обновление: 2020. 11. 22

местонахождения А Б В ГДЕ Ж З И Й К Л М Н О ПР С Т У Ф Х Ц ЧШ Щ Э Ю Я || A B C D E F G H I J K L M N O P R S T U V W X Y Z \\ регионы мира: 1234567 891011121314151617181920212223242526272829303132 - 33 || Россия \ Европа \ Азия \ Африка \ Австралия \ Северная Америка \ Южная Америка \

ВСЕ КАМНИ МИРА196 - В ДВЕ СТРОКИ

или НОВЫЙ МИР КАМНЯ \ НОЯБРЬ, 2020

Заметки на geo.web.ru/druza

От А до Я

№104 №112
2014 №114
№126 №131
№146
№163 №166
2020 №193    

Кристаллы пяти континентов

МИНЕРАЛЫ и не только на druza: А - Б - В - Г - Д - Е - Ж - З - И - К - Л - М - Н - О - П - Р - С - Т - У - Ф - Х - Ц - Ч - ШЩ - Э - Ю - Я \\ Алфавитный список минералов (на geo.web.ru/druza)

см.на www.mindat.org \ A-B-C-D-E-F-G-H-I-J-K-L-M-N-O-P-Q-R-S-T-U-V-W-X-Y-Z

Минералы от A до Z - список IMA (Международной минералогической ассоциации)- http://pubsites.uws.edu.au/ima-cnmnc/

Комиссия по новым минералам, номенклатуре и классификации - http://pubsites.uws.edu.au/ima-cnmnc/ \\ The Commission on New Minerals, Nomenclature and Classification (CNMNC) of the International Mineralogical Association (IMA) was formed in July 2006 by a merger between the Commission on New Minerals and Mineral Names (CNMMN) and the Commission on Classification of Minerals, at the request of both commissions

Алфавитный список_ минералы: от А до Я (на русском языке) - более 4000 минералов ( 4976 страниц категории "Минералы") на http://wiki.web.ru/wiki/ \\ http://webmineral.com/Alphabetical_Listing.shtml

Все минералы мира (от A до Z) \ All Minerals of the World / Tous les mineraux de la terre http://euromin.w3sites.net/mineraux/accueil.html

Алфавитный список_ минералы от A до Z (на английском языке) и фото минералов - http://www.mineralatlas.com/ \\ фото минералов - http://www.cs.cmu.edu/~adg/adg-home.html (на сайте Alan Guisewite ) Список минералов - http://en.wikipedia.org/wiki/List_of_minerals

20-09-06

А

Аваруит \ Awaruite \ Ni3Fe \ https://www.mindat.org/min-439.html

- Россия, Урал: Бобровка р., гора Соловьёва, Ср. Урал, Россия (1913л) \\ Лапта-Пай р., [б-н р. Мокр. Сыня], Пол. Урал, Россия--(Савельева Г.Н. и др.,1970л)

- Нов. Зеландия: Горж Ривер, Вестланд Дистр., Южный о., Нов. Зеландия \ Gorge River, Westland District, West Coast Region, New Zealand ; 44° 11' 20'' South , 168° 18' 18'' East---3 фото (mindat.org) \\ Originally arawuite was found in stream sediments in this river, derived from a belt of serpentinised ultramafic rocks in the Red Hills, in which it occurs in situ (Rodgers and Hey, 1980)". \\ аваруит*

- США: Орегон-- Josephine Creek placers, Josephine Creek Mining District, Josephine Co., Oregon, US - лучшие и самые крупные образцы в мире (до 2,5 см кг) \\ There are a lot of awaruite localities on the Earth, but Josephine Creek placers produce the best and largest known (up to 2.5 kg nuggets) its specimens. Источник: www.mindat.org

---- South Fork Smith River, Klamath Mts, Del Norte Co., California, USA --фото

1. Аваруит. Калифорния, США. Образец: Геолог. музей им. А.А. Штукенберга (№6832), Казанский ун-т. Фото: © А.А. Евсеев. 2. Первоначальное местонахождение \ Type Locality аваруита (Горж Ривер, Вестланд Дистр., Южный о., Нов. Зеландия) и место находки (Josephine Creek placers, Орегон, США) его самых лучших и самых крупных образцов (до 2,5 кг) - по https://www.mindat.org/gallery.php?loc=4064&min=439

Авгит \\ Агат

Агреллит \ Agrellite NaCa2Si4O10F

- Россия: Мурунский м-в, СЗ Алдан, Вост. Сибирь, Россия

- Канада:  Kipawa alkaline complex, Les Lacs-du-Temiscamingue, Temiscamingue RCM, Abitibi-Temiscamingue, Quebec, Canada - первоначальное местонахождение \ Type Locality

- Таджикистан: Дара-и-Пиоз, Таджикистан \ Дара-и-Пиоз, Алайский хр., Таджикистан \\ Семенов Е.И., Дусматов В.Д. Агреллит – первая находка в СССР. - Минерал. Таджикистана (Душанбе), 1989, №8, с.3-5.

Адамин \\

Адуляр \\ Азурит \\ Аквамарин \\ Аксинит \\

Алмаз \\

 

Бабаев И.А., Зейналов М.Б., 1991. Сравнительная характеристика алунит. м-ний Азерб. ССР и Ирана. РЖ "Геология"- 8И68-1992 г.

Альбит \\

Альманах . Среди минералов М., 2001. – 196 стр. Оглавление

Альмандин \\

Амазонит

Аметист \\ Амфиболы

Анальцим \\ Анатаз

Андорит

1. Андорит в мелкозернистом кварце. Николаевский р-к, Дальнегорск, Приморье, Россия. Образец: ФМ (№85338, Свешникова О.Л ., 1987). Фото: © А.А. Евсеев.2. Андорит. Кристалл (7 см.) с включениями шестоватого цинкенита. Сан-Хосе р-к, Оруро, деп. Оруро, Боливия. Образец: ФМ (№93580. Белаковский Д.И., 2011). Фото: © А. Евсеев.

Андрадит \\

-Япония: Kohse mineTenkawa villageYoshino districtNara PrefectureJapan -31 фото!

Анортит \ Anorthite --https://www.mindat.org/min-246.html

Антимонит

Апатит-(CaF) \ Apatite-(CaF) - наиболее обычный (распространенный) минерал в группе апатита.

Апофиллит \\

Арагонит \\ Арсенопирит \\

Астрофиллит

Аугелит \ Augelite Al2(PO4)(OH)3 \\ 302 фото из 6 стран мира - https://www.mindat.org/gallery

- Швеция: Вестано р-к*, Скане, Швеция \ Vastana Iron Mine (Westana Mine), Nasum, Bromolla, Skane County, Sweden - первоначальное местонахождение \ Type Locality

1. Аугелит.  Биг-Фиш-Ривер, Юкон, Канада. Образец: Минерал. музей им. А.Е. Ферсмана (№79682. Cisneros Sh., 1979). Фото: © А. Евсеев. 2. Минералогические находки аугелита в фотографиях на сайте https://geo.web.ru/druza и его первоначальное местонахождение Вестано \ Vestana \ Type Locality (TL ). Составил: А. Евсеев, 2020

Аурипигмент

Б

Бабингтонит

Базы данных: http://www.mindat.org/ \\ http://webmineral.com

Барит

- Южн. Африка находка кристаллов рекордных размеров 85 см и 70 см в золоторудном районе Витватерсранд: Элсранд р-к!!! \\ фото -- параллельный сросток кристаллов 70 см, вес.64 из подземного рудника Kusasalethu Mine (Elandskraal Mine; Elandsrand Mine; Deelkraal Mine), CarletonvilleWestern SectorFar West Rand (West Wits Line)West Rand District (West Rand)GautengSouth Africa

Берилл

Бериллий_минералы \\ Библиография (популярные издания о камнях)- http://basik.ru/forum/index.php?showtopic=77

Библиотеки --РОССИЙСКАЯ ГОСУДАРСТВЕННАЯ БИБЛИОТЕКА--http://search.rsl.ru/ru

Биотит

Биотит в пегматите. Панфилова варака, Чернореченская губа, Сев. Карелия. Фото: © А. Евсеев.

--Молошаг В.П., Теремецкая А.Г. Цезиевые биотиты вмещающих пород одного из полей редкометальных пегматитов // Докл. АН СССР. -1975. Т. 221, № 1. - С. 187-190

--Кориневский В. Г., Кориневский Е. В., Кориневская Г. Г. Бариевый биотит из Ильмен. - Зап. РМО, 2005, 134, № 2, с.75-83 (Южный Урал)

--HessF.L., Fahey J.J. Cesium biotite from Custer County, South Dakota. //Amer. Mineral. — 1932. — Vol.

Бирюза

Бисмутотанталит \ Bismutotantalite Bi(Ta,Nb)O4

БитовнитBytownite

Бор_минералогия и геохимия \ Борнит \\ Брошантит \\ Брукит

Буланжерит

В -

Вад - смесь порошковатых, рыхлых оксидов и гадроксидов марганца (КМС)

Вазы из поделочного камня

Ванадинит \ Vanadinite Pb5(VO4)3Cl \ более 3200 фото - www.mindat.org/gallery, из них более 2000 фото ванадинита из рудного района Мибладен - Mibladen mining district, Midelt Province, Draa-Tafilalet Region, Morocco ; 32° 46' 0'' North , 4° 37' 59'' West

Варисцит

Веб-сайт

-- http://petrographica.ru

Везувиан \\ Вивианит

Викимапия \ Wikimapia (карты мира и России)

Виллиомит \\

Включения в минералах и драг. камнях

Вторая находка минерала в мире

ВУЛКАНЫ \ минералогические находки

Вульфенит

Выставки минералов и поделочных камней

--ЗАНИМАТЕЛЬНАЯ МИНЕРАЛОГИЯ” В КАМНЕ ...Подробнее (pdf)

Г -

Галенит \\

Галит

Галогениды

Гематит

Геммы

- Неверов О.Я. Геммы античного мира

Генезис минералов

--Попов В.А. Практическая генетическая минералогия. - Екатеринбург: УрО РАН, 2011.- 167 с.

Геовикипедия \ GeoWiki Всё о геологии - http://wiki.web.ru/

Гётит \\

Гигантские и крупные кристаллы (индивиды) \\ См.: А.Е. Ферсман. Величина природных кристаллов // Природа, 1925, № 10/12, стлб. 103; его же. Кристаллы-гиганты и монолиты-гиганты // Природа, 1926, № 3/4, стлб. 86—88; его же. Пегматиты. Т. I. Гранитные пегматиты. M.—Д., 1940.

Гидроксилапатит \ Hydroxylapatite \ https://www.mindat.org/min-1992.html

Гипс

Гипс. Ред Ривер, Виннипег, Манитоба, Канада. Образцы: "Русские минералы". Фото: А. Евсеев

Глендонит

Горная энциклопедия - http://www.mining-enc.ru/ \\ http://dic.academic.ru/contents.nsf/enc_geolog/

Горный хрусталь \\

--Буканов В. В. Горный хрусталь Приполярного Урала. Л. Наука, 1974. 212 с.

--Костелов Н.П., Шатнов Ю.А. Хрусталеносные месторождения России и стран СНГ. - Александров, 2005. - 250 с.

Графит

Гроссуляр

Д

Данбурит \\ Датолит

Двойники \\ http://folk.ntnu.no/krill/mineralogee/8.htm \

Демантоид \\ Дендриты

Детский мир камня

--Геологическая школа МГУ -- О полевых практиках и экспедициях

--Школьный факультет РГГРУ - МГРИ \\ 60-летие - http://docplayer.ru/189496-60-let-shkolnomu-fakultetu-mgri-rggru-1947-2007-legendy-i-mify-shkolnogo-fakulteta.html \\

--Клуб юных геологов им. академика В.А. Обручева (Санкт-Петербург) - http://www.anichkov.ru/departments/lyceum/geology

--Ферсман А. Е. Путешествия за камнем. М. 1960 (веб-публикация) :

--Ферсман А.Е. Занимательная минералогия \\ читать

Диопсид

Диоптаз -в фотографиях на странице http://www.mindat.org/min-1295.html Photos of Dioptase - 1958 фото на 2019.05. Из них:

--всего по два фото диоптаза из Европы (Италия - Cape Calamita Mine) и Австралии

--Казахстан - 215; ДР Конго - 127; DR Congo США - 292 ; Republic of Congo (Brazzaville) - 319 ; Намибия - 892 (из них 579 - Цумеб)

Доломит

Дравит

Драгоценные камни (д.к.)—литература о них (по минералам): http://www.geol.msu.ru/departments/mineral/Rus/Edu/deposit_liter_r.htm \\ списки месторождений по минералам (сост. И.А. Бакшеев) - http://www.geol.msu.ru/departments/mineral/Rus/Edu/deposits_r.htm

--Горная энциклопедия - о д.к.

--Пыляев М. И. «Драгоценные камни, их свойства, местонахождения и употребление» \\ http://www.vadim-blin.narod.ru/book/titl.htm \\ указатель (быстрый поиск по ключевым словам) - http://www.vadim-blin.narod.ru/book/glossary.html

Драгоценные камни (самоцветы)_география находок

--Генетическая минералогия драгоценных камней (лекции Э.М. Спиридонова) - http://spiridonov.mineralog.com/

Дымчатый кварц

Е -

Еремеевит - http://www.mindat.org/min-2090.html; фотографии: 52 фото (2008.09) \ 190 фото на 2018.04 - http://www.mindat.org/gallery.php?min=2090

Ж

Жадеит \\

Живопись в камне

Журналы для минералогов и коллекционеров \\ The Mineralogical Record, \\ Rocks & Minerals \\ Le Regne Mineral \\ Mineraux et Fossiles \\ Lapis \\ Mineralien Welt \\ Rivista Mineralogica Italiana \\ Revista de Minerales \\ MineralUp\\ Bocamina \\ UK Journal of Mines and Minerals

З

Закономерные срастания

Занимательная минералогия. По страницам знаменитой книги А. Е. Ферсмана Занимательная минералогия. Источник: https://www.e-reading.club

Знаменитые местонахождения минералов (от Конгсберга до Ору-Прету)

Золото

И -

Изумруд \\ Ильваит \\ Ильменит

Индивиды и агрегаты

--Годовиков А.А., Степанов В.И. Формы нахождения минералов. М. 2003. \\

--Макагонов Е.П.Симметрия сростков минеральных индивидов. Наука 1991

Интернет - минералогия \\ http://geo.web.ru/druza \\ https://webmineral.ru \\ https://www.mindat.org

Искусственные кристаллы \ минералы

Исландский шпат

История минералогии ( находки, открытия и др.)

- Харькив А. Д. , Зинчук Н. Н. , Зуев В. М. История алмаза. - М. : Недра, 1997. - 601 с.

- Годовиков А. А. Краткий очерк по истории минералогии. М.,1998. - 162 с.

История открытий

--Данилевский В.В. Русское Золото. История открытия и добычи до середины XIX в. 1959. - 380 с.

К -

Кавансит

Календари с минералами

Кальцит

Замечательные находки кальцита по всему миру (примеры). Составил: А. Евсеев, 2010.11.

Камень в городе

--Книжная полка минералога \ камни на книжной полке

Камералка минералога \\

Каолинит

Карбонаты

Карта мира - http://maps-of-world.ru/inter.htm \\ http://geography_atlas.academic.ru/

Картирование, минералогическое

Картотека местонахождений минералов, начатая А. Евсеевым в 1967 г., насчитывает сегодня более 100 тыс. названий. Она строится по региональному принципу, внутри крупного региона местонахождения расположены по алфавиту. Для местонахождений приведены ссылки на литературу, авторов, образцы в собраниях музеев. Материалы картотеки используются в публикациях автора, на сайте http://geo.web.ru/druza/ и др.

Е - Ж - З - названия (минералы, местонахождения, авторы). Список на 2017.07

Карты \\ http://www.marshruty.ru/ \\ http://wikimapia.org/country/ \\ http://www.openstreetmap.org/ \\ http://ru.wikipedia.org/wiki/OpenStreetMap-- Карты мира, стран и городов - http://planetolog.ru/ \\ http://mapper.infomine.com/ \\ http://www.veslo.ru/maps.html \\ http://www.maphill.com

--http://wikimapia.org/

--карта мира и минералы (фото) - http://fotki.yandex.ru/users/ilm/map/view/recent

--реки (бассейны) -- http://www.riversnetwork.org/rbo/

Касситерит \\

--Разновидность касситерита - "Деревянистое олово"

- Камчатка \\ Толбачик, вулк. "Неожиданностью стало обнаружение в той же фумароле Арсенатная богатой собственной касситеритовой минерализации эксгаляционного происхождения [Сандалов и др., 2017]: щетки мелких оранжевых и красных кристаллов этого минерала участками достигают по площади десятков см2. " (Пеков И.В. и др., 2019)

---Сандалов Ф.Д., Кошлякова Н.Н., Пеков И.В., Ханин Д.А., Сидоров Е.Г. Касситерит в фумарольных эксгаляциях вулкана Толбачик (Камчатка) // Международная научная конференция «Юбилейный съезд Российского минералогического общества: 200 лет РМО», СПб, 2017, т. 2, с. 316.

--- Сандалов Ф.Д., Кошлякова Н.Н., Пеков И.В., Япаскурт В.О., Ханин Д.А., Сидоров Е.Г. Касситерит из фумарольных эксгаляций вулкана Толбачик (Камчатка): химический состав и морфогенетические особенности // Новые данные о минералах. 2019. Том 53. Вып. 3, стр. 60-70

Каталоги минералогических коллекций

Кварц \\ публикации - http://www.quartzpage.de/info_lit.html -- Экспресс-опрос -2011 (кварц) (на ответ давалось 2-3 мин. )

--Кварц по странам мира - http://www.mindat.org/mesg-95-139699.htm

Киноварь \ Cinnabar \ https://www.mindat.org/min-1052.html - фото: весь мир - 1445 ; Китай - 370 (пров. Гуйчжоу - 244, из них Тонгрен - 129) \\ Испания - 233 (из них Альмаден - 158) \\ \\ Образцы киновари на витринах Мин. музея им. А.Е. Ферсмана РАН - https://fmm.ru/Киноварь

Клинохлор \\

Книжная полка минералога и коллекционера

--http://www.crystalclassicsminerals.com/books.php

Коллекционирование минералов

Степанов В.И. Шкала качества образцов (разработана им в 1970-ые гг.)

-- http://www.strahlen.org/

Колумбит \\ Группа колумбита - танталита \\ Справочник "Минералы" \\ М-2-3, с.303- 322

Колфанит \ Kolfanite Ca2Fe3+3O2(AsO4)3·2H2O

- Россия: Васин-Мыльк г., Вороньи тундры, Кольский п-ов \ Vasin-Myl'k Mt, Voron'i Tundry, Murmansk Oblast, Russia - Волошин А.В. и др., 1982

- Франция: Roua Mines, Daluis, Guillaumes, Alpes-Maritimes, Provence-Alpes-Cote d'Azur, France --фото - www.mindat.org/gallery

Колымит \ Kolymite Cu7Hg6 - 2 фото (2020.04)

- Россия: Найден в Sb-рудопроявлении Крохалиное в 60 км от пос. Ягодное, ЮВ фланг Иньяли-Дебинского мегантиклинория, бассейн р. Колыма, Магаданская обл., Россия\ \  Krokhalinoye dyke, Arik-Revkom zone, Kolyma River Basin, Magadan Oblast, Russia. Образует зерна до 0.8 мм с вростками меди в гидротермально измененных кварцевых порфирах, содержащих также пирит, арсенопирит, антимонит, бертьерит [333]. Название: по месту находки. TS: FM 80178,vis176 \\ Маркова Э.А., Черницова Н.М., Бородаев Ю.С. и др. Новый минерал колымит (Cu7Hg6). // ЗВМО, 1980, 109, 2, 206-211. \\ Источник: Pekov I.V. Minerals First Discovered on the Territory of the Former Soviet Union. Moscow, Ocean Pictures, 1998.- 369 pp.

- Венгрия: Adolf Mine, Rudabanya, Rudabanyai Mts, Borsod-Abauj-Zemplen County, Hungary - фото \\ Zajzon, N., Szentpeteri, K., Feher, B., Szakall, S., Kupi, L., & Barkoczy, P. (2012). New data on Cuamalgams, kolymite and belendorffite from Rudabanya, Hungary. In Acta Mineralogica-Petrographica, Abstract Series (Vol. 7, p. 160).

- США: Комсток \  Comstock LodeVirginia CityComstock DistrictStorey Co.NevadaUSA ; 39° 18' 40'' North , 119° 38' 51'' West \\ Cipriani, C., & Mazzetti, G. (1989). Kolymite (copper amalgam); report of second and third occurrences. European Journal of Mineralogy, 1(5), 719-720.

- Чили: фото - Marcelita prospect, Pabellon, Tierra Amarilla, Copiapo Province, Atacama, Chile - фото

Конкреции \\ Кораллы \\

Кордиерит \ Cordierite (Mg,Fe)2Al3(AlSi5O18) - более 300 фото

Минералогические находки кордиерита в фотографиях, размещенных на странице http://geo.web.ru/druza/m-cordier_0.htm . Составил: А. Евсеев (2020.11.12)

Корунд \\ сайт, посвященный корунду - http://www.corunduminium.com/index1.html

Кремень \\

Кридит

Кридит. [Навидад р-к], Дуранго, Мексика. Образец: ГГМ им. В.И. Вернадского (Дар: Д.И. Белаковский, 2009). \\ см. Navidad Mine, Abasolo, Rodeo, Rodeo Municipality, Durango, Mexico; 25° 25' 59'' North , 104° 46' 59'' West

Кристаллы

Кристаллы и сростки рекордных размеров и др.

Крокоит \ Crocoite PbCr6+O4

- Россия: Березовское м-ние, Ср. Урал \ Berezovsk deposit, Beryozovsky, Sverdlovsk Oblast, Russia --фото

- Австралия: Adelaide Mine, Dundas mineral field, Zeehan District, West Coast municipality, Tasmania, Australia --фото

Крупные образцы минералов (рекордные размеры)

Куплетскит \\ Kupletskite - https://www.mindat.org/min-2290.html - 45 фото (2019.02).

Куприт

Л

Лабрадор

Лазулит \ Lazulite MgAl2(PO4)2(OH)

Лазурит

Лампрофиллит \ Lamprophyllite \ https://www.mindat.org/min-2315.html - 35 фото (2019.01)

Левин-(Ca) \ Levyne-Ca - https://www.mindat.org/min-7154.html \\ Весь мир - 103 фото : Исландия-1; Фареры-2; Чехия-7; Италия-13 (Сардиния-7) \\ Индия-1; Япония-1 \\ Австралия - 3; Нов. Зеландия-4 \\ США - 71 (Орегон - 70)

Лёд \\ http://www.mindat.org/min-2001.html \\ фотогалерея

Линарит \\ Лироконит

Литература о минералах и драгоценных камнях \\ Из публикаций о минералах зарубежных стран \\ Из публикаций о минералах России, а также СССР

Наша библиотека - Геологический музей им. В.В.Ершова - http://ershov-geomuz.narod.ru/libr.htm

Литература по геологии в бибиотеке ДВГИ ДВО РАН. \\ http://wiki.fegi.ru/index.php/

Лопарит

Лоренценит

Любители камня

Люминесцирующие (флюоресцирующие минералы) - тема выставки выставки Минер. музея им.А.Е. Ферсмана РАН

М -

Магнетит \\ Малахит

Марки \\ минералы на марках - Minerals on Stamps

Медь и минералы меди

Меридианы

36 - 37° вост. долг. \ East

Местонахождения минералов вдоль 37° вост. долготы (примеры). Составил : А. Евсеев, 2020.11.

Амазонит и радуга. Плоская г., Кейвы, Кольский п-ов. Фото: М. Моисеев

Таковит, айдырлит на известняке. Подольск (карьер на лев. бер. р. Пахра выше ж.-д. моста), к Ю от Москвы, Россия. Образец: ФМ (М-31151, Степанов В.И., пост. 1988 г.). Фото: © А.А. Евсеев.

Анапаит. Друза сферокристаллов. 2-ой Черноморский р-к, Керчь (р-н), Крым, Россия. Образец: ФМ (№90786. Сбор музея: Абрамов Д.В., 1986). Фото: © А.А. Евсеев.

Перидот (хризолит). Зебергед о., Красное море, Египет. Образец: Мин. муз. им. А.Е. Ферсмана РАН. Фото: © А.А. Евсеев.

Амазонит. Консо, Эфиопия. Кристалл (более 7 см) в центральной части содержит вростки кварца (графическая структура). Образец: Геол. музей им. В.В. Ершова (МГГУ). Фото: © А.А. Евсеев.

Танзанит. Мерелани-Хиллс, близ г. Аруша, Танзания. Мюнхен-шоу-2007. Фото: © М. Моисеев.

36° 21' 47'' в.д. \\ "Е" \ Карьер ЕКамыш-Бурунское (Fe) месторождениеКерченский (Fe)-рудный бассейнКерченский п-ов, Крым, Россия; 45°17'35'' с.ш., 36°21'47'' в.д. \\ барит!; родохрозит!!—пс-зы по раковинам двустворок

36° 42' 0'' East \\ Плоская г., ~2 км к З от г. Вюнцпахк и 34 км к ССЗ от пос. Краснощелье, Кейвы, Кольский п-ов, Россия; 67° 37' 59'' North , 36° 42' 0'' East \\ амазонитовые пегматиты с редкими минералами Y и Yb \\ амазонит!!!; *вюнцпахкит-(Y); галенит!; * (1985) кейвиит- (Y); * (1983) кейвиит-(Yb)--ф; * кулиокит-(Y); * новые мин.—6 видов; плюмбомикролит!!!--xls<20 см; разнообразие - 47 вид. (mindat); ринерсонит ; силленит!; фото --28 (mindat); * (1997) фторталенит-(Y); * (1983) хинганит-(Yb); К-76, 151; Pk (ф) \\ Подробнее: Волошин А. В., Пахомовский Я. А. Минералы и эволюция минералообразования в амазонитовых пегматитах Кольского полуострова. Л. 1986, 168 с. \\ http://www.mindat.org/loc-2670.html

37 в. д.

37° 0' 29'' East \\ Merelani Hills*, Lelatema Mts, Simanjiro District, Manyara Region, Tanzania; 3° 34' 59'' South , 37° 0' 29'' East \\ Аксинит-(Mg)\ Axinite-(Mg) (TL); танзанит!!!

37° 31' 50'' East \\ Дмитриевский карьер, Октябрьский массив, Волновахский район, Донецкая область, Приазовье, Украина \ Dmitrievskii quarry, Oktyabr'skii Massif, Azov Sea Region, Donetsk Oblast, Ukraine; 47° 31' 59'' North, 37° 31' 50'' East - фото www.mindat.org: астрофиллит \ Astrophyllite !--2 фото; баотит \ Baotite ; бафертисит \ Bafertisite ; куплетскит-1; лампрофиллит \ Lamprophyllite ; перроит \ Perraultite !!-15 фото; хейтманит \ Hejtmanite ; цзиньшацзянит \ Jinshajiangite--1 фото

Аметист. Кристаллы до 2 см. Мыс Корабль, Кольский п-ов, Россия. Образец: ФМ. Фото: © А.А. Евсеев.

Циркон. Кристаллы (~2 см) в мариуполите. Октябрьский м-в, Приазовье, Украина. Образец: ФМ (Степанов В.И.(колл.), 1983). Фото: А. Евсеев

Месторождения

Метеориты

- Иванов А.В., Ярошевский А.А., Иванова М.А. Минералы метеоритов – новый каталог // Геохимия. - 2019. - Т. 64. - №8. - C. 869-932. doi: 10.31857/S0016-7525648869-932 \\ текст - https://journals.eco-vector.com/0016-7525/article/view/15885

Метро и камень

Микроклин

Миндат.орг\ www.mindat.org - - крупнейшая база данных о минералах и местонахождениях. Её основатель - Джолиан Ральф \ Jolian Ralf .

Евсеев А.А. Минералогические находки (примеры). IV. Зарубежные страны (без республик быв. СССР). М., 2016. - 256 с.

Минералогический альманах (на сайте )

Минералогический альманах (на русском . яыке) - http://www.minbook.com/mineralogical_almanac_ru.html \

-- Mineralogical Almanac - http://www.minbook.com (на англ. яз.) - на английском языке \ Mineralogical Almanac (Россия \ Russia)

-- В мире минералов. Минералогический Альманах, том 21, выпуск 1, 2016. Подробнее..

-- Минералогический Альманах, том 22, выпуск 2, 2017 - оглавление

Минералогия_для студентов (фото минералов и рисунки кристаллов)- http://geoserv.krc.karelia.ru/geo/rus/ht

Минералогические словари

-- Кривовичев В.Г. Минералогический словарь - http://bibl.gorobr.ru/book/248/book.html (веб-публикация) \\ также - на сайте - http://mmus.geology.spbu.ru/programm

Минералогия

--Бетехтин А.Г. 'Курс минералогии' - Москва: Государственное издательство геологической литературы, 1951 - с.543 --веб-публикация

--Корбел П. и Новак М. . МИНЕРАЛЫ. Иллюстрированная энциклопедия. М.: "Лабиринт Пресс", 2004. - 296 с.

Минералы_список от А до Я - Википедия

МИНЕРАЛЫ (справочник) ------- http://www.geokniga.org/collections/3607 \\ т.2, вып.2

--Силикаты–справочник  краткий указатель - http://geo.web.ru/druza/m-miner_A-Ya_sil.htm  

--Минералы. Справочник. Том 3. Выпуск 1. Силикаты с одиночными и сдвоенными кремнекислородными тетраэдрами. Содержание

Минералы - спутники на расстоянии \\ Евсеев А.А. Минералы - спутники на расстоянии (2): Отдельные статьи Горного информационно-аналитического бюллетеня. - №12. - М.: Издательство "Горная книга", 2009. - 35 с.

МИР КАМНЯ \ WORLD OF STONES - научно-популярный журнал, посвященный минералогии \ Содержание журнала №№ 1-12 за 1993 – 1997 гг

Мозаика

Молибденит

Монацит

--Overstreet, W.C. (1967) The geologic occurrence of monazite. USGS Professional Paper 530: 114-118. \\ читать - https://pubs.usgs.gov/pp/0530/report.pdf

Морфология минералов

М у з е и

Степанов В. И. МИНЕРАЛЬНЫЕ ВИДЫ, ХРАНЯЩИЕСЯ В КРУПНЕЙШИХ МИНЕРАЛОГИЧЕСКИХ МУЗЕЯХ СССР . В кн. Старейшие минералогические музеи СССР.— М.: Нау­ ка, 1989.— Вып. 25.— 239 с. Очерки по истории геологических знаний. , стр.154-233. \\ читать - http://ginras.ru/library/pdf/1989_history_geology_issue25.pdf

--http://www.exmu.ru

Старейшие минералогические музеи СССР. - М.: Наука, 1989. - Вып. 25. - 239 с. Очерки по истории геологических знаний.

--В сборнике помещены материалы, освещающие историю создания и развития трех старейших минералогических музеев СССР, основанных в XVIII веке и ныне превратившихся в крупнейшие широко известные во всем мире собрания минералов. Проводимая таблица содержит полный перечень минеральных видов, хранящихся в этих музеях. Публикуемые фотографии наиболее интересных образцов способствуют лучшему восприятию текста. Книга предназначена для минералогов и историков науки, а также для самого широкого круга любителей камня. \\ Источник: https://fmm.ru/Издания

World Directory of Mineral Collections (Second Edition) Pieter C. Zwaan; Ole V. Petersen . Published by Commission on Museums of the International Mineralogical Association,, Copenhagen, 1977

Россия

- Список геологических музеев России - -http://webmineral.ru/museums/

- Естественно-научный музей Ильменского государственного заповедника \\ Адрес: 456317, Челябинская область, г. Миасс, Ильменский заповедник   - http://www.museum.ru/M3104

- Москва и область

--Екатеринбург

--Иркутск \\ Государственный Минералогический музей им. А.В. Сидорова - http://mineral.inrtu.ru

--Новосибирск \\ "В Центральном сибирском геологическом музее, который основан в июле 1958 года, есть образцы из 50 стран мира и всех регионов России. В коллекции около тысячи видов минералов видов, а общее количество экспонатов — около 20 тысяч." \\ Источник и подробнее - https://ria.ru/nsk/20131110/975805317.html

-- Санкт-Петербург \\ Горный музей

----Санкт-Петербургский ун-т \\ Начало...

--Севастополь. Севастопольский музей камня \\ "В настоящее время музей располагает выставочной площадью 100 квадратных метров, в экспозиции представлено более 3000 экземпляров". Подробнее о музее

Болгария. "Национальный музей "Земля и Люди" является минералогическим музеем в центре Софии. Это один из крупнейших минералогических музеев во всем мире. Датой его основания считается 30 декабря 1985 года, а открыт для посещения он был в июне 1987 года. Инициатором создания музея был доктор наук Михаил Малеев. Музей расположен в оригинальном старинном и реконструированном здании, построенном в конце XIX века (1896-1898 год). Общая площадь музея составляет около 4 000 кв. м". Источник: https://www.rutraveller.ru/place/14261

Германия

Италия

--Неаполь_ Королевский минералогический музей в Неаполе - Real Museo Mineralogico - http://www.cmsnf.it/real-museo-mineralogico/

Китай

--Пекин. Геологический музей. Bancroft,P, Zhengzhi,H and Furui,W (1987) The Peking geological museum, China. Mineral.Record 18, 325-332.

Ливан

МИМ музей (минералогический), Бейрут, Ливан \\ Мим Музей - частный [минералогический] музей в Бейруте, Ливан. В музее более 2000 образцов, представляющих 450 различных видов из 70 стран. Он считается сегодня одной из самых значительных частных коллекций минералов в мире. Создатель музея - Салим Эдде \ Salim Edde, ученый, химик, педагог, коллекционер минералов. Музей был открыт 12 октября 2013 года в присутствии почетных гостей, включая президента Ливана. Подробнее: https://en.wikipedia.org/wiki/Mim_Museum

--репортаж Петера Ликберга - https://www.mindat.org/article.php/1807/The+MIM+Museum+opening%2C+Lebanon \\

--видеорепортажи: (7.36) https://www.youtube.com/watch?v=JKDsSHLu7pE \\ часть 1 (21.48)- https://www.youtube.com/watch?v=StatGGnqyY8 \\ часть 2 (24.43) - https://www.youtube.com/watch?v=qc28tOlGuvI

США

Франция.

--Париж. Национальный музей естественной истории ( фр. Museum national d'histoire naturelle - один из старейших в мире \\ Подробнее. В него входит Минералогическая галерея ( фр. Galerie de Mineralogie et de Geologie). Особая достопримечательность музея - коллекция гигантских кристаллов кварца из Бразилии \\ Подробнее_Википедия \\ http://www.museum-mineral.fr/home.php# \\

-- Минералогическая галерея. Национальный музей естественной истории_Париж. Франция.

--Париж.  l'Ecole des Mines \ Музей высшей горной школы http://www.musee.mines-paristech.fr/Accueil/ \\ фотогалерея- http://www.musee.mines-paristech.fr/Galerie/Photos/

Мусковит

Названия и привязка местонахождений минералов

Названия минералов

Ивсит, новый минерал, открытый на вулкане Толбачик (Камчатка) назван (Филатов С.К. и др., 2016) назван в честь Института вулканологии и сейсмологии ДВО РАН (ИВиС ДВО РАН).

--Филатов С.К., Карпов Г.А., Шаблинский А.П., Кривовичев С.В., Вергасова Л.П., Антонов А.В. Ивсит Na3H(SO4)2 – новый минерал вулканических эксгаляций из фумарол Трещинного Толбачинского извержения им. 50–летия ИВиС ДВО РАН // Доклады академии наук. – 2016. – Т. 468, №6. – С. 690–694.

Митчелл Р.С. Названия минералов. Что они означают? - М.: "Мир", 1982. - 248 с.

Натролит

Недра - http://www.rosnedra.com/

Немалит (разновидность брусита)

Нефелин

Нефрит

Новые карты для минералога -

--Нов. карты 2019.07.01

--Нов. карты 2019.05.12-строки

Новые книги и публикации \\ см. также www.minbook.com/02.12.2016.(авторы со своими новыми книгами)

Новые минералы

Новые поступления в Мин.муз. им. А.Е. Ферсмана РАН

Нортупит

О

Окенит, оливин , ольшанскит и др. Минералогические находки (примеры). Составил: А. Евсеев, 2010.11.

1. Окенит. Фестланд, о. Диско, Гренландия. Образец: Музей Софийского ун-та (М994. Фирма Кранца). Более 7 см. Фото: А. Евсеев. 2017.

2. Оливин (разн. перидот). Чехия и Зальцбург(Австрия). Образцы:. Музеи естественной истории в Вене. . Фото: © Ю. Гриценко. \\ НМК-116

3. Окенит. Первомайский карьер, Крым, Россия. Сферолиты более 1,5 см. Из коллекции А.В. Касаткина. Фото: А. Евсеев. 2017.07.27.

4. Ольшанскит [прожилок в сахаитовой породе]. Титовское м-ние, хр. Тас-Хаяхтах, Якутия, Россия. Образец: ФМ (№71541, Перцев Н.Н., 1968). Фото : © А.А. Евсеев.

5. Опал. 60 карат. Керетаро, Мексика.Образец: Калифорнийская Академия наук. Тусон-шоу-2016 . Фото: Т. Павлова

6. Окенит и гиролит. Пуна (район), Индия. 30х20 см. Образец: Мин. музей МГРИ (№960). Фото: © А.А. Евсеев

7. "Обсидиан. Перу". Образец: В.А. Пелепенко. Фото: © А.А. Евсеев. \\ Диагностика и привязка требуют уточнения (А.Е.)

8. Опал. Пролив Дрейка, Антарктида. Образец С.В. Бусыгина. Фото: © Б.З. Кантор (Мир минералов, 2013)

9. Олмиит. Калахари (марганцеворудное поле), Сев. Капская пров.ЮАР. Образец: Тусон-шоу-2016. Фото: © Т.М. Павлова. \\ 33_19

10. Оливин с Cr-диопсидом (ксенолит в базальте). Виктория шт., Австралия. Образец: ФМ (колл.: Годовиков А.А.). Фото: © А.А. Евсеев.

 

Облицовочные камни \\

Обсидиан

Одноимённые местонахождения

Окаменелое дерево

Окенит \\

Окно (камень у окна)

Оксиды

Онтогения минералов

Опал

Определение (диагностика) минералов

Ортоклаз

ОРТОКЛАЗ и его разновидности. Минералогические находки в фотографиях (примеры). Составил: А. Евсеев, 2020.11. Подробнее: https://geo.web.ru/druza/m-orto_0.htm

Осумилит \ Osumilite - 143 \ 163 фото (2019.04 \ 2020.09) - https://www.mindat.org/min-3039.html

- Россия : Челябинский буроугольный бассейн, Челябинская область, Южный Урал, Россия \\ Сокол Е.В. Новый генетический тип проявлений осумилита. - ЗРМО. 1997. Часть 126. Вып. 4, стр. 43-53 \\ Seryotkin, Y. et al. (2008): Pyrometamorphic osumilite: occurence, paragenesis, and crystal structure as compared to cordierite, European Journal of Mineralogy, Vol. 20, pp. 191-198

- СССР: Богданова Н.Г., Тронева Н.В., Заборовская Н.Б. и др. О первой находке метаморфического осумилита в СССР // Докл. АН СССР, 1980, т. 250, № 3, с. 690-693.

- Япония: Саккабира \ Sakkabira, Япония \  Sakkabira, Kagoshima Prefecture, Japan - первоначальное местонахождение \ Type Locality --Proc.Japan Acad.(1953) 29, 321-323 \\ Образец: ФМ (№69134. Sakurai I., 1966)

- Италия: Funtanafigu Quarry, Marrubiu, Oristano Province, Sardinia, Italy --фото

- Канада: Лабрадор \\ Berg, J., Wheeler, E.P. (1976): Osumilite of deep-seated origin in the contact aureole of the anorthositic Nain complex, Labrador, American Mineralogist, Vol. 61, pp. 20-37

Отенит \ Autunite Ca(UO2)2(PO4)2 · 10-12H2O \\ 888 фото (2020.09)

- Португалия: - Assuncao Mine, Aldeia Nova, Ferreira de Aves, Satao, Viseu, Portugal --фото

- Италия: Bric Colme, I Cardin, San Giacomo, Roburent, Cuneo Province, Piedmont, Italy --фото

- Франция: La Commanderie mine, Treize-Vents, La Roche-sur-Yon, Vendee, Pays de la Loire, France --фото

- США : Дейбрик Майн \ Daybreak Mine, Спокан, Вашингтон, США. Образец: Денвер-шоу-2013. Фото

Открытки с камнем

Охотскит\ Okhotskite Ca2Mn2+Mn3+2[Si2O6OH][SiO4](OH)2(OH) \\ минерал назван по Охотскому морю, расположенному близ места его первой находки

- Япония: Охотскит - новый минерал из р-ка Кокурики, о. Хоккайдо, Япония \ Kokuriki mine, Kitami City, Okhotsk Subprefecture (Abashiri Province), Hokkaido Prefecture, Japan - первоначальное местонахождение \ Type Locality \\ Togari, K. & Akasaka, M. (1987): Okhotskite, a new mineral, a manganese ion(3+)-dominant member of the pumpellyite group, from the Kokuriki mine, Hokkaido, Japan. Mineralogical Magazine 51, 611-614.

- Россия: Аскизский руд. р-н, Хакассия, юг Ср. Сибири \ Askiz ore district: Chapsordag deposit \\ Malosyrsky deposi

- Италия: Valgraveglia Mine (Gambatesa Mine), Monte CopelloReppiaNeGenoaLiguriaItaly \\ Identification by EDS and PXRD as reported by Anatoly Kasatkin \ диагн. - А. Касаткин

П

Параллели_минералогические находки = sh.htm

39° 55' 59'' North \\ Хайдаркан, Киргизия, м-ние (Hg) = Айдаркен м-ние (и район Хайдаркана), Ю. Киргизия \ Khaidarkan Sb-Hg deposit, Batken Region, Kyrgyzstan ; 39° 55' 59'' North , 71° 19' 59'' East \\ азурит; акташит!; аллофан; аллофан медистый; антимонит;арагонит!!!; аурипигмент!!; барит; баумгауерит; буланжерит; вакабаяшилит@!!!--Груздев В.С. и др., 1975л; валентинит!!; ванадинит; *великит(Груздев В.С. и др., 1977); *галхаит!!--Груздев В.С., Степанов В.И., 1972 ; геокронит; гетероморфит; геттардит; гетчеллит@!!!--Волгин В.Ю. и др., 1972л; гидроромеит!; гидросервантит; гипс!; гринокит; *груздевит; джемсонит; доломит!; золото; кальцит!!!; каломель; киноварь!!--ф; клебельсбергит; конихальцит!!; кордероит--Васильев В.И. и др., 1986л; кридит!--xls<2x0,3 см (колл. Степанова В.И.); *кузнецовит; лесюкит!--www.mindat.org; ливингстонит!!!--кв. 287, шт. №46, уч.Кара-Арча (сборы В.И. Степанова, 1976 г.) ; метациннабарит; монтроидит; накрит; оливенит; плагионит; *поярковит; реальгар; розазит; ртуть; сенармонтит; сервантит; серебро; скородит; сорбиит; стибиконит!; таранакит (Суль-Ункур грот); твиннит; теннантит ртутный; терлингуаит; тетраэдрит; тиролит; трипугиит; туранит--"Медная гора"--Сулоев В.И. и др.. 1934; тюямунит--находка В.И. Степанова(до 1976 г.); фармаколит; флюорит!; фольбортит; *хайдарканит(1998)!!; халькофиллит!-един. пластинка (проверен)--Степанов В.И.-1978; целестин; цинкенит; чапманит!--Степанов В.И.; *чурсинит!--Васильев В.И., 1984; *шаховит; эглестонит; энаргит--Степанов В.И.); mdt_2008 [Lapis 11:11-24] \\ Источники: Степанов В.И. (коллекция и устные сообщения); Pk; http://www.mindat.org/loc.php?loc=5596&ob=4 (2003-2008)

39° 44' 27'' North \\ Томас-Рейндж , округ Джуаб, Юта, США \ Thomas Range, Juab Co., Utah, USA ; 39° 44' 27'' North, 113° 8' 34'' West \\ берилл!!!--малиново-красный; биксбиит!!!--(М 2-2), xls< 2, 5 см; дурангит!; спессартин!; топаз!!; * уиксит

36° 20' 9'' N \\ Даллас Джем Майн (Бенитоит Джем майн), окр. Сан-Бенито, Калифорния, США \ California State Gem Mine (Dallas Gem Mine; Benitoite Mine; Benitoite Gem Mine; Gem Mine), Santa Rita PeakNew Idria DistrictDiablo RangeSan Benito Co.CaliforniaUSA ; 36° 20' 9'' N, 120° 36' 19'' W ; 680 фото минералов (2019.04) - \\ бенитоит!!!(www.mindat.org - 355 фото); джоакинит-(Ce)* \ Joaquinite-(Ce) (TL) ; джонесит \ Jonesite (TL) ; нептунит!!--207 фото; серандит!--микро--фото mindat \\ см. на карте

1. Бенитоит. Истоки р. Сан-Бенито, Калифорния, США. Кристаллы до 2 см. Образец: ФМ. 2. Берилл красный ("биксбит") в риолите. Уа-Уа Маунтинс\ Wah Wah Mts, Юта, США. Кристалл ~3 см. Образец: ФМ (№№81692, 84849. Barlow F.J., 1982. Обмен, 1986). 3. Лазурит. Сар-э-Санг, Бадахшан, Афганистан. Образец: Мюнхен-шоу-2008. Фото: М. Моисеев. 4. Гетчеллит. Кара-Арча уч-к, Хайдаркан, Киргизия. Более 7 см. Образец: Минер. музей им. А.Е. Ферсмана РАН. (Федорчук В.П.). Фото 1, 2, 4: © А.А. Евсеев


36° 12' 36'' North \\ Сар-э-Санг = Сари-Санг = Сары-Санг \ Sar-e-Sang = Sar-Sang (Encarta-2001), Бадахшан, Афганистан \ Sar-e Sang (Sar Sang; Sary Sang), Koksha Valley (Kokscha Valley; Kokcha Valley)Khash & Kuran Wa Munjan DistrictsBadakhshanAfghanistan; 36° 12' 36'' North , 70° 47' 36'' East \\ лазурит!!!

33° 6' 1'' North \\ Ред Клауд Майн, Аризона, США \ Red Cloud Mine, Silver Mining District, La Paz County, Arizona, USA ; \\ 33° 6' 1'' North , 114° 35' 59'' West \\ вульфенит!!! - 475 фото (2020.07)

Пегматиты \\ Ферсман А.Е. Пегматиты. М.: Изд-во АН СССР, 1940. Т.1.

Пейзажный камень

Первая находка минерала в быв. СССР и России

Первоначальные местонахождения \ type localities

--Евсеев А.А. Географическая привязка первоначальных местонахождений минералов. - Новые данные о минералах. М.: Экост, 2002. Вып. 38, c. 113-124

Переименования (географических названий)

Перидот \ хризолит

Перовскит \\ Песок и минералы россыпей \\ Петалит

Пещеры

Пирит!!

Пироморфит \

Пироп \\ http://www.mindat.org/min-3321.html \\ фото (27) - www.mindat.org \\

Пирротин \ Pyrrhotite Fe1-xS \\ 882 фото - www.mindat.org/gallery(2020.08)

Плагиоклазы\\ \\ альбит \\ анортит \\ беломорит \\ клевеландит \\ лабрадор \\

Повеллит

Поделочные камни \\ Полевые шпаты \\

Поллуцит

Породообразующие минералы

Пренит - http://www.mindat.org/min-3277.html \\ фото (1002) - http://www.mindat.org/gallery.php?min=3277 - на 2009.05.27

Преподавание минералогии

Псевдоморфозы \\ фотогалерея - http://www.mineralatlas.com/specials/pseudo.htm

--The Mineral News, 2004-2007 \\ Указатель публикаций по авторам \ местонахождениям \ минералам

Р

Радхакришнаит* \ Radhakrishnaite (TL) PbTe3(Cl,S)2

- Россия: Октябрьский р-к, Норильск, Ср. Сибирь, Россия \ Oktyabrsky Mine, Talnakh Cu-Ni Deposit, Noril'sk, Putoran Plateau, Taimyr Peninsula, Taymyrskiy Autonomous Okrug, Krasnoyarsk Krai, Russia - фото

--- Панаречка, Кольский п-ов \ Panarechka volcano \ Чернявский, А. В., Волошин, А. В., & Войтеховский, Ю. Л. (2013). ЗОЛОТОРУДНЫЕ ПРОЯВЛЕНИЯ ПАНАРЕЧЕНСКОЙ ВУЛКАНО-ТЕКТОНИЧЕСКОЙ СТРУКТУРЫ, КОЛЬСКИЙ РЕГИОН: ТИПЫ МИНЕРАЛИЗАЦИИ. МАТЕРИАЛЫ МЕЖДУНАРОДНОЙ КОНФЕРЕЦИИ, 197.

- Индия:* Champion lode, Central Schist Belt, Kolar Gold Fields, Kolar District, Karnataka, India (Type Locality) \\ Genkin A D, Safonov Y G, Vasudev V N, Rao B K, Boronikhin V A, Vyalsov L N, Gorshkov A I, Mokhov A V (1985) Kolarite PbTeCl2 and radhakrishnaite PbTe3(Cl,S)2, new mineral species from the Kolar Gold Deposit, India, The Canadian Mineralogist, 23, 501-506

- Китай: Dongping Mine, Dongping Au-Te ore field, Shuiquangou Complex, Chongli District, Zhangjiakou, Hebei, China

Разнообразие минералов Софийский симпозиум

Реальгар \ Realgar As4S4 \\ 936 фото - mindat (2020.09)

- Румыния: No. 5 Mine, Baia Sprie, Maramures, Romania --фото

- Швейцария: Lengenbach Quarry, Fald, Binn, Goms, Valais, Switzerland --фото

- Китай: Jiepaiyu Mine, Shimen deposit, Shimen Co., Changde, Hunan, China --фото

Региональная минералогия (заметки)

Р-коллекция \\ В феврале 2008 г. в Минералогическом музее РГГРУ (Москва) были записаны первые образцы в новую тематическую коллекцию "Региональная и всемирная минералогия" (сокращенно - Р-коллекция)

Резной камень \\ Рисунок и живопись в камне \\ http://www.minrec.org/artmuseum.asp

Рисунки минералов

Родонит \\

Брусницын А.И. Минералогия месторождений поделочных родонитовых пород Среднего Урала // ЗВМО, 1998. № 3. С. 1–11.

Родохрозит \\

С - Се - Ск - Со - Ст

Самородные элементы

Сапфир

"Сборные" минералов по странам и регионам (10-15 избранных находок) \\ 1-е -в 2007 г .

Селен \\  http://www.mindat.org/loc-30078.html \\ фото селена - http://www.mindat.org/gallery.php?loc=30078

Селенит (разн. гипса) \\

Сера \\ Серандит \\

Серебро \\ silver - mindat --фото (1189), местонахождения (3716) -- на 2009.11.15

Силикаты от А-Я_краткий указатель к справочнику "Минералы"(том.III-V)

Симметрия в геологии, минералогии и не только

Скипетровидные кристаллы (в том числе обратные скипетры аметиста \ reverse sceptre из Боливии ( Esperanza Mine, near Bombori, Nor Potosi Province, Potosi Department) \\ http://www.mindat.org/ \\ http://www.mindat.org/photo-284819.html

Словари

--Кривовичев В.Г. Минералогический словарь.- СПб.: Изд-во С.-Петерб. ун-та, 2008. - 556 с. --СЛОВАРЬ МИНЕР. ВИДОВ - веб (В.Г. Кривовичев. Словарь минеральных видов. СПб, 2006)

--ГЕОЛОГИЧЕСКИЙ СЛОВАРЬ (включает раздел "МИНЕРАЛОГИЯ")

Смитсонит \\ Сода \\ Содалит \\

Спессартин \\ Сперрилит

Список минералов - http://en.wikipedia.org/wiki/List_of_minerals

Сподумен и его разновидности (кунцит, гидденит)

Справочник "Минералы"_краткий указатель к томам IV-V

Справочники

Ставролит

Сталактиты и псевдосталактиты \\

Стеллерит \\ Стильбит \\ Стихтит \\ Сугилит \\

Сфалерит

Сферокристаллы --см. http://geo.web.ru/db/msg.html?mid=1179562. \\ Сферокристаллические сферолиты - http://geo.web.ru/db/msg.html?mid=1175869

Сферолиты

Т -

Тальк - распределение по странам фотографий (279) талька на сайте www.mindat.org -- см. карту http://geo.web.ru/druza/k-33_talc_fd_171014.jpg

Типоморфизм \\ Титанит

Толбачит \\ https://www.mindat.org/min-3990.html

Топаз \\

Топонимика (интересная для минералога) \\ Мурзаев Э.М. Словарь народных географических терминов. М.: Мысль, 1984. - 654 с. - электронная версия

Торбернит Торий_минералы_ география находок \\ Тремолит \\

Турмалин (группа) \\

У

Уваровит

Увит \\ Улексит \\ Уранинит \\ Уссингит

Ф -

Флюорит

- Ottens, B. (2005): Chinese Fluorite. The Mineralogical Record 36(1), 59-68

 

Формы выделения минералов

Фото дня или на geo.web.ru/druza/ - "Вокруг света за 30 дней"

Фото дня на миндат.орг_ретроспектива - http://www.mindat.org/gallery.php?potd=1

Фото мест по всему миру - http://www.panoramio.com/map/

Фотоатлас минералов -- http://tw.strahlen.org/fotoatlas.html (834 minerals, 1148 photos)

Фотогалереи минералов - минералы от A до Z и число их фотографий - указатель для миндат.орг - http://www.mindat.org/photoindex.php--http://www.mineralatlas.com/ \\ http://kristallov.net/index.html \

Фотографии минералов - страница Б.З. Кантора на http://www.mindat.org/user-17280.html - 275 фото (2016.08)

Олег Лопаткин на -- http://www.mindat.org/user-10732.html

Фотосъёмка минералов \\ \\ http://klopotow.narod.ru/soveti/foto.html

--Фото минералов - впервые в рамках Фестиваля "Первозданная Россия" (2016) \\ Подробнее: http://ilm.narod.ru/

Фторапатит

Фториды

1. Виллиомит. Коашва р-к, Хибины, Кольский п-ов, Россия. Просвечивающий спайный выколок. Образец: ФМ (приобретение, 2000). 2. Флюорит (зелен. куб. кристалл 15-18 см). Дальнегорск, Приморье, Россия. Образец: Мин. музей им.А.Е. Ферсмана РАН (№83419). Фото 1-2: © А.А. Евсеев

Фульгурит     FULGURITE . Выдющийся по размерам (110 см) образец из новых поступлений в Минер. музей им. А.Е. Ферсмана (№ ОП-3091, коллекция "Образований и превращений минералов" ) \\ Серого цвета древовидный фульгурит - природное образование из переплавленного при ударе молнии в силикатное стекло (лешательерит) кварцевой составляющей песка с включениями непереплавленных песчаных частиц. Ветвистость обусловнена формой прошедшего через влажный песок электрического разряда. Размер образца по размаху ветвей ~ 110 х 50 х 10 см. Долина реки Селенги в окрестностях города Гусиноозёрск район, Бурятия, Россия. Дар. Белаковский Д.И. 2020.            

Х -

Халцедон \\ http://www.mindat.org/min-960.html ; фото (541) - http://www.mindat.org/gallery.php?min=960

Халькантит \\ Халькопирит \\

Холтит \ Holtite \\ https://www.mindat.org/min-1925.html

Хризопраз

Хризотил \ Chrysotile Mg3(Si2O5)(OH)4

Хризотил-асбест \\

Хромит

Ц -

Цвета минералов

- Красный

1. Виллемит (разн. трустит; кристаллы до 5 см; люминесцирует зеленым), кальцит (люминесцирует красным; см. также фото). Франклин, Нью-Джерси, США. (№49879, зап.1950 г.). 2. Пеццоттаит.[Амбатувита], Мадагаскар. (№91611) Корунд (разн. рубин). 3. Могок, Мьянма. (№50328. Ферсман А.Е., запись 1950 г.). 4. Кварц. Второй Советский р-к, Дальнегорск, Приморье, Россия. Кристаллы длиной до 4 см. Розовато-оранжевый цвет за счет включений гематита по зонам роста. (№91396). Образцы: ФМ. Фото: А. Евсеев.

Цветные камни

--Буканов В.В. Энциклопедия "Цветные камни" - официальный сайт

Целестин

Цеолиты \\

- Tschernich, R. W., 1992, Zeolites of the world: Geoscience Press, Inc. [Phoenix, Ariz.], 563 p.

Церуссит \\ Циркон \\ Цитрин

Цоизит

Ч -

Чароит \\ Чароит. Сиреневое чудо Сибири. Иллюстрированное научно-популярное издание. - Иркутск6 изд-во "Петрографика", 2011. - 192 с. (авторы текстов: Рогова В.П., Воробьев Е.И. и др.)

ШЩ

Шары и яйца из камня

Шаттукит

Шахтёрская энциклопедия - MiningWiki — энциклопедия о шахтах и шахтёрах, создаваемая совместными усилиями горняцкого сообщества. 

Шеелит \\

Шерл

Шорломит

Шпинель

Шунгит

Щелочные массивы \\ XXV Всероссийский семинар с участием стран СНГ. Геохимия магматических пород. 23-26 мая 2008 г. Школа Щелочной магматизм Земли   \\ http://alkaline2008.narod.ru/ \\ Тезисы - http://alkaline2008.narod.ru/Abstract.htm

Щелочные массивы мира - минералы в фотографиях

Ловозеро - 1161 ф mindat
Albite - 6 ф
Dorfmanite - 3 ф
Manaksite (TL) - 13 ф
Tainiolite -12 ф
Zorite - 32 ф
Хибины - 1164 ф \ Khibiny - mindat
Aegirine - 11ф
Delhayelite -13 ф
Manganoneptunite (TL) - 11 ф
Titanite - 9 ф
Zircon - 8 ф
Илимауссак 445 ф - mindat
Aenigmatite (TL) - 7 ф
Murmanite - 4 ф
Westerveldite - 5 ф
Сент-Илер - 5665ф- mindat
Manganoneptunite - 59 ф
Terskite - 10 ф
Zircon - 68 ф

Минералы, выделяющиеся по количеству фотографий (ф) в крупнейшей базе данных https://www.mindat.org - примеры (первые минералы в списке на буквы A, D, M, T, Z). Данные на 2020.10.22. Составил: А. Евсеев.

Э

Эвдиалит \\ \\ https://www.mindat.org/min-1420.html - 234 фото (2018.06): Россия - 64; Швеция - 15; Гвинея -1; ЮАР - 1; Мадагаскар - 2 ; Гренландия - 24; Канада - 82; США-41; Бразилия-3

Эвклаз

Эгирин \\ местонахождения (595) - http://www.mindat.org/min-31.html \\ фото (169) - http://www.mindat.org/gallery.php?min=31 (на 2009.03.22) \

Экскурсии_ минералогические экскурсии. \\ В Гос. геол. музей им. ВИ. Вернадского

Эльбаит \\

Эпидот \\

 

Ю -

Я \\ Я_ Заметки geo.web.ru/druza

Янтарь \\

Ярмарки минералов и драгоценных камней \\

Ярозит \\

Яшма

ЯШМА В РОССИИ [по А.Е. Ферсману] - http://pictoris.ru/5/27/index.html

ОПИСАНИЕ РУССКИХ ЯШМ [по А.Е. Ферсману] - http://pictoris.ru/5/29/index.html

МЕСТОНАХОЖДЕНИЯ МИНЕРАЛОВ

- А-Я _Список местонахождений минералов России и республик бывшего СССР

- А-Я \ А-Z_Список местонахождений минералов, стран и регионов мира

Местонахождения минералов \ mineral localities на сайте и на страницах справочника Евсеев А.А. Географические названия в минералогии. Краткий указатель. Ч. I, М. , 2000. - 269 с.; Ч. II, М. , 2000. - 282 с.
Часть I и II (выборочно):

м-н-ния
А
Б
В
Г
Д
Е
Ж
:З
И
Й
К
Л
М
Н
О
П
Р
С
Т
У
Ф
Х
Ц
Ч
Ш
Щ
Э
Ю
Я
стр.
10-
26-
45-
54
-
63-
73-
75-
77-
81-
87-
88-
122-
132-
151-
160-
166-
180-
188-
213-
226-
234-
239-
247-
249-
255-
260
260-
265-
267-
Locality
A
B
C
D
E
F
G
H
I
J
K
L
M
N
O
P
Q
R
S
T
U
V
W
X
Y
Z
cтр.
9-
24-
44-
63-
71-
78-
86-
97-
108-
113-
118-
135-
148-
173-
181-
188-
203
204-
214-
243-
257-
260-
268-
275-
276-
278-

См. также http://www.mining-enc.ru

Северная Америка
2
33

Новые страницы из серии "Местонахождения минералов" на сайте http://geo.web.ru/druza/index.html за 2019 г.

А

Аделаида Майн, Дундас, Тасмания, Австралия

Адун-Чолон (= Адун-Чилон), Вост. Забайкалье , Россия

Айфель = Эйфель \ Eifel горы (палеовулкан), Рейнланд-Пфальц, Германия \ Eifel, Rheinland-Pfalz, Deutschland

Акжайляу, к В от г. Аягуз, Вост. Казахстан \\ апатит!!!--с александрит. эффектом; КВАРЦ!!!--xl 10 м; кристалл дымч. кварца 5,8 м в длину и 1, 5 м в поперечнике, весил около 90 т-находка в южной части массива (Ерджанов К.Н., 1963);

Акчатау \ Akchatau, Ц. Казахстан \\

Аллуайв, Ловозеро, Кольский п-ов, Россия. \\ 67°51` с. ш. 34°32` в. д.

Алту-Лигонья, Мозамбик

Альмаден, Испания

Арендаль, Ю. Норвегия.

Астафьевское м-ние, Ю. Урал, Россия\\ http://www.mindat.org/loc-192610.html

Ахалцихе (р-н), Грузия.

Ахматовская копь, Ю. Урал, Россия

Б - местонахождения минералов

Баженовское м-ние , г. Асбест, 60 км к СВВ от Екатеринбурга, Ср. Урал, РФ

--Юрий Викторович Ерохин. Минералогия родингитов Баженовского месторождения (Средний Урал).

Минералогический Альманах, том 22, выпуск 3, 2017. Москва: «Минералогический Альманах». 136 стр., 236 иллюстраций, из них 212 фото минералов.

Белореченское м-ние, Сев. Кавказ, Россия

Барит. Белореченское м-ние, Сев. Кавказ, Россия. Дар фирмы "Мир минералов", 2010. ГГМ им. В.И. Вернадского, Москва. 2020.09.04. Фото: А. Евсеев

Бербес, Астурия, Испания \ Berbes, Asturia, Spain \\ см. на карте

Березовское золоторудное месторождение, Средний Урал, Россия \

Биг-Фиш-Ривер \ Big Fish River, 70 км к СЗ от Аклавик, хр. Ричардсон, Юкон, Канада \\ *баричит; *виксит; *горманит!!; лазулит!!; *маричит; *нахпоит; * новые мин.—6 видов; *саттерлиит; MR, 1999, 50 \\ http://www.mindat.org/loc-628.html

Бинн дол., Валлис, Швейцария \ Binn ValleyValaisSwitzerland \\ на карте --1 - 2 - \\ минералы - 276 ; новые минералы - 53 ; фото минералов -  2857(на 2020.09) -  www.mindat.org \\ см. также Ленгенбах

Бисби, Аризона, США

Борон, округ Керн, Калифорния, США \\ в этом же районе находится заброшенный ныне подземный р-к Бейкер майн \ Baker mine, U.S. Borax Mine (Pacific West Coast Borax; Pacific Coast Borax Co.; Boron Mine; U.S. Borax and Chemical Corp.; Kramer Mine; Baker Mine), Kramer Borate deposit, Boron, Kramer District \ подробнее - mindat

Брокен Хилл (Broken Hill), Н. Ю. Уэльс, Австралия, 31-57` ю. ш. , 141-26` в. д. \\ http://www.mindat.org/loc-72.html

--Панов Б.С. Мировой уникум Брокен-Хилл в наше время \ Известия ВУЗов. Геология и разведка, 2004, №4 

Брумаду \\ Бу-Аззер, Марокко \\ Бурпала , Прибайкалье (С), Россия

Бушвелд, интрузив, Южн. Африка

В

Ватиха, Мурзинка, Ср. Урал, Россия

Везувий и Монте-Сомма, Италия \\

Величка, Польша

Верхнекамское м-ние (Соликамский участок и др.) , 180 км к С от Перми, Приуралье, РФ \\ галит!!—xls< 10 см; гёргейит! (Чайковский И. И. , 2011); калистронцит (Чайковский И. И. , 2011); карналлит!!!--xls<8-9 см (техногенное образование) ; пирит!--xls; сильвин!; Смо, 355

Весселс \ Wessels mine, Калахари, Сев. Капская пров., ЮАР

Вишневые горы, Ю. Урал, Россия \\ фотогалерея и др. - http://webmineral.ru/

Водинское м-ние, к ССВ от Самары, Ср. Поволжье, Россия

--Сидоров А.А. Минералогия Водинского месторождения самородной сера Самарской области и история его окрытия. Учебное пособие. Самара: Самар. гос. техн. ун-т, 2011. - 189 с.

Володарск-Волынское пегм. поле, пос. Володарск-Волынский, к З от Житомира, Волынь , Украина \\ берилл!!!--ф; гетит!!!; кварц!!; керит!!; микроклин!; опал!; топаз!!!--xls>100 кг; фенакит!!

Воронцовское м-ние, Краснотурьинск, Сев. Урал, Россия \\ Подробнее: http://webmineral.ru/

Вороньи тундры, Кольский п-ов, Россия

Г

Горихо (Gorikho), м-ние, в ср. и ниж. теч. р. Горихо (приток р. Тола, басс. р. Селенга), 45 км к В от Урги [Улан-Батора], Монголия \\ берилл!; горный хрусталь!; топаз!!; флюорит!; Ф, 491; Ш, 28, 197

Горни-Славков ( (ныне) = Шлаггенвальд (быв.) (Horni Slavkov (now) = Schlaggenwald (form.)), 12 км к ЮЮЗ от гор. Карловы Вары , Богемия, Чехия

Гумешевский р-к, Ср. Урал, Россия

Д

Дальнегорск (и район), Приморье, Россия \\ Дальнегорск в www.mindat.org \\ на 2019. 01.08: минеральных видов - 175; новый минерал - 1(дальнегорскит); фото мин.-2108 \\ сравн. на 2008.08.04 - минер. видов - 170; фото мин.-545 \\ Источник: http://www.mindat.org/loc-2635.htm

- Бор к-р - Боросиликатное м-ние \ Второй Советский р-к \\ Николаевский р-к \ Верхний р-к

Дараи-Пиоз (= Дараи-Пиез = Дара-и-Пиоз = Дарапиоз) (Dara-Pioz) , 45 км к СВ от пос. Гарм и 35 км к ССВ от Таджикабада, Алайский хр. , Таджикистан; 39° 28' North , 70° 42' East \\ http://www.mindat.org/loc.php?loc=3241

Таджикит в кварце. Дара-и-Пиоз, Таджикистан. Кристалл ~15 мм. Минералогический музей МГРИ (№56). Фото: © А.А. Евсеев.

Дашкесан, Азербайджан \\

Джезказган, Казахстан

Джоплин, Миссури, США

Дукат м-ние, 30 км к СЗ от пос. Омсукчан, Магаданская обл. , РФ (СВ) \\ агвиларит; гельвин!; манганит!; науманнит!; платинит!; родонит!; серебро!!; стуртит!; цианотрихит!; цинкит; энаргит!; ялпаит

Додо м-ние, Прип. Урал, Россия - http://www.polarquartz.ru/dep-dodo.html

Е

Ермаковское м-ние, Забайкалье, Россия

Ж

З

Зебергед о. \ Zabargad о., Красное море, Египет

Завитинское (Завитая), м-ние, Вост. Забайкалье , Россия \\ адуляр!; воробьевит!; касситерит!; кукеит!; петалит!!; ростерит!; сподумен!!; турмалин!!; Смо, 351

Змеиногорский р-к (Zmeinogorsk) = Змеиногорское м-ние, Алтай, Сибирь (ЮЗ), РФ

И

Ивигтут \ Ivigtut = Ivittuut, Ю. Гренландия \\ *(1997) йоргенсенит; криолит!!! (М 2-1); * новые мин.—17 видов; пахнолит!! (М 2-1)--xls<4, 5 см; разн.--около 100 мин.; сфалерит! (М 1-1); томсенолит!! (М 2-1); хиолит! (М 2-1); ярлит! (М 2-1); BBM, 68.

Идар-Оберштайн \ Idar-Oberstein Германия (ЮЗ) \\ агат!! \\ 500 лет (с 1375 г. по 1875 г) в этом районе разрабатывались месторождения агата, велась его обработка. Сегодня небольшой городок - крупнейший центр торговли минералами, драгоценными и поделочными камнями, его называют "самоцветной столицей мира." .

Изумрудные копи, Ср. Урал, Россия

Илимауссак, Ю. Гренландия

Ильмены. Ю. Урал, Россия \\ карта и др. http://reserves-park.ru/index/0-204 \\ http://nashural.ru/Mesta/ilmeni.htm

Индер (Inder) (= Индерское м-ние), 15 км к В от пос. Индерборский, 150 км к С от Атырау (= Гурьев (быв.)), Сев. Прикаспий, Казахстан

Итинокава, о. Сикоку, Япония.

Иультин, Чукотка, Россия

Й - К

Каменушинское м-ние (Cu), к С от г. Салаир, Кемеровская обл., ЮЗ Сибирь, Россия

Кап-Гарон \ Cap Garonne, близ Le Pradet, 12 км к В от Тулона, Вар, Франция

Капильитас, Катамарка, Аргентина

Карадаг, Крым, Россия

Карамазар (Karamazar) рудный район, Сев. Таджикистан

Кара-Оба = Караоба \ Kara-Oba, м-ние (Mo-W), пос. Джамбул (47-11`N, 71-23`E), Ц. Казахстан 

Карнасурт, Ловозеро, Кольский п-ов

Кацна яма (копь), 15 км к СВ от Первоуральска, Ср. Урал, Россия \\ эпидот!! (“пушкинит”!!

Кемпирсайский массив, Южн. Урал; Казахстан \\ Юричев А.Н., Чернышов А.И., Корбовяк Е.В. Минералы платиновой группы из хромититов Кемпирсайского ультрамафитового массива (Мугоджары, Казахстан): новые данные. Записки Российского минералогического общества. 2019;148(2):76-86

Кент, м-ние, гранитный м-в и грейзенизированные гранитные пегматиты, 30 км к ЮВ от пос. Карагайлы и 50 км к ЮВ от Каркаралинска, Ц. Казахстан

Керченское м-ние, Крым, Россия \\ анапаит!!!; барит!! вивианит!!; * митридатит; родохрозит, Ca-вый!!--пс-зы по раковинам (ф); смайтит!; Смо, 352; Pk

Кипуши, ДР Конго \\

Кировский р-к, Кировский р-к, Кукисвумчорр, Хибины, Кольский п-ов, Россия

Клара р-к \ Clara Mine (=Clara Grube ), Шварцвальд, Германия --барит!!; клараит*; новые. минералы*!!--14 вид.; разнообразие!!-441 видов; хайдарканит!; флюорит!!; чухровит-(Ce)* \\ Clara Mine, Rankach valleyOberwolfachOrtenaukreisFreiburgBaden-Wurttemberg,Germany; 6126 фото минералов (2019.09) ; 48° 22' 59'' North , 8° 14' 47'' East - https://www.mindat.org/loc-1782.html

Ковдор \\

--Иванюк Г.Ю., Яковенчук В.Н. Минералы Ковдора. Апатиты: изд. Кольского научного центра РАН, 1997. 116 с.

--Иванюк Г.Ю., Яковенчук В.Н., Пахомовский Я.А. Ковдор / Kovdor. Апатиты: Минералы Лапландии, 2002. 326 с.

Конгсберг (Kongsberg), Норвегия \\ * конгсбергит; пренит!; серебро!!!; флюорит!—розовый; ВВМ, 68, 174, 176, 178, 179 \\ O. Johnsen, Mineralogical Record, 1986, 17, 19-36

Кондёр г. , м-в ул.-осн. и щел. пород (Kondoer = Konder), Алданский щит, 75 км к З от пос. Джигда и 100 км к ЗЮЗ от пос. Нелькан, ниж. теч. р. Маймакан, Хабаровский край, РФ \ фото 3D - http://www.mindat.org/photo-619937.html

Консельейру-Пена \ Conselheiro Pena District (пегматитовый район), 21 км к С от Дивину-да-Ларанжейрас, (р-н), Минас-Жерайс, Бразилия

Копейск, Челябинский угольный басс., Ю. Урал, РФ \\ *(1990) дмиштейнбергит—шх. 45; *(1986) копейскит; нашатырь!; * новые мин.--8 видов; *(1990) рорисит—шх.45; *(1989) святославит; * сребродольскит!; *(1988) тиннулкунит—шх.44; * флюорэллестадит--ф; Pk \\

Коршуновское м-ние, Иркутская обл., Вост. Сибирь, Росссия

Кремиковцы = Кремиковци (Kremikovtsi), ~ 15 км к СВ от Софии, Болгария \\ азурит!; барит!; витерит!!; гематит!!; гетит!!; кальцит!; лепидокрокит!; норсетит!! (ММ); родохрозит!!; романешит!!

Кубер-Педи , м-ние (Coober Pedy field), 180 км к С от гор. Туркула и 750 км СЗ от Аделаиды, Ю. Австралия \\ благородный опал!!!--пс-зы!! по раковинам, белемнитам и др

Кугда массив, 10 км к С от устья р. Котуйкан (прит. р. Котуй) и 150 км к ЮЮВ от Хатанги, Ср. Сибирь (С), Россия \\ вермикулит!; перовскит!; Ti-клиногумит!!--xls< 3 см; хризолит!!

Кукисвумчорр, Хибины, Кольский п-ов, Россия \\ Петараситовая жила, Тульйок река (верховья), Кукисвумчорр гора, Хибины, Кольский п-ов, Мурманская область, Россия

Кухилал (Kukhilal) = Кухи-Лал = Кугиляль = Кох-и-Лал, Памир (ЮЗ), Таджикистан

Л

Лаахерское оз. и другие знаменитые местонахождения минералов (примеры): Сент-Илер \ Илимауссак \ Ловозеро \ Хибины \ Лангезундфьорд \ Лаахерское оз. \ Фого вулк. \ Лос о-ва \ Арис --см. на карте

Лаврион = Лавриум, Греция \ Laurium (= Laurion = Lavrion (нем.)), Greece \\ адамин!!; аннабергит!!; арагонит!; кабрерит!; * (1887) лаурионит!; миксит (группа); * новые мин.-- 22 вида(2019.10); пенфильдит!!; разн. - 592 минер. вида (2019.10) * (1881) серпиерит!!; смитсонит; цианотрихит!!; * (1881) цинкалюминит; *(2000) цинквудвардит; MR, 1998, 508; мин. в иллюстрациях--список фото (по www.mindat.org - 340 фото на 22.03.2004 \\ 3796 фото минералов на 2018.10.30 \\ \\ фотогалерея--http://www.mineral-forum.com/ \\ фотогалерея минералов - http://www.mindat.org/g/554

LavreotikiEast AtticaAtticaGreece \\ 684 минер. видов; в т.ч. 28 новых видов; 5963 фото минералов (2020.08.28) \\ Источник:  https://www.mindat.org/loc-14187.html \\ на карте - 01

--Чуканов Н., Пущаровский Д. ,  Зубкова Н. , Пеков И. и др. Цинколивенит CuZn(AsO4)(OH) – новый минерал группы адамина с упорядоченным распределением меди и цинка /  // Доклады Российской Академии наук. — 2007. — Т. 415, № 3. — С. 377–382.

Лакарги гора, Верхнечегемская вулканическая структура, Кабардино-Балкария, Сев. Кавказ, Россия \ Lakargi Mt., Verkhnechegemskaya caldera (Upper Chegem caldera) ; ксенолиты скарнов в игнимбритах; 43°17'N ; 43°6'E \

Лангезундфьорд = Лангесунн-фьорд (Langesund(s)fjord), Ю. Норвегия

Ленгенбах, Бинненталь, Швейцария \\ http://en.wikipedia.org/wiki/Lengenbach_Quarry

Ловозеро, Кольский п-ов, Россия

Ловозерский м-в в https://www.mindat.org

минералы - 394

новые минералы - 107

фото минералов - 1159

на 2020.08.21

Ловозеро.   www.mindat.org -- фото минералов -  1117 (на 2019.07.15)

Минералы Ловозерского массива массива в серии "фото дня" на www.mindat.org: катаплеит \\ кариохроит \ Caryochroite \\ казаковит - Palitra pegmatite, Karnasurt mine, Kedykverpakhk \\ катаплеит \ Catapleiite  \\ коробицынит \ Korobitsynite  \\ лоренценит \ Lorenzenite  \\ стронциопирохлор \ Strontiopyrochlore \\ Фторапатит, Mn-сод. \ Fluorapatite (Var: Manganese-bearing Fluorapatite) . Селсурт (Сэлсурт) г. \\ чёрчит-(Y) \ Churchite-(Y)  Y(PO4)·2H2O , Tsepinite-Na

Лонгбан, Вермланд, Швеция \\ 59°51'13"N , 14°15'34"E

М

Мало-Быстринское м-ние (= Малобыстринское), м-ние, 18 км к З от Слюдянки, Прибайкалье (ЮЗ), РФ \\ афганит!; * (1991) быстрит--ф; лазурит!!!; сера!; * тункит; Pk (ф)

Малханское м-ние , Забайкалье, Россия

Маунт-Кобальт, 120 км к Ю от Клонкерри, Квинсленд, Австралия \ Mount Cobalt ( Mt Cobalt Mine), Selwyn District , Mt Isa - Cloncurry area , Queensland , Australia -- http://www.mindat.org/ \\ фото: гетерогенит!-ф; кобальтин!--ф; мансфельдит (6); смольяниновит—пс-зы по эритрину (кр-лы до 2 мм (3); сферокобальтин!--ф; эритрин!!!—(10 фото);

Маунт-Малоса \ Mt. Malosa, близ Зомба, Малави, Вост. Африка \\ барилит!; микроклин!; миларит!; ниобофиллит!!--фото-- www.mindat.org/gallery1; ортоклаз!; паризит!!; разн. 48 мин. (44 достоверных вида); эгирин!!!—xls> 20 см; эпидидимит!!—xl 5, 4 см; D; L, 1999, №4, 22-32; 48 entries listed. 44 valid minerals-- www.mindat.org (2008.02.24)

--Cairncross, B. (2002). Aegirine and Associated Minerals from Mount Malosa, Malawi. Rocks & Minerals, 77(1), 31-37.

Машамба-Уэст р-к, Катанга, ДР Конго. \\ Везиньеит--ф; карнотит!--ф; кобальтодоломит!!--ф; кобальтокальцит!!-ф; колвезит!--ф; куприт!!-ф; малахит!!--ф; метатюямунит!--ф; планшеит!--ф \\ рудник начал работу в 1978 г. \\ Источник: http://www.mindat.org/loc-4334.htm

Меднорудянский р-к, Ниж. Тагил, Ср. Урал, Россия.

1. Малахит. Меднорудянский р-к, Ниж. Тагил, Ср. Урал, Россия. Образец: Мин. музей им. А.Е. Ферсмана РАН (Строганова, наслед., 1919). 2. Малахит. Меднорудянский р-к, Ср. Урал, Россия. Образец: ФМ (№12117). Фото 1-2: © А.А. Евсеев.

Мерек (= Мерекское), м-ние, ~40 км выше устья р. Мерек (приток р. Амгунь), близ ж.-д. ст. Эанга, к ЮВ от Чегдомына, 270 км к С от Хабаровска, Буреинский хр. , Хабаровский край, РФ \\ касситерит!!—xls \\ Мерек рудопр-ние, в верх. р. Мерек (левобережье р. Амгу)-касситерит!!-фото; рядом-пром. россыпи касситерита-- Расческин Е.В., 2004, 206-207 \\ Д..А. Петроченков. Касситерит [Мерек] и аммониты [Европ. Россия] в ювелирных изделиях--сообщ. в клубе друзей минералогии (2008.06.06)

Мерелани-Хиллс \ Merelani Hills, Танзания \\ алабандин!!!--xl 9x6x4 см; добыт в 2013 г.--фото www.mindat.org

Мибладен, Марокко \\ в поисках ванадинита - видеосюжет www.youtube.com/

Могок = Могоу (новое название, по Е.Я. Киевленко, 2001) (Mogok District), Мьянма (= Бирма (быв.)

Мурзинка, Ср. Урал, Россия

Мурунский массив = Мурун (Murun), близ г. Мурун (1452 м), междуречье рр. Чара и Токко, ~50 км к ЗЮЗ от пос. Торго, Алдан (СЗ), Якутия (ЮЗ), РФ \\\\ Сиреневый Камень месторождение чароита --http://petrographica.ru/

Мусонои р-к \ Musonoi mine, ~25-30 км к З (по другим данным -10 км к СЗ ) от Колвези (10°41`S, 25°39`E), Катанга (быв. Шаба, ДР Конго (быв. Заир); \\ 10° 43' 37'' South , 25° 27' 10'' East - https://www.mindat.org/loc-4322.html

--Wilson, W.E. (2018) The Musonoi mine, Kolwezi District, Lualaba Province, Democratic Republic of the Congo. Mineralogical Record, 49, 236-304.

--Новые минералы - https://www.mindat.org/loc-4322.html (на 2019.07) : Demesmaekerite (TL) \\ Derriksite (TL)\\ Guilleminite (TL) !! \\ Kolwezite (TL)\\ Marthozite (TL) \\ Oosterboschite (TL) \\ Verbeekite (TL)\\ \\

Мусонои в www.mindat.org

минералы -81

новые минералы - 7

фото минералов - 737

на 2019.07.10

--Wilson, W. E. (2018) The Musonoi mine, Kolwezi District, Lualaba Province, Democratic Republic of the Congo. Mineralogical Record 49:236-304

Названия местонахождений - что они означают?--Андамука \ Andamooka - знаменитое месторождение благородного опала в Южн. Австралии (30° 27' 14'' S, 137° 10' 15'' E--mindat). Андамука на языке аборигенов означает "нет названия" \ "no name"

Найка, Чиуауа, Мексика \\

Насик (=Нашик) - Пуна \ Nashik distr. - Pune, Махараштра шт., Индия.

Неройка г., Прип. Урал, Россия \\ Додо м-ние

Никитовское ( = Никитовка), м-ние, ~ 6 км к СЗ от гор. Горловка [ в его черте ] , Донбасс, Украина \\ антимонит!!--xls< 18 см; киноварь!!; мелантерит!; * феррогексагидрит; Багатаев М. Н. , 1997 (МК, №12, 17-23; WS, №12, 10-14); Смо, 354; Pk

Норильский р-н, Ср. Сибирь, Россия

Айоваит (желтые пластинки) в гипсе. Талнахский р-к, Норильск, Ср. Сибирь. Образец: Геолог. музей им. В.В. Ершова. Горный ин-т, НИТУ МИСиС. Фото: © А.А. Евсеев. \\ НМК-146

Н`Чванинг (N`Chwaning), р-ки (без уточнения) , к СЗ от Куруман, Калахари (Mn)-рудное поле, ЮАР \\ афвиллит!!!--xls< 1 см; браунит!!--xl 1, 6 см (ф); журавскит!--xls; кариопилит!!; лейкофеницит!--xls< 3 мм; портландит!!!--xls< 3 см; MR, 1992, v. 23, 436; MRI

О

Одихинча \ Odikhincha, м-в, р. Котуй, 110 км к ЮЮВ от Хатанги, Ср. Сибирь, Россия

Олдоиньо-Ленгаи\ Oldoinyo Lengaii = Ol Doinyo Lengai volcano, к СЗ от гор. Аруша, Танзания; "единственный в мире действующий карбонатитовый вулкан"(Keller J. et al., 1990); 2°44`S, 35°53`E (Dana, 1997)\\ \\ вишневит! (D); МЩ, 146; \\ http://www.mindat.org/min-4190.html \\

Ору-Прету (район), Минас-Жерайс, Бразилия

Отоме,, р-к (Otomezaka = Otome mine), Makioka-cho , Yamanashi City , Kinpuzan district, преф. Яманаси (Yamanashi Pref.), Япония \\ : http://www.mindat.org/loc-220223.html

Оутокумпу, рудное поле \ Outokumpu, Финляндия \ Outokumpu Cu-Co-Zn-Ni-Ag-Au ore field, North KareliaFinland \\ знаменитое местонахождение минералов \\ алабандин \ Alabandite; андуоит\ Anduoite; карелианит*(1963) \ Karelianite (TL) ; кобальт-пентландит* \ Cobaltpentlandite (TL) ; пентландит!--М-1-1, 181а); уваровит!!!--1) 68 фото 2) xls<4,6x2,6 см; ульманнит \ Ullmannite ; уранинит \ Uraninite ; хаапалаит* \ Haapalaite (TL) ; халькопирит; хром-диопсид!--28 фото ; цоизит \ Zoisite ; эпидот, Cr-сод.("тавмавит"); *(1958) эсколаит!!; \\ 82 мин. видов \ valid minerals. 4 (TL) - новых минералов \ type locality of valid minerals. \\ ВВМ, 74; R&M, 1998, 126 \\ \\ Подробнее: http://www.mindat.org/loc-6416.html

Охуэла р-к \ Ojuela mine, Мапими, Дуранго, Мексика \\ кобяшевит!!--новинка Тусон-шоу 2016 г.--фото- http://webmineral.ru/

П

Пайкс-Пик, округ Эль-Пасо, Колорадо, США \ Pikes Peak, El Paso Co., Colorado, USA ; 38° 50' 25'' North , 105° 2' 30'' West \\ амазонит!!!--27фд; сидерофиллит* \ Siderophyllite (TL)

Пала, округ Сан-Диего, Калифорния, США \\ берилл розовый!; кунцит!!; лепидолит!; эльбаит!!!

Палитра пегматит, Кедыкверпахк г., Ловозеро \\ PEKOV, I.V. (2006) The Palitra pegmatite, a newly discovered hyperalkaline pegmatite in the Lovozero massif, Kola Peninsula, Russia. Mineralogical Record, 36, 397-416.

Панашкейра \ Panasqueira; Португалия; 40°10`N , 7°46`W;

Педернейра, р-к (Pederneira mine), Минас-Жерайс, Бразилия \\ эльбаит!!!--xl 20 см (ф), MR, 2000, #1, 56 \\ 18° 10' 9'' South , 42° 10' 59'' West - www.mindat.org

Первомайский (= Трудолюбовский) к-р, 1, 5 км к В от с. Трудолюбовка, гора Кермен, 20 км к ЮЮЗ от Симферополя, Крым, Россия. \\ анальцим, бабингтонит; гидроксиапофиллит!!; гиролит!; окенит!; МК, 1996, №9, 9

Первоначальные местонахождения (type localities) минералов на карте мира

Перекатное м-ние, Алдан, Якутия, Россия. \\ https://webmineral.ru/deposits/item.php?id=1449

Питкяранта, Сев. Приладожье, Ю. Карелия, РФ \\ См. http://karelnedra.karelia.ru/mnia/sn_karelia.htm

Плоская г. , Кейвы, Кольский п-ов, Россия; амазонитовые пегматиты с редкими минералами Y и Yb \\ Гора Плоская 2015 - фоторепортаж - http://webmineral.ru/

Пршибрам, рудное поле, Чехия \ \ Pribram ore field, Czech Republic

Пуйва, Прип. Урал, Россия \\ Пуна\ Poona = Pune (район Пуны), Индия

Р

Рай-Из гипербазитовый массив (район), хр. Марун-Кеу, ж.-д.. ст. Харп, ЯНАО, Тюменская обл., Пол. Урал, Россия

Расвумчорр, Хибины, Кольский п-ов, Россия

Ратнапура, Шри-Ланка

Роджерли майн\ Rogerley mine, Дарем, Камбрия, Англия, Великобритания

Рубцовское м-ние, , (рудник отработан и затоплен), 20 км к ЮВ от г. Рубцовск близ северной окраины дер. Потеряевка, Алтай, Россия; 51°28'14'' с.ш., 81°29'34'' в.д. \\ азурит!!; коннеллит!--фото ; йодаргирит!; куприт!!!; майерсит!!; маршит!!; медь!!; серебро!

Рудные горы, Гемания \ Чехия

С

Садбери Дистр. \ Sudbury District, OntarioCanada - 285 фото минералов - https://www.mindat.org/loc-571.html

Сан-Жозе-да-Сафира \ Sao Jose da Safira (San Jose de Safira), Минас-Жерайс, Бразилия - фото
http://www.hummingbirdminerals.com/IMG_2787zc.jpg \https://www.mindat.org/loc-571.html http://www.hummingbirdminerals.com/mixedminerals7page3.html \\ - фотогалерея - http://www.mindat.org/gallery.php?loc=5894 \ http://www.mindat.org/gallery.php?cform_is_valid=1&loc=5894&cf_pager_page=4

Санкт-Андреасберг, Гарц, Ниж. Саксония, Германия (33_5) \ St Andreasberg District, Harz Mts, Lower Saxony, Germany \\ апофиллит!!; *арсенолит; *брейтгауптит; *гармотом!!!; дискразит!!; кальцит!!!; миаргирит!; мышьяк!!; нов. мин.--4 вида; пираргирит!!!; прустит!; разн.-220 мин.(198 мин. вид.)--http://www.mindat.org/loc-22230.html (на 2008.09.04) ; * самсонит!!; стефанит!!; ВВМ, 46, 56, 240

Сарановское м-ние, Ср. Урал, Россия

--О.К. Иванов. Минералогия Сарановского хромитового месторождения, Урал. - Минералогический Альманах, том 21, выпуск 2, 2016 - http://www.minbook.com/book.php?book=120&russian=1

Сарбайский р-к \ Sarbayskii mine (= Сарбайское м-ние) и Соколовский р-к, гор. Рудный, 45 км к ЮЗ от Кустаная, Казахстан

Сент-Илер массив, Квебек, Канада; 45° 33' 11'' North , 73° 9' 7'' West - http://www.mindat.org/loc-123123.html

--Сент-Илер-- более 5369 фото минералов (на 2019.02). Из них : 306-серандит!!!; 200 -катаплеит!!!+Gui-72; 186-родохрозит;124-анальцим;111-карлетонит!!!;111-натролит; минералов - 415; новых минералов - 66 \ 415 valid minerals. 66 (TL) - type locality of valid minerals. Источник: https://www.mindat.org/loc-123123.html

Минералы Сент-Илера (Квебек, Канада). 1. Анальцим. 2. Астрофиллит. 3-4. Эльпидит. Подробнее см. https://geo.web.ru/druza/l-St-Hilaire_0.htm

Расвумит \ Rasvumite . Poudrette quarry, Mont Saint-Hilaire, La Vallee-du-Richelieu RCM, Monteregie, Quebec, Canada. Высота кристалла ~4 мм. Образец и фото: Modris Baum Это изображение было передано в общественное достояние и может свободно использоваться. Источник: www.mindat.org

Сёрлз озеро и р-к Ю.С. Боракс (Борон, Калифорния)

Сикуаньшань, Хунань, Китай

Слюдянка (и район) Словарь топонимов Слюдянского района - http://www.maxknow.ru/images/upload/articles7/468.htm

Солонго (= Магнетитовое) м-ние, Забайкалье, Бурятия, Россия

Суит-Хоум Майн, Алма, \ Sweet Home Mine, Alma, Колорадо, США

Сюебаодин \ Xuebaoding, горы, район Пинъу \ Pingwu, Сычуань, Китай

Сянхуалин \ Xianghualing (м-ние Sn-Pb-Zn), Хунань, Китай--балифолит*; гиббсит-26ф; либерит*; сянхуалинит*; таафеит!! ФЛЮОРИТ!!!--402фд; Liu, 2006, 201-215

Т

Талнах м-ние, Ср. Сибирь (С)

Таманский п-ов, между морями Черным и Азовским, Россия (Ю)

Тигриное м-ние, Приморье, Россия \\

--Попова В. И., Попов В. А., Коростелёв П. Г., Орловский В. В. Минералогия руд W-Sn-месторождения Тигриное и перспективы его освоения. Екатеринбург: УрО РАН, 2013 г. – 133 с.

Титовское м-ние, р. Догдо, хр. Тас-Хаяхтах, Пол. Якутия, Россия

Толбачик (= Толбачинский) (Tolbachinskii) вулкан, к ЮЗ от Ключевской Сопки, Камчатка, Россия \\ разнообразие - 232 мин.вида - http://www.mindat.org/loc-5602.html ; новые минералы - 123 вида; по числу новых минералов, открытых здесь, вулкан Толбачик занимает теперь 2-ое место в мире среди всех местонахождений минералов (данные И.В. Пекова, 2019.09)

- Shchipalkina, N. V., Pekov, I. V., Koshlyakova, N. N., Britvin, S. N., Zubkova, N. V., Varlamov, D. A., & Sidorov, E. G. (2020). Unusual silicate mineralization in fumarolic sublimates of the Tolbachik volcano, Kamchatka, Russia–Part 2: Tectosilicates. European Journal of Mineralogy, 32(1), 121-136. \\ Щипалкина Н.П., Реков И.В., Кошлякова Н.Н. и др., 2020

Толбачик (= Толбачинский) (Tolbachinskii) вулкан, к ЮЗ от Ключевской Сопки, Камчатка \ Tolbachik volcano, Kamchatka KraiRussia - https://www.mindat.org/loc-5602.html - 55° 49' 59'' North , 160° 19' 59'' East; 501\ 528 фото минералов; 232 \ 260 минералов valid minerals; 123 \ 129 новых минералов  (TL) - type locality of valid minerals (2019.09.03 \ 2020.05.06)

Толбачик, Камчатка_новые минералы

--Большое трещинное извержение (БТТИ), Толбачик вулкан, Камчатский край, Россия

-- \ Second scoria cone, Northern Breakthrough, Great Fissure eruption, Tolbachik volcano, Kamchatka Krai, Russia \\

Johillerite \\ Tsumeb Mine, Tsumeb, Oshikoto Region, Namibia - первоначальное местонахождение \ Type Locality

Траверселла (Traversella), близ Ивреа, Пьемонт, Сев. Италия \\ аметист!!; доломит!; магнетит!!—xls< 3 см; пирит!; шеелит!!; эпидот!; ВВМ, 160, 234

Трепча, Косово (Trepca), 6 км к СВ от гор. Косовска-Митровица, (быв. авт. край Косово, Сербия, Югославия) \\ арсенопирит!!; буланжерит!; вивианит!; лудламит!!--xl 2 см; пирит!--пс-зы по пирротину; пирротин!!—xls< 16 см; сфалерит!; чилдренит!; ВВМ, 81, 83, 100 \\ см. на карте

Турьинские р-ки, Сев. Урал, Россия \\ Фёдоров Е. С., Никитин В. В. Богословский горный округ. Описание в отношении его топографии, минералогии, геологии и рудных месторождений. - СПб., 1901. - С. 92.

Тюямуюн, Киргизия

У

Уа-Уа Маунтинз, близ Delta, округа Бивер, Миллард и Айрон, Юта, США \ Wah Wah Mts, Millard Co. \ Beaver Co. \ Iron Co., Utah, USA \\ берилл!!!--xls, малиново-красный; гейкилит

Уансала, р-к (Pb-Zn) \ Huanzala mine, близ Уансала, 10 км к СЗ от гор. Уальянка, и 80 км к З от Уануко, деп. Уануко, Анкаш, Перу \\ пирит!!--xls < 20 см, друзы; флюорит!!--розовые xls< 5 см (MR, 1981, 12, 187), зеленые октаэдры < 10 см; MR, 1997, #4, 47 \\ \\ ExtraLapis, No. 11 Pyrit · Herbst 1996

Умбозерский р-к, г. Аллуайв, Ловозеро, Кольский п-ов, РФ

Ф.

Фрайберг (=Фрейберг), район.

Франклин, Нью-Джерси \ (Franklin), 80 км к СЗ от Нью-Йорка, округ Сассекс, Нью-Джерси, США \\ аллеганит! (М 3-1); виллемит!! (М 3-1)—xls<20 см; ганит! (М 2-3); гетеролит! (М 2-3); глаукохроит! (М 3-1); годжкинсонит! (М 3-1); ларсенит! (М 3-1); лейкофеницит! (М 3-1); *ленниленапеит (ММ); лёллингит! (М 1-1); * новые мин.—67 видов (вместе с м-нием Стерлинг-Хилл); норбергит! (М 3-1); пирохроит! (М 2-3); родонит!! (М 3-2); тефроит! (М 3-1); * франклинит!! (М 2-3)—xls< 15 см; хендриксит!; цинкит!!! (М 2-2); BG, 19, 21; MR, 1996, 226 (лит.)

Х - местонахождения

Хагендорф-Зюд, Бавария, Германия

Хайдаркан, м-ние, Киргизия

Хибины, Кольский п-ов, Россия\ Khibiny massif - https://www.mindat.org/loc-2680.html : 523 минерал. вида ; 121 новые минерал. виды; 1081 фото минералов (в т.ч. эвдиалит - 52) на 2019.01.11  \\ карта Хибин \\ турист. схема

Хибины  www.mindat.org -- фото минералов -  1092 (на 2019.04.19)

Хуанганг р-к \ Huanggang Mine (Huanggangliang Mine), Внутр. Монголия, Китай

--Ottens, B., and Neumeier, G. (2012): The Huanggang Mine, Inner Mongolia, China. Mineralogical Record 43, 529-563.

Ц

Цумеб \ Tsumeb и район, Намибия \\ (ГРЭ- III , 587-593); геол. карта р-на; геол. разрез); «скопления германита достигали веса в несколько сотен тонн» (с.589) ; \\ https://www.mindat.org/loc-43981.html - 7305 фото минералов; 311 мин. видов; 72 нов. минерал. видов (на 2019.01.23)

Ч

Челекен (Cheleken) , 70 км к Ю гор. Туркменбаши (= Красноводск (быв.)), Туркмения

Чукикамата, Chuquicamata (22°18`S, 68°55`W), 15 км к N от Каламы, Антофагаста, Чили \\ атакамит! (М 2-1); *(2011) бетпакдалит-NaNa; * (1811) блёдит; мендосавиллит*; маршит! (М 2-1); *1908-натрохальцит;(Gui-72); * новые мин.—12 видов; *1986-обрадовичит; * самплеит

Ш Щ

Шерловая Гора (= Шерлова гора = Ширлова гора) (Scherlovaya Gora), Вост. Забайкалье, РФ \ Sherlova Gora, Adun-Cholon Range, Nerchinsk Gem mines, Nerchinsk, Zabaykalsky Krai, Russia ; 50° 31' 12'' North , 116° 18' 0'' East \\ Минералогический Альманах, том 19, выпуск 2, 2014

- Японский двойник кварца(морион) -5 см --Пеков И.В., 2020 (колл.)

Шимен, Хунань, Китай

Шинколобве (Shinkolobwe), Верхняя Катанга, ДР Конго \\ 425 фото минералов ; 128 достоверных минералов \ valid minerals. 38 (TL) - новых минералов \ type locality of valid minerals (2019.01) - https://www.mindat.org/loc-4328.html \\ * (1922) беккерелит!; * биллиетит! (М 2-3); * ванденбрандеит! * вандендрисшеит! (М 2-3); ваэсит!!; * виартит!!; гетерогенит!!; зигенит!!; * купросклодовскит!!; * кюрит; настуран!!--крупное м-ние; * новые мин.—36 видов; * параскупит! (М 2-3); *пиретит (piretite); селенозигенит--М-1-1, 279а); * скупит! (М 2-3); * студтит!; уранинит!--xls; фурмарьерит!; BBM, 15, 92; Gui-72

Шкатулка, пегм. залежь, Умбозерский р-к, Аллуайв, Ловозеро, Кольский п-ов, РФ.

Шнееберг, Рудные горы, Саксония, Германия \\ 365 минералов, из них 299 достоверных видов, из них 43  новых вида ( type locality) на 2016.03.04\\ Источник: http://www.mindat.org/loc-1848.html

Шор-Су = Шорсу, м-ние, 30-35 км к ЮЮЗ от Коканда, Фергана (Ю), Узбекистан \\ озокерит!; сера!!!; целестин; МС-1, 278-279; Смо, 356

Шуньга, Карелия

Э

Эвеслогчорр, Хибины, Кольский п-ов, Россия

Элмвуд майн \ Elmwood Mine, Carthage, округ Смит, Теннесси, США \\ Эльба о., Италия \\ Эронго, Намибия.

Юбилейная залежь \ Jubilee( = Yubileinaya) pegmatite ), Карнасурт, Ловозеро, Кольский п-ов, Россия

Я

Яогансян р-к (W) \ Yaogangxian = Yao Guang Xiang, 40 км к ЮВ от Ченжоу, Хунань (Ю), Китай \ Yaogangxian = Yao Guang Xiang, Yizhang Co., Chenzhou Prefecture, Hunan; 25°35'N , 113°15'E \\ : http://www.mindat.org/loc-4549.html -- 1567 фото минералов (2019.02): арсенопирит!! -184; буланжерит!!--18; бурнонит!!! -141; джемсонит!!--26; станнин!!!--60; ферберит!!--109; шеелит!!--94 и др. \\ на карте

--Ottens, B. and Cook, R.B. (2005): The Yaogangxian tungsten mine, Yizhang County, Chenzhou, Hunan Province, China. Rocks & Minerals 80(1), 46-57.

--Ottens, B. (2011) The Yaogangxian mine, Hunan Province, China. Mineralogical Record, 42, 557-603.


Яхимов (Jachymov) (= быв. Иоахимсталь\ Joachimsthal), Западно-Чешский край, Богемия, Чехия \\ http://www.mindat.org/loc-158151.html \\

см. также--СПРАВОЧНИК МЕСТОНАХОЖДЕНИЙ МИНЕРАЛОВ И РУД - http://mineral.nsu.ru/educat/article/7/

СТРАНЫ и РЕГИОНЫ

Находки минералов по всему миру. Подробнее: Евсеев А.А. Атлас мира для минералога. М., 2004. - 284 с. \\ Евсеев А.А. Атлас для минералога. Россия и бывший СССР . М., 2011. – 248 с

СТРАНЫ от А до Я

находки минералов по листам карты мира: 1234567 891011121314151617181920212223242526272829303132 - 33

Викимапия \ Wikimapia (карты мира и России)

Сев. Америка (С)

Гренландия

Атлантика - Скандинавия - Кольский п-в

Урал
Ср. Сибирь
Якутия
СВ России

Сев. Америка (З - Сев. Америка (Кордильеры)

Сев. Америка (В)

Британ. о-ва, Пиренейский п-в - Зап. Европа - Вост. Европа

Казахстан, Ср. Азия

Юг Сибири
Забайкалье, Вост . Сибирь
Камчатка - Дальний Восток (Россия, Япония
Мексика
Кавказ, ЮЗ Азия
Афганистан, Пакистан
Индия
Монголия. Китай
ЮВ Азия - Тихий океан
Ю. Америка (СЗ) - Кордильеры
Бразилия

Африка - Сев. и Зап.Экв. и ЮжнВост.

Антарктида
Австралия

Тихий океан - Весь мир

Интересная подборка из 9 минералов региона получается если взять по одному из 9 его частей (центр, север, юг, запад, восток, СВ, ЮВ, ЮВ, СЗ)

Mineralienatlas - указатель по странам - https://www.mineralienatlas.de/

Северное полушарие

Замечательные минералогические находки северного полушария (примеры). Вульфенит. Апатит, флогопит. Амальгама. Касситерит. Эпидот. Бенитоит. Болеит. Леграндит. Составил А. Евсеев, 2020.11. Внимание: название и привязка (положение на карте) некоторых местонахождений требует уточнения (показаны на карте красными и коричневыми значками). Карты предназначены только для образовательных целей. Подробнее: Евсеев А.А. Атлас мира для минералога. М., 2004. - 284 с

Арктика

Земля Франца-Иосифа, Северный Ледовитый океан, Арктика; Архангельская обл., Россия \\ Карбонатные (?) конкреции!!--о. Чамп; кварц (халедон) по дереву! - о. Мак-Клинтока о.; сера!

Северный Ледовитый океан - карта

Северный Ледовитый океан и прилегающие территории. Минералогические находки (примеры). Составил: А. Евсеев, 2020.

Новая Земля

Восточное полушарие

Евразия

Россия и СССР

СССР (быв.) в /www.mindat.org

минералы - 2616

новые минералы - 963

фото минералов - 13997

на 2019.08.05

Минералы России. 1. Виллиомит. Хибины, Кольский п-ов, Россия. Более 4 см. Образец: ФМ. 2. Малахит по атакамиту (псевдоморфозы). Турьинские р-ки, Сев. Урал, Россия. Xls<4x0,7 см.
Образец: ФМ (ОП769). 3. Анальцим. Анальцим. Озерное м-ние, Ср. Сибирь, Россия. Образец: Мин. музей МГРИ, №440. 16 см. Фото и монтаж: © А. Евсеев.

Россия в www.mindat.org

минералы - 2479

новые минералы - 844

фото минералов - 12975

на 2020.11.20

 

Россия в /www.mindat.org

минералы - 2378

новые минералы - 811

фото минералов - 12231

на 2019.08.05

Россия в /www.mindat.org

минералы - 2479

новые минералы - 844

фото минералов - 12934

на 2020. 10. 26

Минералы России в фотографиях на https://www.mindat.org/loc-14409.html -   12934 фото минералов на 2020.10.26

Новейшие фото - датолит--ФОТО - Bor Pit, Dal'negorsk B deposit, Dalnegorsk

Старейшие фото - эвдиалит - ФОТО - Kirovskii apatite mine, Kukisvumchorr Mt, Khibiny Massif, Murmansk Oblast, Russia

Самые просматриваемые \ most viewed - рениит - ФОТО - Kudriavy volcano, Iturup Island, Kuril Islands, Sakhalin Oblast, Russia

По рейтингу \ rating - расвумит - ФОТО - - Kirovskii apatite mine, Kukisvumchorr Mt, Khibiny Massif, Murmansk Oblast, Russia

Из [новых] фото минералов на https://www.mindat.org  (2020.10.25): Одихинча массив, р. Котуй, Ср. Сибирь (С), Россия : моримотоит - ФОТО - Odikhincha massif, Maimecha and Kotui Rivers Basin, Krasnoyarsk Krai, Russia

--Минералы СССР, т.1 "Самородные элементы"/ под ред. А.Е.Ферсмана (редактор тома Н.А.Смольянинов), Изд.АН СССР Москва-Ленинград. 1940 г. - 328 с., тир. 3000 экз.

--Геологические памятники природы России "Природное наследие России" . Авторы: Карпунин А.М. , Мамонов С.В. , Мироненко О.А. , Соколов А.Р. Главный редактор - Орлов В.П. Санкт-Петербург, 1998 г.\\ веб-публикация

Физическая карта России - http://town-map.ru/346093.html

Карта России на сайте К.И. Клопотова

Кристаллы России в экспозиции Минералогического музея им. А.Е. Ферсмана РАН (кристаллы 5 см и более на выставке "Кристаллы")

10 замечательных минералов России (экспресс-опрос провел А. Евсеев)

Экспозиция "Замечательные минералы России". 2019 г. Мин. музей им.А.Е. Ферсмана РАН. Подробнее: https://www.fmm.ru/Exp17.

Экспозиция "Минералы России". Зал "Региональная и всемирная минералогия". Минерал. музей МГРИ.

Минералы России по числу ссылок (20 и более) в «Атласе мира для минералога»

Новые минералы ( СССР и Россия) \\ Список всех новых минералов, открытых на территории быв. СССР с 1766 до первой половины 2006 г. содержит 714 достоверных ( valid ) минеральных видов – см. Pekov I.V. New Minerals from Former Soviet Union Countries, 1998-2006 // Mineralogical Almanac, Vol. 11. Moscow, Mineralogical Almanac, 2007, 112 pp. (список - стр. 85-88)

Полезные ископаемые - Википедия

Минералы России в mindat.org - https://www.mindat.org/loc-14409.html

Карта "Самые замечательные месторождения минералов в Союзе" (фрагмент). Источник: Ферсман А.Е. Занимательная минералогия. М. -Л.: "Детская литература", 1937. - 240 с. Объяснения к карте - см. стр. 235-238. Подробнее

Коллекционные минералы из России - http://www.kristallemineralsrussia.com/

Кольский п-в и Карелия

А-Г
Д-Л
М-С
Т-Я
Аллуайв 
Африканда
Вавнбед 
Вороньи тундры
Вуориярви 
Гакмана, дол. 
Илеритовое 
Ильмайок р.
Карелия 
Карнасурт – 
Кедыкверпахк 
Кейвы – 
Кировский р-к 
Коашва 
Ковдор 
Кольская сверхглубокая скважина 
Кольский п-в 
Корабль, мыс
Кукисвумчорр 
Лепхе-Нельм 
Ловозеро 
Люпикко 
Мал. Маннепахк 
Мал. Пункаруайв 
Материальная шт. 
Медвежий, о.
Мончегорское м-ние
Ньоркпахк 
Оленегорское м-ние
Оленица-р.
Оленчик о.
Палитра 
Печенга
Питкяранта
Плоская г. 
Поачвумчорр
Расвумчорр 
Раслака, цирки 
Сев. Карелия 
Тахтарвумчорр, г. 
Тиетта 
Умбозерский р-к 
Флора 
Хибины 
Хит-остров
Чупа 
Эвеслогчорр г. 
Юбилейная залежь 
Юкспор, г. 

Местонахождения минералов Кольского п-ва и Карелии от А до Я на http://geo.web.ru/druza/index.html--см. отдельные страницы \\ 2020.11.01

 

Хибины и Ловозеро --карта (спутник)

Кольский п-в_фото минералов_Bernard - новая страница

-- В.В. Борисова, А.В. Волошин. Перечень минеральных видов Кольского полуострова. Изд. 4-е, испр. и доп. / – Апатиты: К&М, 2010. – 64 с

Минералы Кольского п-ва от A до Z \\ 1168 минералов; 835 минер. видов; 255 новых видов; фото минералов - 22181.(1-е - адамсит-(Y), 101- бахчисарайцевит и т.д.) \\ Источник: http://www.mindat.org/loc-2666.html (на 2014.06.19)

От Белого до Баренцева моря через Кольский полуостров.

Минералы Кольского п-ва от А до Я (по Борисовой В.В. и др., 2002 с доп.)

--Новые минералы---264 вида \\ Волошин А.В. , Пеков И.В., Борисова В.В. Минералы, впервые открытые в Кольском регионе: исторический обзор и статистические данные. - Минер. альманах. Т. 18, вып.2, 2013, с.107-123

Бураковская интрузия, Заонежье, Карелия, Россия \\ Балтийский щит

Карелия \\ http://mindat.ru/locathn/r_karel.htm \

- Атлас структур и текстур докембрийских вулканогенных пород Карелии \\ литература

Вост. Европа

Россия \ Russia

(3086 минералов); 1959 минер. видов; 255 новых видов; фото минералов - 8561(1-е - абрамовит, 101- Allochalcoselite и т.д.) \\ Источник: http://www.mindat.org/loc-14409.html (на 2014.06.19)

2468 минер. видов; 833 новых видов; фото минералов -12839 \\ Источник: http://www.mindat.org/loc-14409.html (на 2020.08.11)

2479 минер. видов; 844 новых видов; фото минералов -12921 \\ Источник: http://www.mindat.org/loc-14409.html (на 2020.10.20)

Минералы России в фотографиях : http://www.mindat.org (примеры из 100 новых фотографий по https://www.mindat.org/gallery.php?loc=14409&pco=1)

Кольский п-ов - расвумит

Пол., Сев. Урал - аксинит царегородцевит

Сред. Сибирь - сперрилит

СВ
Центр

Сред. Урал - малахит

Якутия - гроссуляр - алмаз

Камчатка - вантгоффит; софиит

Юг России - целлерит
Южн Урал - перовскит

Юг Сибири - нефрит

Дальний Восток - индит - пирротин

Местонахождения минералов России на сайте К.И. Клопотова

Европейская часть России

Европ. часть России (север) \\ Тиман \\ Сев. Тиман--путешествия \\ путешествия-2009 \\ схема

Архангельская обл.

Новгородская обл.

КМА \\ лизардит!--ЕК: 3.2512,1

Поволжье \

Район к востоку от Москвы (до Ниж. Новгорода). Минералогические находки (примеры). Подробнее: Евсеев А.А. Минералогические находки. Краткий обзор. III. Восточная Европа (республики быв. СССР). М., 2014. - 326 с.

Подмосковье, Россия и Москва

Гжель , Московская обл.

Центр Европ. части России

Юг России

Крым

--Тищенко А.И. Минералы Крыма. - Симферополь: Бизнес-Информ, 2015. 304 с., 72 с. цв. вкл.

1. Калиевая селитра. Скалистое с. (быв. Татарский Бодрак), Крым, Россия. Образец: Мин. музей им.А.Е. Ферсмана РАН (Ревуцкая Е.Д., 1913) . Фото: © А.А. Евсеев 2. Золото в хризоколле. Оползневское полиметаллическое проявление, Хыр г., Крым, Россия. Поле зрения 5х5 мм. Фото: А.И. Тищенко.

Сев. Кавказ, Россия

Бечасынское плато, б-н р. Малка, Сев. Кавказ, Россия \ (к С от Эльбруса), Россия \ Bechasyn plateau, Karachay-Cherkessia, Russia \\ Давсонит - фото - www.mindat.org

Бечасынское плато, б-н р. Малка, Сев. Кавказ, Россия. Фото: © В. Герасимов 2013 г.

Урал на сайте /www.mindat.org (на 2016.01.25) : минералов - 1057, твердых видов - 727 ; новых минер. видов (type locality) - 81

- пока не найдены (не описаны для Урала на 2014 г.) : сподумен, эвдиалит...:

УРАЛ. Иллюстрированная краеведческая энциклопедия - http://quist.pro/books/ural_01.a.3.php

ПРИРОДНЫЕ ДОСТОПРИМЕЧАТЕЛЬНОСТИ УРАЛА - http://nashural.ru/mesta.htm

Рудники (и не только) Урала - фотогалереи \ видео "Планета Карабаш"

Пермский край, Россия \\ Геологические памятники - http://www.perm-kray.ru/index.htm

Полярный Урал, Россия \\ фото - http://polyarny.net/foto/

ПРИПОЛЯРНЫЙ УРАЛ \\ КЕММЕРИХ А. О.  ПРИПОЛЯРНЫЙ  УРАЛ. ПУТЕВОДИТЕЛЬ. ИЗДАТЕЛЬСТВО «ФИЗКУЛЬТУРА И СПОРТ». МОСКВА 1970 \ веб-публикация

СЕВЕРНЫЙ УРАЛ (64°00'—58°45' с. ш.)

--Минералы, названные в честь ученых, побывавших на Северном Урале - видео - www.youtube.com

Блог Михаила Цыганко - http://zolotoy-kamen.ru

СРЕДНИЙ УРАЛ (58°45' — 56°00' с.ш.

Вишневит и крокоит - минералы, открытые на Урале. Клуб "Эдельвейс". 2017.04.15. Екатеринбург. Прим : образцы на этом фото - синий содалит из Вишнёвых гор. 2. Вишневит. Вишневые горы, Ю. Урал, Россия. Образец: Мин. музей им. А.Е. Ферсмана РАН (№58544. Китаев Г.Г., 1956). Фото: © А.А. Евсеев

ЮЖНЫЙ УРАЛ (56°00' — 51°00' с. ш.)

--Башкирия \\ Оренбургская обл. \\ Челябинская обл. \\ см. также http://webmineral.ru/deposits/item.php?id=60

Сибирь \ Сибирь в "Атласе мира для минералога". - Местонахождения минералов и примеры находок http://geo.web.ru/druza/L-AtE_Sib.htm \\

--Реутовский В.С. Полезные ископаемые Сибири. - СПб., 1905. - 874 с.: карта. Автор - инженер, редактор и издатель журнала "Вестник золотопромышленности и горного дела вообще" (Томск).

Дополнения к списку (Евсеев А.А. Минералогические находки. Краткий обзор. I. Сибирь. М., 2006. – 157 с. )

Зап. Сибирь

Ср. Сибирь

Красноярский край

--Минеральные ресурсы Красноярского края. Кн. 2. Кадастр месторождений полезных ископаемых. — Красноярск, КНИИГиМС, 2002. С.359

Таймыр п-ов

Нижняя Тунгуска р.

Якутия \\

--663 фото минералов; 595 мин. видов. 57 новых видов \ 595 valid minerals. 57 (TL) - type locality of valid minerals (на 2019.09.12) \\ Источник: http://www.mindat.org/loc-2644.html

- Минералы Якутии - на сайте К.И. Клопотова

--Месторождения - http://www.atlas-yakutia.ru/depositmap.html

Якутия. Замечательные минералогические находки (примеры). Составил А. Евсеев, 2020.11 \\ Внимание: название и привязка (положение на карте) некоторых местонахождений требует уточнения (показаны на карте красными и коричневыми значками). Карты предназначены только для образовательных целей. Подробнее: Евсеев А.А. Атлас мира для минералога. М., 2004. - 284 с

Алдан, Якутия

--Эшкин, В. Ю., Карякина, Т. А. и Пацкевич, Г. П. (1) Минералого-генетические особенности локального прогноза и поисков месторождений горного хрусталя в кварцитах Верхнеалданской провинции, Записки Горного Института, 121, с. 120. доступно на: http://pmi.spmi.ru/index.php/pmi/article/view/10264

Хабаровский край, Россия

СВ России

--ГЕОЛОГИЯ И МИНЕРАЛЬНО-СЫРЬЕВЫЕ РЕСУРСЫ СЕВЕРО-ВОСТОКА РОССИИ Материалы всероссийской научно-практической конференции 1-3 апреля 2014 г. Якутск 2014. - http://www.diamond.ysn.ru/content/VNPK_Yakutsk_2014.pdf

Магаданская обл.

Чукотка, Россия (СВ)

Камчатка \\

Корякия \\ Курильские о-ва

-- Толбачик (= Толбачинский) (Tolbachinskii) вулкан, к ЮЗ от Ключевской Сопки, Камчатка \ Tolbachik volcano, Kamchatka KraiRussia - https://www.mindat.org/loc-5602.html - 55° 49' 59'' North , 160° 19' 59'' East; 501\ 528 фото минералов; 232 \ 260 минералов valid minerals; 123 \ 129 новых минералов  (TL) - type locality of valid minerals. (2019.09.03 \ 2020.05.06)

Дальний Восток

Дальний Восток (Россия) литература по геологии и пол. ископ. (в алфавите авторов) - http://wiki.fegi.ru/index.php/Амур р.

--Новые и редкие минералы Дальнего Востока. - Владивосток: ДВО АН СССР, 1987. - 128 с.

Амурская обл., Россия \\

Приморье, Россия \\

Сахалин \\ фото - http://fotocult.ru/gallery/ \\

Хабаровский край и Еврейская АО, Россия

Юг Сибири

Юг Сибири и прилегающие территории. Минералогические находки (примеры). Подробнее: Евсеев А.А. Атлас мира для минералога. М., 2004. - 284 с. \\ Нажмите на изображение, чтобы его увеличить.

Юг Сибири и прилегающие территории. Минералогические находки (примеры - 11 фото). См. карту выше \\ Нажмите на изображение, чтобы его увеличить.

Алтай, Россия \ Казахстан \\

Горный Алтай

Восточная Сибирь

Забайкалье, Россия \\ фото - http://www.crystallika.com.postman.ru/

Забайкалье_местонахождения

--ОПИСАНИЕ МЕСТОРОЖДЕНИЙ ЗАБАЙКАЛЬЯ [А.Е. Ферсман]

- Юргенсон Г. А. Ювелирные и поделочные камни Забайкалья. Новосибирск: Наука, 2001. - 390 с.

Цианотрихит. Удоканское м-ние, Забайкалье (СВ), Россия. Образец: Центральный Сибирский геологический музей (Птицын А.Б.). Фото: © А.А. Евсеев

Бурятия \ на карте 1 \ на карте

Иркутская обл. \\

Кемеровская обл. и Горная Шория

Красноярский край \\ минеральные ресурсы - http://nature.krasn.ru/content.ph

Прибайкалье

Саяны и Присаянье \\

Тува \\

Хакасия

--ЛИТЕРАТУРА О РЕСПУБЛИКЕ ХАКАСИЯ Библиографическийуказатель Том 1 Природа и природные ресурсы Хакасии, их охрана и рациональное использование (2-я половина XIX-XX в.)  - http://www.nbdrx.ru/razdeli/resursi/izd/bibukazatel/bib_ukazatel1.pdf

Зарубежные страны

Атлантика

Исландия

Европа

--Зап. Европа_минералогические особенности (в фотографиях образцов от А до Я) -- Европа_крупные кристаллы \\ Европа _кристаллы_5 см \\ Европа_кристаллы _10 с

Страны Европы в фотографиях минералов по https://www.mindat.org (2019.03.15) : Италия - 48953 фото; Германия - 34409; Франция - 28208; Великобритания - 19 375; Испания - 16809; Португалия -13685; Чехия - 8606 ; Швейцария - 8963

Европа (СЗ) \\ Скандинавия

Норвегия \\ Швеция \\ Финляндия

Норвегия в www.mindat.org

минералы - 921

новые минералы - 85

фото минералов - 5816

на 2019.07.12

Швеция в www.mindat.org

минералы - 898

новые минералы - 185

фото минералов - 3856

на 2019.07.12

Финляндия в www.mindat.org

минералы - 692

новые минералы - 34

фото минералов - 1115

на 2019.07.12

--Wilke, H.-J. (1997) Die Mineralien und Fundstellen von Schweden. Chr. Weise Verlag, Munchen, 200 pp. (in German).

З а п. Е в р о п а

Британ. о-ва, Пиренейский п-в \\ Ирландия \\ Корнуолл, Англия

Испания \ Spain \ http://www.mindat.org/loc-5536.html - 16153 фото минералов (2018.11)

Австрия \\ Австрия \ карта и минералогические находки

Альпы \\ Альпы_карты для минералогов \\ The Alps, Europe - 1504 valid minerals. 224 (TL) - type locality of valid minerals; 4336 фото минералов - https://www.mindat.org/loc-292987.html.\\ От Acanthite до Zoisite (TL) \\ (2018.11.18)

--Gramaccioli, C.M. Minerali Alpini e Prealpini. Vol.1-2. Bergamo, 1975. - 473.

Бавария, Германия \\ Баден-Вюртемберг, Германия

Балканский п-ов \\

Бельгия \\

Болгария \\ Канарата к-р, Вост. Родопы, Болгария

Венгрия

- Речк, Венгрия \ Recsk Mine, Recsk, Heves County, Hungary

1. Кальцит. Фрагмент колонии ископаемых кораллов. Zebegeny, Венгрия. Образец: Минер. муз. им. А.Е. Ферсмана РАН (ОП 1928. Степанов В.И. (коллекция) 1972. Фото: © А. Евсеев. \\ О м-нии - см. https://www.mindat.org/feature-3042557.html 2. Кальцит Малый Мишкольц, Венгрия. Образцы: Мюнхен-2008. Фото: М. Моисеев

 

Парадшашварит \ Paradsasvarite - новый минерал группы малахит - розазит из Парадшашвар, горы Матра, Венгрия \\ https://www.mindat.org/min-43597.html

--Feher, B., Szakall, S., Zajzon, N., Mihaly, J. (2015): Paradsasvarite, a new member of the malachite-rosasite group from Paradsasvar, Matra Mountains, Hungary. Mineralogy and Petrology 109, 405-411. \\ Парадшашвар - https://www.rutraveller.ru/resort/3060

Германия \\ фото минералов \\ http://www.mindat.org/rloc.php?loc=Germany \\ http://www.mindat.org/loc-14244.html)

минералы - 1813; новые минералы - 371 ; фото минералов – 35972 \\ 2020.10.25 \\ Источник: https://www.mindat.org/loc-14244.html

из новых фото минералов на https://www.mindat.org (2020.10.25)   - скородит --фото \ оливенит - фото -- оба из Clara Mine, Oberwolfach, Wolfach, 

- Люнебург, Ниж. Саксония, Германия \ Luneburg District, Lower Saxony, Germany \\ борацит!!!*\ Boracite  -1) Bergmannisches Journal (1789 ) 2) 23 фото; калистронцит \ Kalistrontite; люнебургит* - 7 фото;

Сев. Рейн-Вестфалия (Германия)

Греция \ Greece - https://www.mindat.org/loc-14188.html - минералов - 807 (из них 37 новых видов) \\ 5775 фото минералов (2018.06)

--Stamatakis, M.G., Hall, A., and Hein, J.R. (1996) The zeolite deposits of Greece. Mineralium Deposita, 31, 473-481. \ цеолитовые м-ния

--Voudouris, P., Katerinopoulos, A., and Melfos, V. (2004) Alpine type fissure minerals in Greece. Doc. Natur. 151, 23-45. \\ Минералы альпийских трещин

Италия \ Italy. \\ в www.mindat.org \\ 53032 фото минералов; 1753 valid minerals. 381 (TL) - type locality of valid minerals. 9 (FRL) - first recorded locality of unapproved mineral/variety/etc. 8 erroneous literature entries \\ на 2020.10.25

- из новых фото минералов на https://www.mindat.org (2020.10.25) :

--- кораллоит \ Coralloite--фото--Monte Nero Mine, Rocchetta di Vara, La Spezia Province, Liguria, Italy

--- кварц (горный хрусталь) --фото -- Selvino, Bergamo Province, Lombardy, Italy

Италия в www.mindat.org

минералы -1748

новые минералы - 379

фото минералов - 52343

на 2020.07.06

Италия в www.mindat.org

минералы -1730

новые минералы - 376

фото минералов - 50899

на 2020.03.10

Италия в www.mindat.org

минералы -1697

новые минералы - 364

фото минералов - 49474

на 2019.07.18

Италия --примеры минералов из списка http://www.mindat.org : Acanthite ; Acanthoide';  Acmonidesite (TL); Actinolite ... Godlevskite ; Godovikovite ; Goethite ; Gold ; Goldfieldite; ... Calciopetersite \ Calcite - 1482 фото \ Calderite; ..Cyrilovite ; Dachiardite-Ca (TL) ; Dachiardite-Na (TL) ; Dadsonite; Danburite..... Lusernaite-(Y) (TL) ; Luzonite ;  Macaulayite; Macdonaldite ? ; Macfallite .... Quadridavyne (TL) ; Quartz - 1858 фото ; Quintinite ; .... Szomolnokite; TacharaniteTadzhikite-(Ce); TaeniteTainiolite ; .... Zirconolite;  'Zirconolite-3T' ; Zirkelite;  Zoisite; var. Thulite

--Новые минералы, открытые в Италии \\ Marco E. Ciriotti, Lorenza Fascia, Marco Pasero. Italian Type Minerals. Pisa: Plus-Pisa university press, 2009, 357 pp. \\ О книге (А. Касаткин) - http://www.minbook.com/new_books_ru.html

Пьемонт, Сев. Италия

- Валь д`Ала (Ала = долина Ала = Валь-ди-Ала = Ала-Таль), к СЗ от Турина, Пьемонт, Сев. Италия \\ везувиан!!; гроссуляр (гессонит)!!!; диопсид!!; титанит!!--xls; Gr, 368-369 \\ на карте1 \ карте2

--- Piccoli G.C., Maletto G., Bosio P., Lombardo B. Minerali del Piemonte e della Valle d'Aosta. Associazione Amici del Museo "F. Eusebio" Alba, Ed., Alba (Cuneo), 2007. - 607 pp.

Сардиния \\ Сицилия \\ Тоскана

Карпаты \\ Македония \\

Польша

Румыния \ Romania \\ 7053 фото минералов (=фд) - https://www.mindat.org/loc-14254.html; 747 минер. видов \ valid minerals; 35 новых минералов (TL) - type locality (2019.07.18)

Сербия \\ Словакия \\ Словения

Франция

--Mineralogie de la France by Eric Asselborn, 2013. 242 pages.

Чехия \ Czech Republic

Швейцария \\

Средиземноморье

Вост. Европа \

Белоруссия \\ Прибалтика

Украина

-- Местонахождения минералов Украины от А до Я

Украинский щит - геологические памятники - Google Maps

Волынь и СЗ Украина

Донбасс \

- Ликов О.И. Везувиан из скарнов с. Миколаiвки (ЮЗ окраина Донбасса). - Мат. з мiн Укр.. в.2, 1961, 112-115 \\ ЕК_3.1415

Приазовье

Прикарпатье \\ Закарпатье

Молдавия

Евразия

- Средиземноморье

Азия

Казахстан и Средняя Азия

Казахстан и Средняя Азия_А-Я_местонахождения минералов (на карте)

Целестины . Казахстан. Таджикистан. Туркмения.  Образцы: ФМ. Фото: © А.А. Евсеев.

Казахстан \\

Восточный Казахстан

Средняя Азия \\

Киргизия \

Путешествие вокруг Иссык-Куля, Киргизия, август 2019 г. (фото Е. Матвиенко).

Таджикистан \\ Памир \\

Карамазар рудный район, Сев. Таджикистан: Адрасман (Adrasman) --Алтын-Топкан--Кансай --Кураминский хр

Туркмения \\ Узбекистан

Афганистан \ Afghanistan - http://www.mindat.org/

Пакистан

Кавказ, ЮЗ Азия

Азербайджан \\

Армения \\

Агат. Иджеванский р-н, Армения. Более 25 см. . Из собрания А.Н. Коробкова. Выставка "Живопись в камне". ГГМ им. В.И. Вернадского, Москва. 2020.09.04. Фото: А. Евсеев

- Калькурмолит* \ Calcurmolite  (Ca,Na)2(UO2)3Mo2(O,OH)11 · nH2O - новый минерал (1958) - Каджаран м-ние, Кафанский рн, Армения \ Sokh-Karasu area, Kadzharan Molybdenum Deposit, Upper Okhca River, Kafan District (mindat.org)

- Зодское (= Зод) м-ние (Au), 10 км к В от пос. Варденис, 110 км к В от Еревана, Армения \\ * (1965) волынскит; мелонит!; * (1977) раклиджит; * смирнит; теллуровисмутит; * (1987) чеховичит; Pk 

--Zod Mine (Sotk deposit), Vardenis, Gegharkunik Province, Armenia

Грузия \\

Израиль

Иран \\ Йемен, Аравийский п-ов \\ Оман \\ Саудовская Аравия

Турция \\ минералы и местонахождения--см. http://www.mineralienatlas.de \\ Ryan C. W. Guide to the Known Minerals of Turkey. Ankara, 1960, 196 p.

- Лейцит и псеволейцит - Kirka-Afyon-Suhut-Isparta Volcanic Field

Индия, Непал, Шри-Ланка

Индонезия \\

Шри-Ланка

Вост. Азия ( Китай и др.)

Япония \\ http://www.petrovrareminerals.com/articles02.html \\ http://www.mindat.org/loc-14488.htm

Хенмилит (голубые кристаллы до 0,1- 0,2 см) на белом кальците из места его первой находки - месторождения Фука, Окаяма преф., Япония \ Fuka mine, Bitchu-cho (Bicchu-cho), Takahashi, Okayama, Япония. Образец и фото: © "Русские минералы"

 

Китай \ China \\ www.mindat.org

Китай в https://www.mindat.org

минералы - 1331

новые минералы - 134

фото минералов - 15591

на 2019.07.11

- из [новых] фото минералов Китая на https://www.mindat.org  (2020.10.25) - флюорит - ФОТО - Piaotang Mine, Xihuashan ore field, Dayu Co., Ganzhou, Jiangxi, China

Названия минералов и местонахождений Китая

Китай_географические названия \\ Особенности при переходе от английского варианта к русской транскрипции \\ несколько примеров (от атласа Encarta-2001 к "Атласу мира". М., 1997)

Mianyang Мяньян Xinjiang Синьцзян
Pingwu Пинъу Xixia Сися
Zagunao Дзагунао Xuanhua Сюаньхуа
Zouxian Цзоусянь Xuancheng Сюаньчэн

--фото минералов!!--http://www.williampinch.com/china/

 

85° - 100° вост. долг. 100° - 110°вост. долг E 110° - 120° вост. долг E 120° - 130° вост. долг E 130°-140° вост. долг

Китай

Монголия

Внутр. Монголия(Китай)

Коктогай

Синьцзян

Ганьсу

Цинхай

Янцзы р (верх.)\Yangtze

Непал

Мьянма (Бирма)

Могок

Горихо

Внутр. Монголия (Китай)

Баюнь-Обо

Ганьсу

Шэньси

Сычуань \ Huya

Гуйчжоу

Юньнань

Гуанси-Чжуан. авт.р-н

 

Лаос \ Вьетнам

Внутр. Монголия (Китай)

Хэбэй

Шаньси

Шаньдун

Хэнань

Хубэй

Аньхой

Чжэцзян

Хунань - Яогансян

Цзянси \\ Фуцзянь

Гуандун

Борнео

(Калимантан)

Внутр. Монголия (Китай)

Цзилинь\ Jilin

Хэйлунцзян

Корейский п-ов

Цзянсу

Янцзы р (низ.)

 

Тайвань

 

Филиппины

Китай

Хэйлунцзян

Япония

Хоккайдо

Фука

Тороку -

Итинокава

Кюсю о

Страны ЮВ Азии, регионы, провинции Китая и др. на сайте http://geo.web.ru/druza/index.html \\ с запада на восток и с севера на юг

Внутр. Монголия

Сычуань пров. новые минералы - 6 видов (на 2020.09) \\  www.mindat.org

Тибет , Китай

Хунань, провинция, Китай - http://www.mindat.org/loc-705.html

Юньнань \ Yunnan \\ www.mindat.org \\ Флюорит_Китай и Монголия

1. Гемиморфит. Веншань \ Wenshan, Юньнань, Китай. Более 7 см. Образец из новых поступлений: Мин. музей РГГРУ. 2012.01. Фото: © А.А. Евсеев. 2. Гиперстен. Ха-Тин, Вьетнам. Образец: Образец: Минер. музей им. А.Е. Ферсмана РАН (№ 65374? Геологический техникум, Ханой, 1963) Фото: А. Евсеев.

Вьетнам \\

Индонезия - см. http://www.mineralienatlas.de/ \\ Камбоджа \\ Лаос\ Малайзия \\

Монголия \

- Khaldzan Buragtag massif, Myangad DistrictKhovd ProvinceMongolia ; 48° 24' 30'' North , 91° 57' 2'' East \\ Алюминоцерит-(Ce) \ Aluminocerite-(Ce) ; бацирит \ Bazirite; коронадит! \ Coronadite ; ферриалланит-(Ce) \ Ferriallanite-(Ce) (TL) ; хинганит-(Ce) \ Hingganite-(Ce) --фото!; чевкинит-(Ce)\ Chevkinite-(Ce) ; эльпидит \ var: Calcian Elpidite - фото!; энигматит \ Aenigmatite - фото

Мьянма (быв. Бирма)

Таиланд \\ Флюорит!!--инкрустирует (!) кристаллы антимонита; м-ние не указано--фото--www.mindat.org \\ Unnamed quarry, Chiang Mai Province, Thailand

Филиппины \\

ЮВ Азия

Африка

Африка_Местонахождения минералов от А до Я (примеры) \\ новое на сайте!

Африка. Минералогические находки (примеры) . Составил: А. Евсеев, 2020.11.08.

Сев. Африка и Зап. Африка

Алжир \\ Гана \\ Гвинея \\ Египет \\

Либерия, Зап. Африка \\

Камерун \\ вивианит!!! Vivianite ; новые минералы - Mantienneite (TL) \ Remondite-(Ce) (TL)

Мали

Марокко

Марокко в www.mindat.org

минералы - 534

новые минералы - 28

фото минералов - 10159

на 2019.07.18

 

 

Нигерия: Ferronigerite-2N1S (TL) \\ Liebermannite (TL) \\ Zagamiite (TL)

Нигерия в www.mindat.org

минералы - 141

новые минералы - 3

фото минералов - 192

на 2019.07.10

 

 

Чад \\

Экв. и Южн. Африка

Ангола \\ Ботсвана \\

Габон

Замбия \ Zambia (ныне) = Сев. Родезия (быв.), Африка

Зимбабве \\ фото: бикитаит*--7; борнит!! - 3 (xl>7 см) ; хризоберилл!! - 10; александрит!! - 26; эвклаз!!--40; кермезит!!-14; кианит!--8; топаз--26; зимбабвеит* - 4

Зимбабве в www.mindat.org

минералы - 324

новые минералы - 3

фото минералов - 347

на 2019.07.18

Камерун

Камерун в www.mindat.org

минералы - 91

новые минералы - 2

фото минералов - 18

на 2019.07.10

 

 

Конго НР

Конго ДР (быв. Заир) \\ Buttgenbach H. Mineraux de Belgique et du Congo Belge. Liege, 1947, 590 p.

- Катанга пров., ДР Конго \\ Катанга (фр. Katanga) — провинция Демократической Республики Конго. (до 2015 г.) \\ Источник - https://ru.wikipedia.org/wiki/Катанга_(провинция) \\ см. на карте 1 - 2 - 3 - 4 \\  С 1971 по 1997 год официально называлась провинция Шаба . \\ Выдающиеся находки минералов урана - ванденбрандеит \ Vandenbrandeite Cu(UO2)(OH)4; кюрит*\ Curite Pb3(UO2)8O8(OH)6·3H2O; кубические кристаллы уранинита, псевдоморфозы по ураниниту; сенжьерит!! \ Sengierite (TL)

    --В 2015 году провинция Катанга была упразднена, территория разделена между ТанганьикойВерхним ЛомамиЛуалабой и Верхней Катангой. \\ Источник (2018): https://ru.wikipedia.org/wiki/Катанга_(провинция)

Шахеру г.*, Ньирагонго, вулк., Сев. Киву, ДР Конго \ Mount Shaheru, Nyiragongo VolcanoNyiragongo TerritoryNorth KivuDR Congo ; 1° 28' 59'' South , 29° 13' 59'' East \\ гётценит* \ Gotzenite (TL) ; дельхайелит*; кирштейнит*\ Kirschsteinite (TL) ; комбеит* \ Combeite (TL) ;

-- Sahama, T.G., Hytonen, K. (1959) Delhayelite, a new silicate from the Belgian Congo. Mineralogical Magazine: 32: 6-9.

Намибия \\

- von Bezing, L., Bode, R., Jahn, S. (2016) Namibia Minerals and Localities II. Edition Kruger-Stiftung, Bode Verlag GmbH, Salzhemmendorf, Germany, 661 pages (in English).

Намибия в www.mindat.org

минералы - 783

новые минералы - 108

фото минералов - 14729

на 2019.07.30

 

Южная часть Африки. Минералогические находки (примеры). Составил: А. Евсеев, 2020.11 \\ НМК-196

1. Виллиомит (оранжевый). Арис, Намибия. Фото: И. Лыкова. Мин. музей им. А.Е. Ферсмана РАН. 2015.02.27. Из программы слайдов "Тусон-шоу-2015". 2. Вульфенит на диоптазе. Цумеб, Намибия. Образец: Музей Terra mineralia, Германия. Фото: © Д. Тонкачеев. 3. Галлит. Цумеб, Намибия. (№76158, Kahn W.). Образец: Мин. музей им.А.Е. Ферсмана РАН. 2. 

 

ЮАР

Южн. Африка в www.mindat.org

 

минералы - 911

минералы - 927

новые минералы - 76

новые минералы - 78

фото минералов - 5460

фото минералов - 57909

на 2019.07.18

на 2020.10.24

- из новых фото минералов на https://www.mindat.org (2020.10.25) :

-- кутногорит--фото-- Wessels Mine, Hotazel, Kalahari manganese field, Northern Cape, South Africa

-- пироп--фото--Kimberley, Sol Plaatje, Frances Baard, Northern Cape, South Africa
-- алмаз --фото-- South Africa

ЮАР (С). Замечательные минералогические находки (примеры). Составил А. Евсеев, 2020.11 \\ Внимание: название и привязка (положение на карте) некоторых местонахождений требует уточнения (показаны на карте красными и коричневыми значками). Карты предназначены только для образовательных целей. Подробнее: Евсеев А.А. Атлас мира для минералога. М., 2004. - 284 с

Мессина \ Messina—кварц с включ. ахоита; папагоита!!!
Soutpansberg -- корунд!!!--xls<154 кг
Phalaborwa [P.Complex] -- хондродит!!--xls(D)
Премьер р-к \ Premier mine --алмаз!!! (BG,326)
Барбертон - *нов. минералы!; *1921-треворит
Kusasalethu Mine (Elandskraal Mine) –барит!!!--xls<70 см– Cairncross, B… et al., (2001)
Витватерсранд \ Witwatersrand gold fields--золото!!
Н`Чванинг р-к-II --гаусманнит!!!-xl 4 см; гематит!!; годефруаит!!!-xl 2 см,  стурманит!!!- xls<30 (!) см; таумасит!!! - прозр. xls<1 см
Весселс р-к \ Wessels – афвиллит!!-xls<45 мм; инезит!!!

Вост. Африка \\ Бурунди \\ Кения

Знаменитые минералогические находки Вост. Африки (примеры). Эфиопия - благородный опал (Mezeo) и амазонит ( Консо). Танзания - танзанит (Мерелани Хиллс). Мадагаскар - целестин (Сакоани), бетафит (Бетафу), ортоклаз (Итронгахи). Составил: А. Евсеев. Фото минералов: А. Евсеев, О. Лопаткин (опал и целестин). 2020.11.08

Мадагаскар \\ 352 достоверных вида, 15 новых видов и 2387 фото минералов на 2018.05

Мадагаскар в www.mindat.org

минералы - 369

новые минералы - 17

фото минералов - 3341

на 2019.07.12

Малави \\

Мозамбик \

Руанда \\ минералы - http://www.mindat.org/loc-21896.html \\ местонахождения - http://www.mindat.org/rloc.php?loc=Rwanda

Сомали \\ Судан

Танзания \\ http://www.mindat.org/loc-4384.html \\ м-н-ния - http://www.mindat.org/ \\ Танзания-2017_поездка минералогов --https://www.mineralatlas.eu/?l=11358

Уганда \\

Эфиопия

Австралия

Австралия и Новая Зеландия

--АВСТРАЛИЯ и НОВ. ЗЕЛАНДИЯ. Местонахождения минералов от А до Я (примеры)

Австралия в www.mindat.org

минералы - 1451

новые минералы - 174

фото минералов - 13394

на 2019.07.18

Новая Зеландия в www.mindat.org

минералы - 455

новые минералы - 13

фото минералов - 1687

на 2019.07.12

--Sutherland, F.L., Webb, G. (2014) Gemstones & Minerals of Australia. Reed New Holland, Chatswood, NSW, 144 pages and maps.

Австралия. Минералогические находки (примеры). Составил: А. Евсеев, 2020.11

Зап. Австралия (С)
Северная территория
Квинсленд
Зап. Австралия (Ю)
Южная Австралия

Нов. Южн. Уэльс

Тасмания

Австралия и Новая Зеландия. Минералогические находки по штатам (примеры). 1. Алмаз. 2. Азурит. 3. Аметист 4. Ашбертонит. 5. Бирюза. 6. Аметист. 7. Альмандин. 8. Апофиллит. 9. Актинолит (нефрит). Составил: А. Евсеев, 2020.11.

Виктория, Австралия \ https://www.mindat.org/loc-195.html: 401 достовер. минерал. видов \ valid minerals. 18 (TL) - новых видов \ type locality of valid minerals.(2019.12), в том числе - бетпакдалит-FeFe* \ Betpakdalite-FeFe (TL); уайчпруфит (по КМС) \ Wycheproofite (TL)

Западная Австралия \ Western Australia \\ https://www.mindat.org/loc-15624.html \\ колорадоит!!-2фд--Калгурли

Западная Австралия в www.mindat.org

минералы - 702

новые минералы - 58

фото минералов - 1581

на 2019.07.18

Квинсленд

Новый Южный Уэльс \

Лабрадор!!--Hogarth Range labradorite, Mummulgum, Rous Co., New South Wales, Australia --фото (бесцветные обломки до 4 см; из выветрелых базальтов)

Северная территория \\

Тасмания \\

Южная Австралия

Новая Зеландия

Восточное полушарие

Ю ж н о е _ п о л у ш а р и е

З а п а д н о е _ п о л у ш а р и е

Северная Америка \ Сев. Америка--фото минералов

Северо-Запад Северной Америки. Местонахождения минералов (примеры). Составил: А. Евсеев, 2020.11. Подробнее: Евсеев А.А. Атлас мира для минералога. М., Ассоциация Экост, 2004. - 275 карт-схем, 284 стр. \\ Оглавление (список карт) \\ Избранные страницы

Гренландия

Гренландия в https://www.mindat.org

минералы - 481

новые минералы - 84

фото минералов - 935

на 2019.04.11

--Petersen, O. V. & Johnsen, O. (2005): Mineral species first described from Greenland. Canadian Mineralogist, Special publication no. 8., 184p.

Скалистые горы \ Rocky Mountains, Канада \ США

Скалистые горы, Сев. Америка \ Rocky Mountains, North America \\ https://www.mindat.org/loc-301977.html \\ 1072 valid minerals. 768 (TL) - type locality of valid minerals \\ фото минералов - 10053 \\ 10 примеров: Abernathyite \\ Azurite \\ Dachiardite-Na \\ Dzharkenite \\ Mackayite \\ Muscovite\\ Tacharanite \\ Tyuyamunite ! \\ Zalesiite \\ Zwieselite (2020. 03)

Канада

Минералы Канады на странице https://www.mindat.org/loc-8188.html (на 2019.01.05 \ 2020.09.10): 1628 \ 1679 минеральных видов \ valid minerals; 247 \ 256 новых видов ; 21133 \ 22646 фото минералов

-- Трейл Р. Дж. Каталог минералов Канады. \ Trail R. J. Catalogue of Canadian Minerals. Revised 1980. Geol. Surv. of Canada Paper 80-18, 1983, 483 p.

Канада. Местонахождения минералов (примеры). Составил: Евсеев А., 2020.11.10 \\ Нажмите на изображение, чтобы его увеличить.

Район Великих озер и прилегающие территории (Канада и США). Минералогические находки (примеры). Подробнее: Евсеев А.А. Атлас мира для минералога. М., 2004. - 284 с. \\ Нажмите на изображение, чтобы его увеличить.

США \\ http://www.mineralienatlas.de/lexikon/index.php/USA

США в https://www.mindat.org

минералы - 2645

новые минералы - 831

 

на 2019.05.10

American Mineral Treasures [Сокровища минералов Америки]. 2008. - 368 p. \\ Подробнее: http://www.lithographie.org/bookshop/hc_american_mineral_treasures.htm \\ см. также http://geo.web.ru/druza/l-USA_AMT.htm

Новые минералы - 830 видов (2019.01.15). Источник: https://www.mindat.org/loc-3366.html

Топографическая минералогия ( литература о местонахождениях по штатам) \\ http://www.minsocam.org/

Минералы США в фотографиях на https://www.mindat.org/loc-3366.html -  129046 фото минералов на 2020.10.25

Новейшие фото - Морденит\ MordeniteMagnesio-hornblende \ San Marcial Quarry, Socorro Co., New Mexico, USA \\ (микро)

Старейшие фото - Пирит - \ Little Butte Ore Mine, Butte-Silver Bow, Montana, USA \\ 2, 3 см

Самые просматриваемые \ most viewed - фото - Галенит \ Baxter Springs, Picher Field, Cherokee Co., Kansas, USA \\ 11х8 см

Совсем недавно просмотренные \ most recently viewed - фото - кальцит - Berry Materials Corp. Quarry, North Vernon, Jennings Co., Indiana, USA

Сев. Америка (С)

Аляска \\

Нунавут \\

Северо-Западные территории \ North-West Territories, Канада \\

Юкон

- LAFLAMME, J.H.G., ROBERTS, A.C., CRIDDLE, A.J. & CABRI, L.J. (1995): Owensite, (Ba,Pb)6(Cu,Fe,Ni)25S27, a new mineral species from the Wellgreen Cu-Ni-Pt-Pd deposit, Yukon. Canadian Mineralogist 33, 665-670.  \ Wellgreen Cu-Ni-PGE deposit, Kluane District, Whitehorse mining district, Yukon, Canada

Сев. Америка (В)

Сев. Америка (В)_находки крупных кристаллов (10 см и более)

Айова \\

Арканзас, США

Вермонт \\ Верхнее оз \\ Виргиния \\ Висконсин \\ Джорджия \\ Иллинойс \\ Индиана, США \\ http://www.mindat.org/loc-16287.html \\ более 100 фото минералов из осадочных пород (доломит, миллерит!!; целестин!; флюорит! и др.) www.mindat.org/gallery

Квебек \

Кентукки, США. \\ Коннектикут \\ Лабрадор \\

Манитоба пров., Канада - https://www.mindat.org/loc-20365.html \\ минералы - 300 видов; новые минералы -12 видов (бобфегусонит; воджинит; манитобаит; танкоит; черниит и др. ); фото минералов -424 \\ на 2019.05

Массачусетс \\

Миннесота \\ Миссури \\ Мичиган \\ Мэн \\

Мэриленд, США

Новая Шотландия, Канада \\ Нью-Брансуик пров., Канада\ New Brunswick \\

Нью-Гэмпшир, США \\ Нью-Джерси, США - http://www.mindat.org

Нью-Йорк \\

Огайо

Оклахома \\

Онтарио\ Ontario, Канада

Бьяджониит \ Biagioniite Tl2SbS2 \ IMA 2019-120. \\ новый минерал из м-ния Эмло, Онтарио, Канада \  Hemlo gold deposit, Bomby Township, Thunder Bay District, Ontario, Canada \\  Hemlo gold deposit, Bomby Township, Thunder Bay District, Ontario, Canada - первоначальное местонахождение \ Type Locality

-- Bindi, L., Moelo, Y. (2020) Biagioniite, Tl2SbS2, from the Hemlo gold deposit, Marathon, Ontario, Canada: occurrence and crystal structure. Mineralogical Magazine: 1-22.

Тандербейит * \ Thunderbayite (TL) TlAg3Au3Sb7S6 - новый минерал из м-ния Эмло, Онтарио, Канада \  Hemlo gold deposit, Bomby Township, Thunder Bay District, Ontario, Canada \\ Bindi, L. and Roberts, A. C.: Thunderbayite, IMA 2020-042, in: CNMNC Newsletter 57, Eur. J. Mineral., 32, https://doi.org/10.5194/ejm-32-495-2020, 2020.

Аметист с включениями гетита из района Тандер-Бей. Diamond Willow Mine, McTavish Township, Thunder Bay District, Ontario, Canada. Образец и фото: © О. Лопаткин. Источник: http://www.pegmatite.ru/ \\

Пенсильвания, США - http://www.mindat.org/loc-14026.html

--целестин*!! - параллельно-волокнистые агрегаты Bell's Mill, Bellwood, Blair Co., Pennsylvania, USA ; 40° 36' 21'' North , 78° 19' 23'' West - первоначальное местонахождение \ Type Locality - фото 

Сев. Каролина \\

Полевой шпат и слюдяные пегматиты. Шарлотт, Сев. Каролина, США \\ Gair J.E. et al., 1989 \\ РЖ "Геология" 8И34-1992 \\ ЕК

 

Теннесси \\ Техас

Флорида

Сев. Америка (З)

Минералы запада США в фотографиях : http://www.mindat.org (примеры из 100 новых фотографий по https://www.mindat.org/gallery.php?loc=14409&pco=1 (на 2020.10.20.)

Аляска - альмандин ; Вашингтон - цектцерит; Орегон - Tschernichite

Айдахо - пироморфит

Монтана -Auriacusite - фото

Сев. и Южн. Дакота - монтгомериит; синканкасит
Калифорния - золото; бенитоит*

Невада - аметист

Вайоминг - шортит*; Колорадо-самарскит-(Y) ; родохрозит

Небраска; Канзас- галенит

Калифорния - гидроборацит

Юта; Аризона - гематит

Нью-Мексико - полилитионит

Техас - каломель

Айдахо, США \\

-- Peacock Mine, Cuprum, Seven Devils Mining District, Adams Co., Idaho, USA ; 45° 10' 8'' North , 116° 39' 3'' West \\ повеллит*\ Powellite (TL) Ca(MoO4)

Альберта, Канада

Аризона, США \\ на странице http://www.mindat.org/loc-3293.html \\ в сводке Anthony J.W. et al, 1995 --809 мнр. видов, из них 76 новых видов \\ Anthony, J.W., et al (1995), Mineralogy of Arizona, 3rd.ed.:

Аризона, США в https://www.mindat.org

минералы - 690

новые минералы - 46

 

на 2008 г.

Аризона, США в https://www.mindat.org

минералы - 842

новые минералы - 82

фото минералов - 10662

на 2015.09.27

Аризона в www.mindat.org

минералы - 913

новые минералы - 87

фото минералов - 16367

на 2019.08.07

Аризона в www.mindat.org

минералы - 916

новые минералы - 89

фото минералов - 18073

на 2020.10.24

Из новых фото минералов Аризоны на https://www.mindat.org (2020.10.25) : флюорит - фото - La Fluorita Dulcita prospect, Cochise County, Arizona, USA

--- диоптаз - ФОТО (микро!) - Ray Mine, Scott Mountain, Mineral Creek Mining District, Dripping Spring Mountains, Pinal Co., Arizona, USA

--- азурит - ФОТО - Middlemarch Mine, Middle Pass Mining District, Cochise County, Arizona, USA

Минералы запада США. 1. Абернатиит. Фьюэмроул Майн \ Fuemrole mine, Темпл Маунтин, Юта, США. Образец: Мин. музей им.А.Е. Ферсмана РАН (№88664, Обмен, 1997 ).   2. Амазонит с ферроколумбитом и альбитом. Keyhole Vug, Florissant, Колорадо, США. (№85654, обмен 1988 г.).Образцы 1-2: Мин. музей им. А.Е. Ферсмана РАН. 3. Азурит. Коппер-Куин майн, Аризона, США. Образец: ФМ (№53141). ~25x20 см. 4.Азурит (на песчанике). Лост-Лейк Клейм, Насимиенто Майн, округ Сандовал, Нью-Мексико \ Lost Lake Claim, Nacimiento Mine, Cuba, San Pablo, Sandoval Co., New Mexico, USA , США. Более 15 см. Образец: "Русские минералы". 2012.04.19. Фото и монтаж: © А. Евсеев.

Вайоминг, США

Колорадо \\ http://www.mindat.org

Колорадо шт. в https://www.mindat.org

минералы - 877

новые минералы - 84

фото минералов - 6996

на 2019.07.12

Из новых фото минералов Колорадо на https://www.mindat.org (2020.10.25) : калаверит (кристалл 2 мм) - ФОТО - Cresson Mine, Eclipse Gulch, Cripple Creek Mining District, Teller Co., Colorado, USA

Минералы Колорадо в фотографиях http://www.mindat.org (5 примеров - A - D - M - T - Z): акантит \ Acanthite --фото \\ девиллин \ Devilline--фото \\ магнезиопаскоит \ Magnesiopascoite --фото \\ Тангеит \ Tangeite - фото \\ зуниит \ Zunyite (TL) - фото


Микроклин (амазонит). Кристал Пик и Пайкс Пик, Колорадо, США. Образцы: Мин. музей им.А.Е. Ферсмана РАН. Фото: © А.А. Евсеев

--Колорадо, США \ карта и минералогические находки

Местонахождения минералов района Денвера (Колорадо, США) вдоль 105° зап. долг. Подробнее: Евсеев А.А. Атлас мира для минералога. М., 2004. - 284 с.

 

Манитоба, Канада

Монтана \\ Невада \\ Нью-Мексико, США \\

Нью-Мексико в www.mindat.org

минералы - 709

новые минералы - 17

фото минералов - 6752

на 2019.07.17

Саскачеван, Канада \\

Техас, США

Южная Дакота, США \\

Юта, США

Юта в www.mindat.org

минералы - 813

новые минералы - 113

фото минералов - 7817

на 2019.08.25

1. Отенит. Дейбрик Майн \ Daybreak Mine, Спокан, Вашингтон, США. Образец: Денвер-шоу-2013. \\ 2. Абернатиит. Фьюэмроул Майн \ Fuemrole mine, Темпл Маунтин, Юта, США. Образец: Мин. музей им.А.Е. Ферсмана РАН (№88664, Обмен, 1997). Фото 1-2: © А. Евсеев

- Лисит * \ \ Leesite (TL) - новый минерал из Юты \\ Jomac Mine, White Canyon, San Juan Co., Utah, USA ; 37° 51' 42'' North , 110° 19' 9'' West
-- Olds, T.A., Plasil, J., Kampf, A.R., Spano, T., Haynes, P., Carlson, S.M., Burns, P.C., Simonetti, A., Mills, O.P. (2018): Leesite, K(H2O)2[(UO2)4O2(OH)5]•3H2O, a new K-bearing schoepite-family mineral from the Jomac mine, San Juan County, Utah, U.S.A. American Mineralogist, 103, 143-150. Назван в честь американского дилера и коллекционера минералов Брайана Лиса \ Named in honor of the American mineral dealer and collector Bryan K. Lees (born 1957)

Сев. Америка (Кордильеры)

Британская Колумбия, Канада - http://www.mindat.org/loc-14311.html \\ из новых минералов: Cowlesite (TL) \\ Ferrierite-Mg (TL) \\ Hedleyite (TL) \\ Mannardite (TL)\\ Tetraferroplatinum (TL) \\ Zoltaiite (TL)

- Кварц!!--японский двойник - Harrison Lake, Chilliwack, Regional District Fraser Valley, British Columbia  Canada (2008-2011) \ фото

Британская Колумбия в https://www.mindat.org

минералы - 510

новые минералы - 24

фото минералов - 1071

на 2019.07.13

Вашингтон, США \\ Cannon, B. (1975): Minerals of Washington: 53.

Орегон

Калифорния, США \\ http://www.mindat.org/loc-3424.html \\ фото \\ Калифорния_минералы по контуру

--Чемпион майн ("Чампион")., Калифорния, США \ Champion Mine, White Mountain Peak, White Mts, Mono Co., California, USA \\ андалузит!! --7фото ; аугелит!!! - 6 фото; кварц!--xls<10 см ; рутил!! -57 фото

Калифорния в www.mindat.org

минералы - 1068

новые минералы - 150

фото минералов - 10851

на 2019.08.07

Нью-Мексико в www.mindat.org

минералы - 710

новые минералы - 17

фото минералов - 6785

на 2019.08.07

- Дюмортьерит \ Dumortierite (Al,Fe3+)7(SiO4)3(BO3)O3 \ Dehesa Dumortierite deposit, Alpine, Laguna Mountains, San Diego County, California, USA

- Осарсит \ Osarsite \ (Os,Ru)AsS \ * Gold Bluff beach, Gold Bluffs, Orick, Orick Mining District, Humboldt Co., California, USA (Type Locality)

Гавайские о-ва \ Hawaii, Тихий океан; США

Мексика

Мексика в https://www.mindat.org

минералы - 759

новые минералы - 89

фото минералов - 17 203

на 2019.08.07

Север Мексики и прилегающие территории. Местонахождения минералов вдоль 105 зап. долг.(примеры). Составил: А. Евсеев.

Парагуанахуатит \ Paraguanajuatite Bi2Se3. Санта-Катарина, р-к, Гуанахуато, Мексика. Образец: ФМ (№87438. Дар: В.И. Степанов). Фото: © А.А. Евсеев.

Центральная Америка \\ Куба

Гидросиликаты Ni

Южная Америка

Южная Америка_Местонахождения минералов от А до Я (примеры) \\ новое на сайте!

Южная Америка. Минералогические находки (примеры). Подробнее: Евсеев А.А. Атлас мира для минералога. М., 2004. - 284 с. \\ Нажмите на изображение, чтобы его увеличить.

Южная Америка (южная часть). Минералогические находки (примеры). Подробнее: Евсеев А.А. Атлас мира для минералога. М., 2004. - 284 с. \\ Нажмите на изображение, чтобы его увеличить. 2020.11.

 

Анды.Южная Америка \ AndesSouth America. Короткий список минералов от A до Z (до 26 названий). Источник: https://www.mindat.org . Выборка: первый минерал на каждую букву английского алфавита в списке для страны. Сокращение: TL- type locality (новый минерал). Подробнее см  https://www.mindat.org/loc-332873.html \\ 1298  минералов \ valid minerals; 251- новые минералы \ (TL) - type locality of valid minerals; 16739 - фото минералов (2020.07.26) \\ Acanthite \ Adamite (TL) ; Babanekite; Cadmoselite; Danalite ; Edingtonite ; Fairfieldite ; Gadolinite-(Y) ; Hagendorfite ;  Idaite ;  'Jagueite' (FRL) \ Jahnsite-(CaMnMg) ; Kalinite; LacroixiteMackayiteNacrite ; Obradovicite-KCu (TL) ; PachnoliteQuartz ; Ramaccioniite (TL) ;  Safflorite ;Tacharanite ;  Uchucchacuaite (TL) ; Vaesite ; Wairakite ; Xanthoconite; Yavapaiite ; Zalesiite \\ 2020.07.26

Ю. Америка (СЗ)

Венесуэла \\

Гайана \ Guyana (до 1966 г. - Британская Гвиана) \\ Гондурас \\

Колумбия \\ Эквадор

Аргентина - www.mindat.org

Аргентина в www.mindat.org

минералы - 750

новые минералы - 53

фото минералов - 2464

на 2019.07.10

- Лома Бланка м-ние (бораты) \ Loma Blanca borate deposit, Coranzuli, Susques Department, Jujuy Province, Argentina \\ бура; иниоит \ Inyoite ; теруггит* \ Teruggite; улексит

Боливия \\ www.mindat.org : минералы - 499 ; новые минералы - 45 видов; фото минералов 5838 (на 209.05.15)

 

Давсонит, анальцим, содалит, доломит. Индепенденсия, Серро Сапо, Кочабамба \ Cerro Sapo, Cochabamba, Боливия. Образец: Геологический музей им. В.В. Ершова (Горный ин-т, НИТУ МИСиС). Фото: © А.А. Евсеев.

Перу \\

Перу в www.mindat.org

минералы - 378

новые минералы - 29

фото минералов - 5133

на 2019.07.12

Чили

Чили \ Chilehttps://www.mindat.org/loc-638.html  \\ фото минералов -3908 \  минералы \valid minerals -741 ; новые минералы \ type locality of valid minerals -141 (TL) (на 2020.04.29)

Бразилия \\ минералы \ достоверные виды - 601 \ 854; новые виды - 51 \ 77; местонахождения \ localities - 843 \ ... ; фото минер. – 5430 \ 6613; фото мест – 74 \ 890 (на 2009.08.05 \ 2020.09.19) \\ Источник: http://www.mindat.org/loc-366.html \\ http://www.mindat.org/rloc.php?loc=Brazi

-- Franco, R.R. (editor) (1972) Minerals of Brazil. 3 Volumes, Editora Edgard Blucher, Sao Paolo, Brazil: 426 pp. [in English and Portuguese].

-- О` Тулле м-ние (Ni), Минас-Жерайс, Бразилия \ O'Toole depositFortaleza de MinasMinas GeraisBrazil ; 20° 53' 55'' South , 46° 42' 45'' West - первое в Бразилии сульфидно-никелевое м-ние--T. L. Brenner , N. A. Teixeira ,  J. A. L. Oliveira , N. D. Franke ,  J. F. H. Thompson The O'Toole nickel deposit, Morro do Ferro greenstone belt, Brazil. - Economic Geology (1990) 85 (5): 904-920 \\ ирарсит \ Irarsite ; котульскит \ Kotulskite; пентландит \ Pentlandite ; рениит \ Rheniite \\ ЕК \\ https://pubs.geoscienceworld.org

Баия, Бразилия

- Carnaiba mining district, Pindobacu, Bahia, Brazil

Минас-Жерайс шт. \\ минералов - 713, из них твердых видов - 491, из них новых видов - 46 (на 2015.09. 30) \\ источник: http://www.mindat.org

- Menezes, L.A., Martins, J.M. (1984) The Jacupiranga mine, Sao Paulo (Brazil). Mineralogical Record: 15(5):261-270.

Параиба \\

Риу-Гранди-ду-Норти, Бразилия \\ Риу-Гранди-ду-Сул, Бразилия \\ Сан-Паулу

Уругвай

АНТАРКТИДА \\

Антарктида в www.mindat.org

минералы - 345

новые минералы - 18

фото минералов - 71

на 2019.07.19

Новые минералы из Антарктиды (18 видов на 2019.07.19): Antarcticite (TL) \\ Boralsilite (TL) \\ Chopinite (TL) \\ Dissakisite-(Ce) (TL) \\ Earlandite (TL) \\ Ernstburkeite (TL) \\ Ferri-kaersutite (TL) \\ Gottardiite (TL) \\ Хмаралит Khmaralite (TL) \\ Kushiroite (TL) \\ Magnesiohogbomite-2N4S (TL) \\ Mutinaite (TL) \\ Spheniscidite (TL) \\ Stornesite-(Y) (TL) \\ Tassieite (TL) \\ Terranovaite (TL) \\ Wassonite (TL) \\ Weddellite (TL)

Из новых фото минералов Антарктиды на https://www.mindat.org (2020.10.25) : магнезиохёгбомит-2N4S \ Magnesiohogbomite-2N4S - ФОТО - Sor Rondane Mountains, Queen Maud Land, Eastern Antarctica, Antarctica

Эребус вулк., о. Росс, Земля Виктории, Вост. Антарктида \ Mount ErebusRoss IslandRoss ArchipelagoVictoria LandEastern AntarcticaAntarctica; 77° 31' 47'' South , 167° 9' 12'' East \\ анортоклаз!! \ Anorthoclase - 22 фото ; кенияит!\ Kenyaite -фото

Rosenberg Phillip E., 1988. Aluminum fluoride hydrates, volcanogenic salts from Mount Erebus, Antarctica. - American Mineralogist (1988) 73 (7-8): 855–860. \\ текст

Вокруг Антарктиды (прилегающие территории)_минералогические находки

Океаны

Атлантический океан

Тихий океан

Новая Гвинея о., Океания, Тихий океан; Индонезия \ Папуа - Новая Гвинея \\ второй по величине остров Земли (после Гренландии) \\ Новая Каледония -- геология и пол. ископаемые

Гавайские о-ва \ Hawaii, Тихий океан; США

- палагонит в туфах вулкана Оаху \\ справ. "Минералы" (М-4-2, 110)

Таити о., Франц. Полинезия

Фиджи, Тихий океан

Южное полушарие

Весь мир

"Вокруг света"_ 6 фотографий минералов со страниц http://geo.web.ru/druza/in_NMK.htm

"Вокруг света"_ 6 фотографий минералов со страницы 33_fo_325.htm

 

Страны мира и регионы на страницах базы данных о минералах www.mindat.org (примеры)

Страна, регион, м-ние минералы новые виды фото минералов дата
Камчатский край, Россия
555
158
599
20.10.07
- Толбачик, Камчатка
278
129
532
20.10.07
Италия
1753
381
52977
20.10.07
Япония
1353
151
2034
20.10.07
Канада
1679
256
22768
20.10.07
Калифорния, США
1074
152
11570
20.10.07
Австралия
1480
179
14166
20.10.07
Бразилия
854
77
16066
20.10.07
Антарктида
370
18
78
20.10.07

***

***

--Рудные месторождения России и Мира. Справочник и учебное пособие / Л.Т. Шевырёв. А.Д. Савко. – Труды НИИ геологии ВГУ. – Выпуск 70.– Воронеж: Воронежский государственный университет, 2012. – 284 с., библиография 682 названия. \\ читать - http://www.geokniga.org/bookfiles/geokniga-rudnye-mestorozhdeniya-rossii-i-mira-spravochnik-i-uchebnoe-posobie.pdf \\ Шевырёв Л.Т., Савко А.Д., 2012 - читать .

Фото дня или "За месяц вокруг света" - - 2020.10 - 2020.09 - 2020.08 - 2020. 07 - 2020. 06 - 2020. 05 - 2020. 04 - 2020. 03 - 2020. 02 - 2020. 01 \\ 2019.12 - 2019.11 - 2019.10 - 2019.09 - 2019.08 - 2019.07 - 2019.06 - 2019.05 - 2019.04 - 2019.03 - 2019.02 - 2019.01 \\ 2018.12 - 2018.11 - 2018.10 - 2018.09 - 2018.08 - 2018.07 - 2018.06 - 2018.05 - 2018.04 - 2018.03 - 2018.02 - 2018.01 \\ 2017.12 - 2017.11 - 2017.10 - 2017.09 - 2017.08 -  2017.07 - 2017.06 - 2017.05 - 2017.04 - 2017.03  - 2017.02  - 2017.01  \\ 2016.12- 2016.11- 2016.10 - 2016.09 - 2016.08 - 2016.07 - 2016.06 - 2016.05 -2016.04 -2016.03 - 2016.02 - 2016.01 - 2015.12 - 2015.11 - 2015.10 - 2015.09 - 2015.08 - 2015.07 - 2015.06 - 2015. 05 - 2015. 04 - 2015. 03 - 2015. 02 - 2015. 01 - 2014.11-12 -  

Всемирная минералогия-32 - по одному минералу от региона

А.А. Евсеев. Минералогические находки вокруг света вдоль 40-ой параллели. - Минералогический альманах, т.13, 2008, с. 76-85.
\\ Краткий вариант статьи \\ Полный текст статьи \\ Фотогалерея \\

--Кристаллы пяти континентов_экспозиция в Минералогическом музее им. А.Е. Ферсмана РАН \\ текст

--Минералы- спутники на расстоянии (минералы-телеспутники)

--Журнал "Вокруг света" - http://www.vokrugsveta.ru/

--Институт географии РАН _Информационный портал

--находки минералов по всему миру - https://www.mineralienatlas.de  

Путешествия за камнем

--Ферсман А.Е. "Путешествия за камнем" \\ читать

--В.А. Обручев. Мои путешествия по Сибири \\ читать

МИНЕРАЛЫ \

5 замечательных находок \ Европа - Азия - Африка - Австралия - Сев. Америка - Южн. Америка (выборка: по одному образцу из северной, южной, западной, восточной и центральной части каждого регион). Случайная выборка

Вторые находки минерала в мире, ставшие лучшими

"Сборные" минералов по странам и регионам (10-15 избранных находок) \\ 1-е -в 2007 г.

По 2 минерала от континента за 2 минуты (экспресс-опрос)

Ареалы находок минералов (основные находки ряда минералов, вынесенные на карту мира)

Кристаллы пяти континентов_выставка в Минералогическом музее им. А.Е. Ферсмана РАН

--Евсеев А.А. Географическая привязка первоначальных местонахождений минералов. \\ Новые данные о минералах. М.: ЭКОСТ, 2003. Вып. 38, с. 113-124.

--А.А. Евсеев. Минералогические находки вокруг света вдоль 40-ой параллели с. ш.

Океаны

Острова (от Гренландии до Мадагаскара) \ минералогические находки

Луна \\ минералогия - http://luna-mineralogiya.ru/index.html

АВТОРЫ \ \ А – Л | М - Я | A - Z Анастасенко| | Г.П. Барсанов || И.В. Бельков || В.И. Вернадский || А.В. Волошин || В.И. Воробьев | Гиймен К. \ Guillemin C.| | А.А. Годовиков || Б.З. Кантор | К.И. Клопотов || Ю.С. Кобяшев || П.А. Кочубей | Крыжановский В.И. || А.Н. Лабунцов | М.Н. Малеев || В.А. Мальцев || Л.А.Паутов || И.В. Пеков || В.А. Пелепенко || В.В. Пономаренко | | В.А. Слётов | Э.М. Спиридонов | | В.И. Степанов | А.Е. Ферсман | А.П. Хомяков || Б.В. Чесноков || Н.В. Чуканов || Н.П. Юшкин и другие

Из публикаций: А - Б - В - Г - Д - ЕЁ - Ж - З - И - К - Л - М - Н - О - П - Р - С - Т - У - Ф - Х - Ц - Ч - ШЩ - ЭЮ - Я - AZ \\ A - B - C - D - E - F - G - H - I - J - K - L - M - N - O - P - Q - R - S - T - U - V - W - X - Y - Z

 

МИР КАМНЯ В ЛИЦАХ

Исследователи самоцветов Сибири - http://lavrovit.ru/?page_id=271

Фотографы минералов и не только

Биографии минералогов и коллекционеров - см. The Mineralogical Record Biographical Archive - http://www.minrec.org/labelarchive.asp

Чилдрен, Джон Джордж \ John George Children (1777.05.18 – 1852.01.01), английский химик, минералог и зоолог; хранитель минералогической коллекции Британского музея естественной истории. В его честь назван минерал чилдренит.

НОЯБРЬ \ в тот день

 

В ТОТ ГОД...

1745 г.

Руинный мрамор из района Флоренции, Италия. "Плитка четвероугольная, из флоренского мармора высечена, на которой каменные горы, обрушившиеся и облака в их натуральном виде представлены..." Из описания в каталоге минерального кабинета 1745 г. Образец: Мин. музей им. А.Е. Ферсмана РАН (ПДК 662). Фото: © А.А. Евсеев.

Систематическая коллекция _Минер. муз. им. А.Е. Ферсмана РАН. Из поступлений до 1906 г. Выборка: образцы минералов из №№1-501-1001...20001. \\ Прим.: 2, 4, 5 и другие числа перед названием минерала - номера листов на карте мира: 1 – 2 – 3 и т.д. 

20002010 гг

Булах А. Г., Кривовичев В. Г., Кривовичев С. В. Открытие новых минералов в 2000—2010 гг.: статистика, сущность, лидеры. - Записки РМО, 2012., 141, в. 2, 32-41
АннотацияВ 2000-2010 гг. открыто 726 новых минералов, из них в России - 172, в Италии - 61, в США - 60. По составу преобладают силикаты - 283, фосфаты - 80, арсенаты - 65, сульфиды - 61. Лидерами по первому авторству в описании новых минералов являются И. В. Пеков, Н. В. Чуканов, А. П. Хомяков, А. Р. Кампф, А. К. Робертс \\ читать- https://www.minsoc.ru/FilesBase/af141203f3719.pdf

Страны первых находок новых минералов в 2000—2010 гг. \ Countries with the first discoveries of new minerals in 2000—2010. Источник: Булах А. Г., Кривовичев В. Г., Кривовичев С. В., 2012

2019

2020

Shchipalkina, N. V., Pekov, I. V., Koshlyakova, N. N., Britvin, S. N., Zubkova, N. V., Varlamov, D. A., & Sidorov, E. G. (2020). Unusual silicate mineralization in fumarolic sublimates of the Tolbachik volcano, Kamchatka, Russia–Part 2: Tectosilicates. European Journal of Mineralogy, 32(1), 121-136. \\ Щипалкина Н.П., Реков И.В., Кошлякова Н.Н. и др., 2020 \ Толбачик, вулк., Камчатка

Тандербейит \ Thunderbayite (TL) TlAg3Au3Sb7S6 - новый минерал из м-ния Эмло, Онтарио, Канада \  Hemlo gold deposit, Bomby Township, Thunder Bay District, Ontario, Canada \\ Bindi, L. and Roberts, A. C.: Thunderbayite, IMA 2020-042, in: CNMNC Newsletter 57, Eur. J. Mineral., 32, https://doi.org/10.5194/ejm-32-495-2020, 2020.

В мире минералов. Минералогический Альманах, том 25, выпуск 1, 2020

МИНЕРАЛОГИЧЕСКИЙ УНИВЕРСИТЕТ

КЛУБ ДРУЗЕЙ МИНЕРАЛОГИИ

В зеркале камня

П.А. Вяземский
Кузнецкий мост давно без кузниц —
Парижа пестрый уголок,
Где он вербует русских узниц,
Где он сбирает с них оброк.

А тут, посмотришь, — Русь родная
С своею древней простотой,
Не стертая, не початая,
Как самородок золотой,

Русь в кичке, в красной душегрейке,
Она, как будто за сто лет,
Живет себе на Маросейке,
И до Европы дела нет.
Из «очерков Москвы», 17 мая 1858 г. \\ https://rustih.ru/petr-vyazemskij-iz-ocherkov-moskvy/

А.С. Грибоедов

…Поэт Фехт-Али-хан, лет около 60, кротость в обращении, приятность лица, тихий голос, любит рассказывать. Шах за одну оду положил ему горсть бриллиантов в рот.

Путевые заметки (1819)

И. Ефремов

 Стоявшие у панели проделывали плавные движения, прикасаясь к косым струнам, натянутым у ее левого края. Стена полированного изумруда или стекла становилась прозрачной. В такт их движениям в кристалле плыли, сменяя друг друга, четкие изображения. Они исчезали и возникали быстро, так что даже тренированным наблюдателям – Юнию Анту и Дар Ветру – было трудно полностью понять их смысл

Туманность Андромеды \\ https://royallib.com/read/efremov_ivan/tumannost_andromedi_chas_bika.html#0

   — Вы верно подметили главное противоречие, — подтвердила Фай Родис, — ничто не дается даром, и преимущества идеографического письма становятся ничтожными с развитием культуры и науки. Зато стократно усиливается его недостаток — смысловая окаменелость, способствующая отставанию мышления, замедлению его развития. Сложное красивое письмо, выражающее тысячи оттенков мысли там, где их нужны миллионы, становится архаизмом, подобием пиктограмм людей каменного века, откуда оно, несомненно, и произошло. \\ https://efremov-fiction.ru/roman/3/page/10

***

 Давно окончилась "звездочка" памятной машины — фильма об экспедиции на Торманс, а ученики сидели, окаменев от впечатлений. Учитель не тревожился за крепкую психику девушек и юношей Эры Встретившихся Рук и дал им прочувствовать увиденное. Первыми очнулись Кими и Пуна, всегда самые быстрые. \\ https://efremov-fiction.ru/roman/3/page/63

Час быка

Он лежал на диване навзничь, с полуоткрытыми глазами. Какая-то страшная, чудовищная масса повисла над его телом. Она казалась ужасно, бесконечно далекой и в то же время почти касалась лица Павла Егоровича; она была гораздо мягче, чем пух, но в то же время ее грани напоминали на ощупь необделанный гранит, – и в этой непонятной двойственности было что-то тоскливое, тревожное и мучительное

Дух века

У. Шекспир

Послушайте, скажите откровенно,
Согласны ль вы немедленно прервать
Свои военные приготовленья
И возвратиться в свой законный круг,
Как мирная звезда в свою орбиту,
А не пугать, как грозный метеор,
Недобрыми предвестьями потомство?

ххх

Да, угадать нетрудно. Завтра - бой,
Который многим будет пробным камнем.

Король Генри IV

КИНО_В зеркале камня

***

И. Анненский \\\ И. Бродский \\ И.А. Бунин \\ Ю.И. Визбор \\ М.А. Врубель \\ В.С. Высоцкий \\ П.А. Вяземский \\ И.-В. Гёте \\ И.А. Гончаров \\ В. Маяковский \\ А.C. Пушкин \\ И. Северянин \\ Л. Толстой \\ А.П.Чехов \\ Агат \\ Алмаз \\ Апатит \\ Бирюза \\ Жемчуг \\ Опал \\ Топаз

СТРАНЫ от А до Я

находки минералов по листам карты мира: 1234567 891011121314151617181920212223242526272829303132 - 33

Минераландия

НЕ ТОЛЬКО МИНЕРАЛЫ: А - Б - В - Г - Д - Е - Ж - З - И - К - Л - М - Н - О - П - Р - С - Т - У - Ф - Х - Ц - Ч - ШЩ - Э - Ю - Я

местонахождения минералов - | - mineral localities : А Б В ГДЕ Ж З И Й К Л М Н О ПР С Т У Ф Х Ц ЧШ Щ Э Ю Я || A B C D E F G H I J K L M N O P R S T U V W X Y Z
Сев. Америка (С)

Гренландия

Атлантика - Скандинавия - Кольский п-в

Урал
Ср. Сибирь
Якутия
СВ России

Сев. Америка (З - Сев. Америка (Кордильеры)

Сев. Америка (В)

Британ. о-ва, Пиренейский п-в - Зап. Европа - Вост. Европа

Казахстан, Ср. Азия

Юг Сибири
Забайкалье, Вост . Сибирь
Камчатка - Дальний Восток (Россия, Япония
Мексика
Кавказ, ЮЗ Азия
Афганистан, Пакистан
Индия
Монголия. Китай
ЮВ Азия - Тихий океан
Ю. Америка (СЗ) - Кордильеры
Бразилия

Африка - Сев. и Зап.Экв. и ЮжнВост.

Антарктида
Австралия

Тихий океан - Весь мир

Заметки на geo.web.ru/druza

От А до Я

№104 №112
2014 №114
№126 №131
№146
№163 №166
2020 №193  

Кристаллы пяти континентов

Заметки - А - Б - В - Г - Д - Е - Ж - З - И - Й - К - Л - М- Н -О - П - Р - С - Т - У -Ф - Х - Ц - Ч - Ш Щ - Э - Ю - Я - za - zaa

обновление: 2020. 11. 21

© Александр Евсеев, 2003 - 2020. © Фото: принадлежит авторам, 2020