обновление: 2022. 11. 29

регионы мира: 1234567 891011121314151617181920212223242526272829303132 - 33 || Россия \ Европа \ Азия \ Африка \ Австралия \ С. Америка \ Ю Америка \ Антарктида \ ---------------- ФМ

ВСЕ КАМНИ МИРА220- В ДВЕ СТРОКИ

или НОВЫЙ МИР КАМНЯ \ НОЯБРЬ - 2022

Заметки на geo.web.ru/druza

От А до Я

№104 №112
2014 №114
№126 №131
№146
№163 №166
2020 №193

Кристаллы пяти континентов - ФМ

Заметки geo.web.ru/druza : А - Аг - Аи - Ам - Ар - Ат - Б - Бе - Бо - Бр - В - Ве - Вл - Г -Д - Де - До - Е - Ж - З - И - Им-Й - К - Кв - Км - Кр -- Л - Ли - Ло - М - Мал - Мг - Мо - Му -- Н - Не - Ни - Но - О - П - Пе - Пи - По - Р - Ри - С - Се - Си - Ск - Ст - Т - Ти - Тр -У - Ум - Ур - Ф - Фл - Фо - Х - Хи - Ц - Ч - Ш -- Шо- Щ - Э - Ю - Я - za - zaa - qq

МИНЕРАЛЫ и не только на druza: А - Б - В - Г - Д - Е - Ж - З - И - К - Л - М - Н - О - П - Р - С - Т - У - Ф - Х - Ц - Ч - ШЩ - Э - Ю - Я \\ Алфавитный список минералов (на geo.web.ru/druza)

местонахождения А Б В ГДЕ Ж З И Й К Л М Н О ПР С Т У Ф Х Ц ЧШ Щ Э Ю Я || A B C D E F G H I J K L M N O P R S T U V W X Y Z \\

см.на www.mindat.org \ A-B-C-D-E-F-G-H-I-J-K-L-M-N-O-P-Q-R-S-T-U-V-W-X-Y-Z

Минералы от A до Z - список IMA (Международной минералогической ассоциации)- http://pubsites.uws.edu.au/ima-cnmnc/

Комиссия по новым минералам, номенклатуре и классификации - http://pubsites.uws.edu.au/ima-cnmnc/ \\ The Commission on New Minerals, Nomenclature and Classification (CNMNC) of the International Mineralogical Association (IMA) was formed in July 2006 by a merger between the Commission on New Minerals and Mineral Names (CNMMN) and the Commission on Classification of Minerals, at the request of both commissions

Алфавитный список_ минералы: от А до Я (на русском языке) - более 4000 минералов ( 4976 страниц категории "Минералы") на http://wiki.web.ru/wiki/ \\ http://webmineral.com/Alphabetical_Listing.shtml

Все минералы мира (от A до Z) \ All Minerals of the World / Tous les mineraux de la terre http://euromin.w3sites.net/mineraux/accueil.html

Алфавитный список_ минералы от A до Z (на английском языке) и фото минералов - http://www.mineralatlas.com/ \\ фото минералов - http://www.cs.cmu.edu/~adg/adg-home.html (на сайте Alan Guisewite ) Список минералов - http://en.wikipedia.org/wiki/List_of_minerals

А \\ Авгит \\

Агат \\

Азурит \\ Аквамарин \\ Аксинит \\ Алмаз \\ Альбит

Альманах . Среди минералов М., 2001. – 196 стр. Оглавление

Альмандин \\ Амазонит \\

Аметист \\

Амфиболы \\ Анальцим \\

Анатаз \

Андрадит

1. Андрадит (сросток кристаллов...), с пиритом и присыпками эпидота. Соколовское м-ние, Казахстан. Образец: ФМ ( №88157). Фото: ©.А. Евсеев. 2. Друза кристаллов анлрадита с эпидотом. Дашкесан, Азербайджан. Образец: Центральный Сибирский геологический музей (Еганов Э.). Новосибирск, Россия. 2022.08.02. Фото: Д. Тонкачеев

Анортит \ Anorthite --https://www.mindat.org/min-246.html \ Антимонит \\

Апатит-(CaF) \ Apatite-(CaF) - наиболее обычный (распространенный) минерал в группе апатита.

Апофиллит \\

Арагонит \ Aragonite ( разн. "железные цветы" \ Var: Flos Ferri \\

Арсенопирит

Арфведсонит - удлиненные кристаллы. Кондёр, массив, Хабарвский край, Россия. Образец: Центральный Сибирский геологический музей. Фото: Д. Тонкачеев. 2022.08.02.

Астрофиллит

- Астрофиллит. Минералогические находки на территории быв. СССР (13 местонахождений). Схем. карта. Составил: А. Евсеев.

Ауриигмент

Аурихальцит

 

Афганит \ Afghanite (Na,K)22Ca10(Si24Al24O96)(SO4)6Cl6

 

Б \\ Бабингтонит

Базы данных: http://www.mindat.org/ \\ http://webmineral.com \\

Барит \\

Берилл

Гелиодор, разновидность берилла со скульптурами роста и растворения на гранях кристалла. Волынь, Украина. Образец: Центральный Сибирский геологический музей (Кляхин В.А., 1976). Фото: Д. Тонкачеев. 2022.08.02. \\ НМК-220

Бериллий_минералы \\ Библиография (популярные издания о камнях)- http://basik.ru/forum/index.php?showtopic=77

Библиотеки --РОССИЙСКАЯ ГОСУДАРСТВЕННАЯ БИБЛИОТЕКА--http://search.rsl.ru/ru

Бирюза Бисмутотанталит \ Bismutotantalite Bi(Ta,Nb)O4

Бор_минералогия и геохимия \ Брошантит \\

Брукит \\

Брусит

Бруситит. Образец: Центральный Сибирский геологический музей. Фото: Д. Тонкачеев. 2022.08.02. \\ НМК-220

Буланжерит \\ Бурнонит \ Bournonite PbCuSbS3

Вад - смесь порошковатых, рыхлых оксидов и гадроксидов марганца (КМС)

Вавеллит

Ванадинит \ Vanadinite Pb5(VO4)3Cl \ более 3200 фото - www.mindat.org/gallery, из них более 2000 фото ванадинита из рудного района Мибладен - Mibladen mining district, Midelt Province, Draa-Tafilalet Region, Morocco ; 32° 46' 0'' North , 4° 37' 59'' West

Варисцит

Веб-сайт - http://webmineral.ru/

Веб-сайт

-- http://petrographica.ru

Везувиан \\

Везувиан \ везувиановый жад - плотная порода. Мунилканское м-ние, Момский р-н, Вост. Якутия, Россия. Образец: Центральный Сибирский геологический музей (Востокварцсамоцветы, 1984). Фото: Д. Тонкачеев. 2022.08.02.

Вермикулит \\

Вивианит

Викимапия \ Wikimapia (карты мира и России)

Виллиомит \\ Включения в минералах и драг. камнях

Вольфрамит. Ферберит. Гюбнерит.

Вторая находка минерала в мире

ВУЛКАНЫ \ минералогические находки

Вульфенит

Выставки минералов и поделочных камней

--ЗАНИМАТЕЛЬНАЯ МИНЕРАЛОГИЯ” В КАМНЕ ...Подробнее (pdf)

Г

Галенит \\

Галенит, сидерит. 2-ой Советский р-к, Дальнегорск, Приморье, Россия. Образец: Музейно-выставочный центр г. Дальнегорск (Приморье, Россия). Фото: © Д. Тонкачеев. 2022.08

 

Галит \

Гейландит

Гематит \

Геммы

- Неверов О.Я. Геммы античного мира

Генезис минералов

--Попов В.А. Практическая генетическая минералогия. - Екатеринбург: УрО РАН, 2011.- 167 с.

Геовикипедия \ GeoWiki Всё о геологии - http://wiki.web.ru/

География в названиях минералов

Гётит

Гигантские и крупные кристаллы (индивиды) \\ См.: А.Е. Ферсман. Величина природных кристаллов // Природа, 1925, № 10/12, стлб. 103; его же. Кристаллы-гиганты и монолиты-гиганты // Природа, 1926, № 3/4, стлб. 86—88; его же. Пегматиты. Т. I. Гранитные пегматиты. M.—Д., 1940.

Гидроксилапатит \ Hydroxylapatite \ https://www.mindat.org/min-1992.html

Гипс

Горная энциклопедия - http://www.mining-enc.ru/ \\ http://dic.academic.ru/contents.nsf/enc_geolog/

Горный хрусталь

Графит

Гроссуляр

Гроссуляр (гессонит). Пров. Кордова, Аргентина. Образец: ФМ (№49793, ГИГХС, поступл. 1950 г.). Фото: © А.А. Евсеев.

Д

Данбурит \\

Данбурит. Уникальная друза. Вес 200 кг. Карьер Бор, Дальнегорск, Приморье, Россия. Образец: Центральный Сибирский геологический музей. Фото: Д. Тонкачеев. 2022.08.02.

 

Датолит

Двойники \\ http://folk.ntnu.no/krill/mineralogee/8.htm

Дельхайелит \ Delhayelite (Na,K)10Ca5Al6Si32O80(Cl2,F2,SO4)3 · 18H2O

Демантоид \ Дендриты

Детский мир камня

--Геологическая школа МГУ -- О полевых практиках и экспедициях

--Школьный факультет РГГРУ - МГРИ \\ 60-летие - http://docplayer.ru/189496-60-let-shkolnomu-fakultetu-mgri-rggru-1947-2007-legendy-i-mify-shkolnogo-fakulteta.html \\

--Клуб юных геологов им. академика В.А. Обручева (Санкт-Петербург)

--Ферсман А. Е. Путешествия за камнем. М. 1960 (веб-публикация) :

--Ферсман А.Е. Занимательная минералогия \\ читать

Диаспор \   \  Diaspore  \  234 - фото--mindat.org (2022.03) \\ КУ-I. 63(аз)!!; 112(е)*!!; 122(е); 149(аз)!!; 152(е); 201(е)!!; 240(аз); КУ-II. 96(аз)!!; 145(аф)!!--xl 7, 4 см; 145(аф)!!--xl 7, 4 см; 160(аз)—Турция; 171(аз)!!!--Мугла; 226(аз)!!!--Сельчук

Диопсид \\ Диоптаз \ Dioptase CuSiO3 · H2O \

Доломит \\

Дравит

Драгоценные камни (д.к.)

--Горная энциклопедия - о д.к.

--Пыляев М. И. «Драгоценные камни, их свойства, местонахождения и употребление» \\ http://www.vadim-blin.narod.ru/book/titl.htm \\ указатель (быстрый поиск по ключевым словам) - http://www.vadim-blin.narod.ru/book/glossary.html

Драгоценные камни (самоцветы)_география находок

--Генетическая минералогия драгоценных камней (лекции Э.М. Спиридонова) - http://spiridonov.mineralog.com/

Дундазит \ Dundasite PbAl2(CO3)2(OH)4 · H2O

- Австралия \ Аделаида р-к, Дундас ( = Дундаз = Дендас), Тасмания \ Adelaide Mine (Adelaide Pty Mine; Adelaide Proprietary Mine), Dundas mineral field, Zeehan District, West Coast municipality, Tasmania, Australia - первоначальное местонахождение \ Type Locality

Дымчатый кварц

Е

Единственное местонахождение минерала \\ Urban J. One-locality minerals of at least a half a century. // Rocks and Minerals. - 1978, 53, 10-13. \ Урбан Дж. Минералы единственного местонахождения на протяжении более полувека

Еремеевит - http://www.mindat.org/min-2090.html; фотографии: 52 фото (2008.09) \ 190 фото на 2018.04 - http://www.mindat.org/gallery.php?min=2090

Ж \\ Жадеит \\ Живопись в камне

Журналы для минералогов и коллекционеров \\ The Mineralogical Record, \\ Rocks & Minerals \\ Le Regne Mineral \\ Mineraux et Fossiles \\ Lapis \\ Mineralien Welt \\ Rivista Mineralogica Italiana \\ Revista de Minerales \\ UK Journal of Mines and Minerals

З

Закономерные срастания

Занимательная минералогия. По страницам знаменитой книги А. Е. Ферсмана Занимательная минералогия. Источник: https://www.e-reading.club

Золото

И -

Изумруд \\ Ильваит \\ Ильменит

Индерит

Индивиды и агрегаты

--Годовиков А.А., Степанов В.И. Формы нахождения минералов. М. 2003.

--Макагонов Е.П. Симметрия сростков минеральных индивидов. Наука 1991

Интернет - минералогия \\ http://geo.web.ru/druza \\ https://webmineral.ru \\ https://www.mindat.org

Искусственные кристаллы \ минералы

 

Исландский шпат

История минералогии ( находки, открытия и др.)

- Харькив А. Д. , Зинчук Н. Н. , Зуев В. М. История алмаза. - М. : Недра, 1997. - 601 с.

- Годовиков А. А. Краткий очерк по истории минералогии. М.,1998. - 162 с.

История открытий

К -

Календари с минералами

Кавансит

Кальцит

Кальцитовый "гриб". Дальнегорск, Приморье, Россия. Фото: © Д. Тонкачеев. 2022.08 \\ "Гриб" найден в 1948 г. слесарем С. Моисеенко на 1-ом Советском р-ке. Образец: Музейно-выставочный центр г. Дальнегорск (Приморье, Россия).

Двойник кальцита по ромбоэдрическому закону (приполированный срез). Образец: Центральный Сибирский геологический музей. Фото: Д. Тонкачеев. 2022.08.02. \\ НМК-220

 

Камень в городе

--Книжная полка минералога \ камни на книжной полке

Камералка минералога \\

Карбонат

Карта мира - http://maps-of-world.ru/inter.htm \\ http://geography_atlas.academic.ru/

Картирование, минералогическое

Картотека местонахождений минералов, начатая А. Евсеевым в 1967 г., насчитывает сегодня более 100 тыс. названий. Она строится по региональному принципу, внутри крупного региона местонахождения расположены по алфавиту. Для местонахождений приведены ссылки на литературу, авторов, образцы в собраниях музеев. Материалы картотеки используются в публикациях автора, на сайте http://geo.web.ru/druza/ и др.

Е - Ж - З - названия (минералы, местонахождения, авторы). Список на 2017.07

Карты \\ http://www.marshruty.ru/ \\ http://wikimapia.org/country/ \\ http://www.openstreetmap.org/ \\ http://ru.wikipedia.org/wiki/OpenStreetMap-- Карты мира, стран и городов - http://planetolog.ru/ \\ http://mapper.infomine.com/ \\ http://www.veslo.ru/maps.html \\ http://www.maphill.com

--http://wikimapia.org/

--карта мира и минералы (фото) - http://fotki.yandex.ru/users/ilm/map/view/recent

--реки (бассейны) -- http://www.riversnetwork.org/rbo/

Касситерит

--Разновидность касситерита - "Деревянистое олово"

Каталоги минералогических коллекций

Кварц \\ публикации - http://www.quartzpage.de/info_lit.html -- Экспресс-опрос -2011 (кварц) (на ответ давалось 2-3 мин. )

--Кварц по странам мира - http://www.mindat.org/mesg-95-139699.htm

Кианит

- Огородников В. Н., Коротеев В. А., Войтеховский Ю. Л. и др. Кианитовые руды России. Екатеринбург: УрО РАН, 2012. 334 с. \\ Кианит

Киноварь \ Cinnabar \ https://www.mindat.org/min-1052.html - фото: весь мир - 1445 ; Китай - 370 (пров. Гуйчжоу - 244, из них Тонгрен - 129) \\ Испания - 233 (из них Альмаден - 158) \\ Образцы киновари на витринах Мин. музея им. А.Е. Ферсмана РАН - https://fmm.ru/Киноварь

Книги для минералога

Книжная полка минералога и коллекционера

--http://www.crystalclassicsminerals.com/books.php

Коллекционирование минералов

Степанов В.И. Шкала качества образцов (разработана им в 1970-ые гг.)

-- http://www.strahlen.org/

Колумбит \\ Группа колумбита - танталита \\ Справочник "Минералы" \\ М-2-3, с.303- 322

Конкреции \\

Кораллы \\

Кордиерит \ Cordierite (Mg,Fe)2Al3(AlSi5O18) - более 300 фото

Корнерупин

Корунд \\ сайт, посвященный корунду - http://www.corunduminium.com/index1.html

Кремень \

Кридит

Кристаллы

Кристаллы и сростки рекордных размеров и др.

Крокоит \ Crocoite PbCr6+O4

Крупные образцы минералов (рекордные размеры)

Куприт

Л

Лабрадор \\ Лазулит \ Lazulite MgAl2(PO4)2(OH)

Лазурит \\

Фото лазурита на https://www.mindat.org/min-2357.html (289 фото на 2022.05.26)

33_22 - Сев. Америка (С) 33_23 -Гренландия 33_1-3 -Арктика; Атлантика, Сев. Европа 7 - 11 -Урал; Азия
33_26-25 - Сев. Америка (З) - 4 фото
33_24_Сев. Америка (В) \ Нью-Йорк шт. -6 \\ США-15
4-6 - Европа - Somma-Vesuvius Complex -7
12-17 - Россия- 27; Афганистан!!! - 226 фото ; Таджикистан-1 ; Мьянма -5
33_27 - Мексика
33_28 - Центр. Америка
33_18 - Африка
33_15-16 - Зап. Азия \ Индия
33_29 - Анды \\ Чили--10
33_30 - Бразилия - 30 \\
33_19 - 20
33_21 -Австралия ; Тихий океан; Антарктида

Леграндит \ Legrandite \ Zn2(AsO4)(OH) · H2O \\ Лёд \\ http://www.mindat.org/min-2001.html \\ фотогалерея

Лепидолит

Лироконит

Литература о минералах и драгоценных камнях \\ Из публикаций о минералах зарубежных стран \\ Из публикаций о минералах России, а также СССР

Наша библиотека - Геологический музей им. В.В.Ершова - http://ershov-geomuz.narod.ru/libr.htm

Литература по геологии в бибиотеке ДВГИ ДВО РАН. \\ http://wiki.fegi.ru/index.php/

Лопарит \\ Лоренценит \\ Любители камня

Люминесцирующие (флюоресцирующие минералы) - тема выставки выставки Минер. музея им.А.Е. Ферсмана РАН

М

Магнетит \\ Малахит \\ Марказит

Марки \\ минералы на марках - Minerals on Stamps

Медь и минералы меди

Меридианы

Месторождения минералов

Метеориты

- Иванов А.В., Ярошевский А.А., Иванова М.А. Минералы метеоритов – новый каталог // Геохимия. - 2019. - Т. 64. - №8. - C. 869-932. doi: 10.31857/S0016-7525648869-932 \\ текст - https://journals.eco-vector.com/0016-7525/article/view/15885

- Коллекция метеоритов, тектитов и импактитов Минералогического Музея им.А.Е.Ферсмана

Метро и камень

Микроклин \ Microcline K(AlSi3O8)

Норвегия: Arendal, Agder, Norway и Stavern (Fredriksvarn), Larvik, Vestfold og Telemark, Norway \\ микроклин* - первоначальные местонахождения   \ Co-Type Localities:

Миндат.орг\ www.mindat.org - - крупнейшая база данных о минералах и местонахождениях. Её основатель - Джолиан Ральф \ Jolian Ralf .

Евсеев А.А. Минералогические находки (примеры). IV. Зарубежные страны (без республик быв. СССР). М., 2016. - 256 с.

Минералогический альманах (на сайте )

Минералогический альманах (на русском . яыке) - http://www.minbook.com/mineralogical_almanac_ru.html \

-- Mineralogical Almanac - http://www.minbook.com (на англ. яз.) - на английском языке \ Mineralogical Almanac (Россия \ Russia)

-- В мире минералов. Минералогический Альманах, том 21, выпуск 1, 2016. Подробнее..

-- Минералогический Альманах, том 22, выпуск 2, 2017 - оглавление

Минералогические словари

-- Кривовичев В.Г. Минералогический словарь. СПб.: Издательство СПбГУ. 2008. 556 с.

Минералогия

--Бетехтин А.Г. 'Курс минералогии' - Москва: Государственное издательство геологической литературы, 1951 - с.543 --веб-публикация

--Корбел П. и Новак М. . МИНЕРАЛЫ. Иллюстрированная энциклопедия. М.: "Лабиринт Пресс", 2004. - 296 с.

Минералы_список от А до Я - Википедия

МИНЕРАЛЫ (справочник) ------- http://www.geokniga.org/collections/3607 \\ т.2, вып.2

--Силикаты–справочник  краткий указатель - http://geo.web.ru/druza/m-miner_A-Ya_sil.htm  

--Минералы. Справочник. Том 3. Выпуск 1. Силикаты с одиночными и сдвоенными кремнекислородными тетраэдрами. Содержание

Минералы - спутники на расстоянии \\ Евсеев А.А. Минералы - спутники на расстоянии (2): Отдельные статьи Горного информационно-аналитического бюллетеня. - №12. - М.: Издательство "Горная книга", 2009. - 35 с.

МИР КАМНЯ \ WORLD OF STONES - научно-популярный журнал, посвященный минералогии \ Содержание журнала №№ 1-12 за 1993 – 1997 гг

Мозаика

Морфология минералов

М у з е и

Степанов В. И. МИНЕРАЛЬНЫЕ ВИДЫ, ХРАНЯЩИЕСЯ В КРУПНЕЙШИХ МИНЕРАЛОГИЧЕСКИХ МУЗЕЯХ СССР . В кн. Старейшие минералогические музеи СССР.— М.: Нау­ ка, 1989.— Вып. 25.— 239 с. Очерки по истории геологических знаний. , стр.154-233. \\ читать - http://ginras.ru/library/pdf/1989_history_geology_issue25.pdf

Геологические и природоведческие музеи России (Справочник). - Российское геологическое общество: ООО "Геоинформмарк". - М., 2005. - 264 с.

--http://www.exmu.ru

- Старейшие минералогические музеи СССР. - М.: Наука, 1989. - Вып. 25. - 239 с. Обложка. Очерки по истории геологических знаний.

--В сборнике помещены материалы, освещающие историю создания и развития трех старейших минералогических музеев СССР, основанных в XVIII веке и ныне превратившихся в крупнейшие широко известные во всем мире собрания минералов. Проводимая таблица содержит полный перечень минеральных видов, хранящихся в этих музеях. Публикуемые фотографии наиболее интересных образцов способствуют лучшему восприятию текста. Книга предназначена для минералогов и историков науки, а также для самого широкого круга любителей камня. \\ Источник: https://fmm.ru/Издания

World Directory of Mineral Collections (Second Edition) Pieter C. Zwaan; Ole V. Petersen . Published by Commission on Museums of the International Mineralogical Association,, Copenhagen, 1977

Россия

- Список геологических музеев России - -http://webmineral.ru/museums/

- Естественно-научный музей Ильменского государственного заповедника \\ Адрес: 456317, Челябинская область, г. Миасс, Ильменский заповедник   - http://www.museum.ru/M3104

- Минералогический музей ДВГИ ДВО РАН \\ Владивосток \\ http://www.fegi.ru/muzeum

ПУБЛИКАЦИИ О МУЗЕЕ

- Москва и область

--- МУЗЕЙ "САМОЦВЕТЫ". МИНЕРАЛЫ И ДРАГОЦЕННЫЕ КАМНИ СССР (Москва) - видеорепортаж А. Никифорова (2021.03) https://www.youtube.com/watch?v=K_6IpS68OjI

--Екатеринбург

--Иркутск \\ Государственный Минералогический музей им. А.В. Сидорова - http://mineral.inrtu.ru

--Новосибирск \\ "В Центральном сибирском геологическом музее, который основан в июле 1958 года, есть образцы из 50 стран мира и всех регионов России. В коллекции около тысячи видов минералов видов, а общее количество экспонатов — около 20 тысяч." \\ Источник и подробнее - https://ria.ru/nsk/20131110/975805317.html

Центральный Сибирский геологический музей. Новосибирск, Россия. 2022.08.02. Фото: Д. Тонкачеев \\ НМК-220

-- Санкт-Петербург \\

--Севастополь. Севастопольский музей камня \\ "В настоящее время музей располагает выставочной площадью 100 квадратных метров, в экспозиции представлено более 3000 экземпляров". Подробнее о музее

Австрия \\ Музей ест.истории (Вена)

Болгария. "Национальный музей "Земля и Люди" является минералогическим музеем в центре Софии. Это один из крупнейших минералогических музеев во всем мире. Датой его основания считается 30 декабря 1985 года, а открыт для посещения он был в июне 1987 года. Инициатором создания музея был доктор наук Михаил Малеев. Музей расположен в оригинальном старинном и реконструированном здании, построенном в конце XIX века (1896-1898 год). Общая площадь музея составляет около 4 000 кв. м". Источник: https://www.rutraveller.ru/place/14261

Германия \ Италия

Китай

--Пекин. Геологический музей. Bancroft,P, Zhengzhi,H and Furui,W (1987) The Peking geological museum, China. Mineral.Record 18, 325-332.

Ливан

МИМ музей (минералогический), Бейрут, Ливан \\ Мим Музей - частный [минералогический] музей в Бейруте, Ливан. В музее более 2000 образцов, представляющих 450 различных видов из 70 стран. Он считается сегодня одной из самых значительных частных коллекций минералов в мире. Создатель музея - Салим Эдде \ Salim Edde, ученый, химик, педагог, коллекционер минералов. Музей был открыт 12 октября 2013 года в присутствии почетных гостей, включая президента Ливана. Подробнее: https://en.wikipedia.org/wiki/Mim_Museum

--репортаж Петера Ликберга - https://www.mindat.org/article.php/1807/The+MIM+Museum+opening%2C+Lebanon \\

--видеорепортажи: (7.36) https://www.youtube.com/watch?v=JKDsSHLu7pE \\ часть 1 (21.48)- https://www.youtube.com/watch?v=StatGGnqyY8 \\ часть 2 (24.43) - https://www.youtube.com/watch?v=qc28tOlGuvI

США

Франция

--Париж. Национальный музей естественной истории ( фр. Museum national d'histoire naturelle - один из старейших в мире \\ Подробнее. В него входит Минералогическая галерея ( фр. Galerie de Mineralogie et de Geologie). Особая достопримечательность музея - коллекция гигантских кристаллов кварца из Бразилии \\ Подробнее_Википедия \\ http://www.museum-mineral.fr/home.php# \\

-- Минералогическая галерея. Национальный музей естественной истории_Париж. Франция.

--Париж.  l'Ecole des Mines \ Музей высшей горной школы http://www.musee.mines-paristech.fr/Accueil/ \\ фотогалерея- http://www.musee.mines-paristech.fr/Galerie/Photos/

Мусковит

Названия и привязка местонахождений минералов

Названия минералов

География в названиях минералов

Анапаит. Друза сферокристаллов. 2-ой Черноморский р-к, Керчь (р-н), Крым, Россия. Образец: ФМ (№90786. Сбор музея: Абрамов Д.В., 1986). Фото: © А.А. Евсеев. "Фото дня" на сайте или "За месяц вокруг света". 2020.08.06

Бразилианит. Более 10 см. [Galilea mine, Governador Valedaris], Минас-Жерайс \Minas Gerais, Бразилия. Образец: ФМ [№65178]. Фото: © А. Евсеев. "Фото дня" на сайте или "За месяц вокруг света". 2019.04. 30

 

Натролит

Недра - http://www.rosnedra.com/

Нефрит

Новые карты для минералога -

--Нов. карты 2019.07.01

--Нов. карты 2019.05.12-строки

Новые книги и публикации \\ см. также www.minbook.com/02.12.2016.(авторы со своими новыми книгами)

Новые минералы

Новые поступления в Мин.муз. им. А.Е. Ферсмана РАН

О

Облицовочные камни \\ Обсидиан

Одноимённые местонахождения \\ Одноименные географические названия затрудняют привязку находок минералов \\ Будьте внимательны при работе с картами, атласами и базами данных. Так, в интерактивном атласе мира Encarta-2001 среди 1,8 миллиона географических названий, есть множество одноименных.

Окаменелое дерево \\ Окенит \ Okenite Ca10Si18O46 · 18H2O

- Malad, Ward 38, Mumbai, Mumbai District, Maharashtra, India

Окно (камень у окна)

Оливин \\ Онтогения минералов \ \\ Олигоклаз \\ Опал \\

Ортоклаз

Отенит \ Autunite Ca(UO2)2(PO4)2 · 10-12H2O \\ 888 фото (2020.09)

Открытки с камнем

П

Параллели_минералогические находки = sh.htm

Пегматиты \\ Ферсман А.Е. Пегматиты. М.: Изд-во АН СССР, 1940. Т.1

Пейзажный камень

Первая находка минерала в быв. СССР и России

Первоначальные местонахождения \ type localities

--Евсеев А.А. Географическая привязка первоначальных местонахождений минералов. - Новые данные о минералах. М.: Экост, 2002. Вып. 38, c. 113-124

Переименования (географических названий)

Перидот \ хризолит \\ Песок и минералы россыпей \\

Пирит!!

Пироморфит \\

Пироп \\ http://www.mindat.org/min-3321.html \\ фото (27) - www.mindat.org \\ Пирротин \ Pyrrhotite Fe1-xS \\ 882 фото - www.mindat.org/gallery(2020.08)

 

Пирофиллит [Северная] Каролина, США \\ в www.mindat.org нет фото пирофиллита из Южн. Каролины, а из Северной Каролины - 44 фото, в т.ч. сходного вида \\ Образец: Центральный Сибирский геологический музей (Прокопенко А.). Новосибирск, Россия. 2022.08.02. Фото: Д. Тонкачеев

Плагиоклазы\\ \\ альбит \\ анортит \\ беломорит \\ клевеландит \\ лабрадор

Поделочные камни \\ Полевые шпаты \\ Поллуцит

Породообразующие минералы

Пренит - http://www.mindat.org/min-3277.html \\ фото (1002) - http://www.mindat.org/gallery.php?min=3277 - на 2009.05.27

Псевдоморфозы \\

Псевдоморфоза кальцита, кварца по данбуриту. Дальнегорск, Приморье, Россия.Образец: Музейно-выставочный центр г. Дальнегорск (Приморье, Россия). Фото: © Д. Тонкачеев. 2022.08

- фотогалерея - http://www.mineralatlas.com/specials/pseudo.htm

--The Mineral News, 2004-2007 \\ Указатель публикаций по авторам \ местонахождениям \ минералам

Пьемонтит

1. Пьемонтит. в пироксеновом скарне. Ляджвардаринское м-ние, ЮЗ Памир, Таджикистан (Бакуменко И.Т., 1986). 2. Пьемонтит. Николаевское м-ние, Иркутская обл. , Россия(Татаринов А.В., 1994) . Образцы: Центральный Сибирский геологический музей. Новосибирск, Россия. 2022.08.02. Фото: Д. Тонкачеев

 

Р

Разнообразие минералов Софийский симпозиум

Реальгар \ Realgar As4S4 \\ 936 фото - mindat (2020.09)

Региональная минералогия (заметки)

Р-коллекция \\ В феврале 2008 г. в Минералогическом музее РГГРУ (Москва) были записаны первые образцы в новую тематическую коллекцию "Региональная и всемирная минералогия" (сокращенно - Р-коллекция)

Резной камень \\ Рисунок и живопись в камне \\ http://www.minrec.org/artmuseum.asp

Рисунки минералов

Роговая обманка

 

Роговая обманка. Чехия. Кристаллы до 4-5 см. Образцы: ФМ (№30964. Колл.: Кочубей П.А., поступл. 1913 г.). Фото: © А.А. Евсеев.

Родонит \

Брусницын А.И. Минералогия месторождений поделочных родонитовых пород Среднего Урала // ЗВМО, 1998. № 3. С. 1–11.

Родонит. Сросток крупных кристаллов. Франклин-Фернас\  Franklin Furnace, Sussex Co., Нью-Джерси, США. Фото: © А.А. Евсеев. Образец: ФМ (№49566) \ Расположен на витрине exp78-1 

 

Родохрозит

 

Ртуть

Рутил

С - Се - Ск - Со - Ст

Самородные элементы \\ Сапфир

"Сборные" минералов по странам и регионам (10-15 избранных находок) \\ 1-е -в 2007 г .

Селен \\  http://www.mindat.org/loc-30078.html \\ фото селена - http://www.mindat.org/gallery.php?loc=30078

Селенит (разн. гипса)

Сера

Серандит \\

Серебро \\ silver - mindat --фото (1189), местонахождения (3716) -- на 2009.11.15

"Фото дня" на сайте или "За месяц вокруг света". 2021.06. 03

Серпентин \  Минералы (справочник) - т. 4, в.1, стр. 122 \\ группа каолинита- серпентина \ Kaolinite-Serpentine Group \\ подгруппа серпентина \ Serpentine Subgroup \\ антигорит \ Antigorite --фото \\ Caryopilite --фото

Силикаты от А-Я_краткий указатель к справочнику "Минералы"(том.III-V)

Симметрия в геологии, минералогии и не только

Скипетровидные кристаллы (в том числе обратные скипетры аметиста \ reverse sceptre из Боливии ( Esperanza Mine, near Bombori, Nor Potosi Province, Potosi Department) \\ http://www.mindat.org/ \\ http://www.mindat.org/photo-284819.html

Сколецит

Словари

--Кривовичев В.Г. Минералогический словарь.- СПб.: Изд-во С.-Петерб. ун-та, 2008. - 556 с. --СЛОВАРЬ МИНЕР. ВИДОВ - веб (В.Г. Кривовичев. Словарь минеральных видов. СПб, 2006)

--ГЕОЛОГИЧЕСКИЙ СЛОВАРЬ (включает раздел "МИНЕРАЛОГИЯ")

Смитсонит \\

Смитсонит, кальцит. 2-ой Советский р-к, Дальнегорск, Приморье, Россия. Образец: Музейно-выставочный центр г. Дальнегорск (Приморье, Россия). Фото: © Д. Тонкачеев. 2022.08

 

Сода \\ Содалит \\

Спессартин \

Сперрилит

Список минералов - http://en.wikipedia.org/wiki/List_of_minerals

Сподумен и его разновидности (кунцит, гидденит)

Справочник "Минералы"_краткий указатель к томам IV-V

Cправочник “Минералы”

Минералы. Справочник. Том 1. Самородные элементы, интерметаллические соединения, карбиды, нитриды, фосфиды, арсениды, антимониды, висмутиды, сульфиды, селениды, теллуриды. Издательство Академии наук СССР, Москва, 1960 г., 617 стр. Редакторы: Бонштедт-Куплетская Э.М., Чухров Ф.В. \\ https://www.geokniga.org/books/3449

Минералы: Справочник. Т. II, вып.1. Галогениды. – Издательство Академии наук СССР, Москва, 1963 г., 296 стр.

Минералы: Справочник. Т. II, вып.2. Простые окислы. – Издательство "Наука", Москва, 1965 г., 343 стр.

Минералы: Справочник. Т. II, вып.3. Сложные окислы, титанаты, ниобаты, танталаты, антимонаты, гидроокислы. – Издательство "Наука", Москва, 1967 г., 676 стр.

Минералы: Справочник. Т. III, вып.1. Силикаты с одиночными и сдвоенными кремнекислородными тетраэдрами. – Издательство "Наука", Москва, 1972 г., 884 стр.

Минералы: Справочник. Т. III, вып.2. Силикаты с линейными трехчленныит группами, кольцами и цепочками кремнекислородных тетраэдров. – Издательство "Наука", Москва, 1981 г., 616 стр.

Минералы: Справочник. Т. III, вып.3. Силикаты с лентами кремнекислородных тетраэдров. – Издательство "Наука", Москва, 1981 г., 400 стр.

Минералы: Справочник. Т. IV, вып.1. Силикаты со структурой, переходной от цепочечной к слоистой. Слоистые силикаты (каолиновые минералы, серпентины. пирофиллит, тальк, слюды).– М.: Наука, 1992.– 600 с. (= М-4-1)
Минералы: Справочник. Т. IV, вып.2. Слоистые силикаты (смектиты, хлориты, смешаннослойные). Слоистые силикаты со сложными тетраэдрическими радикалами– М.: Наука, 1992.– 663 с. (= М-4-2)
Минералы: Справочник. Т. IV, вып.3. Силикаты. Дополнения к томам III и IV(= М-4-3)– М.: Наука, 1996.– 428 с.
Минералы: Справочник. Т. V. Каркасные силикаты. Вып.1. Силикаты с разорванными каркасами. Полевые шпаты.– М.: Наука, 2003. – 584 с. (= М-5-1)
Минералы: Справочник. Т. V, Каркасные силикаты. Вып.2. Фельдшпатоиды.– М.: Наука, 2003. – 382 с. (= М-5-2) \ Гл. ред.: Бокий Г.Б., Боруцкий Б.Е. ; Отв. ред. Мозгова Н.Н., Соколова М.Н. \\ Подробнее: https://www.geokniga.org/books/5945

Рисунки кристаллов в справочнике “Минералы” (примеры - первый рисунок в каждом томе)

Справочники

Ставролит

Сталактиты и псевдосталактиты \\ Стеллерит \\ Стильбит \\ Стихтит \\ Сугилит \\ Сульфаты . Сульфиды. Сфалерит

Сферокристаллы --см. http://geo.web.ru/db/msg.html?mid=1179562. \\ Сферокристаллические сферолиты - http://geo.web.ru/db/msg.html?mid=1175869

Сферолиты

Т

Тальк - распределение по странам фотографий (279) талька на сайте www.mindat.org -- см. карту http://geo.web.ru/druza/k-33_talc_fd_171014.jpg

Типоморфизм \\

Титанит

1. Титанит. Слева направо: 1. Арандис, Намибия. 2. Диана, Нью-Йорк, США. 3. Вишневые горы, Ю. Урал, Россия. Образцы: ФМ . Фото: © А.А. Евсеев.

Титанит. Двойники по (100) из жилы альпийского типа. Капелинья \ Capelinha, Минас-Жерайс, Бразилия. Образец: ФМ (№72321, Ehrmann M.I., 1969)-!!. Фото: © А.А. Евсеев

Толбачит \\ https://www.mindat.org/min-3990.html

Топаз

Топонимика (интересная для минералога) \\ Мурзаев Э.М. Словарь народных географических терминов. М.: Мысль, 1984. - 654 с. - электронная версия

Торбернит

Торий_минералы_ география находок \\

Торит (разн. оранжит). Сёр-Ауднедаль (Sor Audnedal), Ромтеланд, Норвегия. Образец: ФМ (Музей минералогии и геологии (Осло), 1956 г.). Фото+карта: © А.А. Евсеев. "Фото дня" на сайте или "За месяц вокруг света". 2019.07. 02

Тремолит

Тугтупит \ Tugtupite Na4BeAlSi4O12Cl

Тугтупит. Кванефельд, Илимауссак, Ю. Гренландия. Образец: ФМ (№74531).Фото+к: © А.А. Евсеев. "Фото дня" на сайте или "За месяц вокруг света". 2018.07.23

33_22 - Гренландия \\ Tugtup Agtakorfia, Tunulliarfik Fjord, Ilimaussaq complex, Kujalleq, Greenland - первоначальное местонахождение \ Type Locality

33_24 - Канада \\Пудрет, к-р, Сент-Илер массив, Квебек, Канада Poudrette quarry, Mont Saint-Hilaire, La Vallee-du-Richelieu RCM, Monteregie, Quebec, Canada

Турмалин (группа) \\

У

Уваровит

Увит \\

Улексит \\ Уранинит \\ Уссингит

Ф

Фаялит \ Fayalite Fe2+2SiO4

- Фаял о., Азорские о-ва, Португалия \ Атлантический океан \  Faial, Azores, Portugal - первоначальное местонахождение \ Type Locality

Фиолетовый цвет минералов ( примеры)

Флюорит

Флюорит. Николаевское м-ние, Дальнегорск, Приморье, Россия. Образец: Музейно-выставочный центр г. Дальнегорск (Приморье, Россия). Фото: © Д. Тонкачеев. 2022.08

Формы выделения минералов

Фосфаты \\ Фосфаты, арсенаты и др. Образцы из коллекции В.И. Степанова. Минер. музей им.А.Е. Ферсмана РАН

Фосфорит

Фото дня или на geo.web.ru/druza/ - "Вокруг света за 30 дней"

Фото дня на миндат.орг_ретроспектива - http://www.mindat.org/gallery.php?potd=1

Фото мест по всему миру - http://www.panoramio.com/map/

Фотоатлас минералов -- http://tw.strahlen.org/fotoatlas.html (834 minerals, 1148 photos)

Фотогалереи минералов - минералы от A до Z и число их фотографий - указатель для миндат.орг - http://www.mindat.org/photoindex.php--http://www.mineralatlas.com/ \\ http://kristallov.net/index.html \

Фотографии минералов - страница Б.З. Кантора на http://www.mindat.org/user-17280.html - 275 фото (2016.08)

Олег Лопаткин на -- http://www.mindat.org/user-10732.html

Фотосъёмка минералов \\ \\ http://klopotow.narod.ru/soveti/foto.html

--Фото минералов - впервые в рамках Фестиваля "Первозданная Россия" (2016) \\ Подробнее: http://ilm.narod.ru/

Фотосъёмка природы \\ За кадром: Сергей Горшков | Анималистика \\ Мастер-класс Сергея Горшкова: съемка в плохую погоду \\ съемка с уровня земли \\ cъемка в темное время суток

Фторапатит    

Х -

Халцедон \\ http://www.mindat.org/min-960.html ; фото (541) - http://www.mindat.org/gallery.php?min=960

Халькантит \\

Халькантит. Planet Mine, Ла-Пас округ \ La Paz Co, Аризона, США. 3х1,5х1см. Образец и фото: "Русские иминералы" "Фото дня" на сайте или "За месяц вокруг света". 2020.07. 25

Халькопирит

Халькопирит, сидерит. Кайву р-к, Гуйчжоу, Китай \ Kaiwu Mine, Bijie Pref. , Guizhou, China. 50 x 38 x 32 мм. Фото: © О. Лопаткин, 2015. "Фото дня" на сайте или "За месяц вокруг света". 2020.07. 17

 

Халькопирит \\

Холтит \ Holtite \\ https://www.mindat.org/min-1925.html

Хризопраз

Хризотил \ Chrysotile Mg3(Si2O5)(OH)4 \ Хризотил-асбест \\

Хромит

Ц -

Цвета минералов

Цветные камни

--Буканов В.В. Энциклопедия "Цветные камни" - официальный сайт

Целестин

Цеолиты \\

- Tschernich, R. W., 1992, Zeolites of the world: Geoscience Press, Inc. [Phoenix, Ariz.], 563 p.

Церуссит \\

Циркон


Циркон. 1-2 . Гора Каравай, Вишнёвые горы, Южн. Урал, Россия. 3. Сиам, Таиланд. Образцы: ФМ . Фото: © А.А. Евсеев.

Цитрин \\

Цоизит \ Zoisite

 

Цоизит. Крупные призматические кристаллы в гранулированном кварце. Слюдорудник пос., Челябинская обл., Ю. Урал, Россия. Образец: Центральный Сибирский геологический музей (Хохлов В.И., Кузьмин В.Г., 1979) . Фото: Д. Тонкачеев (2022.08.02). 2. Танзанит. [Мерелани-Хиллс], Аруша, Танзания. Образец: -ФМ (№72322, Ehrmann M.L., 1969). Фото: © А.А. Евсеев

Цоизит-(Pb) (TL) \ Zoisite-(Pb) (TL) CaPbAl3[Si2O7][SiO4]O(OH)

-33_2 - Швеция: Якобсберг, Вермланд, Швеция \  Jakobsberg Mine, Jakobsberg ore field, Nordmark District, Filipstad, Varmland County, Sweden \\ Perchiazzi, Natale, Daniela Mauro, Pietro Vignola, Federica Zaccarini, and Knut Eldjarn. (2022) "Zoisite-(Pb), a New Orthorhombic Epidote-Related Mineral from the Jakobsberg Mine, Varmland, Sweden, and Its Relationships with Hancockite" Minerals 12, no. 1: 51. https://doi.org/10.3390/min12010051

 

Ч -

Чароит \\ Чароит. Сиреневое чудо Сибири. Иллюстрированное научно-популярное издание. - Иркутск6 изд-во "Петрографика", 2011. - 192 с. (авторы текстов: Рогова В.П., Воробьев Е.И. и др.)

ШЩ

Шары и яйца из камня \\

Шахтёрская энциклопедия - MiningWiki — энциклопедия о шахтах и шахтёрах, создаваемая совместными усилиями горняцкого сообщества. 

Шеелит \\ Шерл

Шомиокит-(Y) \ Shomiokite-(Y) \ Na3Y[CO3]3 · 3H2O

Шорломит \\

Шпинель \\

Шпинель (фиолетовая). Могок, Мьянма. Более 5 см. Образец : Е. Соловьёв, 2022.11.02. Дар Мин. музею им. А.Е. Ферсмана РАН. Фото: © А. Евсеев

 

Щелочные массивы \\ XXV Всероссийский семинар с участием стран СНГ. Геохимия магматических пород. 23-26 мая 2008 г. Школа Щелочной магматизм Земли   \\ http://alkaline2008.narod.ru/ \\ Тезисы - http://alkaline2008.narod.ru/Abstract.htm

Щелочные массивы мира - минералы в фотографиях

Э

Эвклаз \ Euclase

Эвдиалит \ Eudialyte \\ https://www.mindat.org/min-1420.html - 234 фото (2018.06): Россия - 64; Швеция - 15; Гвинея -1; ЮАР - 1; Мадагаскар - 2 ; Гренландия - 24; Канада - 82; США-41; Бразилия-3

-- Схематическая карта распространения эвдиалита, эвколита и катаплеита. Источник: Минералы Хибинских и Ловозерских тундр. М. - Л.: Изд-во АН СССР, 1937. - 563 с. \\ 33_3

Эгирин \\ местонахождения (595) - http://www.mindat.org/min-31.html \\ фото (169) - http://www.mindat.org/gallery.php?min=31 (на 2009.03.22) \

Экскурсии_ минералогические экскурсии. \\ В Гос. геол. музей им. ВИ. Вернадского

Эльбаит \

Энаргит \\

Эпидот

Эпидот. Призматический кристалл. Kharan Mt., Baluchistan, Пакистан.

Образец эпидота справа -  Dmitriy's pocket, Green Monster Mt., Prince of Wales Island, Alaska, США. Минералы-спутники: АндрадитКварц.
Поступил в музей в 2010 году \\ см. фото https://www.fmm.ru/FMM_1_93173#/media/File:FMM_1_93173.JPG

Ю -

Я \\ Я_ Заметки geo.web.ru/druza

Янтарь \\

Ярмарки минералов и драгоценных камней \\

Ярозит \\

Яшма

ЯШМА В РОССИИ [по А.Е. Ферсману] - http://pictoris.ru/5/27/index.html

ОПИСАНИЕ РУССКИХ ЯШМ [по А.Е. Ферсману] - http://pictoris.ru/5/29/index.html

МЕСТОНАХОЖДЕНИЯ МИНЕРАЛОВ

А Б В Г Д Е Ж З И Й К Л М Н О П Р С Т У Ф Х Ц Ч Ш Щ Э Ю Я || A B C D E F G H I J K L M N O P Q R S T U V W X Y Z

Местонахождения минералов и географические названия от А от Я \ заметки : 01 - А - Б - В - Г- Д - Е - Ж - З - И- К - Л - М - Н - О - П - Р - С - Т - У - Х - Ц - Ч - Ш - Щ -Э - Ю - Я

1. А.Б. Никифоров на р. Дакат (приток р. Ниж. Тунгуска). Июнь 2009 г. "Такие толстые наледи растают только в августе". (В. Левицкий). Фото: © http://www.rusmineral.ru/ 2. Коралловый риф. Акабский залив, Дахаб, Красное море, Египет. Ноябрь 2010 г.. Фото: В. Герасимов.

Справочник  Дана Э.С. Описательная минералогия. Л.-М, 1937  содержит  более 5000 названий местонахождений минералов по всему миру  - см. указатель, составленный  А. Евсеевым (рукописный вариант). Многие из них требуют сегодня исправления и уточнения.

- А-Я _Список местонахождений минералов России и республик бывшего СССР

- А-Я \ А-Z_Список местонахождений минералов, стран и регионов мира

Местонахождения минералов \ mineral localities на сайте и на страницах справочника Евсеев А.А. Географические названия в минералогии. Краткий указатель. Ч. I, М. , 2000. - 269 с.; Ч. II, М. , 2000. - 282 с.
Часть I и II (выборочно):

м-н-ния
А
Б
В
Г
Д
Е
Ж
:З
И
Й
К
Л
М
Н
О
П
Р
С
Т
У
Ф
Х
Ц
Ч
Ш
Щ
Э
Ю
Я
стр.
10-
26-
45-
54
-
63-
73-
75-
77-
81-
87-
88-
122-
132-
151-
160-
166-
180-
188-
213-
226-
234-
239-
247-
249-
255-
260
260-
265-
267-
Locality
A
B
C
D
E
F
G
H
I
J
K
L
M
N
O
P
Q
R
S
T
U
V
W
X
Y
Z
cтр.
9-
24-
44-
63-
71-
78-
86-
97-
108-
113-
118-
135-
148-
173-
181-
188-
203
204-
214-
243-
257-
260-
268-
275-
276-
278-

См. также http://www.mining-enc.ru

Одихинча \ Odikhincha, м-в, р. Котуй, Ср. Сибирь, Россия  \ Odikhincha м-в, Ср. Сибирь(С), Россия ; 70°55'0'' с.ш., 103°1'0'' в..д- https://webmineral.ru/deposits/item.php?id=194. \\ меланит!!; моримотоит!!; нефелин!!

Слюдянка, Ю. Прибайкалье, Россия \\ апатит!!!; диопсид!!; флогопит!!!

Джидинское (=Джида), м-ние, г. Закаменск, Россия \\ айкинит!!--xls< 1 м; браннерит!; гюбнерит!!; родохрозит!!; триплит!!; ферримолибдит!; хаммарит

Pingwu beryl mine (Huya W-Sn-Be dep.; Xuebaoding; 32° 37' 10'' N ,103° 57' 41'' E www.mindat.org \\ аквамарин!!;; касситерит!!; шеелит!!!

Minh Tien Mine, Luc Yкn Distr.- данбурит!; корунд!шпинель!!; эльбаит

А

Аделаида Майн, Дундас, Тасмания, Австралия

Адун-Чолон (= Адун-Чилон), Вост. Забайкалье , Россия

Айфель = Эйфель \ Eifel горы (палеовулкан), Рейнланд-Пфальц, Германия \ Eifel, Rheinland-Pfalz, Deutschland

Акжайляу, к В от г. Аягуз, Вост. Казахстан \\ апатит!!!--с александрит. эффектом; КВАРЦ!!!--xl 10 м; кристалл дымч. кварца 5,8 м в длину и 1, 5 м в поперечнике, весил около 90 т-находка в южной части массива (Ерджанов К.Н., 1963);

Акчатау \ Akchatau, Ц. Казахстан

Аллуайв, Ловозеро, Кольский п-ов, Россия. \\ 67°51` с. ш. 34°32` в. д.

Алту-Лигонья, Мозамбик

Альмаден, Испания

Арендаль, Ю. Норвегия.

Астафьевское м-ние, Ю. Урал, Россия\\ http://www.mindat.org/loc-192610.html

Ахалцихе (р-н), Грузия

Б - местонахождения минералов

Баженовское м-ние , г. Асбест, 60 км к СВВ от Екатеринбурга, Ср. Урал, РФ

Балмат, округ Сент-Лоренс, Нью-Йорк, США.

Бекили \ Bekily, Toliara, Мадагаскар

Бивер, Земля Мак-Робертсона, Вост. Антарктида

Березовское золоторудное месторождение, Средний Урал, Россия \

Биг-Фиш-Ривер \ Big Fish River, 70 км к СЗ от Аклавик, хр. Ричардсон, Юкон, Канада \ Big Fish RiverDawson mining districtYukonCanada ; 68° 28' 25'' North , 136° 29' 14'' West \\ *баричит; *виксит; *горманит!!; лазулит!!; *маричит; *нахпоит; * новые мин.—6 видов; *саттерлиит; MR, 1999, 50 \\ http://www.mindat.org/loc-628.html

Бинн дол., Валлис, Швейцария \ Binn ValleyValaisSwitzerland \\ на карте --1 - 2 - \\ минералы - 276 ; новые минералы - 53 ; фото минералов -  2857(на 2020.09) -  www.mindat.org \\ см. также Ленгенбах

Бисби, Аризона, США

Болео, Мексика \  Boleo District, Santa Rosalia, Mulege Municipality, Baja California Sur, Mexico.

Борон, округ Керн, Калифорния, США \\ в этом же районе находится заброшенный ныне подземный р-к Бейкер майн \ Baker mine, U.S. Borax Mine (Pacific West Coast Borax; Pacific Coast Borax Co.; Boron Mine; U.S. Borax and Chemical Corp.; Kramer Mine; Baker Mine), Kramer Borate deposit, Boron, Kramer District \ подробнее - mindat

Брокен Хилл (Broken Hill), Н. Ю. Уэльс, Австралия, 31-57` ю. ш. , 141-26` в. д. \\ http://www.mindat.org/loc-72.html

--Панов Б.С. Мировой уникум Брокен-Хилл в наше время \ Известия ВУЗов. Геология и разведка, 2004, №4 

Брумаду \\

Бу-Аззер, Марокко

Бурпала , Прибайкалье (С), Россия

Бушвелд, интрузив, Южн. Африка

В

Вавнбед , г. , Ловозеро, Кольский п-ов, РФ \\ * (1961) власовит; манганильменит!!--xls; циркон!!--xls; * (1979) стронциопирохлор—пс-зы по лопариту; Pk (ф)

Вайоминг \ Wyoming, США \\ Hausel W. D. Minerals and Rocks of Wyoming / Wyoming Geol.l Surv. Bull. 66, 1986, 117 p.

Ватиха, Мурзинка, Ср. Урал, Россия

- Рябков В.П., Таланцев А.С., Кокоулин В.А. Генезис аметистоносных полостей месторождений Ватиха (Урал). - Изв. АН СССР. Сер. геол. 1985, № 11, с. 120-129

Везувий и Монте-Сомма, Италия \\ Величка, Польша

Верхнекамское м-ние (Соликамский участок и др.) , 180 км к С от Перми, Приуралье, РФ \\ галит!!—xls< 10 см; гёргейит! (Чайковский И. И. , 2011); калистронцит (Чайковский И. И. , 2011); карналлит!!!--xls<8-9 см (техногенное образование) ; пирит!--xls; сильвин!; Смо, 355

Весселс \ Wessels mine, Калахари, Сев. Капская пров., ЮАР

Вишневые горы, Ю. Урал, Россия \\ фотогалерея и др. - http://webmineral.ru/

Водинское м-ние, к ССВ от Самары, Ср. Поволжье, Россия

Володарск-Волынское пегм. поле, пос. Володарск-Волынский, к З от Житомира, Волынь , Украина \\ берилл!!!--ф; гетит!!!; кварц!!; керит!!; микроклин!; опал!; топаз!!!--xls>100 кг; фенакит!!

Воронцовское м-ние, Краснотурьинск, Сев. Урал, Россия \\ Подробнее: http://webmineral.ru/

Вороньи тундры, Кольский п-ов, Россия

Г

Горихо (Gorikho), м-ние, в ср. и ниж. теч. р. Горихо (приток р. Тола, басс. р. Селенга), 45 км к В от Урги [Улан-Батора], Монголия \\ берилл!; горный хрусталь!; топаз!!; флюорит!; Ф, 491; Ш, 28, 197

Горни-Славков ( (ныне) = Шлаггенвальд (быв.) (Horni Slavkov (now) = Schlaggenwald (form.)), 12 км к ЮЮЗ от гор. Карловы Вары , Богемия, Чехия

Гумешевский р-к, Ср. Урал, Россия

Д

Дальнегорск (и район), Приморье, Россия \\ Дальнегорск в www.mindat.org \\ на 2019. 01.08: минеральных видов - 175; новый минерал - 1(дальнегорскит); фото мин.-2108 \\ сравн. на 2008.08.04 - минер. видов - 170; фото мин.-545 \\ Источник: http://www.mindat.org/loc-2635.htm

Дальнегорск, Приморье, Россия. Фото: © Д. Тонкачеев. 2022.08

Минералы. Музейно-выставочный центр г. Дальнегорск (Приморье, Россия). . Фото: © Д. Тонкачеев. 2022.08

Дальнегорск, Приморье, Россия. Фото предоставил Д. Тонкачеев. 2022.08

Флюорит (кристаллы до ~8 см), кальцит. Дальнегорск, Приморье, Россия. Пирротин (кристаллы до 10 см) на щетке кварца. Дальнегорск, Приморье, Россия. ( №84).  Образцы: Минералогический музей МГРИ-РГГРУ Фото: © А.А. Евсеев

- Бор к-р - Боросиликатное м-ние \

Второй Советский р-к \\ Николаевский р-к \

Верхний р-к

Дараи-Пиез (= Дараи-Пиоз = Дара-и-Пиоз = Дарапиоз) (Dara-Pioz) , 45 км к СВ от пос. Гарм и 35 км к ССВ от Таджикабада, Алайский хр. , Таджикистан; 39° 28' North , 70° 42' East \\ http://www.mindat.org/loc.php?loc=3241

 

Джезказган, Казахстан

Додо м-ние, Прип. Урал, Россия - http://www.polarquartz.ru/dep-dodo.html

Долина Гейзеров \\ Долина Монументов \\ Долина Смерти

Е - Ж - З

Завитинское (Завитая), м-ние, Вост. Забайкалье , Россия \\ адуляр!; воробьевит!; касситерит!; кукеит!; петалит!!; ростерит!; сподумен!!; турмалин!!; Смо, 351

Знаменитые местонахождения минералов

И

Ивигтут \ Ivigtut = Ivittuut, Ю. Гренландия \\ *(1997) йоргенсенит; колумбит!!; криолит!!! (М 2-1); * новые мин.—17 видов; пахнолит!! (М 2-1)--xls<4, 5 см; разн.--около 100 мин.; сфалерит! (М 1-1); томсенолит!! (М 2-1); хиолит! (М 2-1); ярлит! (М 2-1); BBM, 68.

Идар-Оберштайн \ Idar-Oberstein Германия (ЮЗ) \\ агат!! \\ 500 лет (с 1375 г. по 1875 г) в этом районе разрабатывались месторождения агата, велась его обработка. Сегодня небольшой городок - крупнейший центр торговли минералами, драгоценными и поделочными камнями, его называют "самоцветной столицей мира." .

Изумрудные копи, Ср. Урал, Россия

Илимауссак, Ю. Гренландия

Ильмены. Ю. Урал, Россия \\ карта и др. http://reserves-park.ru/index/0-204 \\ http://nashural.ru/Mesta/ilmeni.htm

Индер (Inder) (= Индерское м-ние), 15 км к В от пос. Индерборский, 150 км к С от Атырау (= Гурьев (быв.)), Сев. Прикаспий, Казахстан

Итинокава, о. Сикоку, Япония.

Иультин, Чукотка, Россия

Й - К

Каменушинское (Cu) месторождение, Салаирский ГОК, 6 км к С от г. Салаир, Гурьевский район, Кемеровская область, ЮЗ Сибирь, Россия \\ азурит!!; гиббсит!; малахит!!; цианотрихит! \\ подробнее - http://webmineral.ru \\ на карте - 01 - 02 - 03

Кап-Гарон \ Cap Garonne, близ Le Pradet, 12 км к В от Тулона, Вар, Франция

Капильитас, Катамарка, Аргентина

Карадаг, Крым, Россия

Карамазар (Karamazar) рудный район, Сев. Таджикистан

Кара-Оба = Караоба \ Kara-Oba, м-ние (Mo-W), пос. Джамбул (47-11`N, 71-23`E), Ц. Казахстан

Карнасурт, Ловозеро, Кольский п-ов

Катанга, ДР Конго \\ малахит!!!

Керченское м-ние, Крым, Россия \\ анапаит!!!; барит!! вивианит!!; * митридатит; родохрозит, Ca-вый!!--пс-зы по раковинам (ф); смайтит!; Смо, 352; Pk

Кент, м-ние, гранитный м-в и грейзенизированные гранитные пегматиты, 30 км к ЮВ от пос. Карагайлы и 50 км к ЮВ от Каркаралинска, Ц. Казахстан

Кипуши, ДР Конго

Кировский р-к, Кировский р-к, Кукисвумчорр, Хибины, Кольский п-ов, Россия

Клара р-к \ Clara Mine (=Clara Grube ), Шварцвальд, Германия --барит!!; клараит*; новые. минералы*!!--14 вид.; разнообразие!!-441 видов; хайдарканит!; флюорит!!; чухровит-(Ce)* \\ Clara Mine, Rankach valleyOberwolfachOrtenaukreisFreiburgBaden-Wurttemberg,Germany; 6126 фото минералов (2019.09) ; 48° 22' 59'' North , 8° 14' 47'' East - https://www.mindat.org/loc-1782.html

КМА, Россия

Кнаппенванд \ Knappenwand, Унтерзульцбахталь, Зальцбург, Австрия \\ актинолит!! (биссолит); апатит!!; эпидот!!!--xls< 1м \\ BG, 395; ВВМ, 80, 197; R. Seeman, 1986, Mineralogical Record, 17, 167-181

Ковдор

Конгсберг (Kongsberg), Норвегия \\ * конгсбергит; пренит!; серебро!!!; флюорит!—розовый; ВВМ, 68, 174, 176, 178, 179 \\ O. Johnsen, Mineralogical Record, 1986, 17, 19-36

Кондёр г. , м-в ул.-осн. и щел. пород (Kondoer = Konder), 75 км к З от пос. Джигда и 100 км к ЗЮЗ от пос. Нелькан, ниж. теч. р. Маймакан, Хабаровский край, РФ \\ Алданский щит - https://wiki.web.ru/wiki/Кондерский_массив \ фото 3D - http://www.mindat.org/photo-619937.html

Консельейру-Пена \ Conselheiro Pena District (пегматитовый район), 21 км к С от Дивину-да-Ларанжейрас, (р-н), Минас-Жерайс, Бразилия

Копейск, Челябинский угольный басс., Ю. Урал, РФ \\ *(1990) дмиштейнбергит—шх. 45; *(1986) копейскит; нашатырь!; * новые мин.--8 видов; *(1990) рорисит—шх.45; *(1989) святославит; * сребродольскит!; *(1988) тиннулкунит—шх.44; * флюорэллестадит--ф; Pk \\

Коршуновское м-ние, Иркутская обл., Вост. Сибирь, Россия

Оолитовая гематит-магнетитовая руда. Коршуновское м-ние, Ангаро-Илимский район, Ср. Сибирь(Ю), Россия. Образцы: Центральный Сибирский геологический музей. Новосибирск, Россия. 2022.08.02. Фото: Д. Тонкачеев \\ НМК-220

Кремиковцы = Кремиковци (Kremikovtsi), ~ 15 км к СВ от Софии, Болгария \\ азурит!; барит!; витерит!!; гематит!!; гетит!!; кальцит!; лепидокрокит!; норсетит!! (ММ); родохрозит!!; романешит!!

Кубер-Педи , м-ние (Coober Pedy field), 180 км к С от гор. Туркула и 750 км СЗ от Аделаиды, Ю. Австралия \\ благородный опал!!!--пс-зы!! по раковинам, белемнитам и др

Кугда массив, 10 км к С от устья р. Котуйкан (прит. р. Котуй) и 150 км к ЮЮВ от Хатанги, Ср. Сибирь (С), Россия \\ вермикулит!; перовскит!; Ti-клиногумит!!--xls< 3 см; хризолит!!

Кугитанг-тау , пещера Хашм-Ойик, зал Гигантский. Туркмения

Кукисвумчорр, Хибины, Кольский п-ов, Россия \\ Петараситовая жила, Тульйок река (верховья), Кукисвумчорр гора, Хибины, Кольский п-ов, Мурманская область, Россия

Кухилал (Kukhilal) = Кухи-Лал = Кугиляль = Кох-и-Лал, Памир (ЮЗ), Таджикистан

Л

Лаахерское оз. и другие знаменитые местонахождения минералов (примеры): Сент-Илер \ Илимауссак \ Ловозеро \ Хибины \ Лангезундфьорд \ Лаахерское оз. \ Фого вулк. \ Лос о-ва \ Арис --см. на карте

Лаврион = Лавриум, Греция \ Laurium (= Laurion = Lavrion (нем.)) \ Lavrion Mining District ,  AtticaGreece \\ адамин!!; аннабергит!!; арагонит!; кабрерит!; * (1887) лаурионит!; миксит (группа); * новые мин.-- 22 вида(2019.10); пенфильдит!!; разн. - 592 минер. вида (2019.10) * (1881) серпиерит!!; смитсонит; цианотрихит!!; * (1881) цинкалюминит; *(2000) цинквудвардит; MR, 1998, 508; мин. в иллюстрациях--список фото (по www.mindat.org - 340 фото на 22.03.2004 \\ 3796 фото минералов на 2018.10.30 \\ \\ фотогалерея--http://www.mineral-forum.com/ \\ фотогалерея минералов - http://www.mindat.org/g/554

LavreotikiEast AtticaAtticaGreece \\ 684 минер. видов; в т.ч. 28 новых видов; 5963 фото минералов (2020.08.28) \\ Источник:  https://www.mindat.org/loc-14187.html \\ на карте - 01

--Чуканов Н., Пущаровский Д. ,  Зубкова Н. , Пеков И. и др. Цинколивенит CuZn(AsO4)(OH) – новый минерал группы адамина с упорядоченным распределением меди и цинка /  // Доклады Российской Академии наук. — 2007. — Т. 415, № 3. — С. 377–382.

Лакарги гора, Верхнечегемская вулканическая структура, Кабардино-Балкария, Сев. Кавказ, Россия \ Lakargi Mt., Verkhnechegemskaya caldera (Upper Chegem caldera) ; ксенолиты скарнов в игнимбритах; 43°17'N ; 43°6'E \

Лангезундфьорд = Лангесунн-фьорд (Langesund(s)fjord), Ю. Норвегия

Ленгенбах \ Lengenbach, Бинненталь, Швейцария \\ http://en.wikipedia.org/wiki/Lengenbach_Quarry \\ см. на карте-01 - 02

Ловозеро, Кольский п-ов, Россия \ Lovozero MassifMurmansk OblastRussia - https://www.mindat.org/loc-2697.html

Лонгбан, Вермланд, Швеция \\ 59°51'13"N , 14°15'34"E

М

Мало-Быстринское м-ние (= Малобыстринское), м-ние, 18 км к З от Слюдянки, Прибайкалье (ЮЗ), РФ \\ афганит!; * (1991) быстрит--ф; лазурит!!!; сера!; * тункит; Pk (ф)

Малханское м-ние , Забайкалье, Россия

Малый Пункаруайв г., Ловозерский м-в, Кольский п-ов, Россия\ Malyi Punkaruaiv Mountain, Lovozersky District, Murmansk Oblast, Russia \\ минералы -  40; новые минералы -  6; фото минералов – 8 (2020.12.11) \\ беловит-(Ce)* \ Belovite-(Ce) (TL) ; вигришинит*\ Vigrishinite (TL) ; герасимовскит* \ Gerasimovskite (TL) ; звягинит*\ Zvyaginite (TL) ; пункаруайвит*\ Punkaruaivite (TL) ; чкаловит*\ chkalovite (TL)

Маунт-Кобальт, 120 км к Ю от Клонкерри, Квинсленд, Австралия \ Mount Cobalt ( Mt Cobalt Mine), Selwyn District , Mt Isa - Cloncurry area , Queensland , Australia -- http://www.mindat.org/ \\ фото: гетерогенит!-ф; кобальтин!--ф; мансфельдит (6); смольяниновит—пс-зы по эритрину (кр-лы до 2 мм (3); сферокобальтин!--ф; эритрин!!!—(10 фото);

Маунт-Малоса \ Mt. Malosa, близ Зомба, Малави, Вост. Африка \\ барилит!; микроклин!; миларит!; ниобофиллит!!--фото-- www.mindat.org/gallery1; ортоклаз!; паризит!!; разн. 48 мин. (44 достоверных вида); эгирин!!!—xls> 20 см; эпидидимит!!—xl 5, 4 см; D; L, 1999, №4, 22-32; 48 entries listed. 44 valid minerals-- www.mindat.org (2008.02.24)

--Cairncross, B. (2002). Aegirine and Associated Minerals from Mount Malosa, Malawi. Rocks & Minerals, 77(1), 31-37.

Машамба-Уэст р-к, КатангаДР Конго.; 10° 44' 26'' S, 25° 22' 32'' E \\ на карте01 - 02 \\ Везиньеит--ф; карнотит!--ф; кобальтодоломит!!--ф; кобальтокальцит!!-34ф; колвезит!--ф; куприт!!-ф; малахит!!--134ф; метатюямунит!--ф; планшеит!--ф ; фото минералов - 447 (2018.06) \\ рудник начал работу в 1978 г. \\ Источник: http://www.mindat.org/loc-4334.htm

- Lhoest, J.J., Gauthier, G.J. and King, V.T. (1991), Famous mineral localities: the Mashamba West Mine Shaba Zaire, Mineralogical Record: 22(1): 13-20, 28.

Меднорудянский р-к, Ниж. Тагил, Ср. Урал, Россия.

Менделеева, вулкан, приблизительно в 12 км к ЮЗ от пос. Южно-Курильск, Кунашир о. Курильские о-ва, Россия; 43° 58' 33'' North , 145° 44' 9'' East \\ http://webmineral.ru/deposits \ Mendeleev volcanoKunashir IslandKuril Islands (Kurile Islands)Sakhalin OblastRussia \\ онофрит!; плагиоклаз (кристаллы-лапилли). сера!!

Мерек (= Мерекское), м-ние, ~40 км выше устья р. Мерек (приток р. Амгунь), близ ж.-д. ст. Эанга, к ЮВ от Чегдомына, 270 км к С от Хабаровска, Буреинский хр. , Хабаровский край, РФ \\ касситерит!!—xls \\ Мерек рудопр-ние, в верх. р. Мерек (левобережье р. Амгу)-касситерит!!-фото; рядом-пром. россыпи касситерита-- Расческин Е.В., 2004, 206-207 \\ Д..А. Петроченков. Касситерит [Мерек] и аммониты [Европ. Россия] в ювелирных изделиях--сообщ. в клубе друзей минералогии (2008.06.06)

Мерелани-Хиллс \ Merelani Hills, Танзания \\ алабандин!!!--xl 9x6x4 см; добыт в 2013 г.--фото www.mindat.org

Мибладен, Марокко

Могок = Могоу (новое название, по Е.Я. Киевленко, 2001) (Mogok District), Мьянма (= Бирма (быв.)

Мурзинка, Ср. Урал, Россия

Мурунский массив = Мурун (Murun), близ г. Мурун (1452 м), междуречье рр. Чара и Токко, ~50 км к ЗЮЗ от пос. Торго, Алдан (СЗ), Якутия (ЮЗ), РФ \\\\ Сиреневый Камень месторождение чароита --http://petrographica.ru

Минералы Мурунского щелочного массива. Центральный Сибирский геологический музей. Новосибирск, Россия. 2022.08.02. Фото: Д. Тонкачеев \\ НМК-220

Апофиллитизация - обесцвечивание чароита. Мурунский массив, Ю. Якутия, Россия. Образец: Центральный Сибирский геологический музей. Новосибирск, Россия. 2022.08.02. Фото: Д. Тонкачеев \\ НМК-220

Фёдорит (розовогоцвета) с кварцем в чароитите. Мурунский массив, Ю. Якутия, Россия. Образец: Центральный Сибирский геологический музей. Новосибирск, Россия. 2022.08.02. Фото: Д. Тонкачеев \

 

Мусонои р-к \ Musonoi mine, ~25-30 км к З (по другим данным -10 км к СЗ ) от Колвези (10°41`S, 25°39`E), Катанга (быв. Шаба, ДР Конго (быв. Заир) \\ 10° 43' 37'' South , 25° 27' 10'' East - https://www.mindat.org/loc-4322.html

--Wilson, W.E. (2018) The Musonoi mine, Kolwezi District, Lualaba Province, Democratic Republic of the Congo. Mineralogical Record, 49, 236-304.

--Новые минералы - https://www.mindat.org/loc-4322.html (на 2019.07) : Demesmaekerite (TL) \\ Derriksite (TL)\\ Guilleminite (TL) !! \\ Kolwezite (TL)\\ Marthozite (TL) \\ Oosterboschite (TL) \\ Verbeekite (TL)\\ \\

Мусонои в www.mindat.org

минералы -81

новые минералы - 7

фото минералов - 737

на 2019.07.10

--Wilson, W. E. (2018) The Musonoi mine, Kolwezi District, Lualaba Province, Democratic Republic of the Congo. Mineralogical Record 49:236-304

Названия местонахождений - что они означают?

--Андамука \ Andamooka - знаменитое месторождение благородного опала в Южн. Австралии (30° 27' 14'' S, 137° 10' 15'' E--mindat). Андамука на языке аборигенов означает "нет названия" \ "no name"

Навегадора р-к \ Navegadora Mine, Минас-Жерайс, Бразилия

Найка, Чиуауа, Мексика \\ гипс!!! - гигантские кристаллы

Гипс. Найка, Чиуауа, Мексика. Образец: Музей Terra mineralia, Германия. Фото: © Д. Тонкачеев. "Фото дня" на сайте или "За месяц вокруг света". 2018.04.27.

Гигантские кристаллы гипса (до 11 метров!). Найка, Чиуауа, Мексика. This image has been released to the public domain and may be used freely. Источник: https://www.mindat.org.
"Фото дня" на сайте
 или "За месяц вокруг света"2022.04. 27

 

Насик (=Нашик) - Пуна \ Nashik distr. - Pune, Махараштра шт., Индия.

Неройка г., Прип. Урал, Россия \\ Додо м-ние \\ на карте--01 - 02

Нерчинский горный округ (быв.), Вост. Забайкалье, Россия \\ Местонахождения минералов быв. Нерчинского горного округа (Вост. Забайкалье, Россия) с примерами находок. Карта Составил: © А.А. Евсеев. с.

Нидым р. (Nidym) , левый прит. р. Ниж. Тунгуска (25 км ниже пос. Тура), Ср. Сибирь, РФ \\ на карте - 01 \\ анальцим!!--ф; апофиллит!; кальцит (исландский шпат)!!; стильбит!; томсонит!; эрионит

Никитовское ( = Никитовка), м-ние, ~ 6 км к СЗ от гор. Горловка [ в его черте ], Донбасс \\ антимонит!!--xls< 18 см; киноварь!!; мелантерит!; * феррогексагидрит; Багатаев М. Н. , 1997 (МК, №12, 17-23; WS, №12, 10-14); Смо, 354; Pk

Норильский р-н, Ср. Сибирь, Россия

О

Одихинча \ Odikhincha, м-в, р. Котуй, 110 км к ЮЮВ от Хатанги, Ср. Сибирь, РФ \ Odikhincha massif, Maimecha and Kotui Rivers BasinKrasnoyarsk KraiRussia \\ андрадит, Ti-сод. (меланит!!); магнетит!; нефелин!!--xls; мелилит!; тасекит!; шорломит!!; МЩ, 133 \\ Зайцев В.А. Редкометальная минерализация нефелин-сиенитового пегматита из массива Одихинча --стенд доклад - http://alkaline2008.narod.ru/ \\ Зайцев В.А., Чуканов Н.В. ТАСЕКИТ ИЗ НЕФЕЛИН-СИЕНИТОВОГО ПЕГМАТИТА МАССИВА ОДИХИНЧА. \\ http://alkaline2008.narod.ru/Abstract.htm

Олдоиньо-Ленгаи \ Oldoinyo Lengaii = Ol Doinyo Lengai volcano, к СЗ от гор. Аруша, Танзания; "единственный в мире действующий карбонатитовый вулкан"(Keller J. et al., 1990); 2°44`S, 35°53`E (Dana, 1997)\\ \\ вишневит! (D); МЩ, 146; \\ http://www.mindat.org/min-4190.html

Ору-Прету (район), Минас-Жерайс, Бразилия

Оутокумпу, рудное поле \ Outokumpu, Финляндия \ Outokumpu Cu-Co-Zn-Ni-Ag-Au ore field, North KareliaFinland \\ знаменитое местонахождение минералов \\ алабандин \ Alabandite; андуоит\ Anduoite; карелианит*(1963) \ Karelianite (TL) ; кобальт-пентландит* \ Cobaltpentlandite (TL) ; пентландит!--М-1-1, 181а); уваровит!!!--1) 68 фото 2) xls<4,6x2,6 см; ульманнит \ Ullmannite ; уранинит \ Uraninite ; хаапалаит* \ Haapalaite (TL) ; халькопирит; хром-диопсид!--28 фото ; цоизит \ Zoisite ; эпидот, Cr-сод.("тавмавит"); *(1958) эсколаит!!; \\ 82 мин. видов \ valid minerals. 4 (TL) - новых минералов \ type locality of valid minerals. \\ ВВМ, 74; R&M, 1998, 126 \\ \\ Подробнее: http://www.mindat.org/loc-6416.html

Охуэла р-к \ Ojuela mine, Мапими, Дуранго, Мексика \\ кобяшевит!!--новинка Тусон-шоу 2016 г.--фото- http://webmineral.ru/

П

Пайкс-Пик, округ Эль-Пасо, Колорадо, США \ Pikes Peak, El Paso Co., Colorado, USA ; 38° 50' 25'' North , 105° 2' 30'' West \\ амазонит!!!--27фд; сидерофиллит* \ Siderophyllite (TL)

Пала, округ Сан-Диего, Калифорния, США \\ берилл розовый!; кунцит!!; лепидолит!; эльбаит!!!

Палабора, Лимпопо, Южная Африка \ Palabora mine (Foscor open pit; PMC mine), LoolekopPhalaborwaLimpopoSouth Africa; 23° 59' 31'' South , 31° 7' 41'' East\\ \\ фото карьера - The biggest hole in South Africa- www.mindat.org/photo \\ Бадделеит!!! \ Baddeleyite--кр-л 10 см--фото \\ Разнообразие минералов в базе данных  www.mindat.org:  минералы \ valid minerals - 96; (TL) - новые минералы \ type locality of valid minerals - 0 ; фото минералов - 97 (на 2020.12.24)

Палитра пегматит, Кедыкверпахк г., Ловозеро \\ PEKOV, I.V. (2006) The Palitra pegmatite, a newly discovered hyperalkaline pegmatite in the Lovozero massif, Kola Peninsula, Russia. Mineralogical Record, 36, 397-416.

Панашкейра \ Panasqueira; Португалия; 40°10`N , 7°46`W;

Педернейра, р-к (Pederneira mine), Минас-Жерайс, Бразилия \\ эльбаит!!!--xl 20 см (ф), MR, 2000, #1, 56 \\ 18° 10' 9'' South , 42° 10' 59'' West - www.mindat.org

Первомайский (= Трудолюбовский) к-р, 1, 5 км к В от с. Трудолюбовка, гора Кермен, 20 км к ЮЮЗ от Симферополя, Крым, Россия. \\ анальцим, бабингтонит; гидроксиапофиллит!!; гиролит!; окенит!; МК, 1996, №9, 9

Первоначальные местонахождения (type localities) минералов на карте мира

Перекатное м-ние, Алдан, Якутия, Россия. \\ https://webmineral.ru/deposits/item.php?id=1449

Питкяранта, Сев. Приладожье, Ю. Карелия, РФ \\ См. http://karelnedra.karelia.ru/mnia/sn_karelia.htm

Плоская г. , Кейвы, Кольский п-ов, Россия; амазонитовые пегматиты с редкими минералами Y и Yb \\ Гора Плоская 2015 - фоторепортаж - http://webmineral.ru/

Пршибрам, рудное поле, Чехия \ \ Pribram ore field, Czech Republic

Пуйва, Прип. Урал, Россия

Пуна\ Poona = Pune (район Пуны), Индия

Р

Рай-Из гипербазитовый массив (район), хр. Марун-Кеу, ж.-д.. ст. Харп, ЯНАО, Тюменская обл., Пол. Урал, Россия

Расвумчорр, Хибины, Кольский п-ов, Россия

Ратнапура, Шри-Ланка

Роджерли майн\ Rogerley mine, Дарем, Камбрия, Англия, Великобритания

Рубцовское м-ние, , (рудник отработан и затоплен), 20 км к ЮВ от г. Рубцовск близ северной окраины дер. Потеряевка, Алтай, Россия; 51°28'14'' с.ш., 81°29'34'' в.д. \\ азурит!!; коннеллит!--фото ; йодаргирит!; куприт!!!; майерсит!!; маршит!!; медь!!; серебро!

Дендриты меди с мелкими дендритами самородного серебра. Рубцовский р-к, Алтайский край, Россия. Образец: Центральный Сибирский геологический музей. Новосибирск, Россия. 2022.08.02. Фото: Д. Тонкачеев \\ НМК-220

Рудные горы, Гемания \ Чехия

С

Садбери Дистр. \ Sudbury District, OntarioCanada - 285 фото минералов - https://www.mindat.org/loc-571.html

Сан-Жозе-да-Сафира \ Sao Jose da Safira (San Jose de Safira), Минас-Жерайс, Бразилия - фото
http://www.hummingbirdminerals.com/IMG_2787zc.jpg \https://www.mindat.org/loc-571.html http://www.hummingbirdminerals.com/mixedminerals7page3.html \\ - фотогалерея - http://www.mindat.org/gallery.php?loc=5894 \ http://www.mindat.org/gallery.php?cform_is_valid=1&loc=5894&cf_pager_page=4

Санкт-Андреасберг, Гарц, Ниж. Саксония, Германия (33_5) \ St Andreasberg District, Harz Mts, Lower Saxony, Germany \\ апофиллит!!; *арсенолит; *брейтгауптит; *гармотом!!!; дискразит!!; кальцит!!!; миаргирит!; мышьяк!!; нов. мин.--4 вида; пираргирит!!!; прустит!; разн.-220 мин.(198 мин. вид.)--http://www.mindat.org/loc-22230.html (на 2008.09.04) ; * самсонит!!; стефанит!!; ВВМ, 46, 56, 240

Сарановское м-ние, Ср. Урал, Россия

--О.К. Иванов. Минералогия Сарановского хромитового месторождения, Урал. - Минералогический Альманах, том 21, выпуск 2, 2016 - http://www.minbook.com/book.php?book=120&russian=1

Сарбайский р-к \ Sarbayskii mine (= Сарбайское м-ние) и Соколовский р-к, гор. Рудный, 45 км к ЮЗ от Кустаная, Казахстан

Сент-Илер массив, Квебек, Канада; 45° 33' 11'' North , 73° 9' 7'' West - http://www.mindat.org/loc-123123.html

--Сент-Илер-- более 5369 фото минералов (на 2019.02). Из них : 306-серандит!!!; 200 -катаплеит!!!+Gui-72; 186-родохрозит;124-анальцим;111-карлетонит!!!;111-натролит; минералов - 415; новых минералов - 66 \ 415 valid minerals. 66 (TL) - type locality of valid minerals. Источник: https://www.mindat.org/loc-123123.html

Сикуаньшань, Хунань, Китай

Слюдянка (и район) Словарь топонимов Слюдянского района - http://www.maxknow.ru/images/upload/articles7/468.htm

Смарагдит(тремолит) - длинношестоватые кристаллы в кальци-диопсидовой породе. Слюдянка, ЮЗ Прибайкалье, Иркутская обл., Россия. Образец: Центральный Сибирский геологический музей. Новосибирск, Россия. 2022.08.02. Фото: Д. Тонкачеев

1. Менделеевит - удлиненные темно-коричневые кристаллы с черным турмалином в породе. Слюдянка, ЮЗ Прибайкалье, Россия. Образец: Центральный Сибирский геологический музей. Новосибирск, Россия. 2022.08.02. Фото: Д. Тонкачеев 2. Шпинель розовая в кальцитовом мраморе. Слюдянка, ЮЗ Прибайкалье, Россия . Образцы : Центральный Сибирский геологический музей. Новосибирск, Россия. Автор верхнего образца - А.А. Годовиков. Фото: Д. Тонкачеев (2022.08.02.)

 

Солонго (= Магнетитовое) м-ние, Забайкалье, Бурятия, Россия

Суит-Хоум Майн, Алма, \ Sweet Home Mine, Alma, Колорадо, США

Сюебаодин \ Xuebaoding, горы, район Пинъу \ Pingwu, Сычуань, Китай

Сянхуалин \ Xianghualing (м-ние Sn-Pb-Zn), Хунань, Китай--балифолит*; гиббсит-26ф; либерит*; сянхуалинит*; таафеит!! ФЛЮОРИТ!!!--402фд; Liu, 2006, 201-215

Т

Талнах м-ние, Ср. Сибирь (С)

Таманский п-ов, между морями Черным и Азовским, Россия (Ю)

Тигриное м-ние, Приморье, Россия \\ --Попова В. И., Попов В. А., Коростелёв П. Г., Орловский В. В. Минералогия руд W-Sn-месторождения Тигриное и перспективы его освоения. Екатеринбург: УрО РАН, 2013 г. – 133 с.

Титовское м-ние, р. Догдо, хр. Тас-Хаяхтах, Пол. Якутия, Россия

Толбачик (= Толбачинский) (Tolbachinskii) вулкан, к ЮЗ от Ключевской Сопки, Камчатка, Россия \\ разнообразие - 232 мин.вида - http://www.mindat.org/loc-5602.html ; новые минералы - 123 вида; по числу новых минералов, открытых здесь, вулкан Толбачик занимает теперь 2-ое место в мире среди всех местонахождений минералов (данные И.В. Пекова, 2019.09)

Толбачик (= Толбачинский) (Tolbachinskii) вулкан, к ЮЗ от Ключевской Сопки, Камчатка \ Tolbachik volcano, Kamchatka KraiRussia - https://www.mindat.org/loc-5602.html - 55° 49' 59'' North , 160° 19' 59'' East; 501\ 528 \ 541 фото минералов; 232 \ 260 \ 279 минералов valid minerals; 123 \ 129 \ 130 новых минералов  (TL) - type locality of valid minerals (2019.09.03 \ 2020.05.06) \ 2020.12.25

- Koshlyakova, N.N., Pekov, I.V., Vigasina, M.F., Zubkova, N.V., Agakhanov, A.A., Britvin, S.N., Siderov, E.G., Pushcharovsky, D.Yu. (2022) Reznitskyite, CaMg(VO4)F, a new mineral from the Tolbachik volcano, Kamchatka, Russia and the first vanadate with a titanite-type structure. Mineralogical Magazine: 86(2): 307-313. \ http://forum.amiminerals.it/viewtopic.php?f=5&t=17514&sid=ac8394b86b3099bb772b2f3d5a9c4044

Толбачик. К 40-летию изучения процессов и продуктов деятельности Большого трещинного Толбачинского извержения 1975-1976 гг.
Идея: профессор СПбГУ, д.г.-м.н. С.К. Филатов - https://crystal.geology.spbu.ru/tolbachik/

- Арсенатная фумарола, БТТИ, Толбачик

--

Кононовит - агрегат из белых кристаллов на вулканическом шлаке. Фумарола Арсенатная, БТТИ, влк. Толбачик, Камчатка, Россия. Образец: Центральный Сибирский геологический музей (Пеков И.В.). Новосибирск, Россия. 2022.08.02. Фото: Д. Тонкачеев \\ НМК-220

- Ядовитая фумарола, 2-ой шлаковый конус, БТТИ, Толбачик, Камчатка, Россия\ Yadovitaya fumarole, Second scoria coneNorthern Breakthrough (North Breach)Great Fissure eruption (Main Fracture)Tolbachik volcanoKamchatka KraiRussia ; 55° 49' 59'' North , 160° 19' 59'' East \\ минералы - 63 ; новые минералы -21  ; фото минералов – 95 (на 2021.11.07) \\ алеутит*

- Siidra, O.I., Nazarchuk, E.V., Agakhanov, A.A., Yury S. Polekhovsky, Y.S. (2019) Aleutite [Cu5O2](AsO4)(VO4)·(Cu0.5?0.5)Cl, a new complex salt-inclusion mineral with Cu2+ substructure derived from Kagome-net. Mineralogical Magazine: 83(6): 847-853.

Минералы (примеры). Источник : https://www.mindat.org/loc-5602.html

Толбачик, Камчатка_новые минералы--Большое трещинное извержение (БТТИ), Толбачик вулкан, Камчатский край, Россия-- \ Second scoria cone, Northern Breakthrough, Great Fissure eruption, Tolbachik volcano, Kamchatka Krai, Russia

Траверселла (Traversella), близ Ивреа, Пьемонт, Сев. Италия \\ аметист!!; доломит!; магнетит!!—xls< 3 см; пирит!; шеелит!!; эпидот!; ВВМ, 160, 234

Турьинские р-ки, Сев. Урал, Россия \\ Фёдоров Е. С., Никитин В. В. Богословский горный округ. Описание в отношении его топографии, минералогии, геологии и рудных месторождений. - СПб., 1901. - С. 92. \\ на карте-01 -02

Тюямуюн, Киргизия

У

Умбозерский р-к, г. Аллуайв, Ловозеро, Кольский п-ов, РФ

Ф.

Фрайберг (=Фрейберг), район.

Франклин, Нью-Джерси \ (Franklin) и Стерлинг-Хилл, 80 км к СЗ от Нью-Йорка, округ Сассекс, Нью-Джерси, США \\ аллеганит! (М 3-1); виллемит!! (М 3-1)—xls<20 см; ганит! (М 2-3); гетеролит! (М 2-3); глаукохроит! (М 3-1); годжкинсонит! (М 3-1); ларсенит! (М 3-1); лейкофеницит! (М 3-1); *ленниленапеит (ММ); лёллингит! (М 1-1); * новые мин.—67 видов (вместе с м-нием Стерлинг-Хилл); норбергит! (М 3-1); пирохроит! (М 2-3); родонит!! (М 3-2); тефроит! (М 3-1); * франклинит!! (М 2-3)—xls< 15 см; хендриксит!; цинкит!!! (М 2-2); BG, 19, 21; MR, 1996, 226 (лит.)

Х - местонахождения

Хагендорф-Зюд, Бавария, Германия

Хайдаркан, м-ние, Киргизия

Хибины, Кольский п-ов, Россия\ Khibiny massif - https://www.mindat.org/loc-2680.html : 523 минерал. вида ; 121 новые минерал. виды; 1081 фото минералов (в т.ч. эвдиалит - 52) на 2019.01.11  \\ карта Хибин \\ турист. схема

Хибины  www.mindat.org -- фото минералов -  1092 (на 2019.04.19).

Хуанганг р-к \ Huanggang Mine (Huanggangliang Mine), Внутр. Монголия, Китай --Ottens, B., and Neumeier, G. (2012): The Huanggang Mine, Inner Mongolia, China. Mineralogical Record 43, 529-563.

Ц

Цумеб \ Tsumeb и район, Намибия \\ (ГРЭ- III , 587-593); геол. карта р-на; геол. разрез); «скопления германита достигали веса в несколько сотен тонн» (с.589) ; \\ https://www.mindat.org/loc-43981.html :

Цумеб \ Tsumeb Mine, Tsumeb, Oshikoto Region, Namibia \ Разнообразие минералов в базе данных  www.mindat.org:  минералы \ valid minerals - 325 ; (TL) - новые минералы \ type locality of valid minerals - 72; фото минералов - 7299 (на 2021.01.23)  

-- Wilson, W.E. et al. (1977) Tsumeb. Mineralogical Record, 8(3), 4-129.

Ч

Челябинск, Ю. Урал, Россия

Чупа, Сев. Карелия

Чукикамата, Chuquicamata (22°18`S, 68°55`W), 15 км к N от Каламы, Антофагаста, Чили \\ атакамит! (М 2-1); *(2011) бетпакдалит-NaNa; * (1811) блёдит; мендосавиллит*; маршит! (М 2-1); *1908-натрохальцит; (Gui-72); * новые мин.—12 видов; *1986-обрадовичит; * самплеит

Ш Щ

Шерловая Гора (= Шерлова гора = Ширлова гора) (Scherlovaya Gora), Вост. Забайкалье, РФ \ Sherlova Gora, Adun-Cholon Range, Nerchinsk Gem mines, Nerchinsk, Zabaykalsky Krai, Russia ; 50° 31' 12'' North , 116° 18' 0'' East \\ Минералогический Альманах, том 19, выпуск 2, 2014

Шимен, Хунань, Китай

Шинколобве (Shinkolobwe), Верхняя Катанга, ДР Конго \ Shinkolobwe Mine (Kasolo Mine), ShinkolobweKambove DistrictHaut-KatangaDR Congo \ ; 11° 2' 54'' South , 26° 33' 2'' East \\ 425 фото минералов ; 128 достоверных минералов \ valid minerals. 38 (TL) - новых минералов \ type locality of valid minerals (2019.01) - https://www.mindat.org/loc-4328.html \\ * (1922) беккерелит!; * биллиетит! (М 2-3); * ванденбрандеит! * вандендрисшеит! (М 2-3); ваэсит!!; * виартит!!; гетерогенит!!; зигенит!!; * купросклодовскит!!; * кюрит; настуран!!--крупное м-ние; * новые мин.—36 видов; * параскупит! (М 2-3); *пиретит (piretite); селенозигенит--М-1-1, 279а); * скупит! (М 2-3); * студтит!; уранинит!--xls; фурмарьерит!; BBM, 15, 92; Gui-72

Шкатулка, пегм. залежь, Умбозерский р-к, Аллуайв, Ловозеро, Кольский п-ов, РФ.

Шнееберг, Рудные горы, Саксония, Германия \\ 365 минералов, из них 299 достоверных видов, из них 43  новых вида ( type locality) на 2016.03.04\\ Источник: http://www.mindat.org/loc-1848.html

Шор-Су = Шорсу, м-ние, 30-35 км к ЮЮЗ от Коканда, Фергана (Ю), Узбекистан \\ озокерит!; сера!!!; целестин; МС-1, 278-279; Смо, 356

Э

Юбилейная залежь \ Jubilee( = Yubileinaya) pegmatite ), Карнасурт, Ловозеро, Кольский п-ов, Россия

Я

Яогансян р-к (W) \ Yaogangxian = Yao Guang Xiang, 40 км к ЮВ от Ченжоу, Хунань (Ю), Китай \ Yaogangxian = Yao Guang Xiang, Yizhang Co., Chenzhou Prefecture, Hunan; 25°35'N , 113°15'E \\ : http://www.mindat.org/loc-4549.html -- 1567 фото минералов (2019.02): арсенопирит!! -184; буланжерит!!--18; бурнонит!!! -141; джемсонит!!--26; станнин!!!--60; ферберит!!--109; шеелит!!--94 и др. \\ на карте

Яхимов (Jachymov) (= быв. Иоахимсталь\ Joachimsthal), Западно-Чешский край, Богемия, Чехия \\ http://www.mindat.org/loc-158151.html \\ см. также--СПРАВОЧНИК МЕСТОНАХОЖДЕНИЙ МИНЕРАЛОВ И РУД - http://mineral.nsu.ru/educat/article/7/

СТРАНЫ и РЕГИОНЫ

Малахит. Шилу \ Shilu, Yangchun, Гуандун, Китай. Образец: Музей Terra mineralia, Германия. Фото: © Д. Тонкачеев. "Фото дня" на сайте или "За месяц вокруг света". 2022.05. 17

Находки минералов по всему миру. Подробнее: Евсеев А.А. Атлас мира для минералога. М., 2004. - 284 с. \\ Евсеев А.А. Атлас для минералога. Россия и бывший СССР . М., 2011. – 248 с

СТРАНЫ от А до Я

находки минералов по листам карты мира: 1234567 891011121314151617181920212223242526272829303132 - 33

Викимапия \ Wikimapia (карты мира и России) - ФМ

Сев. Америка (С)

Гренландия

Атлантика - Скандинавия - Кольский п-в

Урал
Ср. Сибирь
Якутия
СВ России

Сев. Америка (З - Сев. Америка (Кордильеры)

Сев. Америка (В)

Британ. о-ва, Пиренейский п-в - Зап. Европа - Вост. Европа

Казахстан, Ср. Азия

Юг Сибири
Забайкалье, Вост . Сибирь
Камчатка - Дальний Восток (Россия, Япония
Мексика
Кавказ, ЮЗ Азия
Афганистан, Пакистан
Индия
Монголия. Китай
ЮВ Азия - Тихий океан
Ю. Америка (СЗ) - Кордильеры
Бразилия

Африка - Сев. и Зап.Экв. и ЮжнВост.

Антарктида
Австралия

Тихий океан - Весь мир

Интересная подборка из 9 минералов региона получается если взять по одному из 9 его частей (центр, север, юг, запад, восток, СВ, ЮВ, ЮВ, СЗ)

Страны и регионы по числу фотографий минералов в базе данных миндат \ mindat.org

Mineralienatlas - указатель по странам - https://www.mineralienatlas.de/

Северное полушарие

Арктика

Земля Франца-Иосифа, Северный Ледовитый океан, Арктика; Архангельская обл., Россия \\ Карбонатные (?) конкреции!!--о. Чамп; кварц (халедон) по дереву! - о. Мак-Клинтока о.; сера!

Северный Ледовитый океан - карта

Новая Земля

Восточное полушарие

1. Крокоит. Dundas, Zeehan, Тасмания, Австралия 2. Поллуцит (кристалл~20 см). Шенгус \ Shengus, Пакистан. Образцы: ФМ .Фото: © А. Евсеев. \\

Европа \

Евразия

 

Россия и СССР

- Россия \ Russia: минеральные виды - 2559 \ 2529; новые минералы - 860 \ 845; фото минералов - 13594 \ 13453 (на 2021.09.24 \ 2021.07.25) \\ по https://www.mindat.org/loc-14409.html

- минералы России в фотографиях www.mindat.org ( 2022.11.23) \\ примеры : алмаз - 80; галит -6 ; гипс - 13; кальцит - 552; кварц - 438++; малахит - 89; пирит - 102 ; пирротин - 170; сперрилит -71; тальк- 5; топаз - 170; уваровит-231 ; флюорит - 598;

1. Pekov I. V. Minerals First Discovered on the Territory of the former Soviet Union. Moscow, Ocean Pictures Ltd, 1998. -369 p. \ Пеков И.В. Новые минералы, открытые на территории быв. СССР. 2. Алтаит. Заводинский р-к [2-ой Заводинский р-к], Зап. Алтай, Казахстан. Образец: ФМ (№54080. Егоров К.Ф.). 3. Зорит. Юбилейная , залежь, Карнасурт, Ловозеро, Кольский п-ов, Россия. Образец: ФМ (№75698. Дорфман М.Д., 1974. Фото 2, 3: © А.А. Евсеев.

СССР (быв.) в /www.mindat.org

минералы - 2616

новые минералы - 963

фото минералов - 13997

на 2019.08.05

Россия в www.mindat.org

минералы - 2479

новые минералы - 844

фото минералов - 12975

на 2020.11.20

 

Россия в /www.mindat.org

минералы - 2479

новые минералы - 844

фото минералов - 12934

на 2020. 10. 26

Россия в /www.mindat.org

минералы - 2378

новые минералы - 811

фото минералов - 12231

на 2019.08.05

Европа Вост.(регионы) главные минералы местонахождений по количеству образцов в систематической коллекции. ФМ :

- Хибины - эвдиалит (333 обр.) \\ Ловозеро - лоренценит (192 обр.) \\ Чупа и др., Сев. Карелия - циртолит(133 обр.) \\ Русавкино, Подмосковье - кальцит (8) \\ Володарск-Волынский (ныне -Хорошев \ укр. Хорошів) - топаз(96) и берилл (96 ) \\ Никитовка - киноварь (74) \\ Керченское м-ние - вивианит (84)

Минералы России в фотографиях на https://www.mindat.org/loc-14409.html -   12934 фото минералов на 2020.10.26

Новейшие фото - датолит--ФОТО - Bor Pit, Dal'negorsk B deposit, Dalnegorsk

Старейшие фото - эвдиалит - ФОТО - Kirovskii apatite mine, Kukisvumchorr Mt, Khibiny Massif, Murmansk Oblast, Russia

Самые просматриваемые \ most viewed - рениит - ФОТО - Kudriavy volcano, Iturup Island, Kuril Islands, Sakhalin Oblast, Russia

По рейтингу \ rating - расвумит - ФОТО - - Kirovskii apatite mine, Kukisvumchorr Mt, Khibiny Massif, Murmansk Oblast, Russia

Из [новых] фото минералов на https://www.mindat.org  (2020.10.25): Одихинча массив, р. Котуй, Ср. Сибирь (С), Россия : моримотоит - ФОТО - Odikhincha massif, Maimecha and Kotui Rivers Basin, Krasnoyarsk Krai, Russia

--Минералы СССР, т.1 "Самородные элементы"/ под ред. А.Е.Ферсмана (редактор тома Н.А.Смольянинов), Изд.АН СССР Москва-Ленинград. 1940 г. - 328 с., тир. 3000 экз.

--Геологические памятники природы России "Природное наследие России" . Авторы: Карпунин А.М. , Мамонов С.В. , Мироненко О.А. , Соколов А.Р. Главный редактор - Орлов В.П. Санкт-Петербург, 1998 г.\\ веб-публикация

Физическая карта России - http://town-map.ru/346093.html

Карта России на сайте К.И. Клопотова

Кристаллы России в экспозиции Минералогического музея им. А.Е. Ферсмана РАН (кристаллы 5 см и более на выставке "Кристаллы")

10 замечательных минералов России (экспресс-опрос провел А. Евсеев)

Экспозиция "Замечательные минералы России". 2019 г. Мин. музей им.А.Е. Ферсмана РАН. Подробнее: https://www.fmm.ru/Exp17.

Экспозиция "Минералы России". Зал "Региональная и всемирная минералогия". Минерал. музей МГРИ.

Минералы России по числу ссылок (20 и более) в «Атласе мира для минералога»

Новые минералы ( СССР и Россия) \\ Список всех новых минералов, открытых на территории быв. СССР с 1766 до первой половины 2006 г. содержит 714 достоверных ( valid ) минеральных видов – см. Pekov I.V. New Minerals from Former Soviet Union Countries, 1998-2006 // Mineralogical Almanac, Vol. 11. Moscow, Mineralogical Almanac, 2007, 112 pp. (список - стр. 85-88) Полезные ископаемые - Википедия

Минералы России в mindat.org - https://www.mindat.org/loc-14409.html

Карта "Самые замечательные месторождения минералов в Союзе" (фрагмент). Источник: Ферсман А.Е. Занимательная минералогия. М. -Л.: "Детская литература", 1937. - 240 с. Объяснения к карте - см. стр. 235-238. Подробнее

Коллекционные минералы из России - http://www.kristallemineralsrussia.com/

Кольский п-в и Карелия

Россия

Хибины и Ловозеро --карта (спутник)

1. Титанит с нефелином. Кировский р-к, Кукисвумчорр, Хибины, Кольский п-ов, Россия. Образец: ФМ (№92516. Обмен 2008 г..). Фото: © А.А. Евсеев.  На карте \\ "Фото дня" на сайте (2022.01. 03). 2. 2. Холтит (кристаллы до 4 см; люминесцирует синим) в пегматите. Васин-Мыльк, Вороньи тундры, Кольский п-ов, Россия. Образец: ФМ. (№80818, Гордиенко В.В., 1981). Фото: © А.А. Евсеев. "Фото дня" на сайте ( 2020.07. 03).

Кольский п-в_фото минералов_Bernard - новая страница

-- В.В. Борисова, А.В. Волошин. Перечень минеральных видов Кольского полуострова. Изд. 4-е, испр. и доп. / – Апатиты: К&М, 2010. – 64 с

Минералы Кольского п-ва от A до Z \\ 1168 минералов; 835 минер. видов; 255 новых видов; фото минералов - 22181.(1-е - адамсит-(Y), 101- бахчисарайцевит и т.д.) \\ Источник: http://www.mindat.org/loc-2666.html (на 2014.06.19) От Белого до Баренцева моря через Кольский полуостров.

Минералы Кольского п-ва от А до Я (по Борисовой В.В. и др., 2002 с доп.)

--Новые минералы---264 вида \\ Волошин А.В. , Пеков И.В., Борисова В.В. Минералы, впервые открытые в Кольском регионе: исторический обзор и статистические данные. - Минер. альманах. Т. 18, вып.2, 2013, с.107-123

Карелия \\ http://mindat.ru/locathn/r_karel.htm

- Атлас структур и текстур докембрийских вулканогенных пород Карелии \\ литература

- Шуньга, Карелия

Вост. Европа

Лабрадор. Рудня Воровская, Волынь, Украина. Образец: Минер. музей МГРИ-РГГРУ(Дар: Е.Б. Соловьев. Находка 1975 г.). Фото: А. Евсеев. "Фото дня" на сайте или "За месяц вокруг света"2021.07. 06

Сера. Водинское м-ние, Ср. Поволжье, Россия. Кристалл ~15 см. Образец: ФМ. Фото: © А.А. Евсеев. "Фото дня" на сайте или "За месяц вокруг света"2021.06. 06

Топаз с включениями флюорита. Володарск-Волынский, Украина. 14х16 см. Фото: © А.В. Свердлов. "Фото дня" на сайте или "За месяц вокруг света"2022.01. 06

Россия \ Russia \ минералы -2587 ;  новые минералы - 869; фото минералов -  13557 (2022.04)

ср. 2014. 06 : 3086 минералов \ 1959 минер. видов; 255 новых видов; фото минералов - 8561(1-е - абрамовит, 101- Allochalcoselite и т.д.) \\ Источник: http://www.mindat.org/loc-14409.html (на 2014.06.19)

Минералы России в фотографиях : http://www.mindat.org (примеры из 100 новых фотографий по https://www.mindat.org/gallery.php?loc=14409&pco=1)

Местонахождения минералов России на сайте К.И. Клопотова

Европейская часть России

Европ. часть России (север) \\ Тиман \\ Сев. Тиман--путешествия \\ путешествия-2009 \\ схема

Архангельская обл. Новгородская обл.

КМА \\ лизардит!--ЕК: 3.2512,1

Подмосковье, Россия и Москва

Гжель , Московская обл.

Центр Европ. части России

Крым

1. Анапаит. Мыс Железный Рог, Таманский п-ов, юг России. Образец: ФМ (№90799. Дар: Аристов В., 1988). Фото: © А.А. Евсеев. 2. Датолит. Трудолюбовский к-р, Крым, Россия. Образец и фото: Севастопольский музей камня. "Фото дня" на сайте или "За месяц вокруг света"2022.03. 06

Сев. Кавказ, Россия

Поволжье

Урал на сайте /www.mindat.org (на 2016.01.25) : минералов - 1057, твердых видов - 727 ; новых минер. видов (type locality) - 81

Пермский край, Россия \\ Геологические памятники - http://www.perm-kray.ru/index.htm

Полярный Урал, Россия \\ фото - http://polyarny.net/foto/

ПРИПОЛЯРНЫЙ УРАЛ \\ КЕММЕРИХ А. О.  ПРИПОЛЯРНЫЙ  УРАЛ. ПУТЕВОДИТЕЛЬ. ИЗДАТЕЛЬСТВО «ФИЗКУЛЬТУРА И СПОРТ». МОСКВА 1970 \ веб-публикация

СЕВЕРНЫЙ УРАЛ (64°00'—58°45' с. ш.)

--Минералы, названные в честь ученых, побывавших на Северном Урале - видео - www.youtube.comБлог Михаила Цыганко - http://zolotoy-kamen.ru

СРЕДНИЙ УРАЛ (58°45' — 56°00' с.ш.

ЮЖНЫЙ УРАЛ (56°00' — 51°00' с. ш.)

-Башкирия \\ Оренбургская обл. \\

Челябинская обл. \\ см. также http://webmineral.ru/deposits/item.php?id=60

«Минералы Южного Урала» - новая издание книги С. В. Колисниченко и др. (2022 г.)

Сибирь \ Сибирь в "Атласе мира для минералога". - Местонахождения минералов и примеры находок http://geo.web.ru/druza/L-AtE_Sib.htm \\

--Реутовский В.С. Полезные ископаемые Сибири. - СПб., 1905. - 874 с.: карта. Автор - инженер, редактор и издатель журнала "Вестник золотопромышленности и горного дела вообще" (Томск).

Дополнения к списку (Евсеев А.А. Минералогические находки. Краткий обзор. I. Сибирь. М., 2006. – 157 с. )

Зап. Сибирь

Ср. Сибирь

Красноярский край --Минеральные ресурсы Красноярского края. Кн. 2. Кадастр месторождений полезных ископаемых. — Красноярск, КНИИГиМС, 2002. С.359

Таймыр п-ов \\ Нижняя Тунгуска р

Железо самородное. Таймыр, Ср. Сибирь (С), Россия. Образец: Центральный Сибирский геологический музей (Рябов В.В). Фото: Д. Тонкачеев. 2022.08.02.

Якутия \\--663 фото минералов; 595 мин. видов. 57 новых видов \ 595 valid minerals. 57 (TL) - type locality of valid minerals (на 2019.09.12) \\ Источник: http://www.mindat.org/loc-2644.html- Минералы Якутии - на сайте К.И. Клопотова --Месторождения - http://www.atlas-yakutia.ru/depositmap.html

Алдан, Якутия

СВ России

--ГЕОЛОГИЯ И МИНЕРАЛЬНО-СЫРЬЕВЫЕ РЕСУРСЫ СЕВЕРО-ВОСТОКА РОССИИ Материалы всероссийской научно-практической конференции 1-3 апреля 2014 г. Якутск 2014. - http://www.diamond.ysn.ru/content/VNPK_Yakutsk_2014.pdf

Магаданская обл. \\ Чукотка, Россия (СВ)

"Фото дня" на сайте или "За месяц вокруг света". 2022.11. 09

Циркон. Округлые зерна из кимберлитов. Якутия, Россия. Образец:ФМ (№64355). Фото: © А.А. Евсеев.

"Фото дня" на сайте или "За месяц вокруг света". 2022.11. 10

Цианотрихит, сод. Se. Невское м-ние, Омсукчанский р-н, Магаданская обл., Россия. Образец: ФМ (№60084, Годовиков А.А., 1958). Фото: © А.А. Евсеев. \

"Фото дня" на сайте или "За месяц вокруг света". 2022.11. 11

Гранаты ряда шеферит - берцелиит, свабит на корке ангидрита. Фумарола Арсенатная, вулк. Толбачик, Камчатка, Россия. Образец более 10 см. ФМ. А.А. Агаханов, И.В. Пеков с коллегами, 2020 г. Фото: А. Евсеев.

Камчатка \\ Камчатский край \ Kamchatka KraiRussia \\ минералы -  539; новые минералы - 152 ; фото минералов – 603 \\ Источник: https://www.mindat.org/loc-2651.html (2020.12.14)

Корякия \\ Куфарит   KUFAHRITE PtPb   Гекс. - новый минерал с Корякского нагорья \\ ФМ (№ 97126. Оригинал исследования нового минерала Ручей Ледяной, Корякское нагорье, Камчатский край, Россия.  Оригинал исследования. Сидоров Е.Г. 2020 г.)

Курильские о-ва

Толбачик (= Толбачинский) (Tolbachinskii) вулкан, к ЮЗ от Ключевской Сопки, Камчатка \ Tolbachik volcano, Kamchatka KraiRussia - https://www.mindat.org/loc-5602.html - 55° 49' 59'' North , 160° 19' 59'' East; 501\ 528 фото минералов; 232 \ 260 минералов valid minerals; 123 \ 129 новых минералов  (TL) - type locality of valid minerals. (2019.09.03 \ 2020.05.06)

Дальний Восток

Дальний Восток (Россия) литература по геологии и пол. ископ. (в алфавите авторов) - http://wiki.fegi.ru/index.php/Амур р.

--Новые и редкие минералы Дальнего Востока. - Владивосток: ДВО АН СССР, 1987. - 128 с.

Амурская обл., Россия

Приморье, Россия

Сахалин \\ фото - http://fotocult.ru/gallery/

Хабаровский край и Еврейская АО, Россия

Юг Сибири

Вокзал. Новосибирск, Россия. 2022.08.02. Фото: Д. Тонкачеев

Вход в Центральный Сибирский геологический музей. Новосибирск, Россия. 2022.08.02. Фото: Д. Тонкачеев

Карта "Полезные ископаемые Сибири и Дальнего Востока" . Центральный Сибирский геологический музей. Новосибирск, Россия. 2022.08.02. Фото: Д. Тонкачеев

Карта "Месторождения цветного камня Сибири". Центральный Сибирский геологический музей. Новосибирск, Россия. 2022.08.02. Фото: Д. Тонкачеев

 

Алтай, Россия \ Казахстан Горный Алтай

Восточная Сибирь

Забайкалье, Россия \\ фото - http://www.crystallika.com.postman.ru/

Забайкалье_местонахождения

--ОПИСАНИЕ МЕСТОРОЖДЕНИЙ ЗАБАЙКАЛЬЯ [А.Е. Ферсман]

- Юргенсон Г. А. Ювелирные и поделочные камни Забайкалья. Новосибирск: Наука, 2001. - 390 с.

Тунгстит. Читинская обл., Забайкалье, Россия. Образец: Центральный Сибирский геологический музей (Рипп Г.С.). Новосибирск, Россия. 2022.08.02. Фото: Д. Тонкачеев

 

Бурятия \ на карте 1 \ на карте

Иркутская обл.

Кемеровская обл. и Горная Шория

Красноярский край \\ минеральные ресурсы - http://nature.krasn.ru/content.ph

Прибайкалье

Саяны и Присаянье \\

Тува

Хакасия

--ЛИТЕРАТУРА О РЕСПУБЛИКЕ ХАКАСИЯ Библиографический указатель Том 1 Природа и природные ресурсы Хакасии, их охрана и рациональное использование (2-я половина XIX-XX в.)  - http://www.nbdrx.ru/razdeli/resursi/izd/bibukazatel/bib_ukazatel1.pdf

 

Зарубежные страны

Атлантика

Исландия

Европа

 

 

З а п. Е в р о п а

Европа (СЗ) \\ Скандинавия

Норвегия \\ Швеция \\ Финляндия

Британ. о-ва, Пиренейский п-в \\ Ирландия \\ Корнуолл, Англия- халькозин !!! \ chalcocite. Из колл. Британского музея (#21235 (1975))--фото

Испания \ Spain \ http://www.mindat.org/loc-5536.html - 19066 \ 17176 фото минералов ; 1158 \ 1049 минералов valid minerals. 36 \ 33 (TL) - новых минералов \ type locality of valid minerals (на 2021.09 \ 2019.06)

Австрия \\ Австрия \ карта и минералогические находки

Альпы \\ Альпы_карты для минералогов \\ The Alps, Europe - 1504 valid minerals. 224 (TL) - type locality of valid minerals; 4336 фото минералов - https://www.mindat.org/loc-292987.html.\\ От Acanthite до Zoisite (TL) \\ (2018.11.18)

Разнообразие минералов (Альпы) в базе данных  www.mindat.org:  минералы \ valid minerals - 1597; (TL) - новые минералы \ type locality of valid minerals - 238 ; фото минералов -  49302 (на 2021.01.13)  

--Gramaccioli, C.M. Minerali Alpini e Prealpini. Vol.1-2. Bergamo, 1975. - 473.

Бавария, Германия \\ Баден-Вюртемберг, Германия

Балканский п-ов

Бельгия \\

Болгария \\

Венгрия

Германия \\ фото минералов \\ http://www.mindat.org/rloc.php?loc=Germany \\ http://www.mindat.org/loc-14244.html

- минералы - 1813; новые минералы - 371 ; фото минералов – 35972 \\ 2020.10.25 \\ Источник: https://www.mindat.org/loc-14244.html

Греция \ Greece - https://www.mindat.org/loc-14188.html - минералов - 955 \ 807 (из них 44 \ 37 новых видов) \\ 7621 \ 5775фото минералов (2021.09 \ 2018.06)

--Stamatakis, M.G., Hall, A., and Hein, J.R. (1996) The zeolite deposits of Greece. Mineralium Deposita, 31, 473-481. \ цеолитовые м-ния --Voudouris, P., Katerinopoulos, A., and Melfos, V. (2004) Alpine type fissure minerals in Greece. Doc. Natur. 151, 23-45. \\ Минералы альпийских трещин

Италия \ Italy. \\ в www.mindat.org \\55470 \ 48988 фото минералов ; 1772 \ 1671 мин. видов \ valid minerals; 385 \ 358 новых минералов \\ на 2021.09\ 2019.03 \\

--- кварц (горный хрусталь) --фото -- Selvino, Bergamo Province, Lombardy, Italy

Италия в www.mindat.org

минералы -1748

новые минералы - 379

фото минералов - 52343

на 2020.07.06

Италия в www.mindat.org

минералы -1730

новые минералы - 376

фото минералов - 50899

на 2020.03.10

Италия в www.mindat.org

минералы -1697

новые минералы - 364

фото минералов - 49474

на 2019.07.18

Италия -- http://www.mindat.org :

--Новые минералы, открытые в Италии \\ Marco E. Ciriotti, Lorenza Fascia, Marco Pasero. Italian Type Minerals. Pisa: Plus-Pisa university press, 2009, 357 pp. \\ О книге (А. Касаткин) - http://www.minbook.com/new_books_ru.html

Пьемонт, Сев. Италия - Валь д`Ала (Ала = долина Ала = Валь-ди-Ала = Ала-Таль), к СЗ от Турина, Пьемонт, Сев. Италия \\ везувиан!!; гроссуляр (гессонит)!!!; диопсид!!; титанит!!--xls; Gr, 368-369 \\ на карте1 \ карте2--- Piccoli G.C., Maletto G., Bosio P., Lombardo B. Minerali del Piemonte e della Valle d'Aosta. Associazione Amici del Museo "F. Eusebio" Alba, Ed., Alba (Cuneo), 2007. - 607 pp.

Сардиния \\ Сицилия \\ Тоскана

Карпаты \\

- "MINERALS OF THE CARPATHIANS", Edited by S. Szakall, 480 p. in English. Praha, 2002. \\ Фото минералов (примеры): антимонит!! --Бая-Сприе (с.179); вавеллит!--Венгрия (с.301); гематит--Догнеча (с.204); джемсонит--Herja(с.159); золото!!--Rosia Mont.(с.126); кварц!!--Кавник(с.216); меллит!!--Чордакут(с.375); родохрозит!!--Кавник(с.245); целестин-Махув (с.261); эвхроит--Любьетова (с.289); шабазит!!--Магловец (с.316)

Македония \\

Польша

- Pieczka, A., Biagioni, C., Golebiowska, B., Jelen, P., Pasero, M., & Sitarz, M. (2018) Parafiniukite, Ca2Mn3(PO4)3Cl, a New Member of the Apatite Supergroup from the Szklary Pegmatite, Lower Silesia, Poland: Description and Crystal Structure. Minerals: 8(11): 485. \ Парафинюкит - новый минерал

Румыния \ Romania \\ 7053 фото минералов (=фд) - https://www.mindat.org/loc-14254.html; 747 минер. видов \ valid minerals; 35 новых минералов (TL) - type locality (2019.07.18)

Сербия \\

Словакия

Словения

Франция--Mineralogie de la France by Eric Asselborn, 2013. 242 pages.

Чехия \ Czech Republic

- Яхимов, Карловы Вары, Карловарский край, Чехия \ Jachymov, Karlovy Vary District, Karlovy Vary Region, Czech Republic \\ минералы -362 ;  новые минералы - 52; фото минералов - 769 (2021.12)

Швейцария \\

Средиземноморье

Вост. Европа

Белоруссия

Прибалтика

Украина

-- Местонахождения минералов Украины от А до Я

Украинский щит - геологические памятники - Google Maps

Волынь и СЗ Украина

Донбасс \ - Ликов О.И. Везувиан из скарнов с. Миколаiвки (ЮЗ окраина Донбасса). - Мат. з мiн Укр.. в.2, 1961, 112-115 \\ ЕК_3.1415

Приазовье \\ Прикарпатье \\ Закарпатье

Молдавия

Евразия

- Средиземноморье

Азия

Казахстан и Средняя Азия

Казахстан и Средняя Азия_А-Я_местонахождения минералов (на карте)

Кальцит. Сталагмит "Гриб".Хайдаркан, Киргизия. 30х15 см. Находка 1980 г. Образец:В.А. Пелепенко. Фото: © А.А. Евсеев. "Фото дня" на сайте или "За месяц вокруг света"2022.08. 14.

Малахит (сферокристаллы до 4 см). Джезказган, Казахстан. Образец: ФМ . Кол.: В.И. Степанов (Дар: Худодян К., 1972). Фото: © А.А. Евсеев. "Фото дня" на сайте или "За месяц вокруг света". 2022.10. 14

 

Казахстан \\ Мангышлак \\ Восточный Казахстан

Средняя Азия \\Киргизия \ Путешествие вокруг Иссык-Куля, Киргизия, август 2019 г. (фото Е. Матвиенко).

Таджикистан \\ Памир \ Карамазар рудный район, Сев. Таджикистан: Адрасман (Adrasman) --Алтын-Топкан--Кансай --Кураминский хр

Туркмения \\ Узбекистан- Челекен, Туркмения \\ Афганистан \ Afghanistan - http://www.mindat.org/ \\ Пакистан

Кавказ, ЮЗ Азия

Азербайджан \\ Армения

Грузия

Ближний Восток \\ Хатрурим. формация \\ Hatrurim Formation , Ближний Восток \ "Hatrurim Formation" is often used as a locality name, but it is really a geological unit, outcropping at many localities, spread over three countries. - https://www.mindat.org/loc-2063.html

Израиль \\ Иордания \

Индия \ India \\ минералы - 596 ; новые минералы -  22; фото минералов – 6329 (на 2021.08.17) -- примеры из списка минералов Индии - https://www.mindat.org : аваруит \ Awaruite ; апофиллит!!! (группа)- 436 фото; идаит; окенит!! - 229 фото; улексит; эвдиалит; югаваралит!! \ Yugawaralite ; ярроуит \ Yarrowite

Иран \\

Йемен, Аравийский п-ов \\ Оман \\ Саудовская Аравия

Турция \ Turkey \\ минералы и местонахождения--см. http://www.mineralienatlas.de \\ Ryan C. W. Guide to the Known Minerals of Turkey. Ankara, 1960, 196 p.

- Новые минералы, открытые на территории Турции: альмандин* \ Almandine (TL) ; Chantalite (TL) ; Defernite (TL) ; Ephesite (TL) \ эфесит ; Eugsterite (TL); Fontarnauite (TL) ; Konyaite (TL) ; Liebigite (TL); Partheite (TL); Tertschite (TL) ; Trabzonite (TL) ; Vuagnatite (TL); Yazganite (TL)

Индия, Непал, Шри-Ланка

ИНДИЯ  \ India \\ минералы - 596 ; новые минералы -  22; фото минералов – 6329 (на 2021.08.17)

НЕПАЛ \ Nepal \\ Разнообразие минералов в базе данных  www.mindat.org:  минералы \ valid minerals - 71; (TL) - новые минералы \ type locality of valid minerals - 0 ; фото минералов - 387 (на 2021.04.26) \\ гамбергит!--фото; дравит!!--46 фото; рубин!; сапфир! ; эльбаит! - Hyakule, Sankhuwasabha District, Province No. 1, Nepal

Индонезия \\Шри-Ланка \\ Вост. Азия ( Китай и др.)

Китай \ China \\ www.mindat.org

Китай в https://www.mindat.org

минералы - 1331

новые минералы - 134

фото минералов - 15591

на 2019.07.11

- из [новых] фото минералов Китая на https://www.mindat.org  (2020.10.25) - флюорит - ФОТО - Piaotang Mine, Xihuashan ore field, Dayu Co., Ganzhou, Jiangxi, China

Названия минералов и местонахождений Китая

Китай_географические названия \\ Особенности при переходе от английского варианта к русской транскрипции \\ несколько примеров (от атласа Encarta-2001 к "Атласу мира". М., 1997)

Внутр. Монголия

Гуанси-Чжуанский авт. р-н, Китай

Сычуань пров. новые минералы - 6 видов (на 2020.09) \\  www.mindat.org

Тибет , Китай

Хунань, провинция, Китай - http://www.mindat.org/loc-705.html

Юньнань \ Yunnan \\ www.mindat.org \\ Флюорит_Китай и Монголия

Вьетнам

Корейский п-ов

- Янгунит \ Janggunite Mn5-x(Mn,Fe)1+xO8(OH)6 https://www.mindat.org/min-2073.html

-  Janggun mine, Bonghwa County, North Gyeongsang Province, South Korea - первоначальное местонахождение \ Type Locality \\ Kim, S.J. (1977) Janggunite, a new manganese hydroxide mineral from the Janggun mine, Bonghwa, Korea. Mineralogical Magazine: 41: 519-523.

Индонезия - см. http://www.mineralienatlas.de/ \\ Камбоджа \\ Лаос\

Малайзия

Монголия

Мьянма (быв. Бирма)

Таиланд \\ Флюорит!!--инкрустирует (!) кристаллы антимонита; м-ние не указано--фото--www.mindat.org \\ Unnamed quarry, Chiang Mai Province, Thailand Филиппины \\

ЮВ Азия.

Япония \\ http://www.petrovrareminerals.com/articles02.html \\ http://www.mindat.org/loc-14488.htm

Африка

Африка_Местонахождения минералов от А до Я (примеры) \\ новое на сайте!

Сев. Африка и Зап. Африка

Алжир \\

Сервантит. Айн-Керма, Алжир. Образец: ФМ (№74004. Bureau de Recherches Geologiques et Minieres, 1971) . Фото: © А.А. Евсеев.

Гана \\

Гвинея

Египет \\ Мали

Марокко

Марокко в www.mindat.org

минералы - 534

новые минералы - 28

фото минералов - 10159

на 2019.07.18

 

 

Нигерия: Ferronigerite-2N1S (TL) \\ Liebermannite (TL) \\ Zagamiite (TL)

Нигерия в www.mindat.org

минералы - 141

новые минералы - 3

фото минералов - 192

на 2019.07.10

 

 

Экв. и Южн. Африка

Ангола \\ Ботсвана \\ Габон \\ Замбия \ Zambia (ныне) = Сев. Родезия (быв.), Африка

Зимбабве \ Zimbabwe \\ фото: бикитаит*--7; борнит!! - 3 (xl>7 см) ; хризоберилл!! - 10; александрит!! - 26; эвклаз!!--40; кермезит!!-14; кианит!--8; топаз--26; зимбабвеит* - 4

Камерун

Камерун в www.mindat.org

минералы - 91

новые минералы - 2

фото минералов - 18

на 2019.07.10

 

 

Конго НР

Конго ДР \ Демократическая Республика Конго ( ДР КОНГО (быв. Заир) \ DR Congo \

Конго ДР в www.mindat.org

минералы - 442

новые минералы - 101

фото минералов - 4511

на 2020.12.11

--Buttgenbach H. Mineraux de Belgique et du Congo Belge. Liege, 1947, 590 p.-

Гетерогенит (черный), хризоколла. Лубумбаши, ДР Конго. Более 20 см. Образец: Минер. музей им. А.Е. Ферсмана РАН (№93524. Дар: Камзолкин Н.Н., Попов А.В., 2011) . Фото: © А. Евсеев. \\

 

 

Катанга пров., ДР Конго \\ Катанга (фр. Katanga) — провинция Демократической Республики Конго. (до 2015 г.) \\ Источник - https://ru.wikipedia.org/wiki/Катанга_(провинция) \\ см. на карте 1 - 2 - 3 - 4 \\  С 1971 по 1997 год официально называлась провинция Шаба . \\ В 2015 году провинция Катанга была упразднена, территория разделена между Танганьикой, Верхним Ломами, Луалабой и Верхней Катангой. \\ Источник (2018): https://ru.wikipedia.org/wiki/Катанга_(провинция)

--Выдающиеся находки минералов урана - ванденбрандеит \ Vandenbrandeite Cu(UO2)(OH)4; кюрит*\ Curite Pb3(UO2)8O8(OH)6·3H2O; кубические кристаллы уранинита, псевдоморфозы по ураниниту; сенжьерит!! \ Sengierite (TL)

Намибия \ Namibia

- von Bezing, L., Bode, R., Jahn, S. (2016) Namibia Minerals and Localities II. Edition Kruger-Stiftung, Bode Verlag GmbH, Salzhemmendorf, Germany, 661 pages (in English).

Намибия в www.mindat.org

минералы - 783

новые минералы - 108

фото минералов - 14729

на 2019.07.30

Разнообразие минералов Намибии в базе данных www.mindat.org:  минералы \ valid minerals - 823;   (TL) - новые минералы \type locality of valid minerals - 108; фото минералов- 15980 (на 2020.12.23) \\ примеры:

ЮАР

Южная Африка \\ www.mindat.org \\ Разнообразие минералов в базе данных  www.mindat.org:  минералы \ valid minerals - 927; (TL) - новые минералы \ type locality of valid minerals - 78; фото минералов -  5735 (на 2020.12.24)  

Вост. Африка \\ Бурунди \\ Кения

 

Мадагаскар \\ 369 достоверных вида, 17 новых видов и 3341 фото минералов на 2019.07..12

- Bosi, F., Celata, B., Skogby, H., Halenius, U., Tempesta, G., Ciriotti, M.E., Bittarello, E., Marengo, A. (2021): Mn-bearing purplish-red tourmaline from the Anjanabonoina pegmatite, Madagascar. Mineralogical Magazine: 85(2): 242-253.

Малави \\

Мозамбик \

Руанда \\ минералы - http://www.mindat.org/loc-21896.html \\ местонахождения - http://www.mindat.org/rloc.php?loc=Rwanda

Сомали \\ Судан

Танзания \\ http://www.mindat.org/loc-4384.html \\ м-н-ния - http://www.mindat.org/ \\ Танзания-2017_поездка минералогов --https://www.mineralatlas.eu/?l=11358

 

 

Уганда \ Эфиопия

Австралия

Австралия и Новая Зеландия--АВСТРАЛИЯ и НОВ. ЗЕЛАНДИЯ. Местонахождения минералов от А до Я (примеры)

Австралия в www.mindat.org

минералы - 1485

новые минералы - 182

фото минералов - 14267

на 2021.01.12

Новая Зеландия в www.mindat.org

минералы - 455

новые минералы - 13

фото минералов - 1687

на 2019.07.12

--Sutherland, F.L., Webb, G. (2014) Gemstones & Minerals of Australia. Reed New Holland, Chatswood, NSW, 144 pages and maps.

Виктория, Австралия \ https://www.mindat.org/loc-195.html: 401 достовер. минерал. видов \ valid minerals. 18 (TL) - новых видов \ type locality of valid minerals.(2019.12), в том числе - бетпакдалит-FeFe* \ Betpakdalite-FeFe (TL); уайчпруфит (по КМС) \ Wycheproofite (TL)

Западная Австралия \ Western Australia \\ https://www.mindat.org/loc-15624.html \\ колорадоит!!-2фд--Калгурли

 

Калгурли \ Kalgoorlie, Зап. Австралия \\ алтаит; золото!; калаверит; колорадоит!; креннерит; петцит; роскоэлит; сильванит; теллуриды (Au)!!; * тиванит; * (1979) томичит

Карр Бойд р-к (Ni), 80 км к ССВ от Калгурли \ Carr Boyd Rocks Ni mine (Carr Boyd Ni mine), Goongarrie, Kalgoorlie-Boulder City, Goldfields-Esperance region, Western Australia; 30°4'0"S , 121°37'45"E \\ Источник: http://www.mindat.org/loc-219.html

Квинсленд

Новый Южный Уэльс \Лабрадор!!--Hogarth Range labradorite, Mummulgum, Rous Co., New South Wales, Australia --фото (бесцветные обломки до 4 см; из выветрелых базальтов)

 

Северная территория \\

Тасмания, Австалия \ Tasmania, Australia \\ https://www.mindat.org/loc-15621.html \\ 2433 \ 2572 фото минералов, из них - касситерит-64 \ 64; крокоит - 590\ 619 \\ разнообразте - 486 \ 529 достоверных минерала \ valid minerals; 11\11 (TL) - новых видов \ type locality of valid minerals \\ (2018.05.02 \ 2020.11.25).

Южная Австралия

Новая Зеландия \ New Zealand \\ Разнообразие минералов в базе данных  www.mindat.org:  минералы \ valid minerals - 476; (TL) - новые минералы \ type locality of valid minerals - 14; фото минералов - 2756 (на 2022.01.20) \\ примеры: .. канкринит;. ..оффретит; окенит... ранкинит ... тюямунит ... югаваралит \\ 1406 min. loc.\ м-н-ний --New Zealand \ Нов. Зеландия --mindat-2019.05

Восточное полушарие

- Восточное полушарие (примеры минералогических находок)

Южное полушарие

Западное полушарие

Северная Америка \ Сев. Америка--фото минералов

Гренландия

Гренландия в https://www.mindat.org \\  минералы - 497;  новые минералы - 86; фото минералов - 1122 (2022.06.05)

--Petersen, O. V. & Johnsen, O. (2005): Mineral species first described from Greenland. Canadian Mineralogist, Special publication no. 8., 184p.

Скалистые горы \ Rocky Mountains, Канада \ США

Скалистые горы, Сев. Америка \ Rocky Mountains, North America \\ https://www.mindat.org/loc-301977.html \\ 1072 valid minerals. 768 (TL) - type locality of valid minerals \\ фото минералов - 10053 \\ 10 примеров: Abernathyite \\ Azurite \\ Dachiardite-Na \\ Dzharkenite \\ Mackayite \\ Muscovite\\ Tacharanite \\ Tyuyamunite ! \\ Zalesiite \\ Zwieselite (2020. 03)

 

Канада

Минералы Канады на странице https://www.mindat.org/loc-8188.html (на 2019.01.05 \ 2020.09.10): 1628 \ 1679 минеральных видов \ valid minerals; 247 \ 256 новых видов ; 21133 \ 22646 фото минералов

-- Трейл Р. Дж. Каталог минералов Канады. \ Trail R. J. Catalogue of Canadian Minerals. Revised 1980. Geol. Surv. of Canada Paper 80-18, 1983, 483 p.

США \\ http://www.mineralienatlas.de/lexikon/index.php/USA

США в https://www.mindat.org

минералы - 2645

новые минералы - 831

 

на 2019.05.10

American Mineral Treasures [Сокровища минералов Америки]. 2008. - 368 p. \\ Подробнее: http://www.lithographie.org/bookshop/hc_american_mineral_treasures.htm \\ см. также http://geo.web.ru/druza/l-USA_AMT.htmНовые минералы - 830 видов (2019.01.15). Источник: https://www.mindat.org/loc-3366.htmlТопографическая минералогия ( литература о местонахождениях по штатам) \\ http://www.minsocam.org/

Минералы США в фотографиях на https://www.mindat.org/loc-3366.html -  129046 фото минералов на 2020.10.25

Новейшие фото - Морденит\ MordeniteMagnesio-hornblende \ San Marcial Quarry, Socorro Co., New Mexico, USA \\ (микро)

Старейшие фото - Пирит - \ Little Butte Ore Mine, Butte-Silver Bow, Montana, USA \\ 2, 3 см Самые просматриваемые \ most viewed - фото - Галенит \ Baxter Springs, Picher Field, Cherokee Co., Kansas, USA \\ 11х8 см Совсем недавно просмотренные \ most recently viewed - фото - кальцит - Berry Materials Corp. Quarry, North Vernon, Jennings Co., Indiana, USA

Сев. Америка (С)

Аляска \\ Нунавут \\

Северо-Западные территории \ North-West Territories, Канада

Юкон

Сев. Америка (В)

Сев. Америка (В)_находки крупных кристаллов (10 см и более)

Айова \\ Арканзас, США \\

Вермонт \\ Верхнее оз \\

Виргиния, США \ Virginia, USA \\ минералы - 430;  новые минералы - 3; фото минералов -  1223 (2021.12)

Висконсин \\

Джорджия \\ Иллинойс \\ Индиана, США \\ http://www.mindat.org/loc-16287.html \\ более 100 фото минералов из осадочных пород (доломит, миллерит!!; целестин!; флюорит! и др.) www.mindat.org/gallery

Канзас \ Kansas, USA \\ минералы - 126; новые минералы - 4 ; фото минералов 356 (2020.12. 08)

- Baxter Springs, Picher FieldCherokee Co.KansasUSA

Квебек \\ Кентукки, США. \\ Коннектикут \\

Манитоба пров., Канада - https://www.mindat.org/loc-20365.html \\ минералы - 300 видов; новые минералы -12 видов (бобфегусонит; воджинит; манитобаит; танкоит; черниит и др. ); фото минералов -424 \\ на 2019.05

Массачусетс \\ Миннесота \\ Миссури \\ Мичиган \\ Мэн

Мэриленд, США

Новая Шотландия, Канада \\ Нью-Брансуик пров., Канада\ New Brunswick \\ Нью-Гэмпшир, США \\ Нью-Джерси, США - http://www.mindat.org Нью-Йорк \\ Огайо \\

Оклахома

Онтарио\ Ontario, Канада

Сев. Каролина \\ Теннесси \\ Техас \\ Флорида

Сев. Америка (З)

  • Невада \ NevadaUSA
  • минералы - 927 
  • новые минералы - 51
  • фото минералов - 6444
  • на 2022.11.16
  • Юта \ UtahUSA
  • минералы - 842 
  • новые минералы - 123 
  • фото минералов - 9028
  • на 2021.12
  • Колорадо \ ColoradUSA
  • минералы - 889 
  • новые минералы - 95
  • фото минералов - 8241
  • на 2021.12
  • Калифорния \ CaliforniaUSA
  • минералы - 1083 
  • новые минералы - 151 
  • фото минералов - 13213
  • на 2022.11.16
  • Аризона \ ArizonaUSA
  • минералы - 932 
  • новые минералы - 95 
  • фото минералов - 19542
  • на 2021.12
  • Нью-Мексико \ New MexicoUSA
  • минералы - 720 
  • новые минералы - 18 
  • фото минералов - 8476
  • на 2021.12

Разнообразие минералов западных штатов США (примеры) . Источник: https://www.mindat.org

Айдахо, США \\ Альберта, Канада

Аризона, США \\ на странице http://www.mindat.org/loc-3293.html \\ в сводке Anthony J.W. et al, 1995 --809 мнр. видов, из них 76 новых видов \\ Anthony, J.W., et al (1995), Mineralogy of Arizona, 3rd.ed.:

Аризона, в www.mindat.org

минералы - 932

новые минералы - 95

фото минералов - 19671

на 2022.01.31

Вайоминг, США

Квебек, Канада

Колорадо \\ http://www.mindat.org

Колорадо шт. в https://www.mindat.org

минералы - 877

новые минералы - 84

фото минералов - 6996

на 2019.07.12

Из новых фото минералов Колорадо на https://www.mindat.org (2020.10.25) : калаверит (кристалл 2 мм) - ФОТО - Cresson Mine, Eclipse Gulch, Cripple Creek Mining District, Teller Co., Colorado, USA

Манитоба, Канада \\ Монтана \\ Невада \\

Нью-Мексико, США

Нью-Мексико в www.mindat.org

минералы - 709

новые минералы - 17

фото минералов - 6752

на 2019.07.17

Саскачеван, Канада \\ Техас, США \\ Южная Дакота, США \\ Юта, США \ Utah , USA

Юта в www.mindat.org

минералы - 813

новые минералы - 113

фото минералов - 7817

на 2019.08.25

Юта в www.mindat.org

минералы - 832

новые минералы - 119

фото минералов - 8670

на 2021.04.25

- Редканьонит Redcanyonite - новый минерал \\ Olds, T.A., Plasil, J., Kampf, A.R., Burns, P.C., Nash, B.P., Marty, J., Rose, T.P., Carlson, S.M. (2018): Redcanyonite, (NH4)2Mn[(UO2)4O4(SO4)2](H2O)4, a new zippeite group mineral from the Blue Lizard Mine, San Juan County, Utah, USA. Mineralogical Magazine, 82 (6): 1261-1275

Сев. Америка (Кордильеры)

Британская Колумбия в https://www.mindat.org

минералы - 510

новые минералы - 24

фото минералов - 1071

на 2019.07.13

Вашингтон, США \\ Cannon, B. (1975): Minerals of Washington: 53. Аметист!! \\

--- Denny Mountain, King Co., Washington, USA --фото и ещё более 30 фото Орегон

Калифорния, США \\ http://www.mindat.org/loc-3424.html \\ фото \\ Калифорния_минералы по контуру

Калифорния в www.mindat.org

минералы - 1068

новые минералы - 150

фото минералов - 10851

на 2019.08.07

Нью-Мексико в www.mindat.org

минералы - 710

новые минералы - 17

фото минералов - 6785

на 2019.08.07

Мексика

Касситерит ("деревянистое олово"). Дуранго шт., Мексика. Образец: Минер. музей МГРИ-РГГРУ (Р-1525. Евсеев. Поступление 2012.12). Фото \ карта : © А.А. Евсеев. "Фото дня" на сайте или "За месяц вокруг света". 2022.09. 27

Малахит. Милпильяс р-к, Сонора, Мексика \ Milpillas Mine, Cuitaca, Mun. de Santa Cruz, Sonora . Образец: Тусон-шоу-2015. Фото: © И. Лыкова. "Фото дня" на сайте или "За месяц вокруг света". 2022.05. 27\\ Подробнее  www.mindat.org/

Центральная Америка \\ Куба

Южная Америка

Ю. Америка (СЗ)

Венесуэла \\ Гайана \ Guyana (до 1966 г. - Британская Гвиана) \\ Гондурас \\Колумбия \\ Эквадор

Аргентина - www.mindat.org

Аргентина в www.mindat.org

минералы - 750

новые минералы - 53

фото минералов - 2464

на 2019.07.10

Магнетит, замещенный гематитом (псевдоморфоза по скелетному кристаллу магнетита). [Паюн-Матру, вулк.], Патагония, Аргентина. 9 см. Образец:ФМ. Фото: Н. Пекова. Источник: www.fmm.ru . "Фото дня" на сайте или "За месяц вокруг света". 2022.10. 29.

Халцедон. Псевдоморфоза по шишкам араукарии. [Cerro Cuadrado], Аргентина. Образец: ФМ. Фото: © А.А. Евсеев. "Фото дня" на сайте или "За месяц вокруг света". 2020.07. 29

Боливия

Перу

Перу в www.mindat.org

минералы - 378

новые минералы - 29

фото минералов - 5133

на 2019.07.12

Чили

Чили \ Chilehttps://www.mindat.org/loc-638.html  \\ фото минералов -3908 \  минералы \valid minerals -741 ; новые минералы \ type locality of valid minerals -141 (TL) (на 2020.04.29)

Бразилия \\ минералы \ достоверные виды - 601 \ 854; новые виды - 51 \ 77; местонахождения \ localities - 843 \ ... ; фото минер. – 5430 \ 6613; фото мест – 74 \ 890 (на 2009.08.05 \ 2020.09.19) \\ Источник: http://www.mindat.org/loc-366.html \\ http://www.mindat.org/rloc.php?loc=Brazi

Баия, Бразилия- Carnaiba mining district, Pindobacu, Bahia, Brazil

Сложный двойник полупрозрачного магнезита размером 5-6см. Brumado Mine, Bahia, Brazil. Образец: Тусон-шоу-2009. Фото: © "Русские минералы". "Фото дня" на сайте или "За месяц вокруг света". 2022.10. 30.

Спессартин. Навегадора р-к \ Navegadora Mine, Минас-Жерайс, Бразилия. 39х35х33 мм. Образец и фото: © О. Лопаткин. Подробнее: http://www.pegmatite.ru . "Фото дня" на сайте или "За месяц вокруг света". 2018.07.30

 

Минас-Жерайс шт. \\ минералов - 713, из них твердых видов - 491, из них новых видов - 46 (на 2015.09. 30) \\ источник: http://www.mindat.org.

 

Капелинья р-к \ Capelinha, ~110 км к ЗСЗ от Теофилу-Отони, Минас-Жерайс, Бразилия \\ альбит!--ф; кварц--ф; ?кианит!!; периклин!--ф; титанит!! --зеленый (Gui-72); топаз!--ф; эвклаз!--ф; эпидот!! (MR, 1999, 51) \\ подробнее - www.mindat.org

- Bartorelli A., Cornejo C., Chavex M.L.S.C., Dias C.H. and Romano A.W. (2022) Capelinha: Titanite and epidote deposits of the Capelinha Region, Minas Gerais , Brazil: Mineralogical Record v. 53, no. 3, pp 315-370

- Капелинья и соседние местонахождения минералов штата Минас-Жерайс (Бразилия). Карта района . Составил : А Евсеев, 2015.02.02 \\ НМК-127

Жакупиранга р-к, Сан-Паулу, Бразилия

- Menezes, L.A., Martins, J.M. (1984) The Jacupiranga mine, Sao Paulo (Brazil). Mineralogical Record: 15(5):261-270.

Параиба \\

Риу-Гранди-ду-Норти, Бразилия \\

Риу-Гранди-ду-Сул, Бразилия \\

Сан-Паулу

Уругвай

АНТАРКТИДА \\

Антарктида в www.mindat.org

минералы - 378

новые минералы - 17

фото минералов - 101

на 2022.01.04

Вокруг Антарктиды (прилегающие территории)_минералогические находки

Океаны

Атлантический океан

Индийский океан

Индийский океан и прилегающие территории. Местонахождения минералов (примеры). Карта. Составил А. Евсеев. \ k-32_Ind-oc_20-03-12_loc.jpg

Тихий океан

Полушария

Местонахождения минералов на карте мира (30х30). Северное полушарие.

Южное полушарие (ТЕКСТ)- tx18-31.htm \\ Карта и минер. находки - k-33S.htm \\ l-sfer_S.htm \\ 33_S_MN.htm

Весь мир \

Вокруг света. Минералогические находки (примеры)

 

Меридианы

Меридианы 32° - 38° в.д. Европа \ Азия \ Африка. Минералогические находки \ местонахождения минералов (примеры). Карта. Составил: А. Евсеев, 2022.11 \\

Параллели

 

***

. Из фото дня или "За месяц вокруг света"Январь 2021 г. 

Фото дня или "За месяц вокруг света" - \\ 2021.01 \\ 2020.12 \\ 2020.11 - 2020.10 - 2020.09 - 2020.08 - 2020. 07 - 2020. 06 - 2020. 05 - 2020. 04 - 2020. 03 - 2020. 02 - 2020. 01 \\ 2019.12 - 2019.11 - 2019.10 - 2019.09 - 2019.08 - 2019.07 - 2019.06 - 2019.05 - 2019.04 - 2019.03 - 2019.02 - 2019.01 \\ 2018.12 - 2018.11 - 2018.10 - 2018.09 - 2018.08 - 2018.07 - 2018.06 - 2018.05 - 2018.04 - 2018.03 - 2018.02 - 2018.01 \\ 2017.12 - 2017.11 - 2017.10 - 2017.09 - 2017.08 -  2017.07 - 2017.06 - 2017.05 - 2017.04 - 2017.03  - 2017.02  - 2017.01  \\ 2016.12- 2016.11- 2016.10 - 2016.09 - 2016.08 - 2016.07 - 2016.06 - 2016.05 -2016.04 -2016.03 - 2016.02 - 2016.01 - 2015.12 - 2015.11 - 2015.10 - 2015.09 - 2015.08 - 2015.07 - 2015.06 - 2015. 05 - 2015. 04 - 2015. 03 - 2015. 02 - 2015. 01 - 2014.11-12 -  Всемирная минералогия-32 - по одному минералу от региона

А.А. Евсеев. Минералогические находки вокруг света вдоль 40-ой параллели. - Минералогический альманах, т.13, 2008, с. 76-85.
\\ Краткий вариант статьи \\ Полный текст статьи \\ Фотогалерея \\ --Кристаллы пяти континентов_экспозиция в Минералогическом музее им. А.Е. Ферсмана РАН \\ текст--Минералы- спутники на расстоянии (минералы-телеспутники)--Журнал "Вокруг света" - http://www.vokrugsveta.ru/--Институт географии РАН _Информационный портал --находки минералов по всему миру - https://www.mineralienatlas.de  

Путешествия за камнем

--Ферсман А.Е. "Путешествия за камнем" \\ читать

--В.А. Обручев. Мои путешествия по Сибири \\ читать

МИНЕРАЛЫ \

5 замечательных находок \ Европа - Азия - Африка - Австралия - Сев. Америка - Южн. Америка (выборка: по одному образцу из северной, южной, западной, восточной и центральной части каждого регион). Случайная выборка

Вторые находки минерала в мире, ставшие лучшими "Сборные" минералов по странам и регионам (10-15 избранных находок) \\ 1-е -в 2007 г.По 2 минерала от континента за 2 минуты (экспресс-опрос)

Ареалы находок минералов (основные находки ряда минералов, вынесенные на карту мира)

Кристаллы пяти континентов_выставка в Минералогическом музее им. А.Е. Ферсмана РАН

--Евсеев А.А. Географическая привязка первоначальных местонахождений минералов. \\ Новые данные о минералах. М.: ЭКОСТ, 2003. Вып. 38, с. 113-124.

--А.А. Евсеев. Минералогические находки вокруг света вдоль 40-ой параллели с. ш.

Океаны

Острова (от Гренландии до Мадагаскара) \ минералогические находкиЛуна \\ минералогия - http://luna-mineralogiya.ru/index.html

АВТОРЫ \ \ А – Л | М - Я | A - Z Анастасенко| | Г.П. Барсанов || И.В. Бельков || В.И. Вернадский || А.В. Волошин || В.И. Воробьев | Гиймен К. \ Guillemin C.| | А.А. Годовиков || Б.З. Кантор | К.И. Клопотов || Ю.С. Кобяшев || П.А. Кочубей | Крыжановский В.И. || А.Н. Лабунцов | М.Н. Малеев || В.А. Мальцев || Л.А.Паутов || И.В. Пеков || В.А. Пелепенко || В.В. Пономаренко | | В.А. Слётов | Э.М. Спиридонов | | В.И. Степанов | А.Е. Ферсман | А.П. Хомяков || Б.В. Чесноков || Н.В. Чуканов || Н.П. Юшкин и другие

Из публикаций: А - Б - В - Г - Д - ЕЁ - Ж - З - И - К - Л - М - Н - О - П - Р - С - Т - У - Ф - Х - Ц - Ч - ШЩ - ЭЮ - Я - AZ \\ A - B - C - D - E - F - G - H - I - J - K - L - M - N - O - P - Q - R - S - T - U - V - W - X - Y - Z

МИР КАМНЯ В ЛИЦАХ

 

НОЯБРЬ в тот день

 

 

В ТОТ ГОД..

 

"Изморозь" - кристаллы снега, вырастающие в морозную погоду из тумана. Снимок на полярной станции в Хибинах, на вершине горы Юкспор, где сростки кристаллов изморози достигают 70 см. (И. Зеленой, 1936). (Ферсман, 1937, с.146). Фотоархив Мин. музея им.А.Е. Ферсмана РАН.

 

2000 - 2007 - 2008 - 2009 - 2010 г - 2015 г -

2018

2019 -

2020

Tucson Mineral Show 2020 \ Тусон-шоу минералов и драгоценных камней 2020 г.

В мире минералов. Минералогический Альманах, том 25, выпуск 1, 2020

2021

Таллиомелан* - новый минерал \\ Golebiowska, B., Pieczka, A., Zubko, M., Voegelin, A., Gottlicher, J., Rzepa, G. (2021). Thalliomelane, TlMn4+7.5Cu2+0.5O16, a new member of the coronadite group from the preglacial oxidation zone at Zalas, southern Poland. American Mineralogist: 106(12): 2020-2027

2022

Костов, Р. И., К. Богданов, Р. Атанасова, Р. Василева, Л. Нешева. 2022. Минералите на България. София, Мултипринт, 320+16 с. (на болгарском языке). 1- я обложка

«Минералы Южного Урала» - новая издание книги С. В. Колисниченко и др. (2022 г.)

 

МИНЕРАЛОГИЧЕСКИЙ УНИВЕРСИТЕТ

КЛУБ ДРУЗЕЙ МИНЕРАЛОГИИ

КЛУБ ДРУЗЕЙ МИНЕРАЛОГИИ

11 ноября 2022 г., пятница, 17 ч.

Виолетта Шанина

(ст. науч. сотр. геолог. фак-т МГУ)

Полевые учебные практики геологического факультета МГУ

Дмитрий Тонкачеев (по зуму)

Поездка в Дальнегорск осенью 2022

Встреча состоится в ФМ (Ленинский пр., 18, к.2. Тел. 8 (495) 954-39-00. Вход свободный

Подробнее : Дмитрий Тонкачеев: фото из Дальнегорска и Владивостока https://disk.yandex.ru/d/KbI08Swqq9UNQg \\ Фото из музея  геологии центральной сибири https://disk.yandex.ru/d/1cNtYRLhGA5rrg \\ Фото из местного мин музея на Алтае https://disk.yandex.ru/d/Jkdi38P-zQsMqw 

1. Встреча в клубе друзей минералогии 2022.11.11. ФМ. 2. Студенты МГУ на геологической практике. Крым. Фото из доклада В. Шаниной. 3. Геолог Виолетта Шанина. 2022.11.11. ФМ. 4. Кальцитовый гриб - самый известный образец из Дальнегорского м-ния. Фото из программы Дм. Тонкачеева (в кадре - справа). Нажмите на изображение, чтобы его увеличить

Виолетта Шанина и Николай Латышев. 2022.11.11. ФМ. Фото: А.А. Евсеев.

В зеркале камня

КИНО_В зеркале камня

И. Анненский \\\ И. Бродский \\ И.А. Бунин \\ Ю.И. Визбор \\ М.А. Врубель \\ В.С. Высоцкий \\ П.А. Вяземский \\ И.-В. Гёте \\ И.А. Гончаров \\ В. Маяковский \\ А.C. Пушкин \\ И. Северянин \\ Л. Толстой \\ А.П.Чехов \\ Агат \\ Алмаз \\ Апатит \\ Бирюза \\ Жемчуг \\ Опал \\ Топаз

Поиск в Яндекс : евсеев фото минерал образец: ФМ \ 2022.10.08

 

СТРАНЫ от А до Я

находки минералов по листам карты мира: 1234567 891011121314151617181920212223242526272829303132 - 33

Минераландия

НЕ ТОЛЬКО МИНЕРАЛЫ: А - Б - В - Г - Д - Е - Ж - З - И - К - Л - М - Н - О - П - Р - С - Т - У - Ф - Х - Ц - Ч - ШЩ - Э - Ю - Я

местонахождения минералов - | - mineral localities : А Б В ГДЕ Ж З И Й К Л М Н О ПР С Т У Ф Х Ц ЧШ Щ Э Ю Я || A B C D E F G H I J K L M N O P R S T U V W X Y Z
Сев. Америка (С)

Гренландия

Атлантика - Скандинавия - Кольский п-в

Урал
Ср. Сибирь
Якутия
СВ России

Сев. Америка (З - Сев. Америка (Кордильеры)

Сев. Америка (В)

Британ. о-ва, Пиренейский п-в - Зап. Европа - Вост. Европа

Казахстан, Ср. Азия

Юг Сибири
Забайкалье, Вост . Сибирь
Камчатка - Дальний Восток (Россия, Япония
Мексика
Кавказ, ЮЗ Азия
Афганистан, Пакистан
Индия
Монголия. Китай
ЮВ Азия - Тихий океан
Ю. Америка (СЗ) - Кордильеры
Бразилия

Африка - Сев. и Зап.Экв. и ЮжнВост.

Антарктида
Австралия

Тихий океан - Весь мир

Заметки на geo.web.ru/druza

От А до Я

№104 №112
2014 №114
№126 №131
№146
№163 №166
2020 №193

Кристаллы пяти континентов

ФМ

4a - 44a - 8a - 88a

Заметки - А - Б - В - Г - Д - Е - Ж - З - И - Й - К - Л - М- Н -О - П - Р - С - Т - У -Ф - Х - Ц - Ч - Ш Щ - Э - Ю - Я - za - zaa

обновление: 2022. 11. 29

© Александр Евсеев, 2003 - 2022. © Фото: принадлежит авторам, 2022