................................................. 237

Составители: Иван Васильев, Александр Шпекторов. Редактор: Олег Шереметьев. Технический редактор: Айсылу Хисамутдинова. Компьютерная вёрстка: Олег Шереметьев. ╘ Школьный Факультет МГРИ√РГГРУ, 2007

1949

Значок, посвященный 40-летию находки первого алмаза на р. Вилюй. Фото: Н.А. Колтовой

1967

Студенты-геологи МГУ по дороге на практику в Крым. Слева направо: М. Назаров,...., Е. Соловьев, А. Евсеев, А. Екимов, ...Июнь 1967 г.

1969

М. Назаров с лотком для шлихования. Бассейн р.Мал.Комуй, хр. Джугджур, Хабаровский край, 1969. Фото: А. Евсеев

С вертолетом - новости. За чтением "Спутника Московского кинофестиваля". Мал. Комуй р., Джугджур, Хабаровский край, Россия. 1969. 07. Фото: ╘ А. Евсеев \\ см. http://geo.web.ru/druza/33_fo_198.htm

1993-1994 гг. \\ Robinson, G. W., King, V. T., Scovil, J., & Cureton, F. (1995). World review of mineral discoveries: 1993-1994. Mineralogical Record, 26(5), 475.

1996 - Фекличев В.Г.. МИНЕРАЛОГИЯ═НА═ПОРОГЕ═XXI═ВЕКА (годичная сессия Московского отделения Всероссийского
Минералогического Общества 17-19 декабря 1996 г.)

1. С. Миронов на открытии выставки "Коллекция минералов Сергея Миронова". Геолог. музей им. В.И. Вернадского. 2016.10.25. 2. Пирит. Испания. Из коллекции С. Миронова. Источник: : https://www.youtube.com/watch?v=bbNU0F0Wd7Y

Килманит-(Ce) \ Kihlmanite-(Ce) --новый минерал из Хибин(2014) \\ Yakovenchuk, V. N., Krivovichev, S. V., Ivanyuk, G. Y., Pakhomovsky, Ya. A., Selivanova, E. A.,Zhitova, E. A., Kalashnikova,G. O., Zolotarev, A. A., Mikhailova, J. A., Kadyrova, G. I. (2014): Kihlmanite-(Ce), Ce2TiO2[SiO4](HCO3)2(H2O), a new rare-earth mineral from the pegmatites of the Khibiny alkaline massif, Kola Peninsula, Russia. Mineralogical Magazine, 78, 483-496.

2016

НазаровМихаил Александрович═(1949.01.13 - 2016.06.08), минералог, выпускник каф. минералогии Геолфака МГУ, руководитель лаборатории метеоритики и Музея внеземного вещества (ГЕОХИ РАН) \\═http://www.geokhi.ru/~meteorit/news.html#news028═\\http://www.geokhi.ru/exhibition/museum1.html.

Михаил Александрович Назаров (1949-2016)

--Назаров М.А. Метеоритная коллекция Российской академии наук. - Природа, 1999, ╧12, с.49-58.

--Тарасов Л.С., Назаров М.А., Шевалеевский И.Д., Кудряшова А.Ф., Гавердовская А.С., Корина М.И. (1980) Петрография пород и особенности состава минералов реголита из Моря Кризисов. В кн.: Лунный грунт из Моря Кризисов. М.: Наука. с. 78-95.

 

МИНЕРАЛОГИЧЕСКИЙ УНИВЕРСИТЕТ

 

КЛУБ ДРУЗЕЙ МИНЕРАЛОГИИ

⌠В ЗЕРКАЛЕ КАМНЯ■

Михаил Булгаков

Ходит какой-то между столами. В сером френче и чудовищном галифе. Вонзается в группы, и те разваливаются. Как миноноска, режет воду. На кого ни глянет - все бледнеют. Глаза под стол лезут. Только барышням - ничего! Барышням - страх не свойствен.

Подошел. Просверлил глазами, вынул душу, положил на ладонь и внимательно осмотрел. Но душа - кристалл!

Вложил обратно. Улыбнулся благосклонно.

- Завлито?

- Зав. Зав.

Пошел дальше. Парень будто ничего. Но не поймешь, что он у нас делает. На Тео не похож. На Лито тем более.

Записки на манжетах \\ http://dugward.ru/library/bulgakov

Габриэль Гарсиа Маркес

Мальчики так приставали, что Хосе Аркадио Буэндиа заплатил тридцать реалов и вошел с ними в шатер, где бритоголовый великан с обросшим шерстью телом, медным кольцом в ноздре и тяжелой железной цепью на щиколотке сторожил сундук, похожий на те, в которых пираты хранят свои сокровища. Когда великан поднял крышку, из сундука потянуло пронизывающим холодом. Внутри не было ничего, кроме огромной прозрачной глыбы, набитой несметным числом белых иголок; упав на них, вечерний свет разлетелся на тысячи разноцветных звезд.
Хосе Аркадио Буэндиа был озадачен, но, зная, что дети ждут от него немедленного объяснения, он решился и пробормотал:
≈ Это самый большой в мире бриллиант.
≈ Нет, ≈ поправил его великан. ≈ Это лед.
Ничего не понявший Хосе Аркадио Буэндиа потянулся было к глыбе, однако великан отстранил его руку. ╚Еще пять реалов, и тогда трогайте╩, ≈ сказал он. Хосе Аркадио Буэндиа заплатил пять реалов, положил ладонь на лед и держал ее так несколько минут; и сердце его, соприкоснувшееся с тайной, сжалось от страха и восторга. Не зная, как объяснить это необыкновенное чувство детям, он заплатил еще десять реалов, чтобы они сами его испытали. Маленький Хосе Аркадио отказался трогать. Аурелиано, напротив, смело нагнулся и положил руку на лед, но сразу же отдернул ее. ╚Это кипит╩, ≈ испуганно воскликнул он. Отец даже не обратил на него внимания. Опьяненный очевидностью чуда, он забыл в ту минуту и о крушении своих бредовых затей, и о брошенном на съедение кальмарам трупе Мелькиадеса. Заплатив еще пять реалов, Хосе Аркадио Буэндиа торжественно возложил руку на глыбу, как свидетель, дающий показания в суде, кладет ее на Библию, и воскликнул:
≈ Это величайшее изобретение нашего времени!

ххх

Аурелиано впервые в жизни осознал, что его способность к языкам, его энциклопедические знания, его феноменальный дар вспоминать мельчайшие детали неизвестных ему мест и событий так же бесполезны, как шкатулка с драгоценными камнями его жены, которые стоили, наверное, не меньше, чем все добро, которое было тогда у всех последних обитателей Макондо, вместе взятых

╚Сто лет одиночества╩

КИНО_В зеркале камня

Микельанджело Антониони

1. Кадр из фильма "Забриски-Пойнт" (реж. М. Антониони, сцен. Т. Гуэрра и др.). 2. Микельанджело Антониони на Московском кинофестивале. Июль 1975 г. Фото: А.Евсеев. \ На том же месте в 2016 г. - фото

"Забриски Пойнт"(США - Италия, 1969, реж. М. Антониони).

Безжизненная красота хребтов, изрезанных каньонам и оврагами. Марк выходит из тоннеля (штольни?) на склоне холма═
- Смотри, что я нашел - горная соль!═
- Да?
- Да.
Дария берет полупрозрачный кристалл, лижет его, смотрит сквозь кристалл на Марка. Их лица сближаются. Первый поцелуй.
- А это что - гипс?
- Во всяком случае, не соль столовая...

"Забриски Пойнт"(США - Италия, 1969). Запись по фильму \\ Забриски Пойнт находится в Калифорнии на краю Долины Смерти; " это своего рода геологический заповедник... " --═http://www.kino.orc.ru/js/elita/elita_zabriskie.shtml

Тонино Гуэрра - о нем -- http://vm.ru/news/2014/03/16/

Марлен Дитрих

Камешки. Ничего не приносит большей радости, чем собирание и игра с ними.

Кварц. Сердечко из розового кварца на цепочке √ лучший подарок для девочки.

Азбука моей жизни

Константин Ершов

Константин Ершов (1935-1984), кинорежиссер, сценарист и актер. Поставил фильмы "Вий", психологическую драму "Грачи" и другие, в том числе "Человек, которому везло" (в основе фильма лежат реальные события, связанные с открытием месторождений бокситов на Урале, а прототипом главного героя, которого сыграл Г. Бурков, стал геолог Н.А. Каржавин). Снял также фильм "Степанова памятка" (по П.П. Бажову)

Акира Куросава

Фильм≈это кристалл с множеством граней.

Роберт Флаэрти

Роберт Флаэрти \ Robert Flaherty (1884.02.16 - 1951.07.23) - отец документального кино, американский режиссер, пришел в кино через геологию. Он родился в семье горного инженера, учился в Мичиганском горном колледже, участвовал в экспедициях по поиску железных руд на берегах Гудзонова залива на севере Канады. В одну из них в 1913 г. он "просто так" взял кинокамеру. Вспоминая об этом событии, Флаэрти писал : "В ранней юности я ездил в изыскательские экспедиции с отцом и его сослуживцами. Сэр Уильям обронил между прочим : почему бы вам не взять одну из этих штук, по-новому оборудованных, их называют кинокамерами, кажется?" Снятые Флаэрти эпизоды из жизни эскимосов составили знаменитый фильм "Нанук с Севера"["Nanook of the North"] (1921)". \ А. Евсеев "ФИЛЬМЫ, КАМЕШКИ И РЕЖИССЕР С УРАЛА"(1996) - http://geo.web.ru/druza/a-Ev_Film-kam.htm

Роберт Флаэрти: " Создавать кино - всё равно что искать золотой самородок"

"Большая руда", СССР, 1964, реж. В. Ордынский.

1. Гематит и магнетит в железистом кварците. Михайловский р-к, КМА, Россия. Образец: Геол. музей им. В.В. Ершова, МГГУ. 2. Начало работ на Михайловском руднике (КМА). Евгений Урбанский в роли шофера в к\ф "Большая руда" (реж. В. Ордынский). Песня "Ты не печалься..." - фрагмент из фильма - смотреть

МУЗЫКА

И. Двуреченский

- В зоне метеоритов \\ слушать на https://www.realmusic.ru/dvurechenskij/music/?page=2

\\ И. Анненский \\\ И. Бродский \\ И.А. Бунин \\ Ю.И. Визбор \\ М.А. Врубель \\ В.С. Высоцкий \\ П.А. Вяземский \\ И.-В. Гёте \\ И.А. Гончаров \\ \\ А.C. Пушкин \\ И. Северянин \\ Л. Толстой \\ А.П. Чехов \\ Агат \\ Алмаз \\ Апатит \\ Бирюза \\ Жемчуг \\ Опал \\ Топаз \\

СТРАНЫ от А до Я

находки минералов по листам карты мира: 1234567 891011121314151617181920212223242526272829303132 - 33

 

НЕ ТОЛЬКО МИНЕРАЛЫ: А - Б - В - Г - Д - Е - Ж - З - И - К - Л - М - Н - О - П - Р - С - Т - У - Ф - Х - Ц - Ч - ШЩ - Э - Ю - Я

местонахождения минералов - | - mineral localities : А Б В ГДЕ Ж З И Й К Л М Н О ПР С Т У Ф Х Ц ЧШ Щ Э Ю Я || A B C D E F G H I J K L M N O P R S T U V W X Y Z
Сев. Америка (С)

Гренландия

Атлантика - Скандинавия - Кольский п-в

Урал
Ср. Сибирь
Якутия
СВ России

Сев. Америка (З - Сев. Америка (Кордильеры)

Сев. Америка (В)

Британ. о-ва, Пиренейский п-в - Зап. Европа - Вост. Европа

Казахстан, Ср. Азия

Юг Сибири
Забайкалье, Вост . Сибирь
Камчатка - Дальний Восток (Россия, Япония
Мексика
Кавказ, ЮЗ Азия
Афганистан, Пакистан
Индия
Монголия. Китай
ЮВ Азия - Тихий океан
Ю. Америка (СЗ) - Кордильеры
Бразилия

Африка - Сев. и Зап.Экв. и ЮжнВост.

Антарктида
Австралия

Тихий океан - Весь мир

янв
фев
март
апр
май
июнь
июль
авг
сен
окт
нояб
дек
2004
2005
2006
2007
2008
2009
2010
2011
2012
2013
╧104 ╧112
2014 ╧114
2015
╧126 ╧131
2016
           
обновление: 2016. 07. 02

╘ Александр Евсеев, 2003 - 2016. ╘ Фото: принадлежит авторам, 2016